Related Topics:
Pollutant Lookup
Use this table to lookup a "Common Pollutant Name" or "CAS Number" to be entered on the Search Form.
Click on the "Back" button to return to the Multisystem Search Form.
| CAS Number | Common Pollutant Name |
|---|---|
| 57501 | .alpha.-D-Glucopyranoside, .beta.-D-fructofuranosyl |
| 8027472 | .alpha.-D-Glucopyranoside, .beta.-D-fructofuranosyl |
| 8030204 | .alpha.-D-Glucopyranoside, .beta.-D-fructofuranosyl |
| 12040732 | .alpha.-D-Glucopyranoside, .beta.-D-fructofuranosyl |
| 29253789 | .alpha.-D-Glucopyranoside, .beta.-D-fructofuranosyl |
| 29764065 | .alpha.-D-Glucopyranoside, .beta.-D-fructofuranosyl |
| 30027726 | .alpha.-D-Glucopyranoside, .beta.-D-fructofuranosyl |
| 47167522 | .alpha.-D-Glucopyranoside, .beta.-D-fructofuranosyl |
| 47185091 | .alpha.-D-Glucopyranoside, .beta.-D-fructofuranosyl |
| 47257910 | .alpha.-D-Glucopyranoside, .beta.-D-fructofuranosyl |
| 50857686 | .alpha.-D-Glucopyranoside, .beta.-D-fructofuranosyl |
| 51909694 | .alpha.-D-Glucopyranoside, .beta.-D-fructofuranosyl |
| 64533660 | .alpha.-D-Glucopyranoside, .beta.-D-fructofuranosyl |
| 65545995 | .alpha.-D-Glucopyranoside, .beta.-D-fructofuranosyl |
| 75398844 | .alpha.-D-Glucopyranoside, .beta.-D-fructofuranosyl |
| 76056387 | .alpha.-D-Glucopyranoside, .beta.-D-fructofuranosyl |
| 78654770 | .alpha.-D-Glucopyranoside, .beta.-D-fructofuranosyl |
| 80165033 | .alpha.-D-Glucopyranoside, .beta.-D-fructofuranosyl |
| 85456515 | .alpha.-D-Glucopyranoside, .beta.-D-fructofuranosyl |
| 86101306 | .alpha.-D-Glucopyranoside, .beta.-D-fructofuranosyl |
| 87430668 | .alpha.-D-Glucopyranoside, .beta.-D-fructofuranosyl |
| 92004847 | .alpha.-D-Glucopyranoside, .beta.-D-fructofuranosyl |
| 100405081 | .alpha.-D-Glucopyranoside, .beta.-D-fructofuranosyl |
| 104242106 | .alpha.-D-Glucopyranoside, .beta.-D-fructofuranosyl |
| 131932122 | .alpha.-D-Glucopyranoside, .beta.-D-fructofuranosyl |
| 146054355 | .alpha.-D-Glucopyranoside, .beta.-D-fructofuranosyl |
| 146187044 | .alpha.-D-Glucopyranoside, .beta.-D-fructofuranosyl |
| 151756024 | .alpha.-D-Glucopyranoside, .beta.-D-fructofuranosyl |
| 220376227 | .alpha.-D-Glucopyranoside, .beta.-D-fructofuranosyl |
| 635681902 | .alpha.-D-Glucopyranoside, .beta.-D-fructofuranosyl |
| 786702634 | .alpha.-D-Glucopyranoside, .beta.-D-fructofuranosyl |
| 880257625 | .alpha.-D-Glucopyranoside, .beta.-D-fructofuranosyl |
| 1159795784 | .alpha.-D-Glucopyranoside, .beta.-D-fructofuranosyl |
| 1206156822 | .alpha.-D-Glucopyranoside, .beta.-D-fructofuranosyl |
| 35621 | .beta.-D-Galactopyranoside, (2.alpha.,3.beta.,5.alpha.,15.beta.,25R)-2,15-dihydroxyspirostan-3-yl O-.beta.-D-glucopyranosyl-(1.fwdarw.3)-O-.beta.-D-galactopyranosyl-(1.fwdarw.2)-O-[.beta.-D-xylopyranosyl-(1.fwdarw.3)]-O-.beta.-D-glucopyranosyl-(1.fwdarw.4)- |
| 11024241 | .beta.-D-Galactopyranoside, (2.alpha.,3.beta.,5.alpha.,15.beta.,25R)-2,15-dihydroxyspirostan-3-yl O-.beta.-D-glucopyranosyl-(1.fwdarw.3)-O-.beta.-D-galactopyranosyl-(1.fwdarw.2)-O-[.beta.-D-xylopyranosyl-(1.fwdarw.3)]-O-.beta.-D-glucopyranosyl-(1.fwdarw.4)- |
| 52781767 | .beta.-D-Galactopyranoside, (2.alpha.,3.beta.,5.alpha.,15.beta.,25R)-2,15-dihydroxyspirostan-3-yl O-.beta.-D-glucopyranosyl-(1.fwdarw.3)-O-.beta.-D-galactopyranosyl-(1.fwdarw.2)-O-[.beta.-D-xylopyranosyl-(1.fwdarw.3)]-O-.beta.-D-glucopyranosyl-(1.fwdarw.4)- |
| 14901087 | .beta.-D-Glucopyranoside, [(Z)-methyl-ONN-azoxy] methyl |
| 119391 | 1(2H)-Phthalazinone |
| 5418268 | 1(2H)-Phthalazinone |
| 86544 | 1(2H)-Phthalazinone, hydrazone |
| 77098 | 1(3H)-Isobenzofuranone, 3,3-bis(4-hydroxyphenyl)- |
| 467298 | 1(3H)-Isobenzofuranone, 3,3-bis(4-hydroxyphenyl)- |
| 5768876 | 1(3H)-Isobenzofuranone, 3,3-bis(4-hydroxyphenyl)- |
| 57214207 | 1(3H)-Isobenzofuranone, 3,3-bis(4-hydroxyphenyl)- |
| 390417240 | 1(3H)-Isobenzofuranone, 3,3-bis(4-hydroxyphenyl)- |
| 546094137 | 1(3H)-Isobenzofuranone, 3,3-bis(4-hydroxyphenyl)- |
| 17369594 | 1(3H)-Isobenzofuranone, 3-propylidene- |
| 92524 | 1,1'-Biphenyl |
| 56481937 | 1,1'-Biphenyl |
| 72931465 | 1,1'-Biphenyl |
| 1135443729 | 1,1'-Biphenyl |
| 25640782 | 1,1'-Biphenyl, (1-methylethyl)- |
| 26545631 | 1,1'-Biphenyl, (1-methylethyl)- |
| 68306774 | 1,1'-Biphenyl, (1-methylethyl)- |
| 2051243 | 1,1'-Biphenyl, 2,2',3,3',4,4',5,5',6,6'-decachloro- |
| 65510443 | 1,1'-Biphenyl, 2,3',4,4',5'-pentachloro- |
| 52663726 | 1,1'-Biphenyl, 2,3',4,4',5,5'-hexachloro- |
| 31508006 | 1,1'-Biphenyl, 2,3',4,4',5-pentachloro- |
| 69782907 | 1,1'-Biphenyl, 2,3,3',4,4',5'-hexachloro- |
| 39635319 | 1,1'-Biphenyl, 2,3,3',4,4',5,5'-heptachloro- |
| 38380084 | 1,1'-Biphenyl, 2,3,3',4,4',5-hexachloro- |
| 32598144 | 1,1'-Biphenyl, 2,3,3'4,4'-pentachloro- |
| 74472370 | 1,1'-Biphenyl, 2,3,4,4',5-pentachloro- |
| 2052075 | 1,1'-Biphenyl, 2-bromo- |
| 2051607 | 1,1'-Biphenyl, 2-chloro- |
| 321608 | 1,1'-Biphenyl, 2-fluoro- |
| 86000 | 1,1'-Biphenyl, 2-nitro- |
| 32774166 | 1,1'-Biphenyl, 3,3',4,4',5,5'-hexachloro- |
| 31508006 | 1,1'-Biphenyl, 3,3',4,4',5-pentachloro- |
| 57465288 | 1,1'-Biphenyl, 3,3',4,4',5-pentachloro- |
| 32598133 | 1,1'-Biphenyl, 3,3',4,4'-tetrachloro- |
| 70362504 | 1,1'-Biphenyl, 3,4,4',5-tetrachloro- |
| 2113577 | 1,1'-Biphenyl, 3-bromo- |
| 10386842 | 1,1'-Biphenyl, 4,4'-dibromo-2,2',3,3',5,5',6,6'-octafluoro- |
| 91930 | 1,1'-Biphenyl, 4,4'-diisocyanato-3,3'-dimethoxy- |
| 3012655 | 1,1'-Biphenyl, 4,4'-diisocyanato-3,3'-dimethoxy- |
| 92660 | 1,1'-Biphenyl, 4-bromo- |
| 92933 | 1,1'-Biphenyl, 4-nitro- |
| 59536651 | 1,1'-Biphenyl, bromo derivs. |
| 67774327 | 1,1'-Biphenyl, bromo derivs. |
| 1336363 | 1,1'-Biphenyl, chloro derivs. |
| 12767792 | 1,1'-Biphenyl, chloro derivs. |
| 16606023 | 1,1'-Biphenyl, chloro derivs. |
| 36355018 | 1,1'-Biphenyl, hexabromo- |
| 26601649 | 1,1'-Biphenyl, hexachloro- |
| 101848 | 1,1'-Biphenyl, mixt. with 1,1'-oxybis[benzene] |
| 8004135 | 1,1'-Biphenyl, mixt. with 1,1'-oxybis[benzene] |
| 26914330 | 1,1'-Biphenyl, tetrachloro- |
| 1486017 | 1,1'-Biphenyl-2,2',3,3',4,4',5,5',6,6'-d10 |
| 92944 | 1,1':4',1''-Terphenyl |
| 75831651 | 1,1':4',1''-Terphenyl |
| 94363130 | 1,1':4',1''-Terphenyl |
| 302170 | 1,1-Ethanediol, 2,2,2-trichloro- |
| 109128190 | 1,1-Ethanediol, 2,2,2-trichloro- |
| 541220 | 1,10-Decanediaminium, N1,N1,N1,N10,N10,N10-hexamethyl-, bromide (1:2) |
| 60869650 | 1,10-Decanediaminium, N1,N1,N1,N10,N10,N10-hexamethyl-, bromide (1:2) |
| 66717 | 1,10-Phenanthroline |
| 299752 | 1,2,3,4-Butanetetrol, 1,4-dimethanesulfonate, [S-(R*,R*)]- |
| 87661 | 1,2,3-Benzenetriol |
| 77929 | 1,2,3-Propanetricarboxylic acid, 2-hydroxy- |
| 12262736 | 1,2,3-Propanetricarboxylic acid, 2-hydroxy- |
| 43136352 | 1,2,3-Propanetricarboxylic acid, 2-hydroxy- |
| 136108935 | 1,2,3-Propanetricarboxylic acid, 2-hydroxy- |
| 245654346 | 1,2,3-Propanetricarboxylic acid, 2-hydroxy- |
| 623158963 | 1,2,3-Propanetricarboxylic acid, 2-hydroxy- |
| 856568155 | 1,2,3-Propanetricarboxylic acid, 2-hydroxy- |
| 878903721 | 1,2,3-Propanetricarboxylic acid, 2-hydroxy- |
| 890704548 | 1,2,3-Propanetricarboxylic acid, 2-hydroxy- |
| 896506460 | 1,2,3-Propanetricarboxylic acid, 2-hydroxy- |
| 906507377 | 1,2,3-Propanetricarboxylic acid, 2-hydroxy- |
| 1192555955 | 1,2,3-Propanetricarboxylic acid, 2-hydroxy- |
| 56815 | 1,2,3-Propanetriol |
| 8013250 | 1,2,3-Propanetriol |
| 29796427 | 1,2,3-Propanetriol |
| 30049526 | 1,2,3-Propanetriol |
| 37228549 | 1,2,3-Propanetriol |
| 75398786 | 1,2,3-Propanetriol |
| 78630167 | 1,2,3-Propanetriol |
| 1400594628 | 1,2,3-Propanetriol |
| 1422250438 | 1,2,3-Propanetriol |
| 55630 | 1,2,3-Propanetriol, 1,2,3-trinitrate |
| 8013238 | 1,2,3-Propanetriol, 1,2,3-trinitrate |
| 9010020 | 1,2,3-Propanetriol, 1,2,3-trinitrate |
| 80066484 | 1,2,3-Propanetriol, 1,2,3-trinitrate |
| 100292135 | 1,2,3-Propanetriol, 1,2,3-trinitrate |
| 105469316 | 1,2,3-Propanetriol, 1,2,3-trinitrate |
| 1335382 | 1,2,3-Propanetriol, monoacetate |
| 26446355 | 1,2,3-Propanetriol, monoacetate |
| 89054 | 1,2,4,5-Benzenetetracarboxylic acid |
| 3319311 | 1,2,4-Benzenetricarboxylic acid, 1,2,4-tris(2-ethylhexyl) ester |
| 59941467 | 1,2,4-Benzenetricarboxylic acid, 1,2,4-tris(2-ethylhexyl) ester |
| 75882007 | 1,2,4-Benzenetricarboxylic acid, 1,2,4-tris(2-ethylhexyl) ester |
| 82643263 | 1,2,4-Benzenetricarboxylic acid, 1,2,4-tris(2-ethylhexyl) ester |
| 113816970 | 1,2,4-Benzenetricarboxylic acid, 1,2,4-tris(2-ethylhexyl) ester |
| 131734059 | 1,2,4-Benzenetricarboxylic acid, 1,2,4-tris(2-ethylhexyl) ester |
| 144470655 | 1,2,4-Benzenetricarboxylic acid, 1,2,4-tris(2-ethylhexyl) ester |
| 1199184 | 1,2,4-Benzenetriol, 5-(2-aminoethyl)- |
| 28094157 | 1,2,4-Benzenetriol, 5-(2-aminoethyl)-, hydrochloride |
| 7221934 | 1,2,4-Methenocyclopenta[cd]pentalene-5-carboxaldehyde, 2,2a,3,3,4,7-hexachlorodecahydro-, (1.alpha.,2.beta.,2a.beta.,4.beta.,4a.beta.,5.beta.,6a.beta.,6b.beta.,7R*)- |
| 7421934 | 1,2,4-Methenocyclopenta[cd]pentalene-5-carboxaldehyde, 2,2a,3,3,4,7-hexachlorodecahydro-, (1.alpha.,2.beta.,2a.beta.,4.beta.,4a.beta.,5.beta.,6a.beta.,6b.beta.,7R*)- |
| 7621934 | 1,2,4-Methenocyclopenta[cd]pentalene-5-carboxaldehyde, 2,2a,3,3,4,7-hexachlorodecahydro-, (1.alpha.,2.beta.,2a.beta.,4.beta.,4a.beta.,5.beta.,6a.beta.,6b.beta.,7R*)- |
| 20354261 | 1,2,4-Oxadiazolidine-3,5-dione, 2-(3,4-dichlorophenyl)-4-methyl- |
| 2593159 | 1,2,4-Thiadiazole, 5-ethoxy-3-(trichloromethyl)- |
| 123312890 | 1,2,4-Triazin-3(2H)-one, 4,5-dihydro-6-methyl-4-[(3-pyridinylmethylene)amino]-, (E)- |
| 3131600 | 1,2,4-Triazin-3(2H)-one, 5-amino-2-.beta.-D-ribofuranosyl- |
| 21087649 | 1,2,4-Triazin-5(4H)-one, 4-amino-6-(1,1-dimethylethyl)-3-(methylthio)- |
| 41814782 | 1,2,4-Triazolo[3,4-b]benzothiazole, 5-methyl- |
| 1135442759 | 1,2,4-Triazolo[3,4-b]benzothiazole, 5-methyl- |
| 95545 | 1,2-Benzenediamine |
| 95830 | 1,2-Benzenediamine, 4-chloro- |
| 496720 | 1,2-Benzenediamine, 4-methyl- |
| 99569 | 1,2-Benzenediamine, 4-nitro- |
| 615281 | 1,2-Benzenediamine, hydrochloride (1:2) |
| 88960 | 1,2-Benzenedicarboxamide |
| 88993 | 1,2-Benzenedicarboxylic acid |
| 4401643 | 1,2-Benzenedicarboxylic acid |
| 131157 | 1,2-Benzenedicarboxylic acid, 1,2-bis(1-methylheptyl) ester |
| 117839 | 1,2-Benzenedicarboxylic acid, 1,2-bis(2-butoxyethyl) ester |
| 117817 | 1,2-Benzenedicarboxylic acid, 1,2-bis(2-ethylhexyl) ester |
| 8033532 | 1,2-Benzenedicarboxylic acid, 1,2-bis(2-ethylhexyl) ester |
| 40120692 | 1,2-Benzenedicarboxylic acid, 1,2-bis(2-ethylhexyl) ester |
| 50885875 | 1,2-Benzenedicarboxylic acid, 1,2-bis(2-ethylhexyl) ester |
| 109630526 | 1,2-Benzenedicarboxylic acid, 1,2-bis(2-ethylhexyl) ester |
| 126639290 | 1,2-Benzenedicarboxylic acid, 1,2-bis(2-ethylhexyl) ester |
| 137718377 | 1,2-Benzenedicarboxylic acid, 1,2-bis(2-ethylhexyl) ester |
| 205180592 | 1,2-Benzenedicarboxylic acid, 1,2-bis(2-ethylhexyl) ester |
| 275818898 | 1,2-Benzenedicarboxylic acid, 1,2-bis(2-ethylhexyl) ester |
| 607374505 | 1,2-Benzenedicarboxylic acid, 1,2-bis(2-ethylhexyl) ester |
| 117828 | 1,2-Benzenedicarboxylic acid, 1,2-bis(2-methoxyethyl) ester |
| 34006763 | 1,2-Benzenedicarboxylic acid, 1,2-bis(2-methoxyethyl) ester |
| 84695 | 1,2-Benzenedicarboxylic acid, 1,2-bis(2-methylpropyl) ester |
| 131179 | 1,2-Benzenedicarboxylic acid, 1,2-di-2-propen-1-yl ester |
| 124743277 | 1,2-Benzenedicarboxylic acid, 1,2-di-2-propen-1-yl ester |
| 143318734 | 1,2-Benzenedicarboxylic acid, 1,2-di-2-propen-1-yl ester |
| 84742 | 1,2-Benzenedicarboxylic acid, 1,2-dibutyl ester |
| 84617 | 1,2-Benzenedicarboxylic acid, 1,2-dicyclohexyl ester |
| 55819028 | 1,2-Benzenedicarboxylic acid, 1,2-dicyclohexyl ester |
| 169741166 | 1,2-Benzenedicarboxylic acid, 1,2-dicyclohexyl ester |
| 84662 | 1,2-Benzenedicarboxylic acid, 1,2-diethyl ester |
| 1431865870 | 1,2-Benzenedicarboxylic acid, 1,2-diethyl ester |
| 84753 | 1,2-Benzenedicarboxylic acid, 1,2-dihexyl ester |
| 1341395 | 1,2-Benzenedicarboxylic acid, 1,2-diisodecyl ester |
| 26761400 | 1,2-Benzenedicarboxylic acid, 1,2-diisodecyl ester |
| 105009981 | 1,2-Benzenedicarboxylic acid, 1,2-diisodecyl ester |
| 148384025 | 1,2-Benzenedicarboxylic acid, 1,2-diisodecyl ester |
| 28553120 | 1,2-Benzenedicarboxylic acid, 1,2-diisononyl ester |
| 41375911 | 1,2-Benzenedicarboxylic acid, 1,2-diisononyl ester |
| 58033902 | 1,2-Benzenedicarboxylic acid, 1,2-diisononyl ester |
| 105009970 | 1,2-Benzenedicarboxylic acid, 1,2-diisononyl ester |
| 1330912 | 1,2-Benzenedicarboxylic acid, 1,2-diisooctyl ester |
| 25103508 | 1,2-Benzenedicarboxylic acid, 1,2-diisooctyl ester |
| 27554263 | 1,2-Benzenedicarboxylic acid, 1,2-diisooctyl ester |
| 41375900 | 1,2-Benzenedicarboxylic acid, 1,2-diisooctyl ester |
| 131113 | 1,2-Benzenedicarboxylic acid, 1,2-dimethyl ester |
| 64441709 | 1,2-Benzenedicarboxylic acid, 1,2-dimethyl ester |
| 1352054353 | 1,2-Benzenedicarboxylic acid, 1,2-dimethyl ester |
| 84764 | 1,2-Benzenedicarboxylic acid, 1,2-dinonyl ester |
| 117640 | 1,2-Benzenedicarboxylic acid, 1,2-dioctyl ester |
| 117817 | 1,2-Benzenedicarboxylic acid, 1,2-dioctyl ester |
| 117840 | 1,2-Benzenedicarboxylic acid, 1,2-dioctyl ester |
| 8031296 | 1,2-Benzenedicarboxylic acid, 1,2-dioctyl ester |
| 131180 | 1,2-Benzenedicarboxylic acid, 1,2-dipentyl ester |
| 131168 | 1,2-Benzenedicarboxylic acid, 1,2-dipropyl ester |
| 119062 | 1,2-Benzenedicarboxylic acid, 1,2-ditridecyl ester |
| 3648202 | 1,2-Benzenedicarboxylic acid, 1,2-diundecyl ester |
| 154766253 | 1,2-Benzenedicarboxylic acid, 1,2-diundecyl ester |
| 85701 | 1,2-Benzenedicarboxylic acid, 1-(2-butoxy-2-oxoethyl) 2-butyl ester |
| 89134 | 1,2-Benzenedicarboxylic acid, 1-(2-ethylhexyl) 2-(8-methylnonyl) ester |
| 85698 | 1,2-Benzenedicarboxylic acid, 1-butyl 2-(2-ethylhexyl) ester |
| 85687 | 1,2-Benzenedicarboxylic acid, 1-butyl 2-(phenylmethyl) ester |
| 58128782 | 1,2-Benzenedicarboxylic acid, 1-butyl 2-(phenylmethyl) ester |
| 84640 | 1,2-Benzenedicarboxylic acid, 1-butyl 2-cyclohexyl ester |
| 84786 | 1,2-Benzenedicarboxylic acid, 1-butyl 2-octyl ester |
| 5334098 | 1,2-Benzenedicarboxylic acid, 1-cyclohexyl 2-(2-methylpropyl) ester |
| 25724587 | 1,2-Benzenedicarboxylic acid, 1-decyl 2-hexyl ester |
| 119073 | 1,2-Benzenedicarboxylic acid, 1-decyl 2-octyl ester |
| 1323735 | 1,2-Benzenedicarboxylic acid, 1-decyl 2-octyl ester |
| 61702816 | 1,2-Benzenedicarboxylic acid, 1-hexyl 2-isodecyl ester |
| 61886600 | 1,2-Benzenedicarboxylic acid, 1-isodecyl 2-tridecyl ester |
| 27215221 | 1,2-Benzenedicarboxylic acid, 1-isooctyl 2-(phenylmethyl) ester |
| 30138751 | 1,2-Benzenedicarboxylic acid, 1-isooctyl 2-(phenylmethyl) ester |
| 85712 | 1,2-Benzenedicarboxylic acid, 2-ethoxy-2-oxoethyl methyl ester |
| 84720 | 1,2-Benzenedicarboxylic acid, 2-ethoxy-2-oxoethyl-, ethyl ester |
| 80264499 | 1,2-Benzenedicarboxylic acid, 2-ethoxy-2-oxoethyl-, ethyl ester |
| 632586 | 1,2-Benzenedicarboxylic acid, 3,4,5,6-tetrachloro- |
| 89190 | 1,2-Benzenedicarboxylic acid, butyl decyl ester |
| 146509 | 1,2-Benzenedicarboxylic acid, diisohexyl ester |
| 4376209 | 1,2-Benzenedicarboxylic acid, mono(2-ethylhexyl) ester |
| 120809 | 1,2-Benzenediol |
| 16474898 | 1,2-Benzenediol |
| 16474901 | 1,2-Benzenediol |
| 37349329 | 1,2-Benzenediol |
| 1198556 | 1,2-Benzenediol, 3,4,5,6-tetrachloro- |
| 56961207 | 1,2-Benzenediol, 3,4,5-trichloro- |
| 32139723 | 1,2-Benzenediol, 3,4,6-trichloro- |
| 51434 | 1,2-Benzenediol, 4-[(1R)-1-hydroxy-2-(methylamino)ethyl]- |
| 51028730 | 1,2-Benzenediol, 4-[(1R)-1-hydroxy-2-(methylamino)ethyl]- |
| 55312 | 1,2-Benzenediol, 4-[(1R)-1-hydroxy-2-(methylamino)ethyl]-, hydrochloride |
| 329657 | 1,2-Benzenediol, 4-[1-hydroxy-2-(methylamino)ethyl]- |
| 51309 | 1,2-Benzenediol, 4-[1-hydroxy-2-[(1-methylethyl)amino]ethyl]-, hydrochloride |
| 949360 | 1,2-Benzenediol, 4-[1-hydroxy-2-[(1-methylethyl)amino]ethyl]-, hydrochloride |
| 1336896 | 1,2-Benzenediol, 4-[1-hydroxy-2-[(1-methylethyl)amino]ethyl]-, hydrochloride |
| 71249428 | 1,2-Benzenediol, 4-[1-hydroxy-2-[(1-methylethyl)amino]ethyl]-, hydrochloride |
| 81072 | 1,2-Benzisothiazol-3(2H)-one, 1,1- dioxide and salts |
| 81072 | 1,2-Benzisothiazol-3(2H)-one, 1,1-dioxide |
| 474919 | 1,2-Benzisothiazol-3(2H)-one, 1,1-dioxide |
| 61255274 | 1,2-Benzisothiazol-3(2H)-one, 1,1-dioxide |
| 126987835 | 1,2-Benzisothiazol-3(2H)-one, 1,1-dioxide |
| 890126348 | 1,2-Benzisothiazol-3(2H)-one, 1,1-dioxide |
| 128449 | 1,2-Benzisothiazol-3(2H)-one, 1,1-dioxide, sodium salt (1:1) |
| 38279264 | 1,2-Benzisothiazol-3(2H)-one, 1,1-dioxide, sodium salt (1:1) |
| 272162 | 1,2-Benzisothiazole |
| 40991386 | 1,2-Benzisothiazole, 3-methoxy- |
| 5493458 | 1,2-Cyclohexanedicarboxylic acid, 1,2-bis(2-oxiranylmethyl) ester |
| 123773 | 1,2-Diazenedicarboxamide |
| 52737710 | 1,2-Diazenedicarboxamide |
| 62494615 | 1,2-Diazenedicarboxamide |
| 62494626 | 1,2-Diazenedicarboxamide |
| 62494853 | 1,2-Diazenedicarboxamide |
| 65098864 | 1,2-Diazenedicarboxamide |
| 65098875 | 1,2-Diazenedicarboxamide |
| 72514455 | 1,2-Diazenedicarboxamide |
| 73247424 | 1,2-Diazenedicarboxamide |
| 73905778 | 1,2-Diazenedicarboxamide |
| 81774201 | 1,2-Diazenedicarboxamide |
| 89073358 | 1,2-Diazenedicarboxamide |
| 97707965 | 1,2-Diazenedicarboxamide |
| 131715269 | 1,2-Diazenedicarboxamide |
| 183256782 | 1,2-Diazenedicarboxamide |
| 218433148 | 1,2-Diazenedicarboxamide |
| 221272726 | 1,2-Diazenedicarboxamide |
| 882523855 | 1,2-Diazenedicarboxamide |
| 1006730148 | 1,2-Diazenedicarboxamide |
| 107153 | 1,2-Ethanediamine |
| 8030248 | 1,2-Ethanediamine |
| 85404188 | 1,2-Ethanediamine |
| 91816 | 1,2-Ethanediamine, N,N-dimethyl-N'-(phenylmethyl)-N'-2-pyridinyl- |
| 154698 | 1,2-Ethanediamine, N,N-dimethyl-N'-(phenylmethyl)-N'-2-pyridinyl-, monohydrochloride |
| 91805 | 1,2-Ethanediamine, N,N-dimethyl-N'-2-pyridinyl-N'-(2-thienylmethyl)- |
| 958930 | 1,2-Ethanediamine, N,N-dimethyl-N'-2-pyridinyl-N'-(3-thienylmethyl)-, monohydrochloride |
| 961717 | 1,2-Ethanediamine, N,N-dimethyl-N'-phenyl-N'-(phenylmethyl)- |
| 2045525 | 1,2-Ethanediamine, N,N-dimethyl-N'-phenyl-N'-(phenylmethyl)-, monohydrochloride |
| 91849 | 1,2-Ethanediamine, N-[(4-methoxyphenyl)methyl]-N',N'-dimethyl-N-2-pyridinyl- |
| 91850 | 1,2-Ethanediamine, N-[(4-methoxyphenyl)methyl]-N',N'-dimethyl-N-2-pyrimidinyl- |
| 63569 | 1,2-Ethanediamine, N-[(4-methoxyphenyl)methyl]-N',N'-dimethyl-N-2-pyrimidinyl-, monohydrochloride |
| 148652 | 1,2-Ethanediamine, N-[(5-chloro-2-thienyl)methyl]-N',N'-dimethyl-N-2-pyridinyl- |
| 110189 | 1,2-Ethanediamine, N1,N1,N2,N2-tetramethyl- |
| 1258795322 | 1,2-Ethanediamine, N1,N1,N2,N2-tetramethyl- |
| 135239 | 1,2-Ethanediamine, N1,N1-dimethyl-N2-2-pyridinyl-N2-(2-thienylmethyl)-, hydrochloride (1:1) |
| 8048019 | 1,2-Ethanediamine, N1,N1-dimethyl-N2-2-pyridinyl-N2-(2-thienylmethyl)-, hydrochloride (1:1) |
| 112243 | 1,2-Ethanediamine, N1,N2-bis(2-aminoethyl)- |
| 14175145 | 1,2-Ethanediamine, N1,N2-bis(2-aminoethyl)- |
| 39421777 | 1,2-Ethanediamine, N1,N2-bis(2-aminoethyl)- |
| 71124113 | 1,2-Ethanediamine, N1,N2-bis(2-aminoethyl)- |
| 105093207 | 1,2-Ethanediamine, N1,N2-bis(2-aminoethyl)- |
| 110670332 | 1,2-Ethanediamine, N1,N2-bis(2-aminoethyl)- |
| 150139029 | 1,2-Ethanediamine, N1,N2-bis(2-aminoethyl)- |
| 193487080 | 1,2-Ethanediamine, N1,N2-bis(2-aminoethyl)- |
| 801997182 | 1,2-Ethanediamine, N1,N2-bis(2-aminoethyl)- |
| 1309612461 | 1,2-Ethanediamine, N1,N2-bis(2-aminoethyl)- |
| 1404190346 | 1,2-Ethanediamine, N1,N2-bis(2-aminoethyl)- |
| 111400 | 1,2-Ethanediamine, N1-(2-aminoethyl)- |
| 8076559 | 1,2-Ethanediamine, N1-(2-aminoethyl)- |
| 26915786 | 1,2-Ethanediamine, N1-(2-aminoethyl)- |
| 53303767 | 1,2-Ethanediamine, N1-(2-aminoethyl)- |
| 54018927 | 1,2-Ethanediamine, N1-(2-aminoethyl)- |
| 59135909 | 1,2-Ethanediamine, N1-(2-aminoethyl)- |
| 73989307 | 1,2-Ethanediamine, N1-(2-aminoethyl)- |
| 94700171 | 1,2-Ethanediamine, N1-(2-aminoethyl)- |
| 98824352 | 1,2-Ethanediamine, N1-(2-aminoethyl)- |
| 203009170 | 1,2-Ethanediamine, N1-(2-aminoethyl)- |
| 419553449 | 1,2-Ethanediamine, N1-(2-aminoethyl)- |
| 859039002 | 1,2-Ethanediamine, N1-(2-aminoethyl)- |
| 1078151435 | 1,2-Ethanediamine, N1-(2-aminoethyl)- |
| 112572 | 1,2-Ethanediamine, N1-(2-aminoethyl)-N2-[2-[(2-aminoethyl)amino]ethyl]- |
| 107324823 | 1,2-Ethanediamine, N1-(2-aminoethyl)-N2-[2-[(2-aminoethyl)amino]ethyl]- |
| 115254449 | 1,2-Ethanediamine, N1-(2-aminoethyl)-N2-[2-[(2-aminoethyl)amino]ethyl]- |
| 675120384 | 1,2-Ethanediamine, N1-(2-aminoethyl)-N2-[2-[(2-aminoethyl)amino]ethyl]- |
| 778611862 | 1,2-Ethanediamine, N1-(2-aminoethyl)-N2-[2-[(2-aminoethyl)amino]ethyl]- |
| 916431340 | 1,2-Ethanediamine, N1-(2-aminoethyl)-N2-[2-[(2-aminoethyl)amino]ethyl]- |
| 951317923 | 1,2-Ethanediamine, N1-(2-aminoethyl)-N2-[2-[(2-aminoethyl)amino]ethyl]- |
| 1061621166 | 1,2-Ethanediamine, N1-(2-aminoethyl)-N2-[2-[(2-aminoethyl)amino]ethyl]- |
| 1151794169 | 1,2-Ethanediamine, N1-(2-aminoethyl)-N2-[2-[(2-aminoethyl)amino]ethyl]- |
| 1465254 | 1,2-Ethanediamine, N1-1-naphthalenyl-, hydrochloride (1:2) |
| 59336 | 1,2-Ethanediamine, N1-[(4-methoxyphenyl)methyl]-N2,N2-dimethyl-N1-2-pyridinyl-, (2Z)-2-butenedioate (1:1) |
| 5572065 | 1,2-Ethanediamine, N1-[(4-methoxyphenyl)methyl]-N2,N2-dimethyl-N1-2-pyridinyl-, (2Z)-2-butenedioate (1:1) |
| 107211 | 1,2-Ethanediol |
| 37221957 | 1,2-Ethanediol |
| 71767641 | 1,2-Ethanediol |
| 1371582330 | 1,2-Ethanediol |
| 111557 | 1,2-Ethanediol, 1,2-diacetate |
| 628966 | 1,2-Ethanediol, 1,2-dinitrate |
| 121749119 | 1,2-Ethanediol, 1,2-dinitrate |
| 542596 | 1,2-Ethanediol, 1-acetate |
| 142461 | 1,2-Hydrazinedicarbothioamide |
| 110214 | 1,2-Hydrazinedicarboxamide |
| 77107483 | 1,2-Hydrazinedicarboxamide |
| 524425 | 1,2-Naphthalenedione |
| 1120714 | 1,2-Oxathiolane, 2,2-dioxide |
| 463490 | 1,2-Propadiene |
| 6688911 | 1,2-Propadiene |
| 78900 | 1,2-Propanediamine |
| 10424381 | 1,2-Propanediamine |
| 68928994 | 1,2-Propanediamine |
| 57556 | 1,2-Propanediol |
| 114261 | 1,2-Propanediol |
| 4254164 | 1,2-Propanediol |
| 63625569 | 1,2-Propanediol |
| 190913758 | 1,2-Propanediol |
| 1194046202 | 1,2-Propanediol |
| 6423434 | 1,2-Propanediol, 1,2-dinitrate |
| 93141 | 1,2-Propanediol, 3-(2-methoxyphenoxy)- |
| 1336670 | 1,2-Propanediol, 3-(2-methoxyphenoxy)- |
| 12041735 | 1,2-Propanediol, 3-(2-methoxyphenoxy)- |
| 128707448 | 1,2-Propanediol, 3-(2-methoxyphenoxy)- |
| 532036 | 1,2-Propanediol, 3-(2-methoxyphenoxy)-, 1-carbamate |
| 145308038 | 1,2-Propanediol, 3-(2-methoxyphenoxy)-, 1-carbamate |
| 96242 | 1,2-Propanediol, 3-chloro- |
| 96662 | 1,2-Propanediol, 3-chloro- |
| 52340462 | 1,2-Propanediol, 3-chloro- |
| 69420220 | 1,2-Propanediol, 3-chloro- |
| 16091182 | 1,3,2-Dioxastannepin-4,7-dione, 2,2-dioctyl- |
| 24493514 | 1,3,2-Dioxastannepin-4,7-dione, 2,2-dioctyl- |
| 32296041 | 1,3,2-Dioxastannepin-4,7-dione, 2,2-dioctyl- |
| 52434421 | 1,3,2-Dioxastannepin-4,7-dione, 2,2-dioctyl- |
| 1034419 | 1,3,4-Metheno-1H-cyclobuta[cd]pentalen-2-ol, 1,1a,3,3a,4,5,5,5a,5b,6-decachlorooctahydro- |
| 2385855 | 1,3,4-Metheno-1H-cyclobuta[cd]pentalene, 1,1a,2,2,3,3a,4,5,5,5a,5b,6-dodecachlorooctahydro- |
| 12557889 | 1,3,4-Metheno-1H-cyclobuta[cd]pentalene, 1,1a,2,2,3,3a,4,5,5,5a,5b,6-dodecachlorooctahydro- |
| 12707436 | 1,3,4-Metheno-1H-cyclobuta[cd]pentalene, 1,1a,2,2,3,3a,4,5,5,5a,5b,6-dodecachlorooctahydro- |
| 12766040 | 1,3,4-Metheno-1H-cyclobuta[cd]pentalene, 1,1a,2,2,3,3a,4,5,5,5a,5b,6-dodecachlorooctahydro- |
| 20594494 | 1,3,4-Metheno-1H-cyclobuta[cd]pentalene, 1,1a,2,2,3,3a,4,5,5,5a,5b,6-dodecachlorooctahydro- |
| 56449786 | 1,3,4-Metheno-1H-cyclobuta[cd]pentalene, 1,1a,2,2,3,3a,4,5,5,5a,5b,6-dodecachlorooctahydro- |
| 4234791 | 1,3,4-Metheno-1H-cyclobuta[cd]pentalene-2-pentanoic acid, 1,1a,3,3a,4,5,5,5a,5b,6-decachlorooctahydro-2-hydroxy-.gamma.-oxo-, ethyl ester |
| 143500 | 1,3,4-Metheno-2H-cyclobuta[cd]pentalen-2-one, 1,1a,3,3a,4,5,5,5a,5b,6-decachlorooctahydro- |
| 19666309 | 1,3,4-Oxadiazol-2(3H)-one, 3-[2,4-dichloro-5-(1-methylethoxy)phenyl]-5-(1,1-dimethylethyl)- |
| 101257 | 1,3,5,7-Tetraazabicyclo[3.3.1]nonane, 3,7-dinitroso- |
| 42617174 | 1,3,5,7-Tetraazabicyclo[3.3.1]nonane, 3,7-dinitroso- |
| 42617185 | 1,3,5,7-Tetraazabicyclo[3.3.1]nonane, 3,7-dinitroso- |
| 50337901 | 1,3,5,7-Tetraazabicyclo[3.3.1]nonane, 3,7-dinitroso- |
| 52229988 | 1,3,5,7-Tetraazabicyclo[3.3.1]nonane, 3,7-dinitroso- |
| 85605181 | 1,3,5,7-Tetraazabicyclo[3.3.1]nonane, 3,7-dinitroso- |
| 100970 | 1,3,5,7-Tetraazatricyclo[3.3.1.13,7]decane |
| 11103676 | 1,3,5,7-Tetraazatricyclo[3.3.1.13,7]decane |
| 15978333 | 1,3,5,7-Tetraazatricyclo[3.3.1.13,7]decane |
| 56549349 | 1,3,5,7-Tetraazatricyclo[3.3.1.13,7]decane |
| 74734160 | 1,3,5,7-Tetraazatricyclo[3.3.1.13,7]decane |
| 91773487 | 1,3,5,7-Tetraazatricyclo[3.3.1.13,7]decane |
| 2691410 | 1,3,5,7-Tetrazocine, octahydro-1,3,5,7-tetranitro- |
| 5222468 | 1,3,5,7-Tetrazocine, octahydro-1,3,5,7-tetranitro- |
| 66038264 | 1,3,5,7-Tetrazocine, octahydro-1,3,5,7-tetranitro- |
| 66745902 | 1,3,5,7-Tetrazocine, octahydro-1,3,5,7-tetranitro- |
| 97956019 | 1,3,5,7-Tetrazocine, octahydro-1,3,5,7-tetranitro- |
| 121631138 | 1,3,5,7-Tetrazocine, octahydro-1,3,5,7-tetranitro- |
| 141615545 | 1,3,5,7-Tetrazocine, octahydro-1,3,5,7-tetranitro- |
| 2353335 | 1,3,5-Triazin-2(1H)-one, 4-amino-1-(2-deoxy-.beta.-D-erythro-pentofuranosyl)- |
| 320672 | 1,3,5-Triazin-2(1H)-one, 4-amino-1-.beta.-D-ribofuranosyl- |
| 101053 | 1,3,5-Triazin-2-amine, 4,6-dichloro-N-(2-chlorophenyl)- |
| 675149 | 1,3,5-Triazine, 2,4,6-trifluoro- |
| 51183 | 1,3,5-Triazine, 2,4,6-tris(1-aziridinyl)- |
| 121824 | 1,3,5-Triazine, hexahydro-1,3,5-trinitro- |
| 50579232 | 1,3,5-Triazine, hexahydro-1,3,5-trinitro- |
| 53800536 | 1,3,5-Triazine, hexahydro-1,3,5-trinitro- |
| 57608454 | 1,3,5-Triazine, hexahydro-1,3,5-trinitro- |
| 82030420 | 1,3,5-Triazine, hexahydro-1,3,5-trinitro- |
| 204655618 | 1,3,5-Triazine, hexahydro-1,3,5-trinitro- |
| 4719044 | 1,3,5-Triazine-1,3,5(2H,4H,6H)-triethanol |
| 63310098 | 1,3,5-Triazine-1,3,5(2H,4H,6H)-triethanol |
| 51235042 | 1,3,5-Triazine-2,4(1H,3H)-dione, 3-cyclohexyl-6-(dimethylamino)-1-methyl- |
| 108805 | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione |
| 504198 | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione |
| 134016527 | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione |
| 273203079 | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione |
| 1025156 | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3,5-tri-2-propen-1-yl- |
| 109521508 | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3,5-tri-2-propen-1-yl- |
| 123339468 | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3,5-tri-2-propen-1-yl- |
| 196519945 | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3,5-tri-2-propen-1-yl- |
| 1086264290 | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3,5-tri-2-propen-1-yl- |
| 87901 | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3,5-trichloro- |
| 499583312 | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3,5-trichloro- |
| 1062228505 | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3,5-trichloro- |
| 827167 | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3,5-trimethyl- |
| 839907 | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3,5-tris(2-hydroxyethyl)- |
| 63118423 | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3,5-tris(2-hydroxyethyl)- |
| 248590650 | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3,5-tris(2-hydroxyethyl)- |
| 2451629 | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3,5-tris(2-oxiranylmethyl)- |
| 414867600 | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3,5-tris(2-oxiranylmethyl)- |
| 61050973 | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3,5-tris(2-oxopropyl)- |
| 7423532 | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3,5-tris(3-chloro-2-hydroxypropyl)- |
| 606031 | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3,5-tris(phenylmethyl)- |
| 2782572 | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3-dichloro- |
| 76162351 | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3-dichloro- |
| 2244215 | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3-dichloro-, potassium salt (1:1) |
| 14426074 | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3-dichloro-, potassium salt (1:1) |
| 25727268 | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3-dichloro-, potassium salt (1:1) |
| 57073479 | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3-dichloro-, potassium salt (1:1) |
| 68462522 | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3-dichloro-, potassium salt (1:1) |
| 73694072 | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3-dichloro-, potassium salt (1:1) |
| 156620803 | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3-dichloro-, potassium salt (1:1) |
| 174016616 | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3-dichloro-, potassium salt (1:1) |
| 2893789 | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3-dichloro-, sodium salt (1:1) |
| 10119309 | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3-dichloro-, sodium salt (1:1) |
| 12676232 | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3-dichloro-, sodium salt (1:1) |
| 13023284 | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3-dichloro-, sodium salt (1:1) |
| 16499744 | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3-dichloro-, sodium salt (1:1) |
| 25717184 | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3-dichloro-, sodium salt (1:1) |
| 76560286 | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3-dichloro-, sodium salt (1:1) |
| 81918505 | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3-dichloro-, sodium salt (1:1) |
| 200401838 | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3-dichloro-, sodium salt (1:1) |
| 2624171 | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, sodium salt (1:1) |
| 15193450 | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, sodium salt (1:1) |
| 108781 | 1,3,5-Triazine-2,4,6-triamine |
| 504187 | 1,3,5-Triazine-2,4,6-triamine |
| 65544345 | 1,3,5-Triazine-2,4,6-triamine |
| 67757431 | 1,3,5-Triazine-2,4,6-triamine |
| 68379555 | 1,3,5-Triazine-2,4,6-triamine |
| 70371196 | 1,3,5-Triazine-2,4,6-triamine |
| 94977272 | 1,3,5-Triazine-2,4,6-triamine |
| 130392039 | 1,3,5-Triazine-2,4,6-triamine |
| 169314629 | 1,3,5-Triazine-2,4,6-triamine |
| 1228929278 | 1,3,5-Triazine-2,4,6-triamine |
| 1399841690 | 1,3,5-Triazine-2,4,6-triamine |
| 1399841714 | 1,3,5-Triazine-2,4,6-triamine |
| 1399841736 | 1,3,5-Triazine-2,4,6-triamine |
| 645056 | 1,3,5-Triazine-2,4,6-triamine, N,N,N',N',N'',N''-hexamethyl- |
| 7673098 | 1,3,5-Triazine-2,4,6-triamine, N2,N4,N6-trichloro- |
| 6190654 | 1,3,5-Triazine-2,4-diamine, 6-chloro-N-(1-methylethyl)- |
| 1007289 | 1,3,5-Triazine-2,4-diamine, 6-chloro-N-ethyl- |
| 139402 | 1,3,5-Triazine-2,4-diamine, 6-chloro-N2,N4-bis(1-methylethyl)- |
| 122349 | 1,3,5-Triazine-2,4-diamine, 6-chloro-N2,N4-diethyl- |
| 11141201 | 1,3,5-Triazine-2,4-diamine, 6-chloro-N2,N4-diethyl- |
| 12764715 | 1,3,5-Triazine-2,4-diamine, 6-chloro-N2,N4-diethyl- |
| 39291640 | 1,3,5-Triazine-2,4-diamine, 6-chloro-N2,N4-diethyl- |
| 119603940 | 1,3,5-Triazine-2,4-diamine, 6-chloro-N2,N4-diethyl- |
| 5915413 | 1,3,5-Triazine-2,4-diamine, 6-chloro-N2-(1,1-dimethylethyl)-N4-ethyl- |
| 63026573 | 1,3,5-Triazine-2,4-diamine, 6-chloro-N2-(1,1-dimethylethyl)-N4-ethyl- |
| 1912249 | 1,3,5-Triazine-2,4-diamine, 6-chloro-N2-ethyl-N4-(1-methylethyl)- |
| 11121316 | 1,3,5-Triazine-2,4-diamine, 6-chloro-N2-ethyl-N4-(1-methylethyl)- |
| 12040458 | 1,3,5-Triazine-2,4-diamine, 6-chloro-N2-ethyl-N4-(1-methylethyl)- |
| 12797727 | 1,3,5-Triazine-2,4-diamine, 6-chloro-N2-ethyl-N4-(1-methylethyl)- |
| 39400721 | 1,3,5-Triazine-2,4-diamine, 6-chloro-N2-ethyl-N4-(1-methylethyl)- |
| 69771319 | 1,3,5-Triazine-2,4-diamine, 6-chloro-N2-ethyl-N4-(1-methylethyl)- |
| 93616398 | 1,3,5-Triazine-2,4-diamine, 6-chloro-N2-ethyl-N4-(1-methylethyl)- |
| 1610180 | 1,3,5-Triazine-2,4-diamine, 6-methoxy-N2,N4-bis(1-methylethyl)- |
| 11126753 | 1,3,5-Triazine-2,4-diamine, 6-methoxy-N2,N4-bis(1-methylethyl)- |
| 7287196 | 1,3,5-Triazine-2,4-diamine, N,N'-bis(1-methylethyl)-6-(methylthio)- |
| 1014706 | 1,3,5-Triazine-2,4-diamine, N,N'-diethyl-6-(methylthio)- |
| 886500 | 1,3,5-Triazine-2,4-diamine, N-(1,1-dimethylethyl)-N'-ethyl-6-(methylthio)- |
| 1610179 | 1,3,5-Triazine-2,4-diamine, N-ethyl-6-methoxy-N'-(1-methylethyl)- |
| 834128 | 1,3,5-Triazine-2,4-diamine, N-ethyl-N'-(1-methylethyl)-6-(methylthio)- |
| 110883 | 1,3,5-Trioxane |
| 113783485 | 1,3,5-Trioxane |
| 123637 | 1,3,5-Trioxane, 2,4,6-trimethyl- |
| 51289715 | 1,3,5-Trioxane, 2,4,6-trimethyl- |
| 108452 | 1,3-Benzenediamine |
| 1274866895 | 1,3-Benzenediamine |
| 823405 | 1,3-Benzenediamine, 2-methyl- |
| 15481706 | 1,3-Benzenediamine, 2-methyl-, dihydrochloride |
| 495545 | 1,3-Benzenediamine, 4-(2-phenyldiazenyl)- |
| 89961160 | 1,3-Benzenediamine, 4-(2-phenyldiazenyl)- |
| 532821 | 1,3-Benzenediamine, 4-(2-phenyldiazenyl)-, hydrochloride (1:1) |
| 5131602 | 1,3-Benzenediamine, 4-chloro- |
| 615054 | 1,3-Benzenediamine, 4-methoxy- |
| 39156417 | 1,3-Benzenediamine, 4-methoxy-, sulfate (1:1) |
| 108066984 | 1,3-Benzenediamine, 4-methoxy-, sulfate (1:1) |
| 95807 | 1,3-Benzenediamine, 4-methyl- |
| 95877 | 1,3-Benzenediamine, 4-methyl- |
| 12236565 | 1,3-Benzenediamine, 4-methyl- |
| 25376458 | 1,3-Benzenediamine, 4-methyl- |
| 85898880 | 1,3-Benzenediamine, 4-methyl- |
| 5131588 | 1,3-Benzenediamine, 4-nitro- |
| 626175 | 1,3-Benzenedicarbonitrile |
| 1897456 | 1,3-Benzenedicarbonitrile, 2,4,5,6-tetrachloro- |
| 37223691 | 1,3-Benzenedicarbonitrile, 2,4,5,6-tetrachloro- |
| 101963739 | 1,3-Benzenedicarbonitrile, 2,4,5,6-tetrachloro- |
| 216082574 | 1,3-Benzenedicarbonitrile, 2,4,5,6-tetrachloro- |
| 342632513 | 1,3-Benzenedicarbonitrile, 2,4,5,6-tetrachloro- |
| 462093272 | 1,3-Benzenedicarbonitrile, 2,4,5,6-tetrachloro- |
| 137893 | 1,3-Benzenedicarboxylic acid, 1,3-bis(2-ethylhexyl) ester |
| 7195439 | 1,3-Benzenedicarboxylic acid, bis(oxiranylmethyl) ester |
| 1477550 | 1,3-Benzenedimethanamine |
| 153326455 | 1,3-Benzenedimethanamine |
| 554432836 | 1,3-Benzenedimethanamine |
| 108463 | 1,3-Benzenediol |
| 136776 | 1,3-Benzenediol, 4-hexyl- |
| 500663 | 1,3-Benzenediol, 5-pentyl- |
| 98486 | 1,3-Benzenedisulfonic acid |
| 22961826 | 1,3-Benzodioxol-4-ol, 2,2-dimethyl- |
| 22781233 | 1,3-Benzodioxol-4-ol, 2,2-dimethyl-, methylcarbamate |
| 120581 | 1,3-Benzodioxole, 5-(1-propen-1-yl)- |
| 191281035 | 1,3-Benzodioxole, 5-(1-propen-1-yl)- |
| 94597 | 1,3-Benzodioxole, 5-(2-propen-1-yl)- |
| 1406559 | 1,3-Benzodioxole, 5-(2-propen-1-yl)- |
| 8022922 | 1,3-Benzodioxole, 5-(2-propen-1-yl)- |
| 120627 | 1,3-Benzodioxole, 5-[2-(octylsulfinyl)propyl]- |
| 23715119 | 1,3-Benzodioxole, 5-[2-(octylsulfinyl)propyl]- |
| 51036 | 1,3-Benzodioxole, 5-[[2-(2-butoxyethoxy)ethoxy]methyl]-6-propyl- |
| 12750924 | 1,3-Benzodioxole, 5-[[2-(2-butoxyethoxy)ethoxy]methyl]-6-propyl- |
| 94586 | 1,3-Benzodioxole, 5-propyl- |
| 120570 | 1,3-Benzodioxole-5-carboxaldehyde |
| 30024749 | 1,3-Benzodioxole-5-carboxaldehyde |
| 659726326 | 1,3-Benzodioxole-5-carboxaldehyde |
| 326614 | 1,3-Benzodioxole-5-methanol, 5-acetate |
| 106990 | 1,3-Butadiene |
| 25339575 | 1,3-Butadiene |
| 130983709 | 1,3-Butadiene |
| 183592612 | 1,3-Butadiene |
| 1213224271 | 1,3-Butadiene |
| 87683 | 1,3-Butadiene, 1,1,2,3,4,4-hexachloro- |
| 1653196 | 1,3-Butadiene, 2,3-dichloro- |
| 126998 | 1,3-Butadiene, 2-chloro- |
| 184963095 | 1,3-Butadiene, 2-chloro- |
| 9010984 | 1,3-Butadiene, 2-chloro-, homopolymer |
| 28430719 | 1,3-Butadiene, 2-chloro-, homopolymer |
| 129541839 | 1,3-Butadiene, 2-chloro-, homopolymer |
| 78795 | 1,3-Butadiene, 2-methyl- |
| 78006925 | 1,3-Butadiene, 2-methyl- |
| 823271950 | 1,3-Butadiene, 2-methyl- |
| 97847 | 1,3-Butanediamine, N1,N1,N3,N3-tetramethyl- |
| 55637280 | 1,3-Butanediamine, N1,N1,N3,N3-tetramethyl- |
| 107880 | 1,3-Butanediol |
| 18826954 | 1,3-Butanediol |
| 817176753 | 1,3-Butanediol |
| 542927 | 1,3-Cyclopentadiene |
| 26912334 | 1,3-Cyclopentadiene |
| 77473 | 1,3-Cyclopentadiene, 1,2,3,4,5,5-hexachloro- |
| 77474 | 1,3-Cyclopentadiene, 1,2,3,4,5,5-hexachloro- |
| 828002 | 1,3-Dioxan-4-ol, 2,6-dimethyl-, 4-acetate |
| 37235599 | 1,3-Dioxan-4-ol, 2,6-dimethyl-, 4-acetate |
| 505226 | 1,3-Dioxane |
| 25683005 | 1,3-Dioxane, 2-butyl-2-methyl- |
| 126396 | 1,3-Dioxolane, 2-ethyl-2-methyl- |
| 90641568 | 1,3-Dioxolane, 2-ethyl-2-methyl- |
| 957464743 | 1,3-Dioxolane, 2-ethyl-2-methyl- |
| 497267 | 1,3-Dioxolane, 2-methyl- |
| 1331095 | 1,3-Dioxolane, 2-methyl- |
| 89579873 | 1,3-Dioxolane, 2-methyl- |
| 5634399 | 1,3-Dioxolane-4-methanol, 2-(1-iodoethyl)- |
| 26419738 | 1,3-Dithiolane-2-carboxaldehyde, 2,4-dimethyl-, O-[(methylamino)carbonyl]oxime |
| 2439012 | 1,3-Dithiolo[4,5-b]quinoxalin-2-one, 6-methyl- |
| 85449 | 1,3-Isobenzofurandione |
| 39363638 | 1,3-Isobenzofurandione |
| 632791 | 1,3-Isobenzofurandione, 4,5,6,7-tetrabromo- |
| 72625957 | 1,3-Isobenzofurandione, 4,5,6,7-tetrabromo- |
| 117088 | 1,3-Isobenzofurandione, 4,5,6,7-tetrachloro- |
| 204975246 | 1,3-Isobenzofurandione, 4,5,6,7-tetrachloro- |
| 858829104 | 1,3-Isobenzofurandione, 4,5,6,7-tetrachloro- |
| 5466842 | 1,3-Isobenzofurandione, 5-nitro- |
| 2610051 | 1,3-Naphthalenedisulfonic acid, 6,6'-[(3,3'-dimethoxy[1,1'-biphenyl]-4,4'-diyl)bis(2,1-diazenediyl)]bis[4-amino-5-hydroxy-, sodium salt (1:4) |
| 755040574 | 1,3-Naphthalenedisulfonic acid, 6,6'-[(3,3'-dimethoxy[1,1'-biphenyl]-4,4'-diyl)bis(2,1-diazenediyl)]bis[4-amino-5-hydroxy-, sodium salt (1:4) |
| 314136 | 1,3-Naphthalenedisulfonic acid, 6,6'-[(3,3'-dimethyl[1,1'-biphenyl]-4,4'-diyl)bis(2,1-diazenediyl)]bis[4-amino-5-hydroxy-, sodium salt (1:4) |
| 179472538 | 1,3-Naphthalenedisulfonic acid, 6,6'-[(3,3'-dimethyl[1,1'-biphenyl]-4,4'-diyl)bis(2,1-diazenediyl)]bis[4-amino-5-hydroxy-, sodium salt (1:4) |
| 1936158 | 1,3-Naphthalenedisulfonic acid, 7-hydroxy-8-(2-phenyldiazenyl)-, sodium salt (1:2) |
| 53988800 | 1,3-Naphthalenedisulfonic acid, 7-hydroxy-8-(2-phenyldiazenyl)-, sodium salt (1:2) |
| 6459945 | 1,3-Naphthalenedisulfonic acid, 8-[2-[3,3'-dimethyl-4'-[2-[4-[[(4-methylphenyl)sulfonyl]oxy]phenyl]diazenyl][1,1'-biphenyl]-4-yl]diazenyl]-7-hydroxy-, sodium salt (1:2) |
| 471258227 | 1,3-Naphthalenedisulfonic acid, 8-[2-[3,3'-dimethyl-4'-[2-[4-[[(4-methylphenyl)sulfonyl]oxy]phenyl]diazenyl][1,1'-biphenyl]-4-yl]diazenyl]-7-hydroxy-, sodium salt (1:2) |
| 6358298 | 1,3-Naphthalenedisulfonic acid, 8-[2-[4'-[2-(4-ethoxyphenyl)diazenyl]-3,3'-dimethyl[1,1'-biphenyl]-4-yl]diazenyl]-7-hydroxy-, sodium salt (1:2) |
| 504609 | 1,3-Pentadiene |
| 109762 | 1,3-Propanediamine |
| 54018949 | 1,3-Propanediamine |
| 17070450 | 1,3-Propanediamine, N-(2-chloroethyl)-N'-(6-chloro-2-methoxy-9-acridinyl)-, dihydrochloride |
| 109557 | 1,3-Propanediamine, N1,N1-dimethyl- |
| 68497585 | 1,3-Propanediamine, N1,N1-dimethyl- |
| 1190921642 | 1,3-Propanediamine, N1,N1-dimethyl- |
| 56188 | 1,3-Propanediamine, N1-(3-aminopropyl)- |
| 6291845 | 1,3-Propanediamine, N1-methyl- |
| 504632 | 1,3-Propanediol |
| 757125932 | 1,3-Propanediol |
| 3296900 | 1,3-Propanediol, 2,2-bis(bromomethyl)- |
| 115775 | 1,3-Propanediol, 2,2-bis(hydroxymethyl)- |
| 75398866 | 1,3-Propanediol, 2,2-bis(hydroxymethyl)- |
| 88201290 | 1,3-Propanediol, 2,2-bis(hydroxymethyl)- |
| 4196865 | 1,3-Propanediol, 2,2-bis[(benzoyloxy)methyl]-, 1,3-dibenzoate |
| 78115 | 1,3-Propanediol, 2,2-bis[(nitrooxy)methyl]-, 1,3-dinitrate |
| 53025846 | 1,3-Propanediol, 2,2-bis[(nitrooxy)methyl]-, 1,3-dinitrate |
| 103842906 | 1,3-Propanediol, 2,2-bis[(nitrooxy)methyl]-, 1,3-dinitrate |
| 108736716 | 1,3-Propanediol, 2,2-bis[(nitrooxy)methyl]-, 1,3-dinitrate |
| 4196876 | 1,3-Propanediol, 2-[(benzoyloxy)methyl]-2-methyl-, 1,3-dibenzoate |
| 77861 | 1,3-Propanediol, 2-amino-2-(hydroxymethyl)- |
| 10819586 | 1,3-Propanediol, 2-amino-2-(hydroxymethyl)- |
| 25149079 | 1,3-Propanediol, 2-amino-2-(hydroxymethyl)- |
| 68755453 | 1,3-Propanediol, 2-amino-2-(hydroxymethyl)- |
| 83147391 | 1,3-Propanediol, 2-amino-2-(hydroxymethyl)- |
| 108195864 | 1,3-Propanediol, 2-amino-2-(hydroxymethyl)- |
| 119320159 | 1,3-Propanediol, 2-amino-2-(hydroxymethyl)- |
| 857365232 | 1,3-Propanediol, 2-amino-2-(hydroxymethyl)- |
| 1158650646 | 1,3-Propanediol, 2-amino-2-(hydroxymethyl)- |
| 52517 | 1,3-Propanediol, 2-bromo-2-nitro- |
| 133248961 | 1,3-Propanediol, 2-bromo-2-nitro- |
| 179733609 | 1,3-Propanediol, 2-bromo-2-nitro- |
| 1135443730 | 1,3-Propanediol, 2-bromo-2-nitro- |
| 497041 | 1,3-Propanediol, 2-chloro- |
| 77996 | 1,3-Propanediol, 2-ethyl-2-(hydroxymethyl)- |
| 30774186 | 1,3-Propanediol, 2-ethyl-2-(hydroxymethyl)- |
| 51811735 | 1,3-Propanediol, 2-ethyl-2-(hydroxymethyl)- |
| 53632318 | 1,3-Propanediol, 2-ethyl-2-(hydroxymethyl)- |
| 59218552 | 1,3-Propanediol, 2-ethyl-2-(hydroxymethyl)- |
| 65581897 | 1,3-Propanediol, 2-ethyl-2-(hydroxymethyl)- |
| 69896099 | 1,3-Propanediol, 2-ethyl-2-(hydroxymethyl)- |
| 77974028 | 1,3-Propanediol, 2-ethyl-2-(hydroxymethyl)- |
| 97649495 | 1,3-Propanediol, 2-ethyl-2-(hydroxymethyl)- |
| 101164618 | 1,3-Propanediol, 2-ethyl-2-(hydroxymethyl)- |
| 102984189 | 1,3-Propanediol, 2-ethyl-2-(hydroxymethyl)- |
| 110368520 | 1,3-Propanediol, 2-ethyl-2-(hydroxymethyl)- |
| 853320124 | 1,3-Propanediol, 2-ethyl-2-(hydroxymethyl)- |
| 3032551 | 1,3-Propanediol, 2-methyl-2-[(nitrooxy)methyl]-, 1,3-dinitrate |
| 57534 | 1,3-Propanediol, 2-methyl-2-propyl-, 1,3-dicarbamate |
| 109808 | 1,3-Propanedithiol |
| 1893330 | 1,4'-Bipiperidine]-4'-carboxamide, 1'-[4-(4-fluorophenyl)-4-oxobutyl]- |
| 106503 | 1,4-Benzenediamine |
| 56481766 | 1,4-Benzenediamine |
| 82785555 | 1,4-Benzenediamine |
| 609201 | 1,4-Benzenediamine, 2,6-dichloro- |
| 61702441 | 1,4-Benzenediamine, 2-chloro-, sulfate (1:1) |
| 95705 | 1,4-Benzenediamine, 2-methyl- |
| 33379316 | 1,4-Benzenediamine, 2-methyl- |
| 62488191 | 1,4-Benzenediamine, 2-methyl- |
| 124688013 | 1,4-Benzenediamine, 2-methyl- |
| 156031300 | 1,4-Benzenediamine, 2-methyl- |
| 6369591 | 1,4-Benzenediamine, 2-methyl-, sulfate (1:?) |
| 81892731 | 1,4-Benzenediamine, 2-methyl-, sulfate (1:?) |
| 5307142 | 1,4-Benzenediamine, 2-nitro- |
| 29467014 | 1,4-Benzenediamine, 2-nitro- |
| 100221 | 1,4-Benzenediamine, N1,N1,N4,N4-tetramethyl- |
| 93050 | 1,4-Benzenediamine, N1,N1-diethyl- |
| 99989 | 1,4-Benzenediamine, N1,N1-dimethyl- |
| 3081149 | 1,4-Benzenediamine, N1,N4-bis(1,4-dimethylpentyl)- |
| 32588764 | 1,4-Benzenediamine, N1,N4-bis(1,4-dimethylpentyl)- |
| 583049461 | 1,4-Benzenediamine, N1,N4-bis(1,4-dimethylpentyl)- |
| 101962 | 1,4-Benzenediamine, N1,N4-bis(1-methylpropyl)- |
| 1042164420 | 1,4-Benzenediamine, N1,N4-bis(1-methylpropyl)- |
| 93469 | 1,4-Benzenediamine, N1,N4-di-2-naphthalenyl- |
| 60005698 | 1,4-Benzenediamine, N1,N4-di-2-naphthalenyl- |
| 112721025 | 1,4-Benzenediamine, N1,N4-di-2-naphthalenyl- |
| 866724574 | 1,4-Benzenediamine, N1,N4-di-2-naphthalenyl- |
| 74317 | 1,4-Benzenediamine, N1,N4-diphenyl- |
| 66746427 | 1,4-Benzenediamine, N1,N4-diphenyl- |
| 72711536 | 1,4-Benzenediamine, N1,N4-diphenyl- |
| 943443445 | 1,4-Benzenediamine, N1,N4-diphenyl- |
| 793248 | 1,4-Benzenediamine, N1-(1,3-dimethylbutyl)-N4-phenyl- |
| 50809580 | 1,4-Benzenediamine, N1-(1,3-dimethylbutyl)-N4-phenyl- |
| 76600845 | 1,4-Benzenediamine, N1-(1,3-dimethylbutyl)-N4-phenyl- |
| 101724 | 1,4-Benzenediamine, N1-(1-methylethyl)-N4-phenyl- |
| 12771903 | 1,4-Benzenediamine, N1-(1-methylethyl)-N4-phenyl- |
| 59792631 | 1,4-Benzenediamine, N1-(1-methylethyl)-N4-phenyl- |
| 87133560 | 1,4-Benzenediamine, N1-(1-methylethyl)-N4-phenyl- |
| 121889803 | 1,4-Benzenediamine, N1-(1-methylethyl)-N4-phenyl- |
| 101542 | 1,4-Benzenediamine, N1-phenyl- |
| 12227746 | 1,4-Benzenediamine, N1-phenyl- |
| 76600630 | 1,4-Benzenediamine, N1-phenyl- |
| 624180 | 1,4-Benzenediamine, hydrochloride (1:2) |
| 100210 | 1,4-Benzenedicarboxylic acid |
| 211863900 | 1,4-Benzenedicarboxylic acid |
| 211863922 | 1,4-Benzenedicarboxylic acid |
| 120616 | 1,4-Benzenedicarboxylic acid, 1,4-dimethyl ester |
| 63143146 | 1,4-Benzenedicarboxylic acid, 1,4-dimethyl ester |
| 202644540 | 1,4-Benzenedicarboxylic acid, 1,4-dimethyl ester |
| 2136790 | 1,4-Benzenedicarboxylic acid, 2,3,5,6-tetrachloro- |
| 709988 | 1,4-Benzenedicarboxylic acid, 2,3,5,6-tetrachloro-, dimethyl ester |
| 1861321 | 1,4-Benzenedicarboxylic acid, 2,3,5,6-tetrachloro-, dimethyl ester |
| 887547 | 1,4-Benzenedicarboxylic acid, 2,3,5,6-tetrachloro-, monomethyl ester |
| 1861321 | 1,4-Benzenedicarboxylic acid, 2,3,5,6-tetrachloro-, monomethyl ester |
| 123319 | 1,4-Benzenediol |
| 8027029 | 1,4-Benzenediol |
| 57534131 | 1,4-Benzenediol |
| 1948330 | 1,4-Benzenediol, 2-(1,1-dimethylethyl)- |
| 29863170 | 1,4-Benzenediol, 2-(1,1-dimethylethyl)- |
| 68816568 | 1,4-Benzenediol, 2-(1,1-dimethylethyl)- |
| 123477690 | 1,4-Benzenediol, 2-(1,1-dimethylethyl)- |
| 140627334 | 1,4-Benzenediol, 2-(1,1-dimethylethyl)- |
| 110634 | 1,4-Butanediol |
| 732189036 | 1,4-Butanediol |
| 1204746064 | 1,4-Butanediol |
| 1400594639 | 1,4-Butanediol |
| 55981 | 1,4-Butanediol, dimethanesulfonate |
| 280579 | 1,4-Diazabicyclo[2.2.2]octane |
| 23790332 | 1,4-Diazabicyclo[2.2.2]octane |
| 88935437 | 1,4-Diazabicyclo[2.2.2]octane |
| 101484199 | 1,4-Diazabicyclo[2.2.2]octane |
| 150605019 | 1,4-Diazabicyclo[2.2.2]octane |
| 165724470 | 1,4-Diazabicyclo[2.2.2]octane |
| 203072111 | 1,4-Diazabicyclo[2.2.2]octane |
| 309955097 | 1,4-Diazabicyclo[2.2.2]octane |
| 746642466 | 1,4-Diazabicyclo[2.2.2]octane |
| 903524958 | 1,4-Diazabicyclo[2.2.2]octane |
| 123911 | 1,4-Dioxane |
| 28347888 | 1,4-Dioxane |
| 28347913 | 1,4-Dioxane |
| 39449246 | 1,4-Dioxane |
| 54841746 | 1,4-Dioxane |
| 95590 | 1,4-Dioxane, 2,3-dichloro- |
| 3883430 | 1,4-Dioxane, 2,3-dichloro-, (2R,3R)-rel- |
| 55290647 | 1,4-Dithiin, 2,3-dihydro-5,6-dimethyl-, 1,1,4,4-tetraoxide |
| 2243610 | 1,4-Naphthalenediamine |
| 130154 | 1,4-Naphthalenedione |
| 117806 | 1,4-Naphthalenedione, 2,3-dichloro- |
| 83727 | 1,4-Naphthalenedione, 2-hydroxy- |
| 5234684 | 1,4-Oxathiin-3-carboxamide, 5,6-dihydro-2-methyl-N-phenyl- |
| 64046793 | 1,4-Pentanediamine, N1,N1-bis(2-chloroethyl)-N4-(6-chloro-2-methoxy-9-acridinyl)- |
| 69056 | 1,4-Pentanediamine, N4-(6-chloro-2-methoxy-9-acridinyl)-N1,N1-diethyl-, dihydrochloride |
| 3682197 | 1,4-Phthalazinedione, 2,3-dihydro-6-nitro- |
| 521313 | 1,4-Phthalazinedione, 5-amino-2,3-dihydro- |
| 309002 | 1,4:5,8-Dimethanonaphthalene, 1,2,3,4,10,10-hexachloro-1,4,4a,5,8,8a-hexahydro-, (1.alpha.,4.alpha.,4a.beta.,5.alpha.,8.alpha.,8a.beta.)- |
| 465736 | 1,4:5,8-Dimethanonaphthalene, 1,2,3,4,10,10-hexachloro-1,4,4a,5,8,8a-hexahydro-, (1R,4S,4aS,5R,8S,8aR)-rel- |
| 20389611 | 1,4:5,8-Dimethanonaphthalene, 1,2,3,4,10,10-hexachloro-1,4,4a,5,8,8a-hexahydro-, (1R,4S,4aS,5R,8S,8aR)-rel- |
| 26302409 | 1,4:5,8-Dimethanonaphthalene, 1,2,3,4,10,10-hexachloro-1,4,4a,5,8,8a-hexahydro-, (1R,4S,4aS,5R,8S,8aR)-rel- |
| 1195521131 | 1,4:5,8-Dimethanonaphthalene, 1,2,3,4,10,10-hexachloro-1,4,4a,5,8,8a-hexahydro-, (1R,4S,4aS,5R,8S,8aR)-rel- |
| 11114140 | 1,4:7,10-Dimethanodibenzo[a,e]cyclooctene, 1,2,3,4,7,8,9,10,13,13,14,14-dodecachloro-1,4,4a,5,6,6a,7,10,10a,11,12,12a-dodecahydro- |
| 13560899 | 1,4:7,10-Dimethanodibenzo[a,e]cyclooctene, 1,2,3,4,7,8,9,10,13,13,14,14-dodecachloro-1,4,4a,5,6,6a,7,10,10a,11,12,12a-dodecahydro- |
| 39386102 | 1,4:7,10-Dimethanodibenzo[a,e]cyclooctene, 1,2,3,4,7,8,9,10,13,13,14,14-dodecachloro-1,4,4a,5,6,6a,7,10,10a,11,12,12a-dodecahydro- |
| 40372585 | 1,4:7,10-Dimethanodibenzo[a,e]cyclooctene, 1,2,3,4,7,8,9,10,13,13,14,14-dodecachloro-1,4,4a,5,6,6a,7,10,10a,11,12,12a-dodecahydro- |
| 59459119 | 1,4:7,10-Dimethanodibenzo[a,e]cyclooctene, 1,2,3,4,7,8,9,10,13,13,14,14-dodecachloro-1,4,4a,5,6,6a,7,10,10a,11,12,12a-dodecahydro- |
| 60880742 | 1,4:7,10-Dimethanodibenzo[a,e]cyclooctene, 1,2,3,4,7,8,9,10,13,13,14,14-dodecachloro-1,4,4a,5,6,6a,7,10,10a,11,12,12a-dodecahydro- |
| 1195618746 | 1,4:7,10-Dimethanodibenzo[a,e]cyclooctene, 1,2,3,4,7,8,9,10,13,13,14,14-dodecachloro-1,4,4a,5,6,6a,7,10,10a,11,12,12a-dodecahydro- |
| 2243621 | 1,5-Naphthalenediamine |
| 458377 | 1,6-Heptadiene-3,5-dione, 1,7-bis(4-hydroxy-3-methoxyphenyl)-, (1E,6E)- |
| 15845473 | 1,6-Heptadiene-3,5-dione, 1,7-bis(4-hydroxy-3-methoxyphenyl)-, (1E,6E)- |
| 33171049 | 1,6-Heptadiene-3,5-dione, 1,7-bis(4-hydroxy-3-methoxyphenyl)-, (1E,6E)- |
| 73729234 | 1,6-Heptadiene-3,5-dione, 1,7-bis(4-hydroxy-3-methoxyphenyl)-, (1E,6E)- |
| 79257480 | 1,6-Heptadiene-3,5-dione, 1,7-bis(4-hydroxy-3-methoxyphenyl)-, (1E,6E)- |
| 91884865 | 1,6-Heptadiene-3,5-dione, 1,7-bis(4-hydroxy-3-methoxyphenyl)-, (1E,6E)- |
| 124094 | 1,6-Hexanediamine |
| 4835114 | 1,6-Hexanediamine, N1,N6-dibutyl- |
| 7149260 | 1,6-Octadien-3-ol, 3,7-dimethyl-, 3-(2-aminobenzoate) |
| 1206794173 | 1,6-Octadien-3-ol, 3,7-dimethyl-, 3-(2-aminobenzoate) |
| 389082 | 1,8-Naphthyridine-3-carboxylic acid, 1-ethyl-1,4-dihydro-7-methyl-4-oxo- |
| 21297723 | 1-Aza-2-silacyclopentane, 2,2-diethoxy-1-(trimethylsilyl)- |
| 1072522 | 1-Aziridineethanol |
| 109739 | 1-Butanamine |
| 42939720 | 1-Butanamine |
| 50929038 | 1-Butanamine |
| 85404213 | 1-Butanamine |
| 102829 | 1-Butanamine, N,N-dibutyl- |
| 168153193 | 1-Butanamine, N,N-dibutyl- |
| 4444682 | 1-Butanamine, N,N-diethyl- |
| 927628 | 1-Butanamine, N,N-dimethyl- |
| 111922 | 1-Butanamine, N-butyl- |
| 924163 | 1-Butanamine, N-butyl-N-nitroso- |
| 13360639 | 1-Butanamine, N-ethyl- |
| 109795 | 1-Butanethiol |
| 71363 | 1-Butanol |
| 42031196 | 1-Butanol |
| 107569517 | 1-Butanol |
| 220713257 | 1-Butanol |
| 1154866917 | 1-Butanol |
| 609314 | 1-Butanol, 2-nitro- |
| 123513 | 1-Butanol, 3-methyl- |
| 123912 | 1-Butanol, 3-methyl-, 1-acetate |
| 123922 | 1-Butanol, 3-methyl-, 1-acetate |
| 626380 | 1-Butanol, 3-methyl-, 1-acetate |
| 628637 | 1-Butanol, 3-methyl-, 1-acetate |
| 29732501 | 1-Butanol, 3-methyl-, 1-acetate |
| 3817116 | 1-Butanol, 4-(butylnitrosoamino)- |
| 1421632 | 1-Butanone, 1-(2,4,5-trihydroxyphenyl)- |
| 64091914 | 1-Butanone, 4-(methylnitrosoamino)-1-(3-pyridinyl)- |
| 689974 | 1-Buten-3-yne |
| 106989 | 1-Butene |
| 1735757 | 1-Butene |
| 25167673 | 1-Butene |
| 33004023 | 1-Butene |
| 54366073 | 1-Butene |
| 563462 | 1-Butene, 2-methyl- |
| 760236 | 1-Butene, 3,4-dichloro- |
| 64037543 | 1-Butene, 3,4-dichloro- |
| 563451 | 1-Butene, 3-methyl- |
| 107006 | 1-Butyne |
| 7173515 | 1-Decanaminium, N-decyl-N,N-dimethyl-, chloride (1:1) |
| 126851249 | 1-Decanaminium, N-decyl-N,N-dimethyl-, chloride (1:1) |
| 129186136 | 1-Decanaminium, N-decyl-N,N-dimethyl-, chloride (1:1) |
| 154765329 | 1-Decanaminium, N-decyl-N,N-dimethyl-, chloride (1:1) |
| 446279852 | 1-Decanaminium, N-decyl-N,N-dimethyl-, chloride (1:1) |
| 879292510 | 1-Decanaminium, N-decyl-N,N-dimethyl-, chloride (1:1) |
| 143102 | 1-Decanethiol |
| 112301 | 1-Decanol |
| 872059 | 1-Decene |
| 25339531 | 1-Decene |
| 112185 | 1-Dodecanamine, N,N-dimethyl- |
| 52622545 | 1-Dodecanamine, N,N-dimethyl- |
| 83855861 | 1-Dodecanamine, N,N-dimethyl- |
| 352546191 | 1-Dodecanamine, N,N-dimethyl- |
| 1643205 | 1-Dodecanamine, N,N-dimethyl-, N-oxide |
| 73502086 | 1-Dodecanamine, N,N-dimethyl-, N-oxide |
| 135526668 | 1-Dodecanamine, N,N-dimethyl-, N-oxide |
| 160714023 | 1-Dodecanamine, N,N-dimethyl-, N-oxide |
| 163221076 | 1-Dodecanamine, N,N-dimethyl-, N-oxide |
| 177162479 | 1-Dodecanamine, N,N-dimethyl-, N-oxide |
| 209122496 | 1-Dodecanamine, N,N-dimethyl-, N-oxide |
| 244235925 | 1-Dodecanamine, N,N-dimethyl-, N-oxide |
| 311814252 | 1-Dodecanamine, N,N-dimethyl-, N-oxide |
| 607690426 | 1-Dodecanamine, N,N-dimethyl-, N-oxide |
| 112550 | 1-Dodecanethiol |
| 112414 | 1-Dodecene |
| 25378227 | 1-Dodecene |
| 1639094 | 1-Heptanethiol |
| 592767 | 1-Heptene |
| 143271 | 1-Hexadecanamine |
| 28319202 | 1-Hexadecanamine |
| 146997924 | 1-Hexadecanamine |
| 104756 | 1-Hexanamine, 2-ethyl- |
| 114272354 | 1-Hexanamine, 2-ethyl- |
| 106207 | 1-Hexanamine, 2-ethyl-N-(2-ethylhexyl)- |
| 102095261 | 1-Hexanamine, 2-ethyl-N-(2-ethylhexyl)- |
| 143168 | 1-Hexanamine, N-hexyl- |
| 111319 | 1-Hexanethiol |
| 111273 | 1-Hexanol |
| 220713279 | 1-Hexanol |
| 104767 | 1-Hexanol, 2-ethyl- |
| 111675571 | 1-Hexanol, 2-ethyl- |
| 592416 | 1-Hexene |
| 33004045 | 1-Hexene |
| 153522124 | 1-Hexene |
| 36734197 | 1-Imidazolidinecarboxamide, 3-(3,5-dichlorophenyl)-N-(1-methylethyl)-2,4-dioxo- |
| 134327 | 1-Naphthalenamine |
| 12262098 | 1-Naphthalenamine |
| 90302 | 1-Naphthalenamine, N-phenyl- |
| 219315454 | 1-Naphthalenamine, N-phenyl- |
| 2429712 | 1-Naphthalenesulfonic acid, 3,3'-[(3,3'-dimethoxy[1,1'-biphenyl]-4,4'-diyl)bis(2,1-diazenediyl)]bis[4-hydroxy-, sodium salt (1:2) |
| 992596 | 1-Naphthalenesulfonic acid, 3,3'-[(3,3'-dimethyl[1,1'-biphenyl]-4,4'-diyl)bis(2,1-diazenediyl)]bis[4-amino-, sodium salt (1:2) |
| 70248714 | 1-Naphthalenesulfonic acid, 3,3'-[(3,3'-dimethyl[1,1'-biphenyl]-4,4'-diyl)bis(2,1-diazenediyl)]bis[4-amino-, sodium salt (1:2) |
| 179472458 | 1-Naphthalenesulfonic acid, 3,3'-[(3,3'-dimethyl[1,1'-biphenyl]-4,4'-diyl)bis(2,1-diazenediyl)]bis[4-amino-, sodium salt (1:2) |
| 6428940 | 1-Naphthalenesulfonic acid, 4-amino-3-((4'-((1-hydroxy-4-sulfo-2-naphthyl)azo)-3,3'-dimethoxy(1,1'-biphenyl)-4-yl)azo)-, disodium salt |
| 3567699 | 1-Naphthalenesulfonic acid, 4-hydroxy-3-[2-(4-sulfo-1-naphthalenyl)diazenyl]-, sodium salt (1:2) |
| 65721859 | 1-Naphthalenesulfonic acid, 4-hydroxy-3-[2-(4-sulfo-1-naphthalenyl)diazenyl]-, sodium salt (1:2) |
| 161628337 | 1-Naphthalenesulfonic acid, 4-hydroxy-3-[2-(4-sulfo-1-naphthalenyl)diazenyl]-, sodium salt (1:2) |
| 337505212 | 1-Naphthalenesulfonic acid, 4-hydroxy-3-[2-(4-sulfo-1-naphthalenyl)diazenyl]-, sodium salt (1:2) |
| 90153 | 1-Naphthalenol |
| 50356213 | 1-Naphthalenol |
| 63252 | 1-Naphthalenol, 1-(N-methylcarbamate) |
| 11095117 | 1-Naphthalenol, 1-(N-methylcarbamate) |
| 11130475 | 1-Naphthalenol, 1-(N-methylcarbamate) |
| 51274034 | 1-Naphthalenol, 1-(N-methylcarbamate) |
| 52001895 | 1-Naphthalenol, 1-(N-methylcarbamate) |
| 1392204771 | 1-Naphthalenol, 1-(N-methylcarbamate) |
| 1455216 | 1-Nonanethiol |
| 143088 | 1-Nonanol |
| 124118 | 1-Nonene |
| 27215958 | 1-Nonene |
| 124301 | 1-Octadecanamine |
| 1341475 | 1-Octadecanamine |
| 8038606 | 1-Octadecanamine |
| 258339978 | 1-Octadecanamine |
| 457883168 | 1-Octadecanamine |
| 1116763 | 1-Octanamine, N,N-dioctyl- |
| 11120277 | 1-Octanamine, N,N-dioctyl- |
| 12612156 | 1-Octanamine, N,N-dioctyl- |
| 51569029 | 1-Octanamine, N,N-dioctyl- |
| 57176406 | 1-Octanamine, N,N-dioctyl- |
| 111866 | 1-Octanethiol |
| 111886 | 1-Octanethiol |
| 111875 | 1-Octanol |
| 29063283 | 1-Octanol |
| 220713268 | 1-Octanol |
| 111660 | 1-Octene |
| 25377837 | 1-Octene |
| 110587 | 1-Pentanamine |
| 621772 | 1-Pentanamine, N,N-dipentyl- |
| 13256069 | 1-Pentanamine, N-nitroso-N-pentyl- |
| 2050922 | 1-Pentanamine, N-pentyl- |
| 110667 | 1-Pentanethiol |
| 71410 | 1-Pentanol |
| 109671 | 1-Pentene |
| 25377724 | 1-Pentene |
| 33004034 | 1-Pentene |
| 763291 | 1-Pentene, 2-methyl- |
| 691372 | 1-Pentene, 4-methyl- |
| 44390467 | 1-Pentene, 4-methyl- |
| 514103 | 1-Phenanthrenecarboxylic acid, 1,2,3,4,4a,4b,5,6,10,10a-decahydro-1,4a-dimethyl-7-(1-methylethyl)-, (1R,4aR,4bR,10aR)- |
| 72452621 | 1-Phenanthrenecarboxylic acid, 1,2,3,4,4a,4b,5,6,10,10a-decahydro-1,4a-dimethyl-7-(1-methylethyl)-, (1R,4aR,4bR,10aR)- |
| 1740198 | 1-Phenanthrenecarboxylic acid, 1,2,3,4,4a,9,10,10a-octahydro-1,4a-dimethyl-7-(1-methylethyl)-, (1R,4aS,10aR)- |
| 2501271 | 1-Phenanthrenecarboxylic acid, 1,2,3,4,4a,9,10,10a-octahydro-1,4a-dimethyl-7-(1-methylethyl)-, (1R,4aS,10aR)- |
| 35949247 | 1-Phenanthrenecarboxylic acid, 1,2,3,4,4a,9,10,10a-octahydro-1,4a-dimethyl-7-(1-methylethyl)-, (1R,4aS,10aR)- |
| 135577730 | 1-Phenanthrenecarboxylic acid, 1,2,3,4,4a,9,10,10a-octahydro-1,4a-dimethyl-7-(1-methylethyl)-, (1R,4aS,10aR)- |
| 5835267 | 1-Phenanthrenecarboxylic acid, 7-ethenyl-1,2,3,4,4a,4b,5,6,7,8,10,10a-dodecahydro-1,4a,7-trimethyl-, (1R,4aR,4bS,7S,10aR)- |
| 7201527 | 1-Phenanthrenecarboxylic acid, 7-ethenyl-1,2,3,4,4a,4b,5,6,7,8,10,10a-dodecahydro-1,4a,7-trimethyl-, (1R,4aR,4bS,7S,10aR)- |
| 107631594 | 1-Phenanthrenecarboxylic acid, 7-ethenyl-1,2,3,4,4a,4b,5,6,7,8,10,10a-dodecahydro-1,4a,7-trimethyl-, (1R,4aR,4bS,7S,10aR)- |
| 57055386 | 1-Phenanthrenecarboxylic acid, chloro-1,2,3,4,4a,9,10,10a-octahydro-1,4a-dimethyl-7-(1-methylethyl)-, (1R-(1.alpha.,4a.beta.,10a.alpha.))- |
| 57055397 | 1-Phenanthrenecarboxylic acid, dichloro-1,2,3,4,4a,9,10,10a-octahydro-1,4a-dimethyl-7-(1-methylethyl)-, (1R-(1.alpha.,4a.beta.,10a.alpha.))- |
| 1642542 | 1-Piperazinecarboxamide, N,N-diethyl-4-methyl-, 2-hydroxy-1,2,3-propanetricarboxylate (1:1) |
| 2591868 | 1-Piperidinecarboxaldehyde |
| 107108 | 1-Propanamine |
| 42939719 | 1-Propanamine |
| 78819 | 1-Propanamine, 2-methyl- |
| 1116401 | 1-Propanamine, 2-methyl-N,N-bis(2-methylpropyl)- |
| 110963 | 1-Propanamine, 2-methyl-N-(2-methylpropyl)- |
| 919302 | 1-Propanamine, 3-(triethoxysilyl)- |
| 919392 | 1-Propanamine, 3-(triethoxysilyl)- |
| 12738500 | 1-Propanamine, 3-(triethoxysilyl)- |
| 60000977 | 1-Propanamine, 3-(triethoxysilyl)- |
| 71618183 | 1-Propanamine, 3-(triethoxysilyl)- |
| 86836284 | 1-Propanamine, 3-(triethoxysilyl)- |
| 88527611 | 1-Propanamine, 3-(triethoxysilyl)- |
| 96726793 | 1-Propanamine, 3-(triethoxysilyl)- |
| 106096791 | 1-Propanamine, 3-(triethoxysilyl)- |
| 131641775 | 1-Propanamine, 3-(triethoxysilyl)- |
| 143178716 | 1-Propanamine, 3-(triethoxysilyl)- |
| 159778173 | 1-Propanamine, 3-(triethoxysilyl)- |
| 204987586 | 1-Propanamine, 3-(triethoxysilyl)- |
| 449753826 | 1-Propanamine, 3-(triethoxysilyl)- |
| 479401053 | 1-Propanamine, 3-(triethoxysilyl)- |
| 607502716 | 1-Propanamine, 3-(triethoxysilyl)- |
| 875121656 | 1-Propanamine, 3-(triethoxysilyl)- |
| 1020103347 | 1-Propanamine, 3-(triethoxysilyl)- |
| 1392103819 | 1-Propanamine, 3-(triethoxysilyl)- |
| 5397319 | 1-Propanamine, 3-[(2-ethylhexyl)oxy]- |
| 29714543 | 1-Propanamine, 3-[(2-ethylhexyl)oxy]- |
| 76461784 | 1-Propanamine, 3-[(2-ethylhexyl)oxy]- |
| 155634201 | 1-Propanamine, 3-[(2-ethylhexyl)oxy]- |
| 5332730 | 1-Propanamine, 3-methoxy- |
| 102692 | 1-Propanamine, N,N-dipropyl- |
| 112488514 | 1-Propanamine, N,N-dipropyl- |
| 621647 | 1-Propanamine, N-nitroso-N-propyl- |
| 142847 | 1-Propanamine, N-propyl- |
| 3327228 | 1-Propanaminium, 3-chloro-2-hydroxy-N,N,N-trimethyl-, chloride (1:1) |
| 58128362 | 1-Propanaminium, 3-chloro-2-hydroxy-N,N,N-trimethyl-, chloride (1:1) |
| 73935214 | 1-Propanaminium, 3-chloro-2-hydroxy-N,N,N-trimethyl-, chloride (1:1) |
| 101360398 | 1-Propanaminium, 3-chloro-2-hydroxy-N,N,N-trimethyl-, chloride (1:1) |
| 115993130 | 1-Propanaminium, 3-chloro-2-hydroxy-N,N,N-trimethyl-, chloride (1:1) |
| 126845690 | 1-Propanaminium, 3-chloro-2-hydroxy-N,N,N-trimethyl-, chloride (1:1) |
| 181939297 | 1-Propanaminium, 3-chloro-2-hydroxy-N,N,N-trimethyl-, chloride (1:1) |
| 1331834628 | 1-Propanaminium, 3-chloro-2-hydroxy-N,N,N-trimethyl-, chloride (1:1) |
| 107039 | 1-Propanethiol |
| 71238 | 1-Propanol |
| 96139 | 1-Propanol, 2,3-dibromo- |
| 116499753 | 1-Propanol, 2,3-dibromo- |
| 204570161 | 1-Propanol, 2,3-dibromo- |
| 126727 | 1-Propanol, 2,3-dibromo-, 1,1',1''-phosphate |
| 1867147 | 1-Propanol, 2,3-dibromo-, 1,1',1''-phosphate |
| 55962486 | 1-Propanol, 2,3-dibromo-, 1,1',1''-phosphate |
| 68112301 | 1-Propanol, 2,3-dibromo-, 1,1',1''-phosphate |
| 1228931665 | 1-Propanol, 2,3-dibromo-, 1,1',1''-phosphate |
| 616239 | 1-Propanol, 2,3-dichloro- |
| 82890220 | 1-Propanol, 2,3-dichloro- |
| 59529 | 1-Propanol, 2,3-dimercapto- |
| 31855411 | 1-Propanol, 2,3-dimercapto- |
| 81600568 | 1-Propanol, 2,3-dimercapto- |
| 98923194 | 1-Propanol, 2,3-dimercapto- |
| 78897 | 1-Propanol, 2-chloro- |
| 60828606 | 1-Propanol, 2-chloro- |
| 1253945515 | 1-Propanol, 2-chloro- |
| 78831 | 1-Propanol, 2-methyl- |
| 94519 | 1-Propanol, 3,3'-oxybis-, dibenzoate |
| 627189 | 1-Propanol, 3-bromo- |
| 1522925 | 1-Propanol, 3-bromo-2,2-bis(bromomethyl)- |
| 627305 | 1-Propanol, 3-chloro- |
| 1067987 | 1-Propanol, 3-chloro-, phosphate (3:1) |
| 111353 | 1-Propanol, 3-ethoxy- |
| 20702776 | 1-Propanone, 1-[4-[[2-O-(6-deoxy-.alpha.-L-mannopyranosyl)-.beta.-D-glucopyranosyl]oxy]-2,6-dihydroxyphenyl]-3-(3-hydroxy-4-methoxyphenyl)- |
| 115071 | 1-Propene |
| 676631 | 1-Propene |
| 33004012 | 1-Propene |
| 1888717 | 1-Propene, 1,1,2,3,3,3-hexachloro- |
| 10436392 | 1-Propene, 1,1,2,3-tetrachloro- |
| 563586 | 1-Propene, 1,1-dichloro- |
| 563542 | 1-Propene, 1,2-dichloro- |
| 7069387 | 1-Propene, 1,2-dichloro-, (1E)- |
| 78875 | 1-Propene, 1,3-dichloro- |
| 542756 | 1-Propene, 1,3-dichloro- |
| 8022762 | 1-Propene, 1,3-dichloro- |
| 68525586 | 1-Propene, 1,3-dichloro- |
| 10061026 | 1-Propene, 1,3-dichloro-, (1E)- |
| 542756 | 1-Propene, 1,3-dichloro-, (Z)- |
| 10061015 | 1-Propene, 1,3-dichloro-, (Z)- |
| 590216 | 1-Propene, 1-chloro- |
| 513371 | 1-Propene, 1-chloro-2-methyl- |
| 78886 | 1-Propene, 2,3-dichloro- |
| 557982 | 1-Propene, 2-chloro- |
| 115117 | 1-Propene, 2-methyl- |
| 382105 | 1-Propene, 3,3,3-trifluoro-2-(trifluoromethyl)- |
| 107051 | 1-Propene, 3-chloro- |
| 107186 | 1-Propene, 3-chloro- |
| 563473 | 1-Propene, 3-chloro-2-methyl- |
| 57067 | 1-Propene, 3-isothiocyanato- |
| 8007407 | 1-Propene, 3-isothiocyanato- |
| 50888647 | 1-Propene, 3-isothiocyanato- |
| 50978488 | 1-Propene, 3-isothiocyanato- |
| 58391870 | 1-Propene, 3-isothiocyanato- |
| 107231301 | 1-Propene, 3-isothiocyanato- |
| 9003070 | 1-Propene, homopolymer |
| 9044591 | 1-Propene, homopolymer |
| 37329036 | 1-Propene, homopolymer |
| 37370573 | 1-Propene, homopolymer |
| 52440183 | 1-Propene, homopolymer |
| 52622647 | 1-Propene, homopolymer |
| 53664327 | 1-Propene, homopolymer |
| 58318959 | 1-Propene, homopolymer |
| 60440688 | 1-Propene, homopolymer |
| 73989501 | 1-Propene, homopolymer |
| 76560786 | 1-Propene, homopolymer |
| 95751294 | 1-Propene, homopolymer |
| 104625254 | 1-Propene, homopolymer |
| 112024687 | 1-Propene, homopolymer |
| 112327421 | 1-Propene, homopolymer |
| 112821100 | 1-Propene, homopolymer |
| 122933373 | 1-Propene, homopolymer |
| 123243049 | 1-Propene, homopolymer |
| 131801188 | 1-Propene, homopolymer |
| 132823575 | 1-Propene, homopolymer |
| 133757661 | 1-Propene, homopolymer |
| 139465751 | 1-Propene, homopolymer |
| 143710365 | 1-Propene, homopolymer |
| 144855914 | 1-Propene, homopolymer |
| 148464771 | 1-Propene, homopolymer |
| 150261044 | 1-Propene, homopolymer |
| 156680705 | 1-Propene, homopolymer |
| 159074972 | 1-Propene, homopolymer |
| 162731353 | 1-Propene, homopolymer |
| 169741702 | 1-Propene, homopolymer |
| 170346993 | 1-Propene, homopolymer |
| 171903392 | 1-Propene, homopolymer |
| 178535676 | 1-Propene, homopolymer |
| 181232122 | 1-Propene, homopolymer |
| 186777480 | 1-Propene, homopolymer |
| 201873769 | 1-Propene, homopolymer |
| 215369918 | 1-Propene, homopolymer |
| 220286704 | 1-Propene, homopolymer |
| 221350750 | 1-Propene, homopolymer |
| 223461981 | 1-Propene, homopolymer |
| 262610593 | 1-Propene, homopolymer |
| 268745659 | 1-Propene, homopolymer |
| 286465972 | 1-Propene, homopolymer |
| 301161999 | 1-Propene, homopolymer |
| 313378448 | 1-Propene, homopolymer |
| 313471920 | 1-Propene, homopolymer |
| 343259030 | 1-Propene, homopolymer |
| 349655636 | 1-Propene, homopolymer |
| 368887790 | 1-Propene, homopolymer |
| 391599578 | 1-Propene, homopolymer |
| 399509343 | 1-Propene, homopolymer |
| 425369262 | 1-Propene, homopolymer |
| 439608932 | 1-Propene, homopolymer |
| 457057497 | 1-Propene, homopolymer |
| 582300707 | 1-Propene, homopolymer |
| 796853322 | 1-Propene, homopolymer |
| 848784134 | 1-Propene, homopolymer |
| 868670762 | 1-Propene, homopolymer |
| 875121178 | 1-Propene, homopolymer |
| 883306976 | 1-Propene, homopolymer |
| 890309258 | 1-Propene, homopolymer |
| 928298833 | 1-Propene, homopolymer |
| 929710907 | 1-Propene, homopolymer |
| 958447308 | 1-Propene, homopolymer |
| 1007233353 | 1-Propene, homopolymer |
| 1072914170 | 1-Propene, homopolymer |
| 1084698598 | 1-Propene, homopolymer |
| 1161009626 | 1-Propene, homopolymer |
| 1170942230 | 1-Propene, homopolymer |
| 1187015719 | 1-Propene, homopolymer |
| 1292821556 | 1-Propene, homopolymer |
| 1365635762 | 1-Propene, homopolymer |
| 1365657506 | 1-Propene, homopolymer |
| 1428902811 | 1-Propene, homopolymer |
| 1429741592 | 1-Propene, homopolymer |
| 1449076612 | 1-Propene, homopolymer |
| 74997 | 1-Propyne |
| 369597386 | 1-Propyne |
| 106967 | 1-Propyne, 3-bromo- |
| 1009031473 | 1-Propyne, 3-bromo- |
| 1187488614 | 1-Propyne, 3-bromo- |
| 1606673 | 1-Pyrenamine |
| 1087757036 | 1-Pyrenamine |
| 1120361 | 1-Tetradecene |
| 26952136 | 1-Tetradecene |
| 136356 | 1-Triazene, 1,3-diphenyl- |
| 7227910 | 1-Triazene, 3,3-dimethyl-1-phenyl- |
| 2437561 | 1-Tridecene |
| 25377826 | 1-Tridecene |
| 112425 | 1-Undecanol |
| 821954 | 1-Undecene |
| 28761275 | 1-Undecene |
| 34580137 | 10H-Benzo[4,5]cyclohepta[1,2-b]thiophen-10-one, 4,9-dihydro-4-(1-methyl-4-piperidinylidene)- |
| 92842 | 10H-Phenothiazine |
| 8023301 | 10H-Phenothiazine |
| 8048224 | 10H-Phenothiazine |
| 1982372 | 10H-Phenothiazine, 10-[(1-methyl-3-pyrrolidinyl)methyl]- |
| 1229352 | 10H-Phenothiazine, 10-[(1-methyl-3-pyrrolidinyl)methyl]-, monohydrochloride |
| 60877 | 10H-Phenothiazine-10-ethanamine, N,N,.alpha.-trimethyl- |
| 73745503 | 10H-Phenothiazine-10-ethanamine, N,N,.alpha.-trimethyl- |
| 58333 | 10H-Phenothiazine-10-ethanamine, N,N,.alpha.-trimethyl-, hydrochloride (1:1) |
| 16639386 | 10H-Phenothiazine-10-ethanamine, N,N,.alpha.-trimethyl-, hydrochloride (1:1) |
| 88208280 | 10H-Phenothiazine-10-ethanamine, N,N,.alpha.-trimethyl-, hydrochloride (1:1) |
| 69090 | 10H-Phenothiazine-10-propanamine, 2-chloro-N,N-dimethyl-, hydrochloride (1:1) |
| 58366 | 10H-Phenoxarsine, 10,10'-oxybis- |
| 53923276 | 10H-Phenoxarsine, 10,10'-oxybis- |
| 64684282 | 10H-Phenoxarsine, 10,10'-oxybis- |
| 64887101 | 10H-Phenoxarsine, 10,10'-oxybis- |
| 107391695 | 10H-Phenoxarsine, 10,10'-oxybis- |
| 115728295 | 10H-Phenoxarsine, 10,10'-oxybis- |
| 6533002 | 18,19-Dinorpregn-4-en-20-yn-3-one, 13-ethyl-17-hydroxy-, (17alpha)-(+-)- |
| 52766 | 19-Norpregn-4-en-20-yn-17-ol, (17.alpha.)- |
| 60416162 | 19-Norpregn-4-en-20-yn-17-ol, (17.alpha.)- |
| 68224 | 19-Norpregn-4-en-20-yn-3-one, 17-hydroxy-, (17.alpha.)- |
| 297767 | 19-Norpregn-4-en-20-yne-3,17-diol, diacetate, (3.beta.,17.alpha.)- |
| 68234 | 19-Norpregn-5(10)-en-20-yn-3-one, 17-hydroxy-, (17.alpha.)- |
| 68235 | 19-Norpregn-5(10)-en-20-yn-3-one, 17-hydroxy-, (17.alpha.)- |
| 72333 | 19-Norpregna-1,3,5(10)-trien-20-yn-17-ol, 3-methoxy-, (17.alpha.)- |
| 57636 | 19-Norpregna-1,3,5(10)-trien-20-yne-3,17-diol, (17.alpha.)- |
| 77538568 | 19-Norpregna-1,3,5(10)-trien-20-yne-3,17-diol, (17.alpha.)- |
| 406932932 | 19-Norpregna-1,3,5(10)-trien-20-yne-3,17-diol, (17.alpha.)- |
| 1050678653 | 19-Norpregna-1,3,5(10)-trien-20-yne-3,17-diol, (17.alpha.)- |
| 7241987 | 1H,12H-Furo[3',2':4,5]furo[2,3-h]pyrano[3,4-c][1]benzopyran-1,12-dione, 3,4,7a,9,10,10a-hexahydro-5-methoxy-, (7aR,10aS)- |
| 61825 | 1H-1,2,4-Triazol-5-amine |
| 155259 | 1H-1,2,4-Triazol-5-amine |
| 6051758 | 1H-1,2,4-Triazol-5-amine |
| 11121009 | 1H-1,2,4-Triazol-5-amine |
| 16681746 | 1H-1,2,4-Triazol-5-amine |
| 29212826 | 1H-1,2,4-Triazol-5-amine |
| 30922306 | 1H-1,2,4-Triazol-5-amine |
| 63598721 | 1H-1,2,4-Triazol-5-amine |
| 64598238 | 1H-1,2,4-Triazol-5-amine |
| 151517463 | 1H-1,2,4-Triazol-5-amine |
| 1057722436 | 1H-1,2,4-Triazol-5-amine |
| 60207901 | 1H-1,2,4-Triazole, 1-[[2-(2,4-dichlorophenyl)-4-propyl-1,3-dioxolan-2-yl]methyl]- |
| 75881822 | 1H-1,2,4-Triazole, 1-[[2-(2,4-dichlorophenyl)-4-propyl-1,3-dioxolan-2-yl]methyl]- |
| 125407525 | 1H-1,2,4-Triazole, 1-[[2-(2,4-dichlorophenyl)-4-propyl-1,3-dioxolan-2-yl]methyl]- |
| 181591673 | 1H-1,2,4-Triazole, 1-[[2-(2,4-dichlorophenyl)-4-propyl-1,3-dioxolan-2-yl]methyl]- |
| 85509199 | 1H-1,2,4-Triazole, 1-[[bis(4-fluorophenyl)methylsilyl]methyl]- |
| 96827348 | 1H-1,2,4-Triazole, 1-[[bis(4-fluorophenyl)methylsilyl]methyl]- |
| 80443410 | 1H-1,2,4-Triazole-1-ethanol, .alpha.-[2-(4-chlorophenyl)ethyl]-.alpha.-(1,1-dimethylethyl)- |
| 107534963 | 1H-1,2,4-Triazole-1-ethanol, .alpha.-[2-(4-chlorophenyl)ethyl]-.alpha.-(1,1-dimethylethyl)- |
| 88671890 | 1H-1,2,4-Triazole-1-propanenitrile, .alpha.-butyl-.alpha.-(4-chlorophenyl)- |
| 96281504 | 1H-1,2,4-Triazole-1-propanenitrile, .alpha.-butyl-.alpha.-(4-chlorophenyl)- |
| 154144931 | 1H-1,2,4-Triazole-1-propanenitrile, .alpha.-butyl-.alpha.-(4-chlorophenyl)- |
| 205862697 | 1H-1,2,4-Triazole-1-propanenitrile, .alpha.-butyl-.alpha.-(4-chlorophenyl)- |
| 503888 | 1H-1,2,4-Triazole-3,5-diamine |
| 1455772 | 1H-1,2,4-Triazole-3,5-diamine |
| 12705054 | 1H-2,1,3-Benzothiadiazin-4(3H)-one, 3-(1-methylethyl)-, 2,2-dioxide |
| 21723400 | 1H-2,1,3-Benzothiadiazin-4(3H)-one, 3-(1-methylethyl)-, 2,2-dioxide |
| 25057890 | 1H-2,1,3-Benzothiadiazin-4(3H)-one, 3-(1-methylethyl)-, 2,2-dioxide |
| 58856829 | 1H-2,1,3-Benzothiadiazin-4(3H)-one, 3-(1-methylethyl)-, 2,2-dioxide |
| 17924924 | 1H-2-Benzoxacyclotetradecin-1,7(8H)-dione, 3,4,5,6,9,10-hexahydro-14,16-dihydroxy-3-methyl-, (3S,11E)- |
| 18695288 | 1H-2-Benzoxacyclotetradecin-1,7(8H)-dione, 3,4,5,6,9,10-hexahydro-14,16-dihydroxy-3-methyl-, (3S,11E)- |
| 2212671 | 1H-Azepine-1-carbothioic acid, hexahydro-, S-ethyl ester |
| 934327 | 1H-Benzimidazol-2-amine |
| 144704994 | 1H-Benzimidazol-2-amine |
| 51172 | 1H-Benzimidazole |
| 25463256 | 1H-Benzimidazole |
| 79351716 | 1H-Benzimidazole |
| 116421273 | 1H-Benzimidazole |
| 3878191 | 1H-Benzimidazole, 2-(2-furanyl)- |
| 148798 | 1H-Benzimidazole, 2-(4-thiazolyl)- |
| 8018040 | 1H-Benzimidazole, 2-(4-thiazolyl)- |
| 8027109 | 1H-Benzimidazole, 2-(4-thiazolyl)- |
| 8028271 | 1H-Benzimidazole, 2-(4-thiazolyl)- |
| 94977067 | 1H-Benzimidazole, 2-(4-thiazolyl)- |
| 98002427 | 1H-Benzimidazole, 2-(4-thiazolyl)- |
| 123242331 | 1H-Benzimidazole, 2-(4-thiazolyl)- |
| 145316672 | 1H-Benzimidazole, 2-(4-thiazolyl)- |
| 1135441278 | 1H-Benzimidazole, 2-(4-thiazolyl)- |
| 94520 | 1H-Benzimidazole, 6-nitro- |
| 89843470 | 1H-Benzimidazole, 6-nitro- |
| 95147 | 1H-Benzotriazole |
| 25377815 | 1H-Benzotriazole |
| 27556510 | 1H-Benzotriazole |
| 28880015 | 1H-Benzotriazole |
| 70644745 | 1H-Benzotriazole |
| 83202919 | 1H-Benzotriazole |
| 94160697 | 1H-Benzotriazole |
| 115773983 | 1H-Benzotriazole |
| 116421319 | 1H-Benzotriazole |
| 152206503 | 1H-Benzotriazole |
| 197463084 | 1H-Benzotriazole |
| 1334724967 | 1H-Benzotriazole |
| 3663249 | 1H-Benzotriazole, 5-butyl- |
| 29385431 | 1H-Benzotriazole, 6(or 7)-methyl- |
| 39327112 | 1H-Benzotriazole, 6(or 7)-methyl- |
| 39410703 | 1H-Benzotriazole, 6(or 7)-methyl- |
| 42441656 | 1H-Benzotriazole, 6(or 7)-methyl- |
| 82467354 | 1H-Benzotriazole, 6(or 7)-methyl- |
| 197463095 | 1H-Benzotriazole, 6(or 7)-methyl- |
| 22144770 | 1H-Cycloundec[d]isoindole-1,11(2H)-dione, 15-(acetyloxy)-3,3a,4,5,6,6a,9,10,12,15-decahydro-6,12-dihydroxy-4,10,12-trimethyl-5-methylene-3-(phenylmethyl)-, (3S,3aR,4S,6S,6aR,7E,10S,12R,13E,15R,15aR)- |
| 35554440 | 1H-Imidazole, 1-[2-(2,4-dichlorophenyl)-2-(2-propenyloxy)ethyl]- |
| 51004467 | 1H-Imidazole, 1-[2-(2,4-dichlorophenyl)-2-(2-propenyloxy)ethyl]- |
| 73790280 | 1H-Imidazole, 1-[2-(2,4-dichlorophenyl)-2-(2-propenyloxy)ethyl]- |
| 24169026 | 1H-Imidazole, 1-[2-[(4-chlorophenyl)methoxy]-2-(2,4-dichlorophenyl)ethyl]-, mononitrate |
| 556229 | 1H-Imidazole, 2-heptadecyl-4,5-dihydro-, acetate (1:1) |
| 100016602 | 1H-Imidazole, 2-heptadecyl-4,5-dihydro-, acetate (1:1) |
| 137955727 | 1H-Imidazole, 2-heptadecyl-4,5-dihydro-, acetate (1:1) |
| 95192 | 1H-Imidazole-1-ethanol, 2-heptadecyl-4,5-dihydro- |
| 1330887 | 1H-Imidazole-1-ethanol, 2-heptadecyl-4,5-dihydro- |
| 37349067 | 1H-Imidazole-1-ethanol, 2-heptadecyl-4,5-dihydro- |
| 50957783 | 1H-Imidazole-1-ethanol, 2-heptadecyl-4,5-dihydro- |
| 53466914 | 1H-Imidazole-1-ethanol, 2-heptadecyl-4,5-dihydro- |
| 74551603 | 1H-Imidazole-1-ethanol, 2-heptadecyl-4,5-dihydro- |
| 443481 | 1H-Imidazole-1-ethanol, 2-methyl-5-nitro- |
| 133884001 | 1H-Imidazole-1-ethanol, 2-methyl-5-nitro- |
| 83857969 | 1H-Imidazole-4-carboxaldehyde, 2-butyl-5-chloro- |
| 4342034 | 1H-Imidazole-4-carboxamide, 5-(3,3-dimethyl-1-triazenyl)- |
| 95136 | 1H-Indene |
| 95316 | 1H-Indene |
| 485472 | 1H-Indene-1,3(2H)-dione, 2,2-dihydroxy- |
| 83261 | 1H-Indene-1,3(2H)-dione, 2-(2,2-dimethyl-1-oxopropyl)- |
| 82666 | 1H-Indene-1,3(2H)-dione, 2-(diphenylacetyl)- |
| 3691358 | 1H-Indene-1,3(2H)-dione, 2-[(4-chlorophenyl)phenylacetyl]- |
| 53861 | 1H-Indole-3-acetic acid, 1-(4-chlorobenzoyl)-5-methoxy-2-methyl- |
| 37242436 | 1H-Indole-3-acetic acid, 1-(4-chlorobenzoyl)-5-methoxy-2-methyl- |
| 91853746 | 1H-Indole-3-acetic acid, 1-(4-chlorobenzoyl)-5-methoxy-2-methyl- |
| 503560734 | 1H-Indole-3-acetic acid, 1-(4-chlorobenzoyl)-5-methoxy-2-methyl- |
| 80789748 | 1H-Indole-5-sulfonic acid, 2,3-dihydro-2,3-dioxo-, monosodium salt |
| 860220 | 1H-Indole-5-sulfonic acid, 2-(1,3-dihydro-3-oxo-5-sulfo-2H-indol-2-ylidene)-2,3-dihydro-3-oxo-, sodium salt (1:2) |
| 85416 | 1H-Isoindole-1,3(2H)-dione |
| 32588764 | 1H-Isoindole-1,3(2H)-dione, 2,2'-(1,2-ethanediyl)bis[4,5,6,7-tetrabromo- |
| 66797351 | 1H-Isoindole-1,3(2H)-dione, 2,2'-(1,2-ethanediyl)bis[4,5,6,7-tetrabromo- |
| 50351 | 1H-Isoindole-1,3(2H)-dione, 2-(2,6-dioxo-3-piperidinyl)- |
| 19246221 | 1H-Isoindole-1,3(2H)-dione, 2-(2,6-dioxo-3-pyridinyl)hexahydro- |
| 17796826 | 1H-Isoindole-1,3(2H)-dione, 2-(cyclohexylthio)- |
| 133073 | 1H-Isoindole-1,3(2H)-dione, 2-[(trichloromethyl)thio]- |
| 52306339 | 1H-Isoindole-1,3(2H)-dione, 2-[(trichloromethyl)thio]- |
| 1135442817 | 1H-Isoindole-1,3(2H)-dione, 2-[(trichloromethyl)thio]- |
| 41663847 | 1H-Isoindole-1,3(2H)-dione, 2-methyl-5-nitro- |
| 2425061 | 1H-Isoindole-1,3(2H)-dione, 3a,4,7,7a-tetrahydro-2-[(1,1,2,2-tetrachloroethyl)thio]- |
| 2939802 | 1H-Isoindole-1,3(2H)-dione, 3a,4,7,7a-tetrahydro-2-[(1,1,2,2-tetrachloroethyl)thio]- |
| 30017051 | 1H-Isoindole-1,3(2H)-dione, 3a,4,7,7a-tetrahydro-2-[(1,1,2,2-tetrachloroethyl)thio]- |
| 61913120 | 1H-Isoindole-1,3(2H)-dione, 3a,4,7,7a-tetrahydro-2-[(1,1,2,2-tetrachloroethyl)thio]- |
| 133062 | 1H-Isoindole-1,3(2H)-dione, 3a,4,7,7a-tetrahydro-2-[(trichloromethyl)thio]- |
| 1321422 | 1H-Isoindole-1,3(2H)-dione, 3a,4,7,7a-tetrahydro-2-[(trichloromethyl)thio]- |
| 37335152 | 1H-Isoindole-1,3(2H)-dione, 3a,4,7,7a-tetrahydro-2-[(trichloromethyl)thio]- |
| 120528258 | 1H-Isoindole-1,3(2H)-dione, 3a,4,7,7a-tetrahydro-2-[(trichloromethyl)thio]- |
| 89407 | 1H-Isoindole-1,3(2H)-dione, 5-nitro- |
| 27813214 | 1H-Isoindole-1,3(2H)-dione, tetrahydro- |
| 446866 | 1H-Purine, 6-[(1-methyl-4-nitro-1H-imidazol-5-yl)thio]- |
| 58082 | 1H-Purine-2,6-dione, 3,7-dihydro-1,3,7-trimethyl- |
| 71701025 | 1H-Purine-2,6-dione, 3,7-dihydro-1,3,7-trimethyl- |
| 95789132 | 1H-Purine-2,6-dione, 3,7-dihydro-1,3,7-trimethyl- |
| 83670 | 1H-Purine-2,6-dione, 3,7-dihydro-3,7-dimethyl- |
| 58559 | 1H-Purine-2,6-dione, 3,9-dihydro-1,3-dimethyl- |
| 46157000 | 1H-Purine-2,6-dione, 3,9-dihydro-1,3-dimethyl- |
| 56645320 | 1H-Purine-2,6-dione, 3,9-dihydro-1,3-dimethyl- |
| 75448532 | 1H-Purine-2,6-dione, 3,9-dihydro-1,3-dimethyl- |
| 111079493 | 1H-Purine-2,6-dione, 3,9-dihydro-1,3-dimethyl- |
| 479185 | 1H-Purine-2,6-dione, 7-(2,3-dihydroxypropyl)-3,7-dihydro-1,3-dimethyl- |
| 52756533 | 1H-Purine-2,6-dione, 7-(2,3-dihydroxypropyl)-3,7-dihydro-1,3-dimethyl- |
| 68350709 | 1H-Purine-2,6-dione, 7-(2,3-dihydroxypropyl)-3,7-dihydro-1,3-dimethyl- |
| 523875 | 1H-Purine-2,6-dione, 8-chloro-3,7-dihydro-1,3-dimethyl-, compd. with 2-(diphenylmethoxy)-N,N-dimethylethanamine (1:1) |
| 133294221 | 1H-Purine-2,6-dione, 8-chloro-3,7-dihydro-1,3-dimethyl-, compd. with 2-(diphenylmethoxy)-N,N-dimethylethanamine (1:1) |
| 147944 | 2(1H)-Pyrimidinone, 4-amino-1-.beta.-D-arabinofuranosyl- |
| 69749 | 2(1H)-Pyrimidinone, 4-amino-1-.beta.-D-arabinofuranosyl-, monohydrochloride |
| 67485294 | 2(1H)-Pyrimidinone, tetrahydro-5,5-dimethyl-, [3-[4-(trifluoromethyl)phenyl]-1-[2-[4-(trifluoromethyl)phenyl]ethenyl]-2-propenylidene]hydrazone |
| 70829128 | 2(1H)-Pyrimidinone, tetrahydro-5,5-dimethyl-, [3-[4-(trifluoromethyl)phenyl]-1-[2-[4-(trifluoromethyl)phenyl]ethenyl]-2-propenylidene]hydrazone |
| 149304 | 2(3H)-Benzothiazolethione |
| 1321080 | 2(3H)-Benzothiazolethione |
| 4464588 | 2(3H)-Benzothiazolethione |
| 12640903 | 2(3H)-Benzothiazolethione |
| 55199934 | 2(3H)-Benzothiazolethione |
| 81605654 | 2(3H)-Benzothiazolethione |
| 112242838 | 2(3H)-Benzothiazolethione |
| 119170411 | 2(3H)-Benzothiazolethione |
| 2492264 | 2(3H)-Benzothiazolethione, sodium salt (1:1) |
| 26249014 | 2(3H)-Benzothiazolethione, sodium salt (1:1) |
| 106691707 | 2(3H)-Benzothiazolethione, sodium salt (1:1) |
| 1208900177 | 2(3H)-Benzothiazolethione, sodium salt (1:1) |
| 95250 | 2(3H)-Benzoxazolone, 5-chloro- |
| 32850843 | 2(3H)-Benzoxazolone, 5-chloro- |
| 96480 | 2(3H)-Furanone, dihydro- |
| 187997166 | 2(3H)-Furanone, dihydro- |
| 1462535 | 2,2'-Bioxirane |
| 1464535 | 2,2'-Bioxirane |
| 298180 | 2,2'-Bioxirane, (2R,2'R)-rel- |
| 57716 | 2,3-Butanedione, 2-oxime |
| 66751 | 2,4(1H,3H)-Pyrimidinedione, 5-[bis(2-chloroethyl)amino]- |
| 314409 | 2,4(1H,3H)-Pyrimidinedione, 5-bromo-6-methyl-3-(1-methylpropyl)- |
| 154670129 | 2,4(1H,3H)-Pyrimidinedione, 5-bromo-6-methyl-3-(1-methylpropyl)- |
| 53404196 | 2,4(1H,3H)-Pyrimidinedione, 5-bromo-6-methyl-3-(1-methylpropyl)-, lithium salt (1:1) |
| 5902512 | 2,4(1H,3H)-Pyrimidinedione, 5-chloro-3-(1,1-dimethylethyl)-6-methyl- |
| 51218 | 2,4(1H,3H)-Pyrimidinedione, 5-fluoro- |
| 1004031 | 2,4(1H,3H)-Pyrimidinedione, 5-fluoro- |
| 4921975 | 2,4(1H,3H)-Pyrimidinedione, 5-fluoro- |
| 79108013 | 2,4(1H,3H)-Pyrimidinedione, 5-fluoro- |
| 2244113 | 2,4,5,6(1H,3H)-Pyrimidinetetrone, monohydrate |
| 3237501 | 2,4,5,6(1H,3H)-Pyrimidinetetrone, monohydrate |
| 309364 | 2,4,6(1H,3H,5H)-Pyrimidinetrione, 1-methyl-5-(1-methyl-2-pentynyl)-5-(2-propenyl)-, sodium salt |
| 50715 | 2,4,6(1H,3H,5H)-Pyrimidinetrione, 5,5-dihydroxy- |
| 2244113 | 2,4,6(1H,3H,5H)-Pyrimidinetrione, 5,5-dihydroxy- |
| 3237501 | 2,4,6(1H,3H,5H)-Pyrimidinetrione, 5,5-dihydroxy- |
| 57330 | 2,4,6(1H,3H,5H)-Pyrimidinetrione, 5-ethyl-5-(1-methylbutyl)-, monosodium salt |
| 8023118 | 2,4,6(1H,3H,5H)-Pyrimidinetrione, 5-ethyl-5-(1-methylbutyl)-, monosodium salt |
| 8050995 | 2,4,6(1H,3H,5H)-Pyrimidinetrione, 5-ethyl-5-(1-methylbutyl)-, monosodium salt |
| 10579814 | 2,4,6(1H,3H,5H)-Pyrimidinetrione, 5-ethyl-5-(1-methylbutyl)-, monosodium salt |
| 23714570 | 2,4,6(1H,3H,5H)-Pyrimidinetrione, 5-ethyl-5-(1-methylbutyl)-, monosodium salt |
| 57432 | 2,4,6(1H,3H,5H)-Pyrimidinetrione, 5-ethyl-5-(3-methylbutyl)- |
| 50066 | 2,4,6(1H,3H,5H)-Pyrimidinetrione, 5-ethyl-5-phenyl- |
| 13366739 | 2,4,6-Metheno-2H-cyclopenta[4,5]pentaleno[1,2-b]oxirene, 2a,3,3,4,5,5a-hexachlorodecahydro-, (1aR,1bR,2S,2aS,4R,5S,5aS,5bS,6S,6aS,7R)- |
| 396010 | 2,4,7-Pteridinetriamine, 6-phenyl- |
| 118525 | 2,4-Imidazolidinedione, 1,3-dichloro-5,5-dimethyl- |
| 67209 | 2,4-Imidazolidinedione, 1-[[(5-nitro-2-furanyl)methylene]amino]- |
| 7261974 | 2,4-Imidazolidinedione, 1-[[[5-(4-nitrophenyl)-2-furanyl]methylene]amino]- |
| 77714 | 2,4-Imidazolidinedione, 5,5-dimethyl- |
| 57410 | 2,4-Imidazolidinedione, 5,5-diphenyl- |
| 125597 | 2,4-Imidazolidinedione, 5,5-diphenyl- |
| 50124 | 2,4-Imidazolidinedione, 5-ethyl-3-methyl-5-phenyl- |
| 50471448 | 2,4-Oxazolidinedione, 3-(3,5-dichlorophenyl)-5-ethenyl-5-methyl- |
| 107378494 | 2,4-Oxazolidinedione, 3-(3,5-dichlorophenyl)-5-ethenyl-5-methyl- |
| 2608482 | 2,4-Pentadienal, 5-(4-nitrophenyl)- |
| 34807415 | 2,4-Pentadienoic acid, 5-phenyl-, (2S,3aR,3bS,3cS,4aR,5S,5aS,8aR,8bR,9R,10R,10aS)-3a,3b,3c,4a,5,5a,8a,9,10,10a-decahydro-5,5a-dihydroxy-4a-(hydroxymethyl)-7,9-dimethyl-10a-(1-methylethenyl)-6-oxo-2-phenyl-6H-2,8b-epoxyoxireno(6,7)azulene(5,4-e)-1,3-benzodioxol-10-yl ester, (2E,4E)- |
| 107415 | 2,4-Pentanediol, 2-methyl- |
| 99113754 | 2,4-Pentanediol, 2-methyl- |
| 123546 | 2,4-Pentanedione |
| 81235327 | 2,4-Pentanedione |
| 58140 | 2,4-Pyrimidinediamine, 5-(4-chlorophenyl)-6-ethyl- |
| 738705 | 2,4-Pyrimidinediamine, 5-[(3,4,5-trimethoxyphenyl)methyl]- |
| 53494705 | 2,5,7-Metheno-3H-cyclopenta[a]pentalen-3-one, 3b,4,5,6,6,6a-hexachlorodecahydro-, (2R,3aR,3bS,4R,5R,6aS,7S,7aR,8R)-rel- |
| 112492 | 2,5,8,11-Tetraoxadodecane |
| 70992857 | 2,5,8,11-Tetraoxadodecane |
| 106514 | 2,5-Cyclohexadiene-1,4-dione |
| 105113 | 2,5-Cyclohexadiene-1,4-dione, 1,4-dioxime |
| 68768 | 2,5-Cyclohexadiene-1,4-dione, 2,3,5-tris(1-aziridinyl)- |
| 8059323 | 2,5-Cyclohexadiene-1,4-dione, 2,3,5-tris(1-aziridinyl)- |
| 108316 | 2,5-Furandione |
| 24937722 | 2,5-Furandione |
| 184288311 | 2,5-Furandione |
| 1190407738 | 2,5-Furandione |
| 1229972046 | 2,5-Furandione |
| 1380217402 | 2,5-Furandione |
| 19780111 | 2,5-Furandione, 3-(2-dodecen-1-yl)dihydro- |
| 1338799033 | 2,5-Furandione, 3-(2-dodecen-1-yl)dihydro- |
| 108305 | 2,5-Furandione, dihydro- |
| 1123596586 | 2,5-Furandione, dihydro- |
| 1024573 | 2,5-Methano-2H-indeno[1,2-b]oxirene, 2,3,4,5,6,7,7-heptachloro-1a,1b,5,5a,6,6a-hexahydro-,(1aR,1bS,2R,5S,5aR,6S,6aR)-rel- |
| 4067305 | 2,5-Methano-2H-indeno[1,2-b]oxirene, 2,3,4,5,6,7,7-heptachloro-1a,1b,5,5a,6,6a-hexahydro-,(1aR,1bS,2R,5S,5aR,6S,6aR)-rel- |
| 24699421 | 2,5-Methano-2H-indeno[1,2-b]oxirene, 2,3,4,5,6,7,7-heptachloro-1a,1b,5,5a,6,6a-hexahydro-,(1aR,1bS,2R,5S,5aR,6S,6aR)-rel- |
| 24717724 | 2,5-Methano-2H-indeno[1,2-b]oxirene, 2,3,4,5,6,7,7-heptachloro-1a,1b,5,5a,6,6a-hexahydro-,(1aR,1bS,2R,5S,5aR,6S,6aR)-rel- |
| 28044828 | 2,5-Methano-2H-indeno[1,2-b]oxirene, 2,3,4,5,6,7,7-heptachloro-1a,1b,5,5a,6,6a-hexahydro-,(1aR,1bS,2R,5S,5aR,6S,6aR)-rel- |
| 66240719 | 2,5-Methano-2H-indeno[1,2-b]oxirene, 2,3,4,5,6,7,7-heptachloro-1a,1b,5,5a,6,6a-hexahydro-,(1aR,1bS,2R,5S,5aR,6S,6aR)-rel- |
| 66429354 | 2,5-Methano-2H-indeno[1,2-b]oxirene, 2,3,4,5,6,7,7-heptachloro-1a,1b,5,5a,6,6a-hexahydro-,(1aR,1bS,2R,5S,5aR,6S,6aR)-rel- |
| 113484 | 2,5-Pyridinedicarboxylic acid, dipropyl ester |
| 136458 | 2,5-Pyridinedicarboxylic acid, dipropyl ester |
| 114308724 | 2,5-Pyridinedicarboxylic acid, dipropyl ester |
| 4602840 | 2,6,10-Dodecatrien-1-ol, 3,7,11-trimethyl- |
| 106241 | 2,6-Octadien-1-ol, 3,7-dimethyl-, (2E)- |
| 8007134 | 2,6-Octadien-1-ol, 3,7-dimethyl-, (2E)- |
| 491611086 | 2,6-Octadien-1-ol, 3,7-dimethyl-, (2E)- |
| 105873 | 2,6-Octadien-1-ol, 3,7-dimethyl-, 1-acetate, (2E)- |
| 5579635 | 2,6-Octadien-1-ol, 3,7-dimethyl-, 1-acetate, (2E)- |
| 8022831 | 2,6-Octadien-1-ol, 3,7-dimethyl-, 1-acetate, (2E)- |
| 130396848 | 2,6-Octadien-1-ol, 3,7-dimethyl-, 1-acetate, (2E)- |
| 5392405 | 2,6-Octadienal, 3,7-dimethyl- |
| 8022944 | 2,6-Octadienal, 3,7-dimethyl- |
| 37350348 | 2,6-Octadienal, 3,7-dimethyl- |
| 96680158 | 2,6-Octadienal, 3,7-dimethyl- |
| 250599190 | 2,6-Octadienal, 3,7-dimethyl- |
| 433282338 | 2,6-Octadienal, 3,7-dimethyl- |
| 1392408160 | 2,6-Octadienal, 3,7-dimethyl- |
| 7492662 | 2,6-Octadiene, 1,1-diethoxy-3,7-dimethyl- |
| 26581817 | 2,6-Piperidinedione, 3-(1,3-dihydro-1-oxo-2H-isoindol-2-yl)- |
| 66819 | 2,6-Piperidinedione, 4-[(2R)-2-[(1S,3S,5S)-3,5-dimethyl-2-oxocyclohexyl]-2-hydroxyethyl]- |
| 4630766 | 2,6-Piperidinedione, 4-[(2R)-2-[(1S,3S,5S)-3,5-dimethyl-2-oxocyclohexyl]-2-hydroxyethyl]- |
| 6399673 | 2,6-Piperidinedione, 4-[(2R)-2-[(1S,3S,5S)-3,5-dimethyl-2-oxocyclohexyl]-2-hydroxyethyl]- |
| 17974048 | 2,6-Piperidinedione, 4-[(2R)-2-[(1S,3S,5S)-3,5-dimethyl-2-oxocyclohexyl]-2-hydroxyethyl]- |
| 21059096 | 2,6-Piperidinedione, 4-[(2R)-2-[(1S,3S,5S)-3,5-dimethyl-2-oxocyclohexyl]-2-hydroxyethyl]- |
| 64653 | 2,6-Piperidinedione, 4-ethyl-4-methyl- |
| 94780 | 2,6-Pyridinediamine, 3-(phenylazo)- |
| 136403 | 2,6-Pyridinediamine, 3-(phenylazo)-, monohydrochloride |
| 4198190 | 2,7-Naphthalenedisulfonic acid, 3,3'-[(3,3'-dimethoxy[1,1'-biphenyl]-4,4'-diyl)bis(2,1-diazenediyl)]bis[4,5-dihydroxy-, sodium salt (1:4) |
| 2429745 | 2,7-Naphthalenedisulfonic acid, 3,3'-[(3,3'-dimethoxy[1,1'-biphenyl]-4,4'-diyl)bis(2,1-diazenediyl)]bis[5-amino-4-hydroxy-, sodium salt (1:4) |
| 51568946 | 2,7-Naphthalenedisulfonic acid, 3,3'-[(3,3'-dimethoxy[1,1'-biphenyl]-4,4'-diyl)bis(2,1-diazenediyl)]bis[5-amino-4-hydroxy-, sodium salt (1:4) |
| 95032750 | 2,7-Naphthalenedisulfonic acid, 3,3'-[(3,3'-dimethoxy[1,1'-biphenyl]-4,4'-diyl)bis(2,1-diazenediyl)]bis[5-amino-4-hydroxy-, sodium salt (1:4) |
| 120146647 | 2,7-Naphthalenedisulfonic acid, 3,3'-[(3,3'-dimethoxy[1,1'-biphenyl]-4,4'-diyl)bis(2,1-diazenediyl)]bis[5-amino-4-hydroxy-, sodium salt (1:4) |
| 2150541 | 2,7-Naphthalenedisulfonic acid, 3,3'-[(3,3'-dimethyl[1,1'-biphenyl]-4,4'-diyl)bis(2,1-diazenediyl)]bis[4,5-dihydroxy-, sodium salt (1:4) |
| 72571 | 2,7-Naphthalenedisulfonic acid, 3,3'-[(3,3'-dimethyl[1,1'-biphenyl]-4,4'-diyl)bis(2,1-diazenediyl)]bis[5-amino-4-hydroxy-, sodium salt (1:4) |
| 179472550 | 2,7-Naphthalenedisulfonic acid, 3,3'-[(3,3'-dimethyl[1,1'-biphenyl]-4,4'-diyl)bis(2,1-diazenediyl)]bis[5-amino-4-hydroxy-, sodium salt (1:4) |
| 2602462 | 2,7-Naphthalenedisulfonic acid, 3,3'-[[1,1'-biphenyl]-4,4'-diylbis(2,1-diazenediyl)]bis[5-amino-4-hydroxy-, sodium salt (1:4) |
| 116675435 | 2,7-Naphthalenedisulfonic acid, 3,3'-[[1,1'-biphenyl]-4,4'-diylbis(2,1-diazenediyl)]bis[5-amino-4-hydroxy-, sodium salt (1:4) |
| 179472561 | 2,7-Naphthalenedisulfonic acid, 3,3'-[[1,1'-biphenyl]-4,4'-diylbis(2,1-diazenediyl)]bis[5-amino-4-hydroxy-, sodium salt (1:4) |
| 627097625 | 2,7-Naphthalenedisulfonic acid, 3,3'-[[1,1'-biphenyl]-4,4'-diylbis(2,1-diazenediyl)]bis[5-amino-4-hydroxy-, sodium salt (1:4) |
| 3564098 | 2,7-Naphthalenedisulfonic acid, 3-hydroxy-4-[(2,4,5-trimethylphenyl)azo]-, disodium salt |
| 915673 | 2,7-Naphthalenedisulfonic acid, 3-hydroxy-4-[2-(4-sulfo-1-naphthalenyl)diazenyl]-, sodium salt (1:3) |
| 11139847 | 2,7-Naphthalenedisulfonic acid, 3-hydroxy-4-[2-(4-sulfo-1-naphthalenyl)diazenyl]-, sodium salt (1:3) |
| 12000496 | 2,7-Naphthalenedisulfonic acid, 3-hydroxy-4-[2-(4-sulfo-1-naphthalenyl)diazenyl]-, sodium salt (1:3) |
| 23307893 | 2,7-Naphthalenedisulfonic acid, 3-hydroxy-4-[2-(4-sulfo-1-naphthalenyl)diazenyl]-, sodium salt (1:3) |
| 3761533 | 2,7-Naphthalenedisulfonic acid, 4-[2-(2,4-dimethylphenyl)diazenyl]-3-hydroxy-, sodium salt (1:2) |
| 64553715 | 2,7-Naphthalenedisulfonic acid, 4-[2-(2,4-dimethylphenyl)diazenyl]-3-hydroxy-, sodium salt (1:2) |
| 1937377 | 2,7-Naphthalenedisulfonic acid, 4-amino-3-[2-[4'-[2-(2,4-diaminophenyl)diazenyl][1,1'-biphenyl]-4-yl]diazenyl]-5-hydroxy-6-(2-phenyldiazenyl)-, sodium salt (1:2) |
| 61701153 | 2,7-Naphthalenedisulfonic acid, 4-amino-3-[2-[4'-[2-(2,4-diaminophenyl)diazenyl][1,1'-biphenyl]-4-yl]diazenyl]-5-hydroxy-6-(2-phenyldiazenyl)-, sodium salt (1:2) |
| 220970376 | 2,7-Naphthalenedisulfonic acid, 4-amino-3-[2-[4'-[2-(2,4-diaminophenyl)diazenyl][1,1'-biphenyl]-4-yl]diazenyl]-5-hydroxy-6-(2-phenyldiazenyl)-, sodium salt (1:2) |
| 3626286 | 2,7-Naphthalenedisulfonic acid, 4-amino-5-hydroxy-3-[2-[4'-[2-(4-hydroxyphenyl)diazenyl][1,1'-biphenyl]-4-yl]diazenyl]-6-(2-phenyldiazenyl)-, sodium salt (1:2) |
| 2429734 | 2,7-Naphthalenedisulfonic acid, 5-amino-3-[2-[4'-[2-(7-amino-1-hydroxy-3-sulfo-2-naphthalenyl)diazenyl][1,1'-biphenyl]-4-yl]diazenyl]-4-hydroxy-, sodium salt (1:3) |
| 52350228 | 2,7-Naphthalenedisulfonic acid, 5-amino-3-[2-[4'-[2-(7-amino-1-hydroxy-3-sulfo-2-naphthalenyl)diazenyl][1,1'-biphenyl]-4-yl]diazenyl]-4-hydroxy-, sodium salt (1:3) |
| 72208 | 2,7:3,6-Dimethanonaphth[2,3-b]oxirene, 3,4,5,6,9,9-hexachloro-1a,2,2a,3,6,6a,7,7a-octahydro-, (1aR,2R,2aR,3R,6S,6aS,7S,7aS)-rel- |
| 7421934 | 2,7:3,6-Dimethanonaphth[2,3-b]oxirene, 3,4,5,6,9,9-hexachloro-1a,2,2a,3,6,6a,7,7a-octahydro-, (1aR,2R,2aR,3R,6S,6aS,7S,7aS)-rel- |
| 72208 | 2,7:3,6-Dimethanonaphth[2,3-b]oxirene, 3,4,5,6,9,9-hexachloro-1a,2,2a,3,6,6a,7,7a-octahydro-, (1aR,2R,2aR,3R,6S,6aS,7S,7aS)-rel-, and metabolites |
| 60571 | 2,7:3,6-Dimethanonaphth[2,3-b]oxirene, 3,4,5,6,9,9-hexachloro-1a,2,2a,3,6,6a,7,7a-octahydro-, (1aR,2R,2aS,3S,6R,6aR,7S,7aS)-rel- |
| 3039007 | 2,7:3,6-Dimethanonaphth[2,3-b]oxirene, 3,4,5,6,9,9-hexachloro-1a,2,2a,3,6,6a,7,7a-octahydro-, (1aR,2R,2aS,3S,6R,6aR,7S,7aS)-rel- |
| 12622752 | 2,7:3,6-Dimethanonaphth[2,3-b]oxirene, 3,4,5,6,9,9-hexachloro-1a,2,2a,3,6,6a,7,7a-octahydro-, (1aR,2R,2aS,3S,6R,6aR,7S,7aS)-rel- |
| 17301109 | 2,7:3,6-Dimethanonaphth[2,3-b]oxirene, 3,4,5,6,9,9-hexachloro-1a,2,2a,3,6,6a,7,7a-octahydro-, (1aR,2R,2aS,3S,6R,6aR,7S,7aS)-rel- |
| 33648225 | 2,7:3,6-Dimethanonaphth[2,3-b]oxirene, 3,4,5,6,9,9-hexachloro-1a,2,2a,3,6,6a,7,7a-octahydro-, (1aR,2R,2aS,3S,6R,6aR,7S,7aS)-rel- |
| 59029571 | 2,7:3,6-Dimethanonaphth[2,3-b]oxirene, 3,4,5,6,9,9-hexachloro-1a,2,2a,3,6,6a,7,7a-octahydro-, (1aR,2R,2aS,3S,6R,6aR,7S,7aS)-rel- |
| 476391 | 2-Anthracenecarboxylic acid, 7-.beta.-D-glucopyranosyl-9,10-dihydro-3,5,6,8-tetrahydroxy-1-methyl-9,10-dioxo- |
| 632553 | 2-Anthracenecarboxylic acid, 7-.beta.-D-glucopyranosyl-9,10-dihydro-3,5,6,8-tetrahydroxy-1-methyl-9,10-dioxo- |
| 1260179 | 2-Anthracenecarboxylic acid, 7-.beta.-D-glucopyranosyl-9,10-dihydro-3,5,6,8-tetrahydroxy-1-methyl-9,10-dioxo- |
| 1389340 | 2-Anthracenecarboxylic acid, 7-.beta.-D-glucopyranosyl-9,10-dihydro-3,5,6,8-tetrahydroxy-1-methyl-9,10-dioxo- |
| 16667064 | 2-Anthracenecarboxylic acid, 7-.beta.-D-glucopyranosyl-9,10-dihydro-3,5,6,8-tetrahydroxy-1-methyl-9,10-dioxo- |
| 37349498 | 2-Anthracenecarboxylic acid, 7-.beta.-D-glucopyranosyl-9,10-dihydro-3,5,6,8-tetrahydroxy-1-methyl-9,10-dioxo- |
| 131802727 | 2-Anthracenecarboxylic acid, 7-.beta.-D-glucopyranosyl-9,10-dihydro-3,5,6,8-tetrahydroxy-1-methyl-9,10-dioxo- |
| 613138 | 2-Anthramine |
| 136958 | 2-Benzothiazolamine |
| 35858538 | 2-Benzothiazolamine |
| 120045467 | 2-Benzothiazolamine |
| 19952477 | 2-Benzothiazolamine, 4-chloro- |
| 5464799 | 2-Benzothiazolamine, 4-methoxy- |
| 1477425 | 2-Benzothiazolamine, 4-methyl- |
| 24072751 | 2-Benzothiazolamine, 5,6-dichloro- |
| 29927080 | 2-Benzothiazolamine, 5,6-dimethyl- |
| 94451 | 2-Benzothiazolamine, 6-ethoxy- |
| 1747600 | 2-Benzothiazolamine, 6-methoxy- |
| 6285570 | 2-Benzothiazolamine, 6-nitro- |
| 13952846 | 2-Butanamine |
| 33966506 | 2-Butanamine |
| 78922 | 2-Butanol |
| 15892236 | 2-Butanol |
| 2421025 | 2-Butanol, 1,1',1''-nitrilotris- |
| 13552211 | 2-Butanol, 1-amino- |
| 13552324 | 2-Butanol, 1-amino- |
| 78933 | 2-Butanone |
| 135311023 | 2-Butanone |
| 43121433 | 2-Butanone, 1-(4-chlorophenoxy)-3,3-dimethyl-1-(1H-1,2,4-triazol-1-yl)- |
| 43121434 | 2-Butanone, 1-(4-chlorophenoxy)-3,3-dimethyl-1-(1H-1,2,4-triazol-1-yl)- |
| 72650409 | 2-Butanone, 1-(4-chlorophenoxy)-3,3-dimethyl-1-(1H-1,2,4-triazol-1-yl)- |
| 93779512 | 2-Butanone, 1-(4-chlorophenoxy)-3,3-dimethyl-1-(1H-1,2,4-triazol-1-yl)- |
| 119143305 | 2-Butanone, 1-(4-chlorophenoxy)-3,3-dimethyl-1-(1H-1,2,4-triazol-1-yl)- |
| 148227321 | 2-Butanone, 1-(4-chlorophenoxy)-3,3-dimethyl-1-(1H-1,2,4-triazol-1-yl)- |
| 39196184 | 2-Butanone, 3,3-dimethyl-1-(methylthio)-, O-[(methylamino)carbonyl]oxime |
| 563804 | 2-Butanone, 3-methyl- |
| 52325527 | 2-Butanone, 3-methyl- |
| 96297 | 2-Butanone, oxime |
| 105287283 | 2-Butanone, oxime |
| 1338234 | 2-Butanone, peroxide |
| 9042653 | 2-Butanone, peroxide |
| 37228094 | 2-Butanone, peroxide |
| 37332211 | 2-Butanone, peroxide |
| 37364684 | 2-Butanone, peroxide |
| 39386168 | 2-Butanone, peroxide |
| 50927894 | 2-Butanone, peroxide |
| 99676025 | 2-Butanone, peroxide |
| 1175509655 | 2-Butanone, peroxide |
| 1403779894 | 2-Butanone, peroxide |
| 123739 | 2-Butenal |
| 4170300 | 2-Butenal |
| 4170303 | 2-Butenal |
| 123739 | 2-Butenal, (2E)- |
| 4170303 | 2-Butenal, (2Z)- |
| 15798648 | 2-Butenal, (2Z)- |
| 107017 | 2-Butene |
| 1735768 | 2-Butene |
| 624646 | 2-Butene, (2E)- |
| 590181 | 2-Butene, (2Z)- |
| 764410 | 2-Butene, 1,4-dichloro- |
| 7644410 | 2-Butene, 1,4-dichloro- |
| 110576 | 2-Butene, 1,4-dichloro-, (2E)- |
| 764410 | 2-Butene, 1,4-dichloro-, (2E)- |
| 1476115 | 2-Butene, 1,4-dichloro-, (2Z)- |
| 513359 | 2-Butene, 2-methyl- |
| 3234024 | 2-Butene-1,4-diol, 2,3-dibromo- |
| 764421 | 2-Butenedinitrile, (2E)- |
| 1187424 | 2-Butenedinitrile, 2,3-diamino-, (2Z)- |
| 54414889 | 2-Butenedinitrile, 2,3-diamino-, (2Z)- |
| 110178 | 2-Butenedioic acid (2E)- |
| 623158974 | 2-Butenedioic acid (2E)- |
| 999213 | 2-Butenedioic acid (2Z)-, 1,4-di-2-propen-1-yl ester |
| 70798720 | 2-Butenedioic acid (2Z)-, 1,4-di-2-propen-1-yl ester |
| 105323339 | 2-Butenedioic acid (2Z)-, 1,4-di-2-propen-1-yl ester |
| 4403616 | 2-Butenenitrile, 2-methyl- |
| 30574971 | 2-Butenenitrile, 2-methyl-, (2E)- |
| 20068024 | 2-Butenenitrile, 2-methyl-, (2Z)- |
| 393453 | 2-Butenoic acid, 2(or 4)-isooctyl-4,6(or 2,6)-dinitrophenyl ester |
| 12684105 | 2-Butenoic acid, 2(or 4)-isooctyl-4,6(or 2,6)-dinitrophenyl ester |
| 39300453 | 2-Butenoic acid, 2(or 4)-isooctyl-4,6(or 2,6)-dinitrophenyl ester |
| 57131132 | 2-Butenoic acid, 2(or 4)-isooctyl-4,6(or 2,6)-dinitrophenyl ester |
| 57526973 | 2-Butenoic acid, 2(or 4)-isooctyl-4,6(or 2,6)-dinitrophenyl ester |
| 7700176 | 2-Butenoic acid, 3-[(dimethoxyphosphinyl)oxy]-, 1-phenylethyl ester, (2E)- |
| 7786347 | 2-Butenoic acid, 3-[(dimethoxyphosphinyl)oxy]-, methyl ester |
| 243464315 | 2-Butenoic acid, 3-[(dimethoxyphosphinyl)oxy]-, methyl ester |
| 31218834 | 2-Butenoic acid, 3-[[(ethylamino)methoxyphosphinothioyl]oxy]-, 1-methylethyl ester, (2E)- |
| 58995372 | 2-Butenoic acid, 3-[[(ethylamino)methoxyphosphinothioyl]oxy]-, 1-methylethyl ester, (2E)- |
| 21739913 | 2-Butenoic acid, 3-bromo-4-(4-methoxyphenyl)-4-oxo-, sodium salt, (2E)- |
| 99489 | 2-Cyclohexen-1-ol, 2-methyl-5-(1-methylethenyl)- |
| 20307862 | 2-Cyclohexen-1-ol, 2-methyl-5-(1-methylethenyl)- |
| 22567186 | 2-Cyclohexen-1-ol, 2-methyl-5-(1-methylethenyl)- |
| 97427 | 2-Cyclohexen-1-ol, 2-methyl-5-(1-methylethenyl)-, 1-acetate |
| 22567131 | 2-Cyclohexen-1-ol, 2-methyl-5-(1-methylethenyl)-, 1-acetate |
| 73468196 | 2-Cyclohexen-1-one, 2-[1-(ethoxyimino)butyl]-5-[2-(ethylthio)propyl]-3-hydroxy- |
| 74051802 | 2-Cyclohexen-1-one, 2-[1-(ethoxyimino)butyl]-5-[2-(ethylthio)propyl]-3-hydroxy- |
| 74433800 | 2-Cyclohexen-1-one, 2-[1-(ethoxyimino)butyl]-5-[2-(ethylthio)propyl]-3-hydroxy- |
| 77107416 | 2-Cyclohexen-1-one, 2-[1-(ethoxyimino)butyl]-5-[2-(ethylthio)propyl]-3-hydroxy- |
| 2244168 | 2-Cyclohexen-1-one, 2-methyl-5-(1-methylethenyl)-, (5S)- |
| 53763738 | 2-Cyclohexen-1-one, 2-methyl-5-(1-methylethenyl)-, (5S)- |
| 78591 | 2-Cyclohexen-1-one, 3,5,5-trimethyl- |
| 3688537 | 2-Furanacetamide, .alpha.-[(5-nitro-2-furanyl)methylene]- |
| 98011 | 2-Furancarboxaldehyde |
| 98000 | 2-Furanmethanol |
| 623176 | 2-Furanmethanol, 2-acetate |
| 110430 | 2-Heptanone |
| 591786 | 2-Hexanone |
| 110123 | 2-Hexanone, 5-methyl- |
| 645625 | 2-Hexenal, 2-ethyl- |
| 128744218 | 2-Hexenal, 2-ethyl- |
| 1197009338 | 2-Hexenal, 2-ethyl- |
| 7688213 | 2-Hexene, (2Z)- |
| 96457 | 2-Imidazolidinethione |
| 96468 | 2-Imidazolidinethione |
| 12261948 | 2-Imidazolidinethione |
| 26856291 | 2-Imidazolidinethione |
| 71836049 | 2-Imidazolidinethione |
| 90613755 | 2-Imidazolidinethione |
| 875479382 | 2-Imidazolidinethione |
| 1854268 | 2-Imidazolidinone, 4,5-dihydroxy-1,3-bis(hydroxymethyl)- |
| 11114082 | 2-Imidazolidinone, 4,5-dihydroxy-1,3-bis(hydroxymethyl)- |
| 11121098 | 2-Imidazolidinone, 4,5-dihydroxy-1,3-bis(hydroxymethyl)- |
| 28085714 | 2-Imidazolidinone, 4,5-dihydroxy-1,3-bis(hydroxymethyl)- |
| 37220329 | 2-Imidazolidinone, 4,5-dihydroxy-1,3-bis(hydroxymethyl)- |
| 39421722 | 2-Imidazolidinone, 4,5-dihydroxy-1,3-bis(hydroxymethyl)- |
| 53789461 | 2-Imidazolidinone, 4,5-dihydroxy-1,3-bis(hydroxymethyl)- |
| 55963592 | 2-Imidazolidinone, 4,5-dihydroxy-1,3-bis(hydroxymethyl)- |
| 58391507 | 2-Imidazolidinone, 4,5-dihydroxy-1,3-bis(hydroxymethyl)- |
| 60704281 | 2-Imidazolidinone, 4,5-dihydroxy-1,3-bis(hydroxymethyl)- |
| 60918663 | 2-Imidazolidinone, 4,5-dihydroxy-1,3-bis(hydroxymethyl)- |
| 66565499 | 2-Imidazolidinone, 4,5-dihydroxy-1,3-bis(hydroxymethyl)- |
| 66797500 | 2-Imidazolidinone, 4,5-dihydroxy-1,3-bis(hydroxymethyl)- |
| 73767336 | 2-Imidazolidinone, 4,5-dihydroxy-1,3-bis(hydroxymethyl)- |
| 79394299 | 2-Imidazolidinone, 4,5-dihydroxy-1,3-bis(hydroxymethyl)- |
| 79749181 | 2-Imidazolidinone, 4,5-dihydroxy-1,3-bis(hydroxymethyl)- |
| 82905508 | 2-Imidazolidinone, 4,5-dihydroxy-1,3-bis(hydroxymethyl)- |
| 97123530 | 2-Imidazolidinone, 4,5-dihydroxy-1,3-bis(hydroxymethyl)- |
| 115803946 | 2-Imidazolidinone, 4,5-dihydroxy-1,3-bis(hydroxymethyl)- |
| 140161553 | 2-Imidazolidinone, 4,5-dihydroxy-1,3-bis(hydroxymethyl)- |
| 186359922 | 2-Imidazolidinone, 4,5-dihydroxy-1,3-bis(hydroxymethyl)- |
| 211866852 | 2-Imidazolidinone, 4,5-dihydroxy-1,3-bis(hydroxymethyl)- |
| 876564759 | 2-Imidazolidinone, 4,5-dihydroxy-1,3-bis(hydroxymethyl)- |
| 1384186122 | 2-Imidazolidinone, 4,5-dihydroxy-1,3-bis(hydroxymethyl)- |
| 79572 | 2-Naphthacenecarboxamide, 4-(dimethylamino)-1,4,4a,5,5a,6,11,12a-octahydro-3,5,6,10,12,12a-hexahydroxy-6-methyl-1,11-dioxo-, (4S,4aR,5S,5aR,6S,12aS)- |
| 1405954 | 2-Naphthacenecarboxamide, 4-(dimethylamino)-1,4,4a,5,5a,6,11,12a-octahydro-3,5,6,10,12,12a-hexahydroxy-6-methyl-1,11-dioxo-, (4S,4aR,5S,5aR,6S,12aS)- |
| 21645090 | 2-Naphthacenecarboxamide, 4-(dimethylamino)-1,4,4a,5,5a,6,11,12a-octahydro-3,5,6,10,12,12a-hexahydroxy-6-methyl-1,11-dioxo-, (4S,4aR,5S,5aR,6S,12aS)- |
| 52214467 | 2-Naphthacenecarboxamide, 4-(dimethylamino)-1,4,4a,5,5a,6,11,12a-octahydro-3,5,6,10,12,12a-hexahydroxy-6-methyl-1,11-dioxo-, (4S,4aR,5S,5aR,6S,12aS)- |
| 96310428 | 2-Naphthacenecarboxamide, 4-(dimethylamino)-1,4,4a,5,5a,6,11,12a-octahydro-3,5,6,10,12,12a-hexahydroxy-6-methyl-1,11-dioxo-, (4S,4aR,5S,5aR,6S,12aS)- |
| 102287296 | 2-Naphthacenecarboxamide, 4-(dimethylamino)-1,4,4a,5,5a,6,11,12a-octahydro-3,5,6,10,12,12a-hexahydroxy-6-methyl-1,11-dioxo-, (4S,4aR,5S,5aR,6S,12aS)- |
| 103351037 | 2-Naphthacenecarboxamide, 4-(dimethylamino)-1,4,4a,5,5a,6,11,12a-octahydro-3,5,6,10,12,12a-hexahydroxy-6-methyl-1,11-dioxo-, (4S,4aR,5S,5aR,6S,12aS)- |
| 105145106 | 2-Naphthacenecarboxamide, 4-(dimethylamino)-1,4,4a,5,5a,6,11,12a-octahydro-3,5,6,10,12,12a-hexahydroxy-6-methyl-1,11-dioxo-, (4S,4aR,5S,5aR,6S,12aS)- |
| 106216573 | 2-Naphthacenecarboxamide, 4-(dimethylamino)-1,4,4a,5,5a,6,11,12a-octahydro-3,5,6,10,12,12a-hexahydroxy-6-methyl-1,11-dioxo-, (4S,4aR,5S,5aR,6S,12aS)- |
| 856305696 | 2-Naphthacenecarboxamide, 4-(dimethylamino)-1,4,4a,5,5a,6,11,12a-octahydro-3,5,6,10,12,12a-hexahydroxy-6-methyl-1,11-dioxo-, (4S,4aR,5S,5aR,6S,12aS)- |
| 1135442000 | 2-Naphthacenecarboxamide, 4-(dimethylamino)-1,4,4a,5,5a,6,11,12a-octahydro-3,5,6,10,12,12a-hexahydroxy-6-methyl-1,11-dioxo-, (4S,4aR,5S,5aR,6S,12aS)- |
| 1256964223 | 2-Naphthacenecarboxamide, 4-(dimethylamino)-1,4,4a,5,5a,6,11,12a-octahydro-3,5,6,10,12,12a-hexahydroxy-6-methyl-1,11-dioxo-, (4S,4aR,5S,5aR,6S,12aS)- |
| 2058460 | 2-Naphthacenecarboxamide, 4-(dimethylamino)-1,4,4a,5,5a,6,11,12a-octahydro-3,5,6,10,12,12a-hexahydroxy-6-methyl-1,11-dioxo-, hydrochloride (1:1), (4S,4aR,5S,5aR,6S,12aS)- |
| 61794352 | 2-Naphthacenecarboxamide, 4-(dimethylamino)-1,4,4a,5,5a,6,11,12a-octahydro-3,5,6,10,12,12a-hexahydroxy-6-methyl-1,11-dioxo-, hydrochloride (1:1), (4S,4aR,5S,5aR,6S,12aS)- |
| 72034969 | 2-Naphthacenecarboxamide, 4-(dimethylamino)-1,4,4a,5,5a,6,11,12a-octahydro-3,5,6,10,12,12a-hexahydroxy-6-methyl-1,11-dioxo-, hydrochloride (1:1), (4S,4aR,5S,5aR,6S,12aS)- |
| 90438850 | 2-Naphthacenecarboxamide, 4-(dimethylamino)-1,4,4a,5,5a,6,11,12a-octahydro-3,5,6,10,12,12a-hexahydroxy-6-methyl-1,11-dioxo-, hydrochloride (1:1), (4S,4aR,5S,5aR,6S,12aS)- |
| 102323648 | 2-Naphthacenecarboxamide, 4-(dimethylamino)-1,4,4a,5,5a,6,11,12a-octahydro-3,5,6,10,12,12a-hexahydroxy-6-methyl-1,11-dioxo-, hydrochloride (1:1), (4S,4aR,5S,5aR,6S,12aS)- |
| 885678739 | 2-Naphthacenecarboxamide, 4-(dimethylamino)-1,4,4a,5,5a,6,11,12a-octahydro-3,5,6,10,12,12a-hexahydroxy-6-methyl-1,11-dioxo-, hydrochloride (1:1), (4S,4aR,5S,5aR,6S,12aS)- |
| 64755 | 2-Naphthacenecarboxamide, 4-(dimethylamino)-1,4,4a,5,5a,6,11,12a-octahydro-3,6,10,12,12a-pentahydroxy-6-methyl-1,11-dioxo-, hydrochloride (1:1), (4S,4aS,5aS,6S,12aS)- |
| 8017774 | 2-Naphthacenecarboxamide, 4-(dimethylamino)-1,4,4a,5,5a,6,11,12a-octahydro-3,6,10,12,12a-pentahydroxy-6-methyl-1,11-dioxo-, hydrochloride (1:1), (4S,4aS,5aS,6S,12aS)- |
| 8026720 | 2-Naphthacenecarboxamide, 4-(dimethylamino)-1,4,4a,5,5a,6,11,12a-octahydro-3,6,10,12,12a-pentahydroxy-6-methyl-1,11-dioxo-, hydrochloride (1:1), (4S,4aS,5aS,6S,12aS)- |
| 90438838 | 2-Naphthacenecarboxamide, 4-(dimethylamino)-1,4,4a,5,5a,6,11,12a-octahydro-3,6,10,12,12a-pentahydroxy-6-methyl-1,11-dioxo-, hydrochloride (1:1), (4S,4aS,5aS,6S,12aS)- |
| 102030193 | 2-Naphthacenecarboxamide, 4-(dimethylamino)-1,4,4a,5,5a,6,11,12a-octahydro-3,6,10,12,12a-pentahydroxy-6-methyl-1,11-dioxo-, hydrochloride (1:1), (4S,4aS,5aS,6S,12aS)- |
| 91598 | 2-Naphthalenamine |
| 3025772 | 2-Naphthalenamine, 1-[2-(4-nitrophenyl)diazenyl]- |
| 494031 | 2-Naphthalenamine, N,N-bis(2-chloroethyl)- |
| 135886 | 2-Naphthalenamine, N-phenyl- |
| 52907172 | 2-Naphthalenamine, N-phenyl- |
| 84420280 | 2-Naphthalenamine, N-phenyl- |
| 6471494 | 2-Naphthalenecarboxamide, 3-hydroxy-4-[2-(2-methoxy-5-nitrophenyl)diazenyl]-N-(3-nitrophenyl)- |
| 3267105 | 2-Naphthalenecarboxamide, 4-[2-(2,5-dichlorophenyl)diazenyl]-3-hydroxy-N-phenyl- |
| 6041947 | 2-Naphthalenecarboxamide, 4-[2-(2,5-dichlorophenyl)diazenyl]-3-hydroxy-N-phenyl- |
| 1342616 | 2-Naphthalenesulfonic acid, 6-hydroxy-5-[2-(4-sulfophenyl)diazenyl]-, sodium salt (1:2) |
| 2783940 | 2-Naphthalenesulfonic acid, 6-hydroxy-5-[2-(4-sulfophenyl)diazenyl]-, sodium salt (1:2) |
| 12707276 | 2-Naphthalenesulfonic acid, 6-hydroxy-5-[2-(4-sulfophenyl)diazenyl]-, sodium salt (1:2) |
| 842079 | 2-Naphthalenol, 1-(2-phenyldiazenyl)- |
| 104407036 | 2-Naphthalenol, 1-(2-phenyldiazenyl)- |
| 3118976 | 2-Naphthalenol, 1-[2-(2,4-dimethylphenyl)diazenyl]- |
| 6356538 | 2-Naphthalenol, 1-[2-(2,5-dimethoxyphenyl)diazenyl]- |
| 6358538 | 2-Naphthalenol, 1-[2-(2,5-dimethoxyphenyl)diazenyl]- |
| 2646175 | 2-Naphthalenol, 1-[2-(2-methylphenyl)diazenyl]- |
| 50926675 | 2-Naphthalenol, 1-[2-(2-methylphenyl)diazenyl]- |
| 2425856 | 2-Naphthalenol, 1-[2-(4-methyl-2-nitrophenyl)diazenyl]- |
| 12238481 | 2-Naphthalenol, 1-[2-(4-methyl-2-nitrophenyl)diazenyl]- |
| 12240016 | 2-Naphthalenol, 1-[2-(4-methyl-2-nitrophenyl)diazenyl]- |
| 12240027 | 2-Naphthalenol, 1-[2-(4-methyl-2-nitrophenyl)diazenyl]- |
| 39310300 | 2-Naphthalenol, 1-[2-(4-methyl-2-nitrophenyl)diazenyl]- |
| 78690694 | 2-Naphthalenol, 1-[2-(4-methyl-2-nitrophenyl)diazenyl]- |
| 470826 | 2-Oxabicyclo[2.2.2]octane, 1,3,3-trimethyl- |
| 8024520 | 2-Oxabicyclo[2.2.2]octane, 1,3,3-trimethyl- |
| 8024531 | 2-Oxabicyclo[2.2.2]octane, 1,3,3-trimethyl- |
| 10458114 | 2-Oxabicyclo[2.2.2]octane, 1,3,3-trimethyl- |
| 855347238 | 2-Oxabicyclo[2.2.2]octane, 1,3,3-trimethyl- |
| 57578 | 2-Oxetanone |
| 1955459 | 2-Oxetanone, 3,3-dimethyl- |
| 45432824 | 2-Oxetanone, 3,3-dimethyl- |
| 77838 | 2-Oxiranecarboxylic acid, 3-methyl-3-phenyl-, ethyl ester |
| 1322049 | 2-Oxiranecarboxylic acid, 3-methyl-3-phenyl-, ethyl ester |
| 121391 | 2-Oxiranecarboxylic acid, 3-phenyl-, ethyl ester |
| 3033770 | 2-Oxiranemethanaminium, N,N,N-trimethyl-, chloride (1:1) |
| 129829227 | 2-Oxiranemethanaminium, N,N,N-trimethyl-, chloride (1:1) |
| 556525 | 2-Oxiranemethanol |
| 61915273 | 2-Oxiranemethanol |
| 98913543 | 2-Oxiranemethanol |
| 141388 | 2-Oxiraneoctanoic acid, 3-octyl-, 2-ethylhexyl ester |
| 1025028390 | 2-Oxiraneoctanoic acid, 3-octyl-, 2-ethylhexyl ester |
| 108098 | 2-Pentanamine, 4-methyl- |
| 54548480 | 2-Pentanamine, 4-methyl- |
| 626380 | 2-Pentanol, 2-acetate |
| 116783176 | 2-Pentanol, 2-acetate |
| 105306 | 2-Pentanol, 4-methyl- |
| 108112 | 2-Pentanol, 4-methyl- |
| 20281883 | 2-Pentanol, 4-methyl- |
| 40747851 | 2-Pentanol, 4-methyl- |
| 54972973 | 2-Pentanol, 4-methyl- |
| 72847315 | 2-Pentanol, 4-methyl- |
| 108849 | 2-Pentanol, 4-methyl-, 2-acetate |
| 142927 | 2-Pentanol, 4-methyl-, 2-acetate |
| 155749227 | 2-Pentanol, 4-methyl-, 2-acetate |
| 107879 | 2-Pentanone |
| 123422 | 2-Pentanone, 4-hydroxy-4-methyl- |
| 107700 | 2-Pentanone, 4-methoxy-4-methyl- |
| 108101 | 2-Pentanone, 4-methyl- |
| 1338234915 | 2-Pentanone, 4-methyl- |
| 646048 | 2-Pentene, (2E)- |
| 25377724 | 2-Pentene, (2E)- |
| 32968642 | 2-Pentene, (2E)- |
| 627203 | 2-Pentene, (2Z)- |
| 33064878 | 2-Pentene, (2Z)- |
| 13284429 | 2-Pentenenitrile |
| 298599 | 2-Piperidineacetic acid, .alpha.-phenyl-, methyl ester, hydrochloride |
| 75310 | 2-Propanamine |
| 85404246 | 2-Propanamine |
| 75649 | 2-Propanamine, 2-methyl- |
| 94896772 | 2-Propanamine, 2-methyl- |
| 108189 | 2-Propanamine, N-(1-methylethyl)- |
| 1051915253 | 2-Propanamine, N-(1-methylethyl)- |
| 38836394 | 2-Propanamine, N-(1-methylpropylidene)- |
| 50340 | 2-Propanaminium, N-methyl-N-(1-methylethyl)-N-[2-[(9H-xanthen-9-ylcarbonyl)oxy]ethyl]-, bromide (1:1) |
| 75332 | 2-Propanethiol |
| 67630 | 2-Propanol |
| 8013705 | 2-Propanol |
| 122203 | 2-Propanol, 1,1',1''-nitrilotris- |
| 53609646 | 2-Propanol, 1,1'-(nitrosoimino)bis- |
| 110974 | 2-Propanol, 1,1'-iminobis- |
| 1335542 | 2-Propanol, 1,1'-iminobis- |
| 1141787009 | 2-Propanol, 1,1'-iminobis- |
| 920661 | 2-Propanol, 1,1,1,3,3,3-hexafluoro- |
| 96231 | 2-Propanol, 1,3-dichloro- |
| 26545733 | 2-Propanol, 1,3-dichloro- |
| 148584489 | 2-Propanol, 1,3-dichloro- |
| 13674878 | 2-Propanol, 1,3-dichloro-, phosphate (3:1) |
| 78966 | 2-Propanol, 1-amino- |
| 1674562 | 2-Propanol, 1-amino- |
| 19686738 | 2-Propanol, 1-bromo- |
| 19785843 | 2-Propanol, 1-bromo- |
| 5131668 | 2-Propanol, 1-butoxy- |
| 127004 | 2-Propanol, 1-chloro- |
| 20008075 | 2-Propanol, 1-chloro- |
| 13674845 | 2-Propanol, 1-chloro-, 2,2',2''-phosphate |
| 16839320 | 2-Propanol, 1-chloro-, 2,2',2''-phosphate |
| 98112324 | 2-Propanol, 1-chloro-, 2,2',2''-phosphate |
| 4769737 | 2-Propanol, 1-chloro-3-phenoxy- |
| 108648266 | 2-Propanol, 1-chloro-3-phenoxy- |
| 107982 | 2-Propanol, 1-methoxy- |
| 58769190 | 2-Propanol, 1-methoxy- |
| 108656 | 2-Propanol, 1-methoxy-, 2-acetate |
| 84540578 | 2-Propanol, 1-methoxy-, 2-acetate |
| 142300821 | 2-Propanol, 1-methoxy-, 2-acetate |
| 1569013 | 2-Propanol, 1-propoxy- |
| 75650 | 2-Propanol, 2-methyl- |
| 75651 | 2-Propanol, 2-methyl- |
| 555317 | 2-Propanol, aluminum salt (3:1) |
| 12343270 | 2-Propanol, aluminum salt (3:1) |
| 51796099 | 2-Propanol, aluminum salt (3:1) |
| 78423413 | 2-Propanol, aluminum salt (3:1) |
| 95797389 | 2-Propanol, aluminum salt (3:1) |
| 188398621 | 2-Propanol, aluminum salt (3:1) |
| 245654302 | 2-Propanol, aluminum salt (3:1) |
| 301192927 | 2-Propanol, aluminum salt (3:1) |
| 358732168 | 2-Propanol, aluminum salt (3:1) |
| 365494413 | 2-Propanol, aluminum salt (3:1) |
| 856761212 | 2-Propanol, aluminum salt (3:1) |
| 67641 | 2-Propanone |
| 684162 | 2-Propanone, 1,1,1,3,3,3-hexafluoro- |
| 13098390 | 2-Propanone, 1,1,1,3,3,3-hexafluoro-, hydrate (2:3) |
| 918003 | 2-Propanone, 1,1,1-trichloro- |
| 513882 | 2-Propanone, 1,1-dichloro- |
| 534076 | 2-Propanone, 1,3-dichloro- |
| 598312 | 2-Propanone, 1-bromo- |
| 116096 | 2-Propanone, 1-hydroxy- |
| 107119 | 2-Propen-1-amine |
| 102705 | 2-Propen-1-amine, N,N-di-2-propen-1-yl- |
| 44905308 | 2-Propen-1-amine, N,N-di-2-propen-1-yl- |
| 343314283 | 2-Propen-1-amine, N,N-di-2-propen-1-yl- |
| 124027 | 2-Propen-1-amine, N-2-propen-1-yl- |
| 1263263746 | 2-Propen-1-amine, N-2-propen-1-yl- |
| 107186 | 2-Propen-1-ol |
| 1071861 | 2-Propen-1-ol |
| 513428 | 2-Propen-1-ol, 2-methyl- |
| 87296 | 2-Propen-1-ol, 3-phenyl-, 1-(2-aminobenzoate) |
| 107028 | 2-Propenal |
| 25314618 | 2-Propenal |
| 78853 | 2-Propenal, 2-methyl- |
| 101393 | 2-Propenal, 2-methyl-3-phenyl- |
| 623303 | 2-Propenal, 3-(2-furanyl)- |
| 1504741 | 2-Propenal, 3-(2-methoxyphenyl)- |
| 104552 | 2-Propenal, 3-phenyl-, (2E)- |
| 14371109 | 2-Propenal, 3-phenyl-, (2E)- |
| 79061 | 2-Propenamide |
| 1198293683 | 2-Propenamide |
| 110269 | 2-Propenamide, N,N'-methylenebis- |
| 1227834367 | 2-Propenamide, N,N'-methylenebis- |
| 2873974 | 2-Propenamide, N-(1,1-dimethyl-3-oxobutyl)- |
| 19910599 | 2-Propenamide, N-(1,1-dimethyl-3-oxobutyl)- |
| 45002231 | 2-Propenamide, N-(1,1-dimethyl-3-oxobutyl)- |
| 56891282 | 2-Propenamide, N-(1,1-dimethyl-3-oxobutyl)- |
| 66251705 | 2-Propenamide, N-(1,1-dimethyl-3-oxobutyl)- |
| 924425 | 2-Propenamide, N-(hydroxymethyl)- |
| 90456670 | 2-Propenamide, N-(hydroxymethyl)- |
| 160278557 | 2-Propenamide, N-(hydroxymethyl)- |
| 176598188 | 2-Propenamide, N-(hydroxymethyl)- |
| 194091526 | 2-Propenamide, N-(hydroxymethyl)- |
| 9003058 | 2-Propenamide, homopolymer |
| 9082068 | 2-Propenamide, homopolymer |
| 12624247 | 2-Propenamide, homopolymer |
| 25038453 | 2-Propenamide, homopolymer |
| 27754570 | 2-Propenamide, homopolymer |
| 31566424 | 2-Propenamide, homopolymer |
| 33338033 | 2-Propenamide, homopolymer |
| 39355072 | 2-Propenamide, homopolymer |
| 39387774 | 2-Propenamide, homopolymer |
| 51312404 | 2-Propenamide, homopolymer |
| 57679115 | 2-Propenamide, homopolymer |
| 68247814 | 2-Propenamide, homopolymer |
| 72270861 | 2-Propenamide, homopolymer |
| 79079155 | 2-Propenamide, homopolymer |
| 104981897 | 2-Propenamide, homopolymer |
| 114265359 | 2-Propenamide, homopolymer |
| 122177633 | 2-Propenamide, homopolymer |
| 124262357 | 2-Propenamide, homopolymer |
| 129774192 | 2-Propenamide, homopolymer |
| 133522777 | 2-Propenamide, homopolymer |
| 143180090 | 2-Propenamide, homopolymer |
| 143180136 | 2-Propenamide, homopolymer |
| 143180227 | 2-Propenamide, homopolymer |
| 143749079 | 2-Propenamide, homopolymer |
| 200138950 | 2-Propenamide, homopolymer |
| 210353858 | 2-Propenamide, homopolymer |
| 223905393 | 2-Propenamide, homopolymer |
| 443682777 | 2-Propenamide, homopolymer |
| 449742465 | 2-Propenamide, homopolymer |
| 1226898287 | 2-Propenamide, homopolymer |
| 1229457128 | 2-Propenamide, homopolymer |
| 1400274089 | 2-Propenamide, homopolymer |
| 125304076 | 2-Propenamide, reaction products with formaldehyde-melamine polymer Bu Me pentyl ether and hydrogen peroxide |
| 107131 | 2-Propenenitrile |
| 1424482 | 2-Propenenitrile |
| 29754210 | 2-Propenenitrile |
| 63908521 | 2-Propenenitrile |
| 769126923 | 2-Propenenitrile |
| 769134669 | 2-Propenenitrile |
| 1006710560 | 2-Propenenitrile |
| 1197872062 | 2-Propenenitrile |
| 1221168600 | 2-Propenenitrile |
| 1309882903 | 2-Propenenitrile |
| 920376 | 2-Propenenitrile, 2-chloro- |
| 126987 | 2-Propenenitrile, 2-methyl- |
| 9003547 | 2-Propenenitrile, polymer with ethenylbenzene |
| 12751507 | 2-Propenenitrile, polymer with ethenylbenzene |
| 37345407 | 2-Propenenitrile, polymer with ethenylbenzene |
| 52434272 | 2-Propenenitrile, polymer with ethenylbenzene |
| 74238907 | 2-Propenenitrile, polymer with ethenylbenzene |
| 75977956 | 2-Propenenitrile, polymer with ethenylbenzene |
| 94362740 | 2-Propenenitrile, polymer with ethenylbenzene |
| 113007571 | 2-Propenenitrile, polymer with ethenylbenzene |
| 125805905 | 2-Propenenitrile, polymer with ethenylbenzene |
| 151165116 | 2-Propenenitrile, polymer with ethenylbenzene |
| 199128353 | 2-Propenenitrile, polymer with ethenylbenzene |
| 287390663 | 2-Propenenitrile, polymer with ethenylbenzene |
| 578006958 | 2-Propenenitrile, polymer with ethenylbenzene |
| 1201851684 | 2-Propenenitrile, polymer with ethenylbenzene |
| 79107 | 2-Propenoic acid |
| 55927872 | 2-Propenoic acid |
| 1265528537 | 2-Propenoic acid |
| 1453489990 | 2-Propenoic acid |
| 19900460 | 2-Propenoic acid, (2-methyloxiranyl)methyl ester |
| 13048334 | 2-Propenoic acid, 1,1'-(1,6-hexanediyl) ester |
| 74872030 | 2-Propenoic acid, 1,1'-(1,6-hexanediyl) ester |
| 88250322 | 2-Propenoic acid, 1,1'-(1,6-hexanediyl) ester |
| 106717060 | 2-Propenoic acid, 1,1'-(1,6-hexanediyl) ester |
| 126038899 | 2-Propenoic acid, 1,1'-(1,6-hexanediyl) ester |
| 174845659 | 2-Propenoic acid, 1,1'-(1,6-hexanediyl) ester |
| 181826084 | 2-Propenoic acid, 1,1'-(1,6-hexanediyl) ester |
| 198694767 | 2-Propenoic acid, 1,1'-(1,6-hexanediyl) ester |
| 671774757 | 2-Propenoic acid, 1,1'-(1,6-hexanediyl) ester |
| 1220287864 | 2-Propenoic acid, 1,1'-(1,6-hexanediyl) ester |
| 2223827 | 2-Propenoic acid, 1,1'-(2,2-dimethyl-1,3-propanediyl) ester |
| 95576402 | 2-Propenoic acid, 1,1'-(2,2-dimethyl-1,3-propanediyl) ester |
| 127194972 | 2-Propenoic acid, 1,1'-(2,2-dimethyl-1,3-propanediyl) ester |
| 3524683 | 2-Propenoic acid, 1,1'-[2-(hydroxymethyl)-2-[[(1-oxo-2-propen-1-yl)oxy]methyl]-1,3-propanediyl] ester |
| 85205487 | 2-Propenoic acid, 1,1'-[2-(hydroxymethyl)-2-[[(1-oxo-2-propen-1-yl)oxy]methyl]-1,3-propanediyl] ester |
| 89900196 | 2-Propenoic acid, 1,1'-[2-(hydroxymethyl)-2-[[(1-oxo-2-propen-1-yl)oxy]methyl]-1,3-propanediyl] ester |
| 98036341 | 2-Propenoic acid, 1,1'-[2-(hydroxymethyl)-2-[[(1-oxo-2-propen-1-yl)oxy]methyl]-1,3-propanediyl] ester |
| 98866069 | 2-Propenoic acid, 1,1'-[2-(hydroxymethyl)-2-[[(1-oxo-2-propen-1-yl)oxy]methyl]-1,3-propanediyl] ester |
| 162774836 | 2-Propenoic acid, 1,1'-[2-(hydroxymethyl)-2-[[(1-oxo-2-propen-1-yl)oxy]methyl]-1,3-propanediyl] ester |
| 204270199 | 2-Propenoic acid, 1,1'-[2-(hydroxymethyl)-2-[[(1-oxo-2-propen-1-yl)oxy]methyl]-1,3-propanediyl] ester |
| 364365311 | 2-Propenoic acid, 1,1'-[2-(hydroxymethyl)-2-[[(1-oxo-2-propen-1-yl)oxy]methyl]-1,3-propanediyl] ester |
| 406935453 | 2-Propenoic acid, 1,1'-[2-(hydroxymethyl)-2-[[(1-oxo-2-propen-1-yl)oxy]methyl]-1,3-propanediyl] ester |
| 912677420 | 2-Propenoic acid, 1,1'-[2-(hydroxymethyl)-2-[[(1-oxo-2-propen-1-yl)oxy]methyl]-1,3-propanediyl] ester |
| 1063995981 | 2-Propenoic acid, 1,1'-[2-(hydroxymethyl)-2-[[(1-oxo-2-propen-1-yl)oxy]methyl]-1,3-propanediyl] ester |
| 1174502545 | 2-Propenoic acid, 1,1'-[2-(hydroxymethyl)-2-[[(1-oxo-2-propen-1-yl)oxy]methyl]-1,3-propanediyl] ester |
| 17831719 | 2-Propenoic acid, 1,1'-[oxybis(2,1-ethanediyloxy-2,1-ethanediyl)] ester |
| 62181219 | 2-Propenoic acid, 1,1'-[oxybis(2,1-ethanediyloxy-2,1-ethanediyl)] ester |
| 108136501 | 2-Propenoic acid, 1,1'-[oxybis(2,1-ethanediyloxy-2,1-ethanediyl)] ester |
| 19660163 | 2-Propenoic acid, 2,3-dibromopropyl ester |
| 2439352 | 2-Propenoic acid, 2-(dimethylamino)ethyl ester |
| 202667605 | 2-Propenoic acid, 2-(dimethylamino)ethyl ester |
| 254887688 | 2-Propenoic acid, 2-(dimethylamino)ethyl ester |
| 4823476 | 2-Propenoic acid, 2-bromoethyl ester |
| 2206895 | 2-Propenoic acid, 2-chloroethyl ester |
| 137053 | 2-Propenoic acid, 2-cyano-, methyl ester |
| 12790657 | 2-Propenoic acid, 2-cyano-, methyl ester |
| 53028652 | 2-Propenoic acid, 2-cyano-, methyl ester |
| 118232590 | 2-Propenoic acid, 2-cyano-, methyl ester |
| 6197304 | 2-Propenoic acid, 2-cyano-3,3-diphenyl-, 2-ethylhexyl ester |
| 80135315 | 2-Propenoic acid, 2-cyano-3,3-diphenyl-, 2-ethylhexyl ester |
| 149984838 | 2-Propenoic acid, 2-cyano-3,3-diphenyl-, 2-ethylhexyl ester |
| 194304331 | 2-Propenoic acid, 2-cyano-3,3-diphenyl-, 2-ethylhexyl ester |
| 103117 | 2-Propenoic acid, 2-ethylhexyl ester |
| 78733321 | 2-Propenoic acid, 2-ethylhexyl ester |
| 84948572 | 2-Propenoic acid, 2-ethylhexyl ester |
| 93460776 | 2-Propenoic acid, 2-ethylhexyl ester |
| 126830022 | 2-Propenoic acid, 2-ethylhexyl ester |
| 1329996895 | 2-Propenoic acid, 2-ethylhexyl ester |
| 1453489978 | 2-Propenoic acid, 2-ethylhexyl ester |
| 999611 | 2-Propenoic acid, 2-hydroxypropyl ester |
| 91029980 | 2-Propenoic acid, 2-hydroxypropyl ester |
| 79414 | 2-Propenoic acid, 2-methyl- |
| 463311957 | 2-Propenoic acid, 2-methyl- |
| 562836844 | 2-Propenoic acid, 2-methyl- |
| 1338439169 | 2-Propenoic acid, 2-methyl- |
| 4655349 | 2-Propenoic acid, 2-methyl-, 1-methylethyl ester |
| 3066704 | 2-Propenoic acid, 2-methyl-, 2,3-dibromopropyl ester |
| 5001876 | 2-Propenoic acid, 2-methyl-, 2-isocyanatoethyl ester |
| 30674807 | 2-Propenoic acid, 2-methyl-, 2-isocyanatoethyl ester |
| 1426396975 | 2-Propenoic acid, 2-methyl-, 2-isocyanatoethyl ester |
| 97869 | 2-Propenoic acid, 2-methyl-, 2-methylpropyl ester |
| 266675132 | 2-Propenoic acid, 2-methyl-, 2-methylpropyl ester |
| 106912 | 2-Propenoic acid, 2-methyl-, 2-oxiranylmethyl ester |
| 55279884 | 2-Propenoic acid, 2-methyl-, 2-oxiranylmethyl ester |
| 89678751 | 2-Propenoic acid, 2-methyl-, 2-oxiranylmethyl ester |
| 96778028 | 2-Propenoic acid, 2-methyl-, 2-oxiranylmethyl ester |
| 98104939 | 2-Propenoic acid, 2-methyl-, 2-oxiranylmethyl ester |
| 117955245 | 2-Propenoic acid, 2-methyl-, 2-oxiranylmethyl ester |
| 122785802 | 2-Propenoic acid, 2-methyl-, 2-oxiranylmethyl ester |
| 126872193 | 2-Propenoic acid, 2-methyl-, 2-oxiranylmethyl ester |
| 169957953 | 2-Propenoic acid, 2-methyl-, 2-oxiranylmethyl ester |
| 201732550 | 2-Propenoic acid, 2-methyl-, 2-oxiranylmethyl ester |
| 202149120 | 2-Propenoic acid, 2-methyl-, 2-oxiranylmethyl ester |
| 203300269 | 2-Propenoic acid, 2-methyl-, 2-oxiranylmethyl ester |
| 210093724 | 2-Propenoic acid, 2-methyl-, 2-oxiranylmethyl ester |
| 865699838 | 2-Propenoic acid, 2-methyl-, 2-oxiranylmethyl ester |
| 1451188707 | 2-Propenoic acid, 2-methyl-, 2-oxiranylmethyl ester |
| 2530850 | 2-Propenoic acid, 2-methyl-, 3-(trimethoxysilyl)propyl ester |
| 65323946 | 2-Propenoic acid, 2-methyl-, 3-(trimethoxysilyl)propyl ester |
| 65323957 | 2-Propenoic acid, 2-methyl-, 3-(trimethoxysilyl)propyl ester |
| 65324723 | 2-Propenoic acid, 2-methyl-, 3-(trimethoxysilyl)propyl ester |
| 66796201 | 2-Propenoic acid, 2-methyl-, 3-(trimethoxysilyl)propyl ester |
| 72779681 | 2-Propenoic acid, 2-methyl-, 3-(trimethoxysilyl)propyl ester |
| 79642981 | 2-Propenoic acid, 2-methyl-, 3-(trimethoxysilyl)propyl ester |
| 82658671 | 2-Propenoic acid, 2-methyl-, 3-(trimethoxysilyl)propyl ester |
| 85256866 | 2-Propenoic acid, 2-methyl-, 3-(trimethoxysilyl)propyl ester |
| 96353412 | 2-Propenoic acid, 2-methyl-, 3-(trimethoxysilyl)propyl ester |
| 100662144 | 2-Propenoic acid, 2-methyl-, 3-(trimethoxysilyl)propyl ester |
| 114266329 | 2-Propenoic acid, 2-methyl-, 3-(trimethoxysilyl)propyl ester |
| 201732583 | 2-Propenoic acid, 2-methyl-, 3-(trimethoxysilyl)propyl ester |
| 834889155 | 2-Propenoic acid, 2-methyl-, 3-(trimethoxysilyl)propyl ester |
| 1246811880 | 2-Propenoic acid, 2-methyl-, 3-(trimethoxysilyl)propyl ester |
| 97881 | 2-Propenoic acid, 2-methyl-, butyl ester |
| 55922775 | 2-Propenoic acid, 2-methyl-, butyl ester |
| 159172357 | 2-Propenoic acid, 2-methyl-, butyl ester |
| 1151915977 | 2-Propenoic acid, 2-methyl-, butyl ester |
| 1310566972 | 2-Propenoic acid, 2-methyl-, butyl ester |
| 1343477791 | 2-Propenoic acid, 2-methyl-, butyl ester |
| 3179473 | 2-Propenoic acid, 2-methyl-, decyl ester |
| 97632 | 2-Propenoic acid, 2-methyl-, ethyl ester |
| 142096 | 2-Propenoic acid, 2-methyl-, hexyl ester |
| 25087267 | 2-Propenoic acid, 2-methyl-, homopolymer |
| 30679051 | 2-Propenoic acid, 2-methyl-, homopolymer |
| 115708684 | 2-Propenoic acid, 2-methyl-, homopolymer |
| 152834816 | 2-Propenoic acid, 2-methyl-, homopolymer |
| 152834827 | 2-Propenoic acid, 2-methyl-, homopolymer |
| 155686809 | 2-Propenoic acid, 2-methyl-, homopolymer |
| 155686810 | 2-Propenoic acid, 2-methyl-, homopolymer |
| 186901871 | 2-Propenoic acid, 2-methyl-, homopolymer |
| 336176024 | 2-Propenoic acid, 2-methyl-, homopolymer |
| 29964849 | 2-Propenoic acid, 2-methyl-, isodecyl ester |
| 32242107 | 2-Propenoic acid, 2-methyl-, isodecyl ester |
| 62649734 | 2-Propenoic acid, 2-methyl-, isodecyl ester |
| 78747496 | 2-Propenoic acid, 2-methyl-, isodecyl ester |
| 107314103 | 2-Propenoic acid, 2-methyl-, isodecyl ester |
| 884998065 | 2-Propenoic acid, 2-methyl-, isodecyl ester |
| 80626 | 2-Propenoic acid, 2-methyl-, methyl ester |
| 162221547 | 2-Propenoic acid, 2-methyl-, methyl ester |
| 220713326 | 2-Propenoic acid, 2-methyl-, methyl ester |
| 874217137 | 2-Propenoic acid, 2-methyl-, methyl ester |
| 1196968394 | 2-Propenoic acid, 2-methyl-, methyl ester |
| 1227277873 | 2-Propenoic acid, 2-methyl-, methyl ester |
| 9011147 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 9011738 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 9063483 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 37206272 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 37243531 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 37260201 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 37317207 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 37329990 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 37348713 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 37383747 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 39307023 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 39307034 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 39316502 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 39404541 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 41354829 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 41354830 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 41354841 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 42617050 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 51004990 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 52051986 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 52254098 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 53148928 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 53637324 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 53663631 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 53988855 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 54018507 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 54242523 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 55802921 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 55819460 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 57455955 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 57460147 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 57608329 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 57829160 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 57881751 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 58057151 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 58968506 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 58968517 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 59355827 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 59519936 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 61642691 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 61642704 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 63454831 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 67167424 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 69071176 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 70226469 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 70816476 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 72270101 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 72394219 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 72626030 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 73019882 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 74239455 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 74871037 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 75831684 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 76559665 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 77751167 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 78206732 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 78207235 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 78590859 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 80209570 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 80619687 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 83764378 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 86438940 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 87210320 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 88528614 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 88813803 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 90092823 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 90248990 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 94469086 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 95567241 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 95918302 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 96420950 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 98825300 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 99550364 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 103220639 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 105417821 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 106008780 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 106440599 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 110617099 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 110866518 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 113041331 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 113096369 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 114512639 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 114558188 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 115165769 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 115190040 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 115252352 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 116189914 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 122463541 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 122525411 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 123611483 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 123897621 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 124181993 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 126482573 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 128151871 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 128417834 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 130123998 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 130243037 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 131463020 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 131831566 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 132694623 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 134490645 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 137012636 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 138185305 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 138186024 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 141911571 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 143476919 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 144747159 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 146909333 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 148092404 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 155123403 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 155197469 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 155421399 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 157090385 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 158319041 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 160170945 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 161740994 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 161755868 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 161776438 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 170905972 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 170906204 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 171022074 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 171040509 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 171970802 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 176366033 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 179530268 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 183131104 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 183325793 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 189021270 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 191551107 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 192464918 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 195009315 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 196623673 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 198292761 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 201948336 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 202289621 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 203526743 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 203665525 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 205599742 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 210823975 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 212624685 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 220286919 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 225105964 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 245346809 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 281223345 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 288264324 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 292865408 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 292865419 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 296786066 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 302571626 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 303190694 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 304916254 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 304916265 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 304916287 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 308276893 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 331443380 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 416900033 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 429685096 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 444904476 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 446263190 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 478957914 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 483278406 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 487021454 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 487021476 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 487021487 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 501120974 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 501645983 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 627538969 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 682813361 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 864969700 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 865348932 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 869186754 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 871813568 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 887401038 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 888615563 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 890935361 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 890935372 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 948029821 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 948310790 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 952661379 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 1044505998 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 1045710277 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 1059626946 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 1093414482 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 1182269959 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 1204590237 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 1256366047 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 1292307415 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 1307225984 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 1337906009 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 1350742958 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 1354782141 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 1425464385 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
| 2157019 | 2-Propenoic acid, 2-methyl-, octyl ester |
| 2210288 | 2-Propenoic acid, 2-methyl-, propyl ester |
| 30110613 | 2-Propenoic acid, 2-methyl-, propyl ester |
| 2155706 | 2-Propenoic acid, 2-methyl-, tributylstannyl ester |
| 154194726 | 2-Propenoic acid, 2-methyl-, tributylstannyl ester |
| 106638 | 2-Propenoic acid, 2-methylpropyl ester |
| 1401517007 | 2-Propenoic acid, 2-methylpropyl ester |
| 106901 | 2-Propenoic acid, 2-oxiranylmethyl ester |
| 69960652 | 2-Propenoic acid, 2-oxiranylmethyl ester |
| 70404761 | 2-Propenoic acid, 2-oxiranylmethyl ester |
| 130232450 | 2-Propenoic acid, 2-oxiranylmethyl ester |
| 999553 | 2-Propenoic acid, 2-propen-1-yl ester |
| 104289 | 2-Propenoic acid, 3-(4-methoxyphenyl)-, 2-ethoxyethyl ester |
| 1322652 | 2-Propenoic acid, 3-(4-methoxyphenyl)-, 2-ethoxyethyl ester |
| 5466773 | 2-Propenoic acid, 3-(4-methoxyphenyl)-, 2-ethylhexyl ester |
| 155867042 | 2-Propenoic acid, 3-(4-methoxyphenyl)-, 2-ethylhexyl ester |
| 1202568704 | 2-Propenoic acid, 3-(4-methoxyphenyl)-, 2-ethylhexyl ester |
| 2863947 | 2-Propenoic acid, 3-[4-[(E)-[(4-ethoxyphenyl)methylene]amino]phenyl]-, ethyl ester, (2E)- |
| 24140305 | 2-Propenoic acid, 3-[4-[(E)-[(4-methoxyphenyl)methylene]amino]phenyl]-, (2S)-2-methylbutyl ester, (2E)- |
| 140322 | 2-Propenoic acid, butyl ester |
| 141322 | 2-Propenoic acid, butyl ester |
| 126492544 | 2-Propenoic acid, butyl ester |
| 220713315 | 2-Propenoic acid, butyl ester |
| 1453490099 | 2-Propenoic acid, butyl ester |
| 140885 | 2-Propenoic acid, ethyl ester |
| 1441020412 | 2-Propenoic acid, ethyl ester |
| 9003014 | 2-Propenoic acid, homopolymer |
| 11132697 | 2-Propenoic acid, homopolymer |
| 37241239 | 2-Propenoic acid, homopolymer |
| 39341225 | 2-Propenoic acid, homopolymer |
| 51142257 | 2-Propenoic acid, homopolymer |
| 54578448 | 2-Propenoic acid, homopolymer |
| 54990828 | 2-Propenoic acid, homopolymer |
| 56747650 | 2-Propenoic acid, homopolymer |
| 59233191 | 2-Propenoic acid, homopolymer |
| 65742167 | 2-Propenoic acid, homopolymer |
| 71767276 | 2-Propenoic acid, homopolymer |
| 71767287 | 2-Propenoic acid, homopolymer |
| 81031529 | 2-Propenoic acid, homopolymer |
| 82446455 | 2-Propenoic acid, homopolymer |
| 82446466 | 2-Propenoic acid, homopolymer |
| 87913028 | 2-Propenoic acid, homopolymer |
| 88650899 | 2-Propenoic acid, homopolymer |
| 101360150 | 2-Propenoic acid, homopolymer |
| 104625856 | 2-Propenoic acid, homopolymer |
| 104922396 | 2-Propenoic acid, homopolymer |
| 105913471 | 2-Propenoic acid, homopolymer |
| 118168846 | 2-Propenoic acid, homopolymer |
| 125857683 | 2-Propenoic acid, homopolymer |
| 125857694 | 2-Propenoic acid, homopolymer |
| 131094478 | 2-Propenoic acid, homopolymer |
| 165724083 | 2-Propenoic acid, homopolymer |
| 168564565 | 2-Propenoic acid, homopolymer |
| 169799284 | 2-Propenoic acid, homopolymer |
| 170473899 | 2-Propenoic acid, homopolymer |
| 174594093 | 2-Propenoic acid, homopolymer |
| 223508972 | 2-Propenoic acid, homopolymer |
| 230287431 | 2-Propenoic acid, homopolymer |
| 471251420 | 2-Propenoic acid, homopolymer |
| 597551810 | 2-Propenoic acid, homopolymer |
| 746620962 | 2-Propenoic acid, homopolymer |
| 746620984 | 2-Propenoic acid, homopolymer |
| 925683303 | 2-Propenoic acid, homopolymer |
| 1243262396 | 2-Propenoic acid, homopolymer |
| 1422717483 | 2-Propenoic acid, homopolymer |
| 8049783 | 2-Propenoic acid, homopolymer, sodium salt |
| 9003047 | 2-Propenoic acid, homopolymer, sodium salt |
| 9080357 | 2-Propenoic acid, homopolymer, sodium salt |
| 25052793 | 2-Propenoic acid, homopolymer, sodium salt |
| 39283051 | 2-Propenoic acid, homopolymer, sodium salt |
| 39301036 | 2-Propenoic acid, homopolymer, sodium salt |
| 56048090 | 2-Propenoic acid, homopolymer, sodium salt |
| 63993691 | 2-Propenoic acid, homopolymer, sodium salt |
| 64441469 | 2-Propenoic acid, homopolymer, sodium salt |
| 67017214 | 2-Propenoic acid, homopolymer, sodium salt |
| 67167128 | 2-Propenoic acid, homopolymer, sodium salt |
| 72870554 | 2-Propenoic acid, homopolymer, sodium salt |
| 75718671 | 2-Propenoic acid, homopolymer, sodium salt |
| 76559778 | 2-Propenoic acid, homopolymer, sodium salt |
| 77847768 | 2-Propenoic acid, homopolymer, sodium salt |
| 83856160 | 2-Propenoic acid, homopolymer, sodium salt |
| 84420202 | 2-Propenoic acid, homopolymer, sodium salt |
| 87210284 | 2-Propenoic acid, homopolymer, sodium salt |
| 87912581 | 2-Propenoic acid, homopolymer, sodium salt |
| 88402975 | 2-Propenoic acid, homopolymer, sodium salt |
| 88650719 | 2-Propenoic acid, homopolymer, sodium salt |
| 88895334 | 2-Propenoic acid, homopolymer, sodium salt |
| 95077682 | 2-Propenoic acid, homopolymer, sodium salt |
| 100359373 | 2-Propenoic acid, homopolymer, sodium salt |
| 111642661 | 2-Propenoic acid, homopolymer, sodium salt |
| 113536699 | 2-Propenoic acid, homopolymer, sodium salt |
| 114355167 | 2-Propenoic acid, homopolymer, sodium salt |
| 118215911 | 2-Propenoic acid, homopolymer, sodium salt |
| 123140089 | 2-Propenoic acid, homopolymer, sodium salt |
| 129979040 | 2-Propenoic acid, homopolymer, sodium salt |
| 135842818 | 2-Propenoic acid, homopolymer, sodium salt |
| 136303349 | 2-Propenoic acid, homopolymer, sodium salt |
| 136753349 | 2-Propenoic acid, homopolymer, sodium salt |
| 162122625 | 2-Propenoic acid, homopolymer, sodium salt |
| 162730952 | 2-Propenoic acid, homopolymer, sodium salt |
| 179045966 | 2-Propenoic acid, homopolymer, sodium salt |
| 183599077 | 2-Propenoic acid, homopolymer, sodium salt |
| 187758129 | 2-Propenoic acid, homopolymer, sodium salt |
| 188899798 | 2-Propenoic acid, homopolymer, sodium salt |
| 200444333 | 2-Propenoic acid, homopolymer, sodium salt |
| 202833485 | 2-Propenoic acid, homopolymer, sodium salt |
| 204720025 | 2-Propenoic acid, homopolymer, sodium salt |
| 208472202 | 2-Propenoic acid, homopolymer, sodium salt |
| 216973410 | 2-Propenoic acid, homopolymer, sodium salt |
| 218949134 | 2-Propenoic acid, homopolymer, sodium salt |
| 227796205 | 2-Propenoic acid, homopolymer, sodium salt |
| 302578069 | 2-Propenoic acid, homopolymer, sodium salt |
| 313991503 | 2-Propenoic acid, homopolymer, sodium salt |
| 318474247 | 2-Propenoic acid, homopolymer, sodium salt |
| 351210032 | 2-Propenoic acid, homopolymer, sodium salt |
| 441742581 | 2-Propenoic acid, homopolymer, sodium salt |
| 444573459 | 2-Propenoic acid, homopolymer, sodium salt |
| 551943147 | 2-Propenoic acid, homopolymer, sodium salt |
| 871118013 | 2-Propenoic acid, homopolymer, sodium salt |
| 1101133441 | 2-Propenoic acid, homopolymer, sodium salt |
| 1152316374 | 2-Propenoic acid, homopolymer, sodium salt |
| 1421768311 | 2-Propenoic acid, homopolymer, sodium salt |
| 96333 | 2-Propenoic acid, methyl ester |
| 102256291 | 2-Propenoic acid, methyl ester |
| 1254182698 | 2-Propenoic acid, methyl ester |
| 814686 | 2-Propenoyl chloride |
| 107197 | 2-Propyn-1-ol |
| 139402 | 2-Propyn-1-ol |
| 2216946 | 2-Propynoic acid, 3-phenyl-, ethyl ester |
| 98964 | 2-Pyrazinecarboxamide |
| 504290 | 2-Pyridinamine |
| 509290 | 2-Pyridinamine |
| 29212315 | 2-Pyridinamine |
| 45505677 | 2-Pyridinamine |
| 102769744 | 2-Pyridinamine |
| 17433317 | 2-Pyridinecarboxylic acid, 2-acetylhydrazide |
| 1918021 | 2-Pyridinecarboxylic acid, 4-amino-3,5,6-trichloro- |
| 132229 | 2-Pyridinepropanamine, .gamma.-(4-chlorophenyl)-N,N-dimethyl- |
| 42882962 | 2-Pyridinepropanamine, .gamma.-(4-chlorophenyl)-N,N-dimethyl- |
| 46970450 | 2-Pyridinepropanamine, .gamma.-(4-chlorophenyl)-N,N-dimethyl- |
| 113928 | 2-Pyridinepropanamine, .gamma.-(4-chlorophenyl)-N,N-dimethyl-, (2Z)-2-butenedioate (1:1) |
| 7054117 | 2-Pyridinepropanamine, .gamma.-(4-chlorophenyl)-N,N-dimethyl-, (2Z)-2-butenedioate (1:1) |
| 132207 | 2-Pyridinepropanamine, N,N-dimethyl-.gamma.-phenyl-, (2Z)-2-butenedioate (1:1) |
| 155683117 | 2-Pyridinepropanamine, N,N-dimethyl-.gamma.-phenyl-, (2Z)-2-butenedioate (1:1) |
| 9003398 | 2-Pyrrolidinone, 1-ethenyl-, homopolymer |
| 9015627 | 2-Pyrrolidinone, 1-ethenyl-, homopolymer |
| 9080595 | 2-Pyrrolidinone, 1-ethenyl-, homopolymer |
| 29386945 | 2-Pyrrolidinone, 1-ethenyl-, homopolymer |
| 41724418 | 2-Pyrrolidinone, 1-ethenyl-, homopolymer |
| 53026736 | 2-Pyrrolidinone, 1-ethenyl-, homopolymer |
| 53026747 | 2-Pyrrolidinone, 1-ethenyl-, homopolymer |
| 53200274 | 2-Pyrrolidinone, 1-ethenyl-, homopolymer |
| 61932727 | 2-Pyrrolidinone, 1-ethenyl-, homopolymer |
| 65931568 | 2-Pyrrolidinone, 1-ethenyl-, homopolymer |
| 111214461 | 2-Pyrrolidinone, 1-ethenyl-, homopolymer |
| 116404616 | 2-Pyrrolidinone, 1-ethenyl-, homopolymer |
| 121414753 | 2-Pyrrolidinone, 1-ethenyl-, homopolymer |
| 132778042 | 2-Pyrrolidinone, 1-ethenyl-, homopolymer |
| 132778053 | 2-Pyrrolidinone, 1-ethenyl-, homopolymer |
| 132834209 | 2-Pyrrolidinone, 1-ethenyl-, homopolymer |
| 153631619 | 2-Pyrrolidinone, 1-ethenyl-, homopolymer |
| 170473902 | 2-Pyrrolidinone, 1-ethenyl-, homopolymer |
| 496908066 | 2-Pyrrolidinone, 1-ethenyl-, homopolymer |
| 730985601 | 2-Pyrrolidinone, 1-ethenyl-, homopolymer |
| 862983742 | 2-Pyrrolidinone, 1-ethenyl-, homopolymer |
| 1173909539 | 2-Pyrrolidinone, 1-ethenyl-, homopolymer |
| 1229193796 | 2-Pyrrolidinone, 1-ethenyl-, homopolymer |
| 1234714829 | 2-Pyrrolidinone, 1-ethenyl-, homopolymer |
| 1310675912 | 2-Pyrrolidinone, 1-ethenyl-, homopolymer |
| 1337987719 | 2-Pyrrolidinone, 1-ethenyl-, homopolymer |
| 1394151520 | 2-Pyrrolidinone, 1-ethenyl-, homopolymer |
| 1431958267 | 2-Pyrrolidinone, 1-ethenyl-, homopolymer |
| 872504 | 2-Pyrrolidinone, 1-methyl- |
| 26138589 | 2-Pyrrolidinone, 1-methyl- |
| 53774359 | 2-Pyrrolidinone, 1-methyl- |
| 57762466 | 2-Pyrrolidinone, 1-methyl- |
| 15569854 | 2-Pyrrolidinone, 1-methyl-5-(3-pyridinyl)- |
| 96504 | 2-Thiazolamine |
| 5654013 | 2-Thiazolamine |
| 58473793 | 2-Thiazolamine |
| 3882982 | 2-Thiazolamine, 4,5-dihydro-, monohydrochloride |
| 52253697 | 2-Thiazolamine, 4-phenyl-, monohydrobromide, monohydrate |
| 121664 | 2-Thiazolamine, 5-nitro- |
| 8017934 | 2-Thiazolamine, 5-nitro- |
| 8023005 | 2-Thiazolamine, 5-nitro- |
| 574936 | 29H,31H-Phthalocyanine |
| 2612546 | 29H,31H-Phthalocyanine |
| 4466642 | 29H,31H-Phthalocyanine |
| 52440514 | 29H,31H-Phthalocyanine |
| 81612160 | 29H,31H-Phthalocyanine |
| 162831665 | 29H,31H-Phthalocyanine |
| 889688862 | 29H,31H-Phthalocyanine |
| 303341 | 2?Butenoic acid, 2-methy-, (1S,7aR)-7-[[(2R)-2,3-dihydroxy-2-[(1S)-1-methoxyethyl]-3-methyl-1-oxobutoxy]methyl]-2,3,5,7a-tetrahydro-1H-ester, (2Z)- |
| 303344 | 2?Butenoic acid, 2-methy-, (1S,7aR)-7-[[(2R)-2,3-dihydroxy-2-[(1S)-1-methoxyethyl]-3-methyl-1-oxobutoxy]methyl]-2,3,5,7a-tetrahydro-1H-ester, (2Z)- |
| 58946 | 2H-1,2,4-Benzothiadiazine-7-sulfonamide, 6-chloro-, 1,1-dioxide |
| 58935 | 2H-1,2,4-Benzothiadiazine-7-sulfonamide, 6-chloro-3,4-dihydro-, 1,1-dioxide |
| 8049498 | 2H-1,2,4-Benzothiadiazine-7-sulfonamide, 6-chloro-3,4-dihydro-, 1,1-dioxide |
| 125727506 | 2H-1,2,4-Benzothiadiazine-7-sulfonamide, 6-chloro-3,4-dihydro-, 1,1-dioxide |
| 346189 | 2H-1,2,4-Benzothiadiazine-7-sulfonamide, 6-chloro-3,4-dihydro-2-methyl-3-[[(2,2,2-trifluoroethyl)thio]methyl]-, 1,1-dioxide (8CI, 9CI) |
| 50180 | 2H-1,3,2-Oxazaphosphorin-2-amine, N,N-bis(2-chloroethyl)tetrahydro-, 2-oxide |
| 60007956 | 2H-1,3,2-Oxazaphosphorin-2-amine, N,N-bis(2-chloroethyl)tetrahydro-, 2-oxide |
| 75526908 | 2H-1,3,2-Oxazaphosphorin-2-amine, N,N-bis(2-chloroethyl)tetrahydro-, 2-oxide |
| 533744 | 2H-1,3,5-Thiadiazine-2-thione, tetrahydro-3,5-dimethyl- |
| 55146106 | 2H-1,3,5-Thiadiazine-2-thione, tetrahydro-3,5-dimethyl- |
| 1135442806 | 2H-1,3,5-Thiadiazine-2-thione, tetrahydro-3,5-dimethyl- |
| 53404607 | 2H-1,3,5-Thiadiazine-2-thione, tetrahydro-3,5-dimethyl-, ion(1-), sodium |
| 439145 | 2H-1,4-Benzodiazepin-2-one, 7-chloro-1,3-dihydro-1-methyl-5-phenyl- |
| 11100371 | 2H-1,4-Benzodiazepin-2-one, 7-chloro-1,3-dihydro-1-methyl-5-phenyl- |
| 53320846 | 2H-1,4-Benzodiazepin-2-one, 7-chloro-1,3-dihydro-1-methyl-5-phenyl- |
| 846491 | 2H-1,4-Benzodiazepin-2-one, 7-chloro-5-(2-chlorophenyl)-1,3-dihydro-3-hydroxy- |
| 91645 | 2H-1-Benzopyran-2-one |
| 119846 | 2H-1-Benzopyran-2-one, 3,4-dihydro- |
| 1341362 | 2H-1-Benzopyran-2-one, 3,4-dihydro- |
| 28772567 | 2H-1-Benzopyran-2-one, 3-[3-(4'-bromo[1,1'-biphenyl]-4-yl)-3-hydroxy-1-phenylpropyl]-4-hydroxy- |
| 5836293 | 2H-1-Benzopyran-2-one, 4-hydroxy-3-(1,2,3,4-tetrahydro-1-naphthalenyl)- |
| 81812 | 2H-1-Benzopyran-2-one, 4-hydroxy-3-(3-oxo-1-phenylbutyl)- |
| 5543566 | 2H-1-Benzopyran-2-one, 4-hydroxy-3-(3-oxo-1-phenylbutyl)- |
| 56573898 | 2H-1-Benzopyran-2-one, 4-hydroxy-3-(3-oxo-1-phenylbutyl)- |
| 81812 | 2H-1-Benzopyran-2-one, 4-hydroxy-3-(3-oxo-1-phenylbutyl)-, and salts |
| 129066 | 2H-1-Benzopyran-2-one, 4-hydroxy-3-(3-oxo-1-phenylbutyl)-, sodium salt (1:1) |
| 12795550 | 2H-1-Benzopyran-2-one, 4-hydroxy-3-(3-oxo-1-phenylbutyl)-, sodium salt (1:1) |
| 51821819 | 2H-1-Benzopyran-2-one, 4-hydroxy-3-(3-oxo-1-phenylbutyl)-, sodium salt (1:1) |
| 859043622 | 2H-1-Benzopyran-2-one, 4-hydroxy-3-(3-oxo-1-phenylbutyl)-, sodium salt (1:1) |
| 2107768 | 2H-1-Benzopyran-2-one, 5,7-dihydroxy-4-methyl- |
| 92488 | 2H-1-Benzopyran-2-one, 6-methyl- |
| 91441 | 2H-1-Benzopyran-2-one, 7-(diethylamino)-4-methyl- |
| 11118211 | 2H-1-Benzopyran-2-one, 7-(diethylamino)-4-methyl- |
| 12224032 | 2H-1-Benzopyran-2-one, 7-(diethylamino)-4-methyl- |
| 12651353 | 2H-1-Benzopyran-2-one, 7-(diethylamino)-4-methyl- |
| 52232209 | 2H-1-Benzopyran-2-one, 7-(diethylamino)-4-methyl- |
| 58694556 | 2H-1-Benzopyran-2-one, 7-(diethylamino)-4-methyl- |
| 61968716 | 2H-1-Benzopyran-2-one, 7-(diethylamino)-4-methyl- |
| 70726420 | 2H-1-Benzopyran-2-one, 7-(diethylamino)-4-methyl- |
| 71123712 | 2H-1-Benzopyran-2-one, 7-(diethylamino)-4-methyl- |
| 73201226 | 2H-1-Benzopyran-2-one, 7-(diethylamino)-4-methyl- |
| 74029280 | 2H-1-Benzopyran-2-one, 7-(diethylamino)-4-methyl- |
| 86090688 | 2H-1-Benzopyran-2-one, 7-(diethylamino)-4-methyl- |
| 96538191 | 2H-1-Benzopyran-2-one, 7-(diethylamino)-4-methyl- |
| 129038922 | 2H-1-Benzopyran-2-one, 7-(diethylamino)-4-methyl- |
| 1215069650 | 2H-1-Benzopyran-2-one, 7-(diethylamino)-4-methyl- |
| 90335 | 2H-1-Benzopyran-2-one, 7-hydroxy-4-methyl- |
| 56275297 | 2H-1-Benzopyran-2-one, 7-hydroxy-4-methyl- |
| 58957 | 2H-1-Benzopyran-6-ol, 3,4-dihydro-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-, 6-acetate, (2R)- |
| 1406708 | 2H-1-Benzopyran-6-ol, 3,4-dihydro-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-, 6-acetate, (2R)- |
| 12741003 | 2H-1-Benzopyran-6-ol, 3,4-dihydro-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-, 6-acetate, (2R)- |
| 26243958 | 2H-1-Benzopyran-6-ol, 3,4-dihydro-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-, 6-acetate, (2R)- |
| 105602 | 2H-Azepin-2-one, hexahydro- |
| 2953039 | 2H-Azepin-2-one, hexahydro- |
| 32838214 | 2H-Azepin-2-one, hexahydro- |
| 32838236 | 2H-Azepin-2-one, hexahydro- |
| 34876181 | 2H-Azepin-2-one, hexahydro- |
| 117955369 | 2H-Azepin-2-one, hexahydro- |
| 168214286 | 2H-Azepin-2-one, hexahydro- |
| 583391 | 2H-Benzimidazole-2-thione, 1,3-dihydro- |
| 2080593 | 2H-Benzimidazole-2-thione, 1,3-dihydro- |
| 2254593 | 2H-Benzimidazole-2-thione, 1,3-dihydro- |
| 12640356 | 2H-Benzimidazole-2-thione, 1,3-dihydro- |
| 49608675 | 2H-Benzimidazole-2-thione, 1,3-dihydro- |
| 98443733 | 2H-Benzimidazole-2-thione, 1,3-dihydro- |
| 124449021 | 2H-Benzimidazole-2-thione, 1,3-dihydro- |
| 134469071 | 2H-Benzimidazole-2-thione, 1,3-dihydro- |
| 138464558 | 2H-Benzimidazole-2-thione, 1,3-dihydro- |
| 316427 | 2H-Benzo[a]quinolizine, 3-ethyl-1,3,4,6,7,11b-hexahydro-9,10-dimethoxy-2-[[(1R)-1,2,3,4-tetrahydro-6,7-dimethoxy-1-isoquinolinyl]methyl]-, hydrochloride (1:2), (2S,3R,11bS)- |
| 73459037 | 2H-Furo[2,3-h]-1-benzopyran-2-one, 5-methyl- |
| 4418262 | 2H-Pyran-2,4(3H)-dione, 3-acetyl-6-methyl-, ion(1-), sodium (1:1) |
| 6381846 | 2H-Pyran-2,4(3H)-dione, 3-acetyl-6-methyl-, ion(1-), sodium (1:1) |
| 20330103 | 2H-Pyran-2,4(3H)-dione, 3-acetyl-6-methyl-, ion(1-), sodium (1:1) |
| 56172680 | 2H-Pyran-2,4(3H)-dione, 3-acetyl-6-methyl-, ion(1-), sodium (1:1) |
| 71756279 | 2H-Pyran-2,4(3H)-dione, 3-acetyl-6-methyl-, ion(1-), sodium (1:1) |
| 74240247 | 2H-Pyran-2,4(3H)-dione, 3-acetyl-6-methyl-, ion(1-), sodium (1:1) |
| 78891904 | 2H-Pyran-2,4(3H)-dione, 3-acetyl-6-methyl-, ion(1-), sodium (1:1) |
| 1003072 | 3(2H)-Isothiazolone |
| 12673722 | 3(2H)-Isothiazolone, 2-octyl- |
| 26530201 | 3(2H)-Isothiazolone, 2-octyl- |
| 53028823 | 3(2H)-Isothiazolone, 2-octyl- |
| 122667236 | 3(2H)-Isothiazolone, 2-octyl- |
| 245125706 | 3(2H)-Isothiazolone, 2-octyl- |
| 249757593 | 3(2H)-Isothiazolone, 2-octyl- |
| 1135442680 | 3(2H)-Isothiazolone, 2-octyl- |
| 2489103 | 3(2H)-Isoxazolone, 5-(aminomethyl)- |
| 2763964 | 3(2H)-Isoxazolone, 5-(aminomethyl)- |
| 12680385 | 3(2H)-Pyridazinone, 4-chloro-5-(methylamino)-2-[3-(trifluoromethyl)phenyl]- |
| 27314132 | 3(2H)-Pyridazinone, 4-chloro-5-(methylamino)-2-[3-(trifluoromethyl)phenyl]- |
| 4080313 | 3,5,7-Triaza-1-azoniatricyclo[3.3.1.13,7]decane, 1-(3-chloro-2-propen-1-yl)-, chloride (1:1) |
| 60789824 | 3,5,7-Triaza-1-azoniatricyclo[3.3.1.13,7]decane, 1-(3-chloro-2-propen-1-yl)-, chloride (1:1) |
| 103638295 | 3,5,7-Triaza-1-azoniatricyclo[3.3.1.13,7]decane, 1-(3-chloro-2-propen-1-yl)-, chloride (1:1) |
| 50339 | 3,5-Pyrazolidinedione, 4-butyl-1,2-diphenyl- |
| 4297921 | 3,5-Pyrazolidinedione, 4-butyl-1,2-diphenyl- |
| 21829254 | 3,5-Pyridinedicarboxylic acid, 1,4-dihydro-2,6-dimethyl-4-(2-nitrophenyl)-, dimethyl ester |
| 4067167 | 3,6,9,12-Tetraazatetradecane-1,14-diamine |
| 778592373 | 3,6,9,12-Tetraazatetradecane-1,14-diamine |
| 531737 | 3,6-Acridinediamine, dihydrochloride |
| 952238 | 3,6-Acridinediamine, monohydrochloride |
| 123331 | 3,6-Pyridazinedione, 1,2-dihydro- |
| 5425796 | 3,6-Pyridazinedione, 1,2-dihydro- |
| 10071133 | 3,6-Pyridazinedione, 1,2-dihydro- |
| 48100181 | 3,6-Pyridazinedione, 1,2-dihydro- |
| 66988327 | 3,6-Pyridazinedione, 1,2-dihydro- |
| 92335530 | 3,6-Pyridazinedione, 1,2-dihydro- |
| 220787042 | 3,6-Pyridazinedione, 1,2-dihydro- |
| 5716154 | 3,6-Pyridazinedione, 1,2-dihydro-, compd. with 2,2'-iminobis[ethanol] (1:1) |
| 17655220 | 3,6-Pyridazinedione, 1,2-dihydro-, compd. with 2,2'-iminobis[ethanol] (1:1) |
| 92335541 | 3,6-Pyridazinedione, 1,2-dihydro-, compd. with 2,2'-iminobis[ethanol] (1:1) |
| 128250102 | 3,6-Pyridazinedione, 1,2-dihydro-, compd. with 2,2'-iminobis[ethanol] (1:1) |
| 16655826 | 3,7-Benzofurandiol, 2,3-dihydro-2,2-dimethyl-, 7-(methylcarbamate) |
| 115184 | 3-Buten-2-ol, 2-methyl- |
| 78944 | 3-Buten-2-one |
| 3160370 | 3-Buten-2-one, 4-(1,3-benzodioxol-5-yl)- |
| 79776 | 3-Buten-2-one, 4-(2,6,6-trimethyl-1-cyclohexen-1-yl)-, (3E)- |
| 14901076 | 3-Buten-2-one, 4-(2,6,6-trimethyl-1-cyclohexen-1-yl)-, (3E)- |
| 1353674222 | 3-Buten-2-one, 4-(2,6,6-trimethyl-1-cyclohexen-1-yl)-, (3E)- |
| 623154 | 3-Buten-2-one, 4-(2-furanyl)- |
| 71496269 | 3-Buten-2-one, 4-(2-furanyl)- |
| 929900265 | 3-Buten-2-one, 4-(2-furanyl)- |
| 16529569 | 3-Butenenitrile, 2-methyl- |
| 98555 | 3-Cyclohexene-1-methanol, .alpha.,.alpha.,4-trimethyl- |
| 2438122 | 3-Cyclohexene-1-methanol, .alpha.,.alpha.,4-trimethyl- |
| 22347882 | 3-Cyclohexene-1-methanol, .alpha.,.alpha.,4-trimethyl- |
| 106354 | 3-Heptanone |
| 106683 | 3-Octanone |
| 541855 | 3-Octanone |
| 96220 | 3-Pentanone |
| 813445 | 3-Pentanone, 1,1,1,2,4,5,5,5-octafluoro-2,4-bis(trifluoromethyl)- |
| 141797 | 3-Penten-2-one, 4-methyl- |
| 4635874 | 3-Pentenenitrile |
| 603178 | 3-Phorbinepropanoic acid, 9-ethenyl-14-ethyl-21-(methoxycarbonyl)-4,8,13,18-tetramethyl-20-oxo-, (2E,7R,11R)-3,7,11,15-tetramethyl-2-hexadecen-1-yl ester, (3S,4S,21R)- |
| 15113356 | 3-Phorbinepropanoic acid, 9-ethenyl-14-ethyl-21-(methoxycarbonyl)-4,8,13,18-tetramethyl-20-oxo-, (2E,7R,11R)-3,7,11,15-tetramethyl-2-hexadecen-1-yl ester, (3S,4S,21R)- |
| 28553186 | 3-Phorbinepropanoic acid, 9-ethenyl-14-ethyl-21-(methoxycarbonyl)-4,8,13,18-tetramethyl-20-oxo-, (2E,7R,11R)-3,7,11,15-tetramethyl-2-hexadecen-1-yl ester, (3S,4S,21R)- |
| 37231519 | 3-Phorbinepropanoic acid, 9-ethenyl-14-ethyl-21-(methoxycarbonyl)-4,8,13,18-tetramethyl-20-oxo-, (2E,7R,11R)-3,7,11,15-tetramethyl-2-hexadecen-1-yl ester, (3S,4S,21R)- |
| 37281155 | 3-Phorbinepropanoic acid, 9-ethenyl-14-ethyl-21-(methoxycarbonyl)-4,8,13,18-tetramethyl-20-oxo-, (2E,7R,11R)-3,7,11,15-tetramethyl-2-hexadecen-1-yl ester, (3S,4S,21R)- |
| 37317898 | 3-Phorbinepropanoic acid, 9-ethenyl-14-ethyl-21-(methoxycarbonyl)-4,8,13,18-tetramethyl-20-oxo-, (2E,7R,11R)-3,7,11,15-tetramethyl-2-hexadecen-1-yl ester, (3S,4S,21R)- |
| 52118635 | 3-Phorbinepropanoic acid, 9-ethenyl-14-ethyl-21-(methoxycarbonyl)-4,8,13,18-tetramethyl-20-oxo-, (2E,7R,11R)-3,7,11,15-tetramethyl-2-hexadecen-1-yl ester, (3S,4S,21R)- |
| 100759862 | 3-Phorbinepropanoic acid, 9-ethenyl-14-ethyl-21-(methoxycarbonyl)-4,8,13,18-tetramethyl-20-oxo-, (2E,7R,11R)-3,7,11,15-tetramethyl-2-hexadecen-1-yl ester, (3S,4S,21R)- |
| 178157114 | 3-Phorbinepropanoic acid, 9-ethenyl-14-ethyl-21-(methoxycarbonyl)-4,8,13,18-tetramethyl-20-oxo-, (2E,7R,11R)-3,7,11,15-tetramethyl-2-hexadecen-1-yl ester, (3S,4S,21R)- |
| 98920 | 3-Pyridinecarboxamide |
| 37321145 | 3-Pyridinecarboxamide |
| 78731472 | 3-Pyridinecarboxamide |
| 123574630 | 3-Pyridinecarboxamide |
| 329895 | 3-Pyridinecarboxamide, 6-amino- |
| 59267 | 3-Pyridinecarboxamide, N,N-diethyl- |
| 438415 | 3H-1,4-Benzodiazepin-2-amine, 7-chloro-N-methyl-5-phenyl-, 4-oxide, monohydrochloride |
| 482893 | 3H-Indol-3-one, 2-(1,3-dihydro-3-oxo-2H-indol-2-ylidene)-1,2-dihydro- |
| 11129412 | 3H-Indol-3-one, 2-(1,3-dihydro-3-oxo-2H-indol-2-ylidene)-1,2-dihydro- |
| 12000747 | 3H-Indol-3-one, 2-(1,3-dihydro-3-oxo-2H-indol-2-ylidene)-1,2-dihydro- |
| 12626732 | 3H-Indol-3-one, 2-(1,3-dihydro-3-oxo-2H-indol-2-ylidene)-1,2-dihydro- |
| 93660981 | 3H-Indol-3-one, 2-(1,3-dihydro-3-oxo-2H-indol-2-ylidene)-1,2-dihydro- |
| 136797303 | 3H-Indol-3-one, 2-(1,3-dihydro-3-oxo-2H-indol-2-ylidene)-1,2-dihydro- |
| 210488463 | 3H-Indol-3-one, 2-(1,3-dihydro-3-oxo-2H-indol-2-ylidene)-1,2-dihydro- |
| 908005947 | 3H-Indol-3-one, 2-(1,3-dihydro-3-oxo-2H-indol-2-ylidene)-1,2-dihydro- |
| 1131642595 | 3H-Indol-3-one, 2-(1,3-dihydro-3-oxo-2H-indol-2-ylidene)-1,2-dihydro- |
| 89258 | 3H-Pyrazol-3-one, 2,4-dihydro-5-methyl-2-phenyl- |
| 12235584 | 3H-Pyrazol-3-one, 2,4-dihydro-5-methyl-2-phenyl- |
| 52224176 | 3H-Pyrazol-3-one, 2,4-dihydro-5-methyl-2-phenyl- |
| 62495970 | 3H-Pyrazol-3-one, 2,4-dihydro-5-methyl-2-phenyl- |
| 72134668 | 3H-Pyrazol-3-one, 2,4-dihydro-5-methyl-2-phenyl- |
| 115566831 | 3H-Pyrazol-3-one, 2,4-dihydro-5-methyl-2-phenyl- |
| 206195951 | 3H-Pyrazol-3-one, 2,4-dihydro-5-methyl-2-phenyl- |
| 58151 | 3H-Pyrazol-3-one, 4-(dimethylamino)-1,2-dihydro-1,5-dimethyl-2-phenyl- |
| 144574107 | 3H-Pyrazol-3-one, 4-(dimethylamino)-1,2-dihydro-1,5-dimethyl-2-phenyl- |
| 59756604 | 4(1H)-Pyridinone, 1-methyl-3-phenyl-5-[3-(trifluoromethyl)phenyl]- |
| 56042 | 4(1H)-Pyrimidinone, 2,3-dihydro-6-methyl-2-thioxo- |
| 1123100 | 4(1H)-Pyrimidinone, 2,3-dihydro-6-methyl-2-thioxo- |
| 31909189 | 4(1H)-Pyrimidinone, 2,3-dihydro-6-methyl-2-thioxo- |
| 91795776 | 4(1H)-Pyrimidinone, 2,3-dihydro-6-methyl-2-thioxo- |
| 51525 | 4(1H)-Pyrimidinone, 2,3-dihydro-6-propyl-2-thioxo- |
| 500505 | 4(1H)-Pyrimidinone, 2,3-dihydro-6-propyl-2-thioxo- |
| 1910425 | 4,4'-Bipyridinium, 1,1'-dimethyl- |
| 4685147 | 4,4'-Bipyridinium, 1,1'-dimethyl- |
| 116047100 | 4,4'-Bipyridinium, 1,1'-dimethyl- |
| 2074502 | 4,4'-Bipyridinium, 1,1'-dimethyl-, bis(methyl sulfate) |
| 1910425 | 4,4'-Bipyridinium, 1,1'-dimethyl-, dichloride |
| 3765784 | 4,4'-Bipyridinium, 1,1'-dimethyl-, dichloride |
| 57593745 | 4,4'-Bipyridinium, 1,1'-dimethyl-, dichloride |
| 65982505 | 4,4'-Bipyridinium, 1,1'-dimethyl-, dichloride |
| 136338653 | 4,4'-Bipyridinium, 1,1'-dimethyl-, dichloride |
| 205105686 | 4,4'-Bipyridinium, 1,1'-dimethyl-, dichloride |
| 247050573 | 4,4'-Bipyridinium, 1,1'-dimethyl-, dichloride |
| 947080 | 4,6(1H,5H)-Pyrimidinedione, 5-ethyldihydro-5-(1-methylpropyl)-2-thioxo-, monosodium salt |
| 125337 | 4,6(1H,5H)-Pyrimidinedione, 5-ethyldihydro-5-phenyl- |
| 24143699 | 4,7-Methano-1H-indene, 1,2,3,4,5,6,7,8,8-nonachloro-2,3,3a,4,7,7a-hexahydro-, (1.alpha.,2.beta.,3.alpha.,3a.alpha.,4.beta.,7.beta.,7a.alpha.)- |
| 29555440 | 4,7-Methano-1H-indene, 1,2,3,4,5,6,7,8,8-nonachloro-2,3,3a,4,7,7a-hexahydro-, (1.alpha.,2.beta.,3.alpha.,3a.alpha.,4.beta.,7.beta.,7a.alpha.)- |
| 39765805 | 4,7-Methano-1H-indene, 1,2,3,4,5,6,7,8,8-nonachloro-2,3,3a,4,7,7a-hexahydro-, (1.alpha.,2.beta.,3.alpha.,3a.alpha.,4.beta.,7.beta.,7a.alpha.)- |
| 57749 | 4,7-Methano-1H-indene, 1,2,4,5,6,7,8,8-octachloro-2,3,3a,4,7,7a-hexahydro- |
| 90437 | 4,7-Methano-1H-indene, 1,2,4,5,6,7,8,8-octachloro-2,3,3a,4,7,7a-hexahydro- |
| 115286 | 4,7-Methano-1H-indene, 1,2,4,5,6,7,8,8-octachloro-2,3,3a,4,7,7a-hexahydro- |
| 39400801 | 4,7-Methano-1H-indene, 1,2,4,5,6,7,8,8-octachloro-2,3,3a,4,7,7a-hexahydro- |
| 53637131 | 4,7-Methano-1H-indene, 1,2,4,5,6,7,8,8-octachloro-2,3,3a,4,7,7a-hexahydro- |
| 57749 | 4,7-Methano-1H-indene, 1,2,4,5,6,7,8,8-octachloro-2,3,3a,4,7,7a-hexahydro-, (1R,2S,3aS,4S,7R,7aS)-rel |
| 5103719 | 4,7-Methano-1H-indene, 1,2,4,5,6,7,8,8-octachloro-2,3,3a,4,7,7a-hexahydro-, (1R,2S,3aS,4S,7R,7aS)-rel |
| 22212528 | 4,7-Methano-1H-indene, 1,2,4,5,6,7,8,8-octachloro-2,3,3a,4,7,7a-hexahydro-, (1R,2S,3aS,4S,7R,7aS)-rel |
| 26703866 | 4,7-Methano-1H-indene, 1,2,4,5,6,7,8,8-octachloro-2,3,3a,4,7,7a-hexahydro-, (1R,2S,3aS,4S,7R,7aS)-rel |
| 28140467 | 4,7-Methano-1H-indene, 1,2,4,5,6,7,8,8-octachloro-2,3,3a,4,7,7a-hexahydro-, (1R,2S,3aS,4S,7R,7aS)-rel |
| 152322297 | 4,7-Methano-1H-indene, 1,2,4,5,6,7,8,8-octachloro-2,3,3a,4,7,7a-hexahydro-, (1R,2S,3aS,4S,7R,7aS)-rel |
| 76448 | 4,7-Methano-1H-indene, 1,4,5,6,7,8,8-heptachloro-3a,4,7,7a-tetrahydro- |
| 23720594 | 4,7-Methano-1H-indene, 1,4,5,6,7,8,8-heptachloro-3a,4,7,7a-tetrahydro- |
| 37229064 | 4,7-Methano-1H-indene, 1,4,5,6,7,8,8-heptachloro-3a,4,7,7a-tetrahydro- |
| 57749 | 4,7-Methano-1H-indene, 2,2,4,5,6,7,8,8-octachloro-2,3,3a,4,7,7a-hexahydro- |
| 5103742 | 4,7-Methano-1H-indene, 2,2,4,5,6,7,8,8-octachloro-2,3,3a,4,7,7a-hexahydro- |
| 5566347 | 4,7-Methano-1H-indene, 2,2,4,5,6,7,8,8-octachloro-2,3,3a,4,7,7a-hexahydro- |
| 77736 | 4,7-Methano-1H-indene, 3a,4,7,7a-tetrahydro- |
| 45737846 | 4,7-Methano-1H-indene, 3a,4,7,7a-tetrahydro- |
| 54335170 | 4,7-Methano-1H-indene, 3a,4,7,7a-tetrahydro- |
| 107760167 | 4,7-Methano-1H-indene, 3a,4,7,7a-tetrahydro- |
| 275363116 | 4,7-Methano-1H-indene, 3a,4,7,7a-tetrahydro- |
| 991424 | 4,7-Methano-1H-isoindole-1,3(2H)-dione, 3a,4,7,7a-tetrahydro-5-(hydroxyphenyl-2-pyridinylmethyl)-8-(phenyl-2-pyridinylmethylene)- |
| 297789 | 4,7-Methanoisobenzofuran, 1,3,4,5,6,7,8,8-octachloro-1,3,3a,4,7,7a-hexahydro- |
| 3212315 | 4,7-Methanoisobenzofuran, 1,3,4,5,6,7,8,8-octachloro-1,3,3a,4,7,7a-hexahydro- |
| 21152158 | 4,7-Methanoisobenzofuran, 1,3,4,5,6,7,8,8-octachloro-1,3,3a,4,7,7a-hexahydro- |
| 115275 | 4,7-Methanoisobenzofuran-1,3-dione, 4,5,6,7,8,8-hexachloro-3a,4,7,7a-tetrahydro- |
| 122485512 | 4,7-Methanoisobenzofuran-1,3-dione, 4,5,6,7,8,8-hexachloro-3a,4,7,7a-tetrahydro- |
| 123193 | 4-Heptanone |
| 128193 | 4-Heptanone |
| 103838 | 4-Heptanone, 2,6-dimethyl- |
| 108838 | 4-Heptanone, 2,6-dimethyl- |
| 958635422 | 4-Heptanone, 2,6-dimethyl- |
| 504245 | 4-Pyridinamine |
| 536334 | 4-Pyridinecarbothioamide, 2-ethyl- |
| 55221 | 4-Pyridinecarboxylic acid |
| 54853 | 4-Pyridinecarboxylic acid, hydrazide |
| 7640371 | 4-Pyridinecarboxylic acid, hydrazide |
| 37271106 | 4-Pyridinecarboxylic acid, hydrazide |
| 41466073 | 4-Pyridinecarboxylic acid, hydrazide |
| 62229510 | 4-Pyridinecarboxylic acid, hydrazide |
| 2971906 | 4-Pyridinol, 3,5-dichloro-2,6-dimethyl- |
| 535897 | 4-Pyrimidinamine, 2-chloro-N,N,6-trimethyl- |
| 4637563 | 4-Quinolinamine, N-hydroxy-, 1-oxide |
| 7177482 | 4-Thia-1-azabicyclo(3.2.0)heptane-2-carboxylic acid, 6-[[(2R)-aminophenylacetyl]amino]-3,3-dimethyl-7-oxo-, trihydrate, (2S,5R,6R)- |
| 132989 | 4-Thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid, 3,3-dimethyl-7-oxo-6-[(2-phenoxyacetyl)amino]-, potassium salt (1:1), (2S,5R,6R)- |
| 8059732 | 4-Thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid, 3,3-dimethyl-7-oxo-6-[(2-phenoxyacetyl)amino]-, potassium salt (1:1), (2S,5R,6R)- |
| 87081 | 4-Thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid, 3,3-dimethyl-7-oxo-6-[(phenoxyacetyl)amino]-, (2S,5R,6R)- |
| 69578 | 4-Thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid, 3,3-dimethyl-7-oxo-6-[(phenylacetyl)amino]-(2S,5R,6R)-, monosodium salt |
| 1406093 | 4-Thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid, 3,3-dimethyl-7-oxo-6-[(phenylacetyl)amino]-(2S,5R,6R)-, monosodium salt |
| 8049603 | 4-Thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid, 3,3-dimethyl-7-oxo-6-[(phenylacetyl)amino]-(2S,5R,6R)-, monosodium salt |
| 20880675 | 4-Thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid, 6-[[(4-hydroxyphenoxy)acetyl]amino]-3,3-dimethyl-7-oxo-, (2S,5R,6R)- |
| 29676719 | 4-Thiazoleacetic acid, 2-amino- |
| 2150552 | 4-Thiazolecarboxylic acid, 2-amino-4,5-dihydro- |
| 141844 | 4-Thiazolidinone, 2-thioxo- |
| 87274 | 4H-1,3,2-Benzodioxabismin-4-one, 2-hydroxy- |
| 8045189 | 4H-1,3,2-Benzodioxabismin-4-one, 2-hydroxy- |
| 14882189 | 4H-1,3,2-Benzodioxabismin-4-one, 2-hydroxy- |
| 55200425 | 4H-1,3,2-Benzodioxabismin-4-one, 2-hydroxy- |
| 56029891 | 4H-1,3,2-Benzodioxabismin-4-one, 2-hydroxy- |
| 61529495 | 4H-1,3,2-Benzodioxabismin-4-one, 2-hydroxy- |
| 16110513 | 4H-1-Benzopyran-2-carboxylic acid, 5,5'-[(2-hydroxy-1,3-propanediyl)bis(oxy)]bis[4-oxo- |
| 117395 | 4H-1-Benzopyran-4-one, 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy- |
| 73123101 | 4H-1-Benzopyran-4-one, 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy- |
| 74893815 | 4H-1-Benzopyran-4-one, 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy- |
| 203645 | 4H-Cyclopenta[def]phenanthrene |
| 118718 | 4H-Pyran-4-one, 3-hydroxy-2-methyl- |
| 23214928 | 5,12-Naphthacenedione, 10-[(3-amino-2,3,6-trideoxy-.alpha.-L-lyxo-hexopyranosyl)oxy]-7,8,9,10-tetrahydro-6,8,11-trihydroxy-8-(hydroxyacetyl)-1-methoxy-, hydrochloride, (8S,10S)- |
| 25316409 | 5,12-Naphthacenedione, 10-[(3-amino-2,3,6-trideoxy-.alpha.-L-lyxo-hexopyranosyl)oxy]-7,8,9,10-tetrahydro-6,8,11-trihydroxy-8-(hydroxyacetyl)-1-methoxy-, hydrochloride, (8S,10S)- |
| 1407154 | 5,12-Naphthacenedione, 8-acetyl-10-[(3-amino-2,3,6-trideoxy-.alpha.-L-lyxo-hexopyranosyl)oxy]-7,8,9,10-tetrahydro-6,8,11-trihydroxy-1-methoxy-, (8S,10S)- |
| 11006545 | 5,12-Naphthacenedione, 8-acetyl-10-[(3-amino-2,3,6-trideoxy-.alpha.-L-lyxo-hexopyranosyl)oxy]-7,8,9,10-tetrahydro-6,8,11-trihydroxy-1-methoxy-, (8S,10S)- |
| 11048296 | 5,12-Naphthacenedione, 8-acetyl-10-[(3-amino-2,3,6-trideoxy-.alpha.-L-lyxo-hexopyranosyl)oxy]-7,8,9,10-tetrahydro-6,8,11-trihydroxy-1-methoxy-, (8S,10S)- |
| 20830813 | 5,12-Naphthacenedione, 8-acetyl-10-[(3-amino-2,3,6-trideoxy-.alpha.-L-lyxo-hexopyranosyl)oxy]-7,8,9,10-tetrahydro-6,8,11-trihydroxy-1-methoxy-, (8S,10S)- |
| 23942769 | 5,12-Naphthacenedione, 8-acetyl-10-[(3-amino-2,3,6-trideoxy-.alpha.-L-lyxo-hexopyranosyl)oxy]-7,8,9,10-tetrahydro-6,8,11-trihydroxy-1-methoxy-, (8S,10S)- |
| 27576814 | 5,12-Naphthacenedione, 8-acetyl-10-[(3-amino-2,3,6-trideoxy-.alpha.-L-lyxo-hexopyranosyl)oxy]-7,8,9,10-tetrahydro-6,8,11-trihydroxy-1-methoxy-, (8S,10S)- |
| 28020806 | 5,12-Naphthacenedione, 8-acetyl-10-[(3-amino-2,3,6-trideoxy-.alpha.-L-lyxo-hexopyranosyl)oxy]-7,8,9,10-tetrahydro-6,8,11-trihydroxy-1-methoxy-, (8S,10S)- |
| 149541571 | 5,12-Naphthacenedione, 8-acetyl-10-[(3-amino-2,3,6-trideoxy-.alpha.-L-lyxo-hexopyranosyl)oxy]-7,8,9,10-tetrahydro-6,8,11-trihydroxy-1-methoxy-, (8S,10S)- |
| 23541506 | 5,12-Naphthacenedione, 8-acetyl-10-[(3-amino-2,3,6-trideoxy-.alpha.-L-lyxo-hexopyranosyl)oxy]-7,8,9,10-tetrahydro-6,8,11-trihydroxy-1-methoxy-, hydrochloride, (8S,10S)- |
| 126863 | 5-Decyne-4,7-diol, 2,4,7,9-tetramethyl- |
| 126864 | 5-Decyne-4,7-diol, 2,4,7,9-tetramethyl- |
| 8043354 | 5-Decyne-4,7-diol, 2,4,7,9-tetramethyl- |
| 37211431 | 5-Decyne-4,7-diol, 2,4,7,9-tetramethyl- |
| 61879194 | 5-Decyne-4,7-diol, 2,4,7,9-tetramethyl- |
| 149079550 | 5-Decyne-4,7-diol, 2,4,7,9-tetramethyl- |
| 166737173 | 5-Decyne-4,7-diol, 2,4,7,9-tetramethyl- |
| 170006538 | 5-Decyne-4,7-diol, 2,4,7,9-tetramethyl- |
| 171023044 | 5-Decyne-4,7-diol, 2,4,7,9-tetramethyl- |
| 504414599 | 5-Decyne-4,7-diol, 2,4,7,9-tetramethyl- |
| 845642797 | 5-Decyne-4,7-diol, 2,4,7,9-tetramethyl- |
| 867273130 | 5-Decyne-4,7-diol, 2,4,7,9-tetramethyl- |
| 872345614 | 5-Decyne-4,7-diol, 2,4,7,9-tetramethyl- |
| 552307 | 5-Isobenzofurancarboxylic acid, 1,3-dihydro-1,3-dioxo- |
| 28605643 | 5-Isobenzofurancarboxylic acid, 1,3-dihydro-1,3-dioxo- |
| 68864891 | 5-Isobenzofurancarboxylic acid, 1,3-dihydro-1,3-dioxo- |
| 70425466 | 5-Isobenzofurancarboxylic acid, 1,3-dihydro-1,3-dioxo- |
| 928770370 | 5-Isobenzofurancarboxylic acid, 1,3-dihydro-1,3-dioxo- |
| 60168889 | 5-Pyrimidinemethanol, .alpha.-(2-chlorophenyl)-.alpha.-(4-chlorophenyl)- |
| 162707166 | 5-Pyrimidinemethanol, .alpha.-(2-chlorophenyl)-.alpha.-(4-chlorophenyl)- |
| 1135442577 | 5-Pyrimidinemethanol, .alpha.-(2-chlorophenyl)-.alpha.-(4-chlorophenyl)- |
| 17673255 | 5H-Cyclopropa[3,4]benz[1,2-e]azulen-5-one, 1,1a,1b,4,4a,7a,7b,8,9,9a-decahydro-4a,7b,9,9a-tetrahydroxy-3-(hydroxymethyl)-1,1,6,8-tetramethyl-, (1aR,1bS,4aR,7aS,7bS,8R,9R,9aS)- |
| 54955 | 5H-Tetrazolo[1,5-a]azepine, 6,7,8,9-tetrahydro- |
| 1031078 | 6,9-Methano-2,4,3-benzodioxathiepin, 6,7,8,9,10,10-hexachloro-1,5,5a,6,9,9a-hexahydro-, 3,3-dioxide |
| 6749253 | 6,9-Methano-2,4,3-benzodioxathiepin, 6,7,8,9,10,10-hexachloro-1,5,5a,6,9,9a-hexahydro-, 3,3-dioxide |
| 87695430 | 6,9-Methano-2,4,3-benzodioxathiepin, 6,7,8,9,10,10-hexachloro-1,5,5a,6,9,9a-hexahydro-, 3,3-dioxide |
| 115297 | 6,9-Methano-2,4,3-benzodioxathiepin, 6,7,8,9,10,10-hexachloro-1,5,5a,6,9,9a-hexahydro-, 3-oxide |
| 6994043 | 6,9-Methano-2,4,3-benzodioxathiepin, 6,7,8,9,10,10-hexachloro-1,5,5a,6,9,9a-hexahydro-, 3-oxide |
| 8003450 | 6,9-Methano-2,4,3-benzodioxathiepin, 6,7,8,9,10,10-hexachloro-1,5,5a,6,9,9a-hexahydro-, 3-oxide |
| 426824513 | 6,9-Methano-2,4,3-benzodioxathiepin, 6,7,8,9,10,10-hexachloro-1,5,5a,6,9,9a-hexahydro-, 3-oxide |
| 891861 | 6,9-Methano-2,4,3-benzodioxathiepin, 6,7,8,9,10,10-hexachloro-1,5,5a,6,9,9a-hexahydro-, 3-oxide, (3.alpha.,5a.alpha.,6.beta.,9.beta.,9a.alpha.)- |
| 8003450 | 6,9-Methano-2,4,3-benzodioxathiepin, 6,7,8,9,10,10-hexachloro-1,5,5a,6,9,9a-hexahydro-, 3-oxide, (3.alpha.,5a.alpha.,6.beta.,9.beta.,9a.alpha.)- |
| 12640594 | 6,9-Methano-2,4,3-benzodioxathiepin, 6,7,8,9,10,10-hexachloro-1,5,5a,6,9,9a-hexahydro-, 3-oxide, (3.alpha.,5a.alpha.,6.beta.,9.beta.,9a.alpha.)- |
| 19670156 | 6,9-Methano-2,4,3-benzodioxathiepin, 6,7,8,9,10,10-hexachloro-1,5,5a,6,9,9a-hexahydro-, 3-oxide, (3.alpha.,5a.alpha.,6.beta.,9.beta.,9a.alpha.)- |
| 33213659 | 6,9-Methano-2,4,3-benzodioxathiepin, 6,7,8,9,10,10-hexachloro-1,5,5a,6,9,9a-hexahydro-, 3-oxide, (3.alpha.,5a.alpha.,6.beta.,9.beta.,9a.alpha.)- |
| 959988 | 6,9-Methano-2,4,3-benzodioxathiepin, 6,7,8,9,10,10-hexachloro-1,5,5a,6,9,9a-hexahydro-, 3-oxide, (3.alpha.,5a.beta.,6.alpha.,9.alpha.,9a.beta.)- |
| 8003450 | 6,9-Methano-2,4,3-benzodioxathiepin, 6,7,8,9,10,10-hexachloro-1,5,5a,6,9,9a-hexahydro-, 3-oxide, (3.alpha.,5a.beta.,6.alpha.,9.alpha.,9a.beta.)- |
| 12640583 | 6,9-Methano-2,4,3-benzodioxathiepin, 6,7,8,9,10,10-hexachloro-1,5,5a,6,9,9a-hexahydro-, 3-oxide, (3.alpha.,5a.beta.,6.alpha.,9.alpha.,9a.beta.)- |
| 19595596 | 6,9-Methano-2,4,3-benzodioxathiepin, 6,7,8,9,10,10-hexachloro-1,5,5a,6,9,9a-hexahydro-, 3-oxide, (3.alpha.,5a.beta.,6.alpha.,9.alpha.,9a.beta.)- |
| 29106318 | 6,9-Methano-2,4,3-benzodioxathiepin, 6,7,8,9,10,10-hexachloro-1,5,5a,6,9,9a-hexahydro-, 3-oxide, (3.alpha.,5a.beta.,6.alpha.,9.alpha.,9a.beta.)- |
| 33213660 | 6,9-Methano-2,4,3-benzodioxathiepin, 6,7,8,9,10,10-hexachloro-1,5,5a,6,9,9a-hexahydro-, 3-oxide, (3.alpha.,5a.beta.,6.alpha.,9.alpha.,9a.beta.)- |
| 150845 | 6-Octen-1-ol, 3,7-dimethyl-, 1-acetate |
| 67650822 | 6-Octen-1-ol, 3,7-dimethyl-, 1-acetate |
| 73494 | 6-Quinazolinesulfonamide, 7-chloro-2-ethyl-1,2,3,4-tetrahydro-4-oxo- |
| 521357 | 6H-Dibenzo(b,d)pyran-1-ol, 6,6,9-trimethyl-3-pentyl- |
| 1972083 | 6H-Dibenzo[b,d]pyran-1-ol, 6a,7,8,10a-tetrahydro-6,6,9-trimethyl-3-pentyl-, (6aR,10aR)- |
| 50442 | 6H-Purine-6-thione, 1,7-dihydro- |
| 6112761 | 6H-Purine-6-thione, 1,7-dihydro-, monohydrate |
| 154427 | 6H-Purine-6-thione, 2-amino-1,7-dihydro- |
| 1563388 | 7-Benzofuranol, 2,3-dihydro-2,2-dimethyl- |
| 1563662 | 7-Benzofuranol, 2,3-dihydro-2,2-dimethyl-, 7-(N-methylcarbamate) |
| 130176 | 7-Benzothiazolesulfonic acid, 2-(4-aminophenyl)-6-methyl- |
| 129679 | 7-Oxabicyclo[2.2.1]heptane-2,3-dicarboxylic acid |
| 145733 | 7-Oxabicyclo[2.2.1]heptane-2,3-dicarboxylic acid |
| 349466393 | 7-Oxabicyclo[2.2.1]heptane-2,3-dicarboxylic acid |
| 857020725 | 7-Oxabicyclo[2.2.1]heptane-2,3-dicarboxylic acid |
| 2164070 | 7-Oxabicyclo[2.2.1]heptane-2,3-dicarboxylic acid, potassium salt (1:2) |
| 106876 | 7-Oxabicyclo[4.1.0]heptane, 3-(2-oxiranyl)- |
| 108876 | 7-Oxabicyclo[4.1.0]heptane, 3-(2-oxiranyl)- |
| 25550496 | 7-Oxabicyclo[4.1.0]heptane, 3-(2-oxiranyl)- |
| 3388043 | 7-Oxabicyclo[4.1.0]heptane, 3-[2-(trimethoxysilyl)ethyl]- |
| 52682889 | 7-Oxabicyclo[4.1.0]heptane, 3-[2-(trimethoxysilyl)ethyl]- |
| 155684303 | 7-Oxabicyclo[4.1.0]heptane, 3-[2-(trimethoxysilyl)ethyl]- |
| 1203548495 | 7-Oxabicyclo[4.1.0]heptane, 3-[2-(trimethoxysilyl)ethyl]- |
| 194592 | 7H-Dibenzo[c,g]carbazole |
| 20073249 | 7H-Furo[3,2-g][1]benzopyran-6-carboxylic acid, 7-oxo-, ethyl ester |
| 484208 | 7H-Furo[3,2-g][1]benzopyran-7-one, 4-methoxy- |
| 298817 | 7H-Furo[3,2-g][1]benzopyran-7-one, 9-methoxy- |
| 12692943 | 7H-Furo[3,2-g][1]benzopyran-7-one, 9-methoxy- |
| 7008426 | 7H-Pyrano[2,3-c]acridin-7-one, 3,12-dihydro-6-methoxy-3,3,12-trimethyl- |
| 148243 | 8-Quinolinol |
| 24804146 | 8-Quinolinol |
| 123574674 | 8-Quinolinol |
| 130267 | 8-Quinolinol, 5-chloro-7-iodo- |
| 22112034 | 8-Quinolinol, 5-chloro-7-iodo- |
| 736176413 | 8-Quinolinol, 5-chloro-7-iodo- |
| 134316 | 8-Quinolinol, sulfate (2:1) |
| 480228 | 9(10H)-Anthracenone, 1,8-dihydroxy- |
| 1143380 | 9(10H)-Anthracenone, 1,8-dihydroxy- |
| 84651 | 9,10-Anthracenedione |
| 17418585 | 9,10-Anthracenedione |
| 790240527 | 9,10-Anthracenedione |
| 2475458 | 9,10-Anthracenedione, 1,4,5,8-tetraamino- |
| 117102 | 9,10-Anthracenedione, 1,8-dihydroxy- |
| 32073077 | 9,10-Anthracenedione, 1,8-dihydroxy- |
| 343235405 | 9,10-Anthracenedione, 1,8-dihydroxy- |
| 8150 | 9,10-Anthracenedione, 1,8-dihydroxy-4,5-dinitro- |
| 81550 | 9,10-Anthracenedione, 1,8-dihydroxy-4,5-dinitro- |
| 12227826 | 9,10-Anthracenedione, 1,8-dihydroxy-4-[[4-(2-hydroxyethyl)phenyl]amino]-5-nitro- |
| 15791783 | 9,10-Anthracenedione, 1,8-dihydroxy-4-[[4-(2-hydroxyethyl)phenyl]amino]-5-nitro- |
| 51281084 | 9,10-Anthracenedione, 1,8-dihydroxy-4-[[4-(2-hydroxyethyl)phenyl]amino]-5-nitro- |
| 58253308 | 9,10-Anthracenedione, 1,8-dihydroxy-4-[[4-(2-hydroxyethyl)phenyl]amino]-5-nitro- |
| 69993119 | 9,10-Anthracenedione, 1,8-dihydroxy-4-[[4-(2-hydroxyethyl)phenyl]amino]-5-nitro- |
| 81492 | 9,10-Anthracenedione, 1-amino-2,4-dibromo- |
| 82280 | 9,10-Anthracenedione, 1-amino-2-methyl- |
| 117793 | 9,10-Anthracenedione, 2-amino- |
| 129157 | 9,10-Anthracenedione, 2-methyl-1-nitro- |
| 463401 | 9,12,15-Octadecatrienoic acid, (9Z,12Z,15Z)- |
| 60333 | 9,12-Octadecadienoic acid (9Z,12Z)- |
| 949900189 | 9,12-Octadecadienoic acid (9Z,12Z)- |
| 90459 | 9-Acridinamine |
| 134509 | 9-Acridinamine, hydrochloride (1:1) |
| 52417228 | 9-Acridinamine, monohydrochloride, monohydrate |
| 112801 | 9-Octadecenoic acid (9Z)- |
| 8046013 | 9-Octadecenoic acid (9Z)- |
| 17156842 | 9-Octadecenoic acid (9Z)- |
| 56833513 | 9-Octadecenoic acid (9Z)- |
| 949900167 | 9-Octadecenoic acid (9Z)- |
| 1190712118 | 9-Octadecenoic acid (9Z)- |
| 1190965719 | 9-Octadecenoic acid (9Z)- |
| 1380514022 | 9-Octadecenoic acid (9Z)- |
| 688379 | 9-Octadecenoic acid (9Z)-, aluminum salt |
| 13961869 | 9-Octadecenoic acid (9Z)-, compd. with 2,2'-iminobis[ethanol] (1:1) |
| 112629 | 9-Octadecenoic acid (9Z)-, methyl ester |
| 139152822 | 9-Octadecenoic acid (9Z)-, methyl ester |
| 228858364 | 9-Octadecenoic acid (9Z)-, methyl ester |
| 5323955 | 9-Octadecenoic acid, 12-hydroxy-, sodium salt (1:1), (9Z,12R)- |
| 8043456 | 9-Octadecenoic acid, 12-hydroxy-, sodium salt (1:1), (9Z,12R)- |
| 23647441 | 9-Octadecenoic acid, 12-hydroxy-, sodium salt (1:1), (9Z,12R)- |
| 132321 | 9H-Carbazol-3-amine, 9-ethyl- |
| 6109973 | 9H-Carbazol-3-amine, 9-ethyl-, monohydrochloride (1:1) |
| 86737 | 9H-Carbazole |
| 86748 | 9H-Carbazole |
| 153786 | 9H-Fluoren-2-amine |
| 6633405 | 9H-Fluoren-2-ol, 7-nitro- |
| 129793 | 9H-Fluoren-9-one, 2,4,7-trinitro- |
| 31551458 | 9H-Fluoren-9-one, 2,7-dinitro- |
| 86730 | 9H-Fluorene |
| 86737 | 9H-Fluorene |
| 84987804 | 9H-Fluorene |
| 15110744 | 9H-Fluorene, 2,5-dinitro- |
| 607578 | 9H-Fluorene, 2-nitro- |
| 3105973 | 9H-Thioxanthen-9-one, 1-[[2-(diethylamino)ethyl]amino]-4-(hydroxymethyl)- |
| 23255938 | 9H-Thioxanthen-9-one, 1-[[2-(diethylamino)ethyl]amino]-4-(hydroxymethyl)-, monomethanesulfonate (salt) |
| 208968 | Acenaphthylene |
| 83329 | Acenaphthylene, 1,2-dihydro- |
| 83399 | Acenaphthylene, 1,2-dihydro- |
| 602879 | Acenaphthylene, 1,2-dihydro-5-nitro- |
| 15067262 | Acenaphthylene-d8, 1,2-dihydro-d2- |
| 75070 | Acetaldehyde |
| 75876 | Acetaldehyde, 2,2,2-trichloro- |
| 79027 | Acetaldehyde, 2,2-dichloro- |
| 107200 | Acetaldehyde, 2-chloro- |
| 60355 | Acetamide |
| 126272 | Acetamide, 2,2'-[(2-hydroxyethyl)imino]bis[N-(1,1-dimethyl-2-phenylethyl)-N-methyl- |
| 10222012 | Acetamide, 2,2-dibromo-2-cyano- |
| 63619090 | Acetamide, 2,2-dibromo-2-cyano- |
| 56757 | Acetamide, 2,2-dichloro-N-[(1R,2R)-2-hydroxy-1-(hydroxymethyl)-2-(4-nitrophenyl)ethyl]- |
| 15313323 | Acetamide, 2,2-dichloro-N-[(1R,2R)-2-hydroxy-1-(hydroxymethyl)-2-(4-nitrophenyl)ethyl]- |
| 55172720 | Acetamide, 2,2-dichloro-N-[(1R,2R)-2-hydroxy-1-(hydroxymethyl)-2-(4-nitrophenyl)ethyl]- |
| 59112593 | Acetamide, 2,2-dichloro-N-[(1R,2R)-2-hydroxy-1-(hydroxymethyl)-2-(4-nitrophenyl)ethyl]- |
| 85666848 | Acetamide, 2,2-dichloro-N-[(1R,2R)-2-hydroxy-1-(hydroxymethyl)-2-(4-nitrophenyl)ethyl]- |
| 137731909 | Acetamide, 2,2-dichloro-N-[(1R,2R)-2-hydroxy-1-(hydroxymethyl)-2-(4-nitrophenyl)ethyl]- |
| 555486 | Acetamide, 2-amino-N-phenyl- |
| 403652197 | Acetamide, 2-amino-N-phenyl- |
| 4801392 | Acetamide, 2-amino-N-phenyl-, monohydrochloride |
| 93710 | Acetamide, 2-chloro-N,N-di-2-propen-1-yl- |
| 1912249 | Acetamide, 2-chloro-N-(1-methylethyl)-N-phenyl- |
| 1918167 | Acetamide, 2-chloro-N-(1-methylethyl)-N-phenyl- |
| 63704814 | Acetamide, 2-chloro-N-(1-methylethyl)-N-phenyl- |
| 15972608 | Acetamide, 2-chloro-N-(2,6-diethylphenyl)-N-(methoxymethyl)- |
| 37924133 | Acetamide, 2-chloro-N-(2-ethyl-6-methylphenyl)-N-(2-methoxy-1-methylethyl)- |
| 51218452 | Acetamide, 2-chloro-N-(2-ethyl-6-methylphenyl)-N-(2-methoxy-1-methylethyl)- |
| 55762760 | Acetamide, 2-chloro-N-(2-ethyl-6-methylphenyl)-N-(2-methoxy-1-methylethyl)- |
| 63150685 | Acetamide, 2-chloro-N-(2-ethyl-6-methylphenyl)-N-(2-methoxy-1-methylethyl)- |
| 94449588 | Acetamide, 2-chloro-N-(2-ethyl-6-methylphenyl)-N-(2-methoxy-1-methylethyl)- |
| 34256821 | Acetamide, 2-chloro-N-(ethoxymethyl)-N-(2-ethyl-6-methylphenyl)- |
| 73412881 | Acetamide, 2-chloro-N-(ethoxymethyl)-N-(2-ethyl-6-methylphenyl)- |
| 123113746 | Acetamide, 2-chloro-N-(ethoxymethyl)-N-(2-ethyl-6-methylphenyl)- |
| 107915 | Acetamide, 2-cyano- |
| 30587805 | Acetamide, 2-cyano- |
| 640197 | Acetamide, 2-fluoro- |
| 127195 | Acetamide, N,N-dimethyl- |
| 6375173 | Acetamide, N-(2-hydroxy-5-methylphenyl)- |
| 120661 | Acetamide, N-(2-methylphenyl)- |
| 17026812 | Acetamide, N-(3-amino-4-ethoxyphenyl)- |
| 53461759 | Acetamide, N-(3-amino-4-ethoxyphenyl)- |
| 102283 | Acetamide, N-(3-aminophenyl)- |
| 591333 | Acetamide, N-(3-ethoxyphenyl)- |
| 621421 | Acetamide, N-(3-hydroxyphenyl)- |
| 537928 | Acetamide, N-(3-methylphenyl)- |
| 122805 | Acetamide, N-(4-aminophenyl)- |
| 1777840 | Acetamide, N-(4-ethoxy-3-nitrophenyl)- |
| 62442 | Acetamide, N-(4-ethoxyphenyl)- |
| 103902 | Acetamide, N-(4-hydroxyphenyl)- |
| 8055081 | Acetamide, N-(4-hydroxyphenyl)- |
| 719293046 | Acetamide, N-(4-hydroxyphenyl)- |
| 1430221003 | Acetamide, N-(4-hydroxyphenyl)- |
| 103899 | Acetamide, N-(4-methylphenyl)- |
| 42135353 | Acetamide, N-(9-oxo-9H-fluoren-4-yl)- |
| 591082 | Acetamide, N-(aminothioxomethyl)- |
| 23184669 | Acetamide, N-(butoxymethyl)-2-chloro-N-(2,6-diethylphenyl)- |
| 53963 | Acetamide, N-9H-fluoren-2-yl- |
| 2508216 | Acetamide, N-9H-fluoren-2-yl- |
| 53952 | Acetamide, N-9H-fluoren-2-yl-N-hydroxy- |
| 28322023 | Acetamide, N-9H-fluoren-4-yl- |
| 144809 | Acetamide, N-[(4-aminophenyl)sulfonyl]- |
| 64868 | Acetamide, N-[(7S)-5,6,7,9-tetrahydro-1,2,3,10-tetramethoxy-9-oxobenzo[a]heptalen-7-yl]- |
| 5843867 | Acetamide, N-[(7S)-5,6,7,9-tetrahydro-1,2,3,10-tetramethoxy-9-oxobenzo[a]heptalen-7-yl]- |
| 30512313 | Acetamide, N-[(7S)-5,6,7,9-tetrahydro-1,2,3,10-tetramethoxy-9-oxobenzo[a]heptalen-7-yl]- |
| 140498 | Acetamide, N-[4-(2-chloroacetyl)phenyl]- |
| 2832408 | Acetamide, N-[4-[2-(2-hydroxy-5-methylphenyl)diazenyl]phenyl]- |
| 12227019 | Acetamide, N-[4-[2-(2-hydroxy-5-methylphenyl)diazenyl]phenyl]- |
| 12238709 | Acetamide, N-[4-[2-(2-hydroxy-5-methylphenyl)diazenyl]phenyl]- |
| 66057656 | Acetamide, N-[4-[2-(2-hydroxy-5-methylphenyl)diazenyl]phenyl]- |
| 59665 | Acetamide, N-[5-(aminosulfonyl)-1,3,4-thiadiazol-2-yl]- |
| 5661256 | Acetamide, N-[5-(aminosulfonyl)-1,3,4-thiadiazol-2-yl]- |
| 8017694 | Acetamide, N-[5-(aminosulfonyl)-1,3,4-thiadiazol-2-yl]- |
| 79152 | Acetamide, N-bromo- |
| 103844 | Acetamide, N-phenyl- |
| 64197 | Acetic acid |
| 69197 | Acetic acid |
| 71501 | Acetic acid |
| 77671228 | Acetic acid |
| 1053656975 | Acetic acid |
| 108054 | Acetic acid ethenyl ester |
| 61891427 | Acetic acid ethenyl ester |
| 82041234 | Acetic acid ethenyl ester |
| 85306269 | Acetic acid ethenyl ester |
| 172702771 | Acetic acid ethenyl ester |
| 220713360 | Acetic acid ethenyl ester |
| 114786 | Acetic acid ethyl ester |
| 141786 | Acetic acid ethyl ester |
| 4938721 | Acetic acid, (2,4,5-trichlorophenoxy)-, 2-methylpropyl ester |
| 93798 | Acetic acid, (2,4,5-trichlorophenoxy)-, butyl ester |
| 53851799 | Acetic acid, (2,4,5-trichlorophenoxy)-, butyl ester |
| 25168154 | Acetic acid, (2,4,5-trichlorophenoxy)-, isooctyl ester |
| 94111 | Acetic acid, (2,4-dichlorophenoxy)-, 1-methylethyl ester |
| 1929733 | Acetic acid, (2,4-dichlorophenoxy)-, 2-butoxyethyl ester |
| 1320189 | Acetic acid, (2,4-dichlorophenoxy)-, 2-butoxymethylethyl ester |
| 29592992 | Acetic acid, (2,4-dichlorophenoxy)-, 2-butoxymethylethyl ester |
| 30286205 | Acetic acid, (2,4-dichlorophenoxy)-, 2-butoxymethylethyl ester |
| 118821775 | Acetic acid, (2,4-dichlorophenoxy)-, 2-butoxymethylethyl ester |
| 53404378 | Acetic acid, (2,4-dichlorophenoxy)-, 2-ethyl-4-methylpentyl ester |
| 1928434 | Acetic acid, (2,4-dichlorophenoxy)-, 2-ethylhexyl ester |
| 1713151 | Acetic acid, (2,4-dichlorophenoxy)-, 2-methylpropyl ester |
| 2971382 | Acetic acid, (2,4-dichlorophenoxy)-, 4-chloro-2-butenyl ester |
| 94804 | Acetic acid, (2,4-dichlorophenoxy)-, butyl ester |
| 2008391 | Acetic acid, (2,4-dichlorophenoxy)-, compd. with N-methylmethanamine (1:1) |
| 59644621 | Acetic acid, (2,4-dichlorophenoxy)-, compd. with N-methylmethanamine (1:1) |
| 64296191 | Acetic acid, (2,4-dichlorophenoxy)-, compd. with N-methylmethanamine (1:1) |
| 123950903 | Acetic acid, (2,4-dichlorophenoxy)-, compd. with N-methylmethanamine (1:1) |
| 1280202 | Acetic acid, (2,4-dichlorophenoxy)-, isooctyl ester |
| 25168267 | Acetic acid, (2,4-dichlorophenoxy)-, isooctyl ester |
| 56645342 | Acetic acid, (2,4-dichlorophenoxy)-, isooctyl ester |
| 94757 | Acetic acid, (2,4-dichlorophenoxy)-, salts and esters |
| 2702729 | Acetic acid, (2,4-dichlorophenoxy)-, salts and esters |
| 1067330 | Acetic acid, 1,1'-(dibutylstannylene) ester |
| 64197 | Acetic acid, 1,1'-anhydride |
| 108247 | Acetic acid, 1,1'-anhydride |
| 540885 | Acetic acid, 1,1-dimethylethyl ester |
| 108214 | Acetic acid, 1-methylethyl ester |
| 105464 | Acetic acid, 1-methylpropyl ester |
| 116698487 | Acetic acid, 1-methylpropyl ester |
| 16284541 | Acetic acid, 2,2',2''-[(butylstannylidyne)tris(thio)]tris-, 1,1',1''-triisooctyl ester |
| 25852704 | Acetic acid, 2,2',2''-[(butylstannylidyne)tris(thio)]tris-, 1,1',1''-triisooctyl ester |
| 54849386 | Acetic acid, 2,2',2''-[(methylstannylidyne)tris(thio)]tris-, 1,1',1''-triisooctyl ester |
| 56225491 | Acetic acid, 2,2',2''-[(methylstannylidyne)tris(thio)]tris-, 1,1',1''-triisooctyl ester |
| 11097635 | Acetic acid, 2,2'-[(dioctylstannylene)bis(thio)]bis-, 1,1'-diisooctyl ester |
| 26401978 | Acetic acid, 2,2'-[(dioctylstannylene)bis(thio)]bis-, 1,1'-diisooctyl ester |
| 31228827 | Acetic acid, 2,2'-[(dioctylstannylene)bis(thio)]bis-, 1,1'-diisooctyl ester |
| 52434432 | Acetic acid, 2,2'-[(dioctylstannylene)bis(thio)]bis-, 1,1'-diisooctyl ester |
| 55353598 | Acetic acid, 2,2'-[(dioctylstannylene)bis(thio)]bis-, 1,1'-diisooctyl ester |
| 67053649 | Acetic acid, 2,2'-[(dioctylstannylene)bis(thio)]bis-, 1,1'-diisooctyl ester |
| 72253679 | Acetic acid, 2,2'-[(dioctylstannylene)bis(thio)]bis-, 1,1'-diisooctyl ester |
| 80497898 | Acetic acid, 2,2'-[(dioctylstannylene)bis(thio)]bis-, 1,1'-diisooctyl ester |
| 103289301 | Acetic acid, 2,2'-[(dioctylstannylene)bis(thio)]bis-, 1,1'-diisooctyl ester |
| 75967 | Acetic acid, 2,2,2-tribromo- |
| 76039 | Acetic acid, 2,2,2-trichloro- |
| 631641 | Acetic acid, 2,2-dibromo- |
| 79436 | Acetic acid, 2,2-dichloro- |
| 42428477 | Acetic acid, 2,2-dichloro- |
| 39765 | Acetic acid, 2-(2,4,5-trichlorophenoxy)- |
| 93765 | Acetic acid, 2-(2,4,5-trichlorophenoxy)- |
| 4834495 | Acetic acid, 2-(2,4,5-trichlorophenoxy)- |
| 94757 | Acetic acid, 2-(2,4-dichlorophenoxy)- |
| 15183398 | Acetic acid, 2-(2,4-dichlorophenoxy)- |
| 2702729 | Acetic acid, 2-(2,4-dichlorophenoxy)-, sodium salt (1:1) |
| 37353585 | Acetic acid, 2-(2,4-dichlorophenoxy)-, sodium salt (1:1) |
| 58318528 | Acetic acid, 2-(2,4-dichlorophenoxy)-, sodium salt (1:1) |
| 67924781 | Acetic acid, 2-(2,4-dichlorophenoxy)-, sodium salt (1:1) |
| 94746 | Acetic acid, 2-(4-chloro-2-methylphenoxy)- |
| 11111130 | Acetic acid, 2-(4-chloro-2-methylphenoxy)- |
| 11111141 | Acetic acid, 2-(4-chloro-2-methylphenoxy)- |
| 50926551 | Acetic acid, 2-(4-chloro-2-methylphenoxy)- |
| 127289401 | Acetic acid, 2-(4-chloro-2-methylphenoxy)- |
| 3653483 | Acetic acid, 2-(4-chloro-2-methylphenoxy)-, sodium salt (1:1) |
| 11100019 | Acetic acid, 2-(4-chloro-2-methylphenoxy)-, sodium salt (1:1) |
| 11114060 | Acetic acid, 2-(4-chloro-2-methylphenoxy)-, sodium salt (1:1) |
| 55335063 | Acetic acid, 2-[(3,5,6-trichloro-2-pyridinyl)oxy]- |
| 69653721 | Acetic acid, 2-[(3,5,6-trichloro-2-pyridinyl)oxy]- |
| 79083 | Acetic acid, 2-bromo- |
| 418768497 | Acetic acid, 2-bromo- |
| 418768500 | Acetic acid, 2-bromo- |
| 79118 | Acetic acid, 2-chloro- |
| 627032 | Acetic acid, 2-ethoxy- |
| 144490 | Acetic acid, 2-fluoro- |
| 9074775 | Acetic acid, 2-fluoro- |
| 62748 | Acetic acid, 2-fluoro-, sodium salt (1:1) |
| 64697 | Acetic acid, 2-iodo- |
| 33089611 | Acetic acid, 2-iodo- |
| 68111 | Acetic acid, 2-mercapto- |
| 7283423 | Acetic acid, 2-mercapto- |
| 57755201 | Acetic acid, 2-mercapto- |
| 367511 | Acetic acid, 2-mercapto-, sodium salt (1:1) |
| 12773250 | Acetic acid, 2-mercapto-, sodium salt (1:1) |
| 28381988 | Acetic acid, 2-mercapto-, sodium salt (1:1) |
| 625456 | Acetic acid, 2-methoxy- |
| 110190 | Acetic acid, 2-methylpropyl ester |
| 723864 | Acetic acid, 2-methylpropyl ester |
| 122598 | Acetic acid, 2-phenoxy- |
| 103457 | Acetic acid, 2-phenylethyl ester |
| 114830 | Acetic acid, 2-phenylhydrazide |
| 57213691 | Acetic acid, [(3,5,6-trichloro-2-pyridinyl)oxy]-, compd. with N,N-diethylethanamine (1:1) |
| 69653732 | Acetic acid, [(3,5,6-trichloro-2-pyridinyl)oxy]-, compd. with N,N-diethylethanamine (1:1) |
| 58548 | Acetic acid, [2,3-dichloro-4-(2-methylene-1-oxobutyl)phenoxy]- |
| 139128 | Acetic acid, aluminum salt (3:1) |
| 8006131 | Acetic acid, aluminum salt (3:1) |
| 631618 | Acetic acid, ammonium salt (1:1) |
| 1066326 | Acetic acid, ammonium salt (1:1) |
| 92206387 | Acetic acid, ammonium salt (1:1) |
| 856326799 | Acetic acid, ammonium salt (1:1) |
| 858824314 | Acetic acid, ammonium salt (1:1) |
| 5589968 | Acetic acid, bromochloro- |
| 123864 | Acetic acid, butyl ester |
| 543908 | Acetic acid, cadmium salt (2:1) |
| 24558494 | Acetic acid, cadmium salt (2:1) |
| 29398763 | Acetic acid, cadmium salt (2:1) |
| 245727622 | Acetic acid, cadmium salt (2:1) |
| 5278955 | Acetic acid, dibromochloro- |
| 71501 | Acetic acid, ion(1-) |
| 301042 | Acetic acid, lead(2+) salt (2:1) |
| 6080564 | Acetic acid, lead(2+) salt, trihydrate |
| 546894 | Acetic acid, lithium salt (1:1) |
| 1600277 | Acetic acid, mercury(2+) salt (2:1) |
| 6129233 | Acetic acid, mercury(2+) salt (2:1) |
| 7619627 | Acetic acid, mercury(2+) salt (2:1) |
| 19701156 | Acetic acid, mercury(2+) salt (2:1) |
| 148333066 | Acetic acid, mercury(2+) salt (2:1) |
| 79209 | Acetic acid, methyl ester |
| 373024 | Acetic acid, nickel(2+) salt (2:1) |
| 17593690 | Acetic acid, nickel(2+) salt (2:1) |
| 219782271 | Acetic acid, nickel(2+) salt (2:1) |
| 628637 | Acetic acid, pentyl ester |
| 140114 | Acetic acid, phenylmethyl ester |
| 127082 | Acetic acid, potassium salt (1:1) |
| 134092629 | Acetic acid, potassium salt (1:1) |
| 325477950 | Acetic acid, potassium salt (1:1) |
| 662141299 | Acetic acid, potassium salt (1:1) |
| 109604 | Acetic acid, propyl ester |
| 127093 | Acetic acid, sodium salt (1:1) |
| 325477994 | Acetic acid, sodium salt (1:1) |
| 883902292 | Acetic acid, sodium salt (1:1) |
| 563688 | Acetic acid, thallium(1+) salt (1:1) |
| 75058 | Acetonitrile |
| 54841724 | Acetonitrile |
| 545062 | Acetonitrile, 2,2,2-trichloro- |
| 3252435 | Acetonitrile, 2,2-dibromo- |
| 107142 | Acetonitrile, 2-chloro- |
| 1867103 | Acetonitrile, 2-chloro- |
| 107164 | Acetonitrile, 2-hydroxy- |
| 590170 | Acetonitrile, bromo- |
| 83463621 | Acetonitrile, bromochloro- |
| 3018120 | Acetonitrile, dichloro- |
| 75519196 | Acetonitrile, tribromo- |
| 75365 | Acetyl chloride |
| 76028 | Acetyl chloride, 2,2,2-trichloro- |
| 79367 | Acetyl chloride, 2,2-dichloro- |
| 79040 | Acetyl chloride, 2-chloro- |
| 79049 | Acetyl chloride, 2-chloro- |
| 1256778774 | Acetyl chloride, 2-chloro- |
| 359068 | Acetyl chloride, 2-fluoro- |
| 260946 | Acridine |
| 14952400 | Actinium, isotope of mass 227 |
| 14331830 | Actinium, isotope of mass 228 |
| 50760 | Actinomycin D |
| 1402513 | Actinomycin D |
| 1402580 | Actinomycin D |
| 13473499 | Actinomycin D |
| 59473040 | Adsorbable organic halides |
| 83219458 | Aflatoxin G1S |
| 1402682 | Aflatoxins |
| 9002180 | Agar |
| 63241816 | Agar |
| 57837191 | Alanine, N-(2,6-dimethylphenyl)-N-(methoxyacetyl)-, methyl ester |
| 102256633 | Alanine, N-(2,6-dimethylphenyl)-N-(methoxyacetyl)-, methyl ester |
| 39288669 | Alfol |
| 108171262 | Alkanes, C10-12, chloro |
| 85535848 | Alkanes, C10-13, chloro |
| 12587461 | Alpha particle |
| 16941109 | Aluminate(1-), tetrahydro-, calcium (2:1), (T-4)- |
| 1302303 | Aluminate(1-), tetrahydro-, lithium (1:1), (T-4)- |
| 16853853 | Aluminate(1-), tetrahydro-, lithium (1:1), (T-4)- |
| 1035696446 | Aluminate(1-), tetrahydro-, lithium (1:1), (T-4)- |
| 1097640737 | Aluminate(1-), tetrahydro-, lithium (1:1), (T-4)- |
| 1097640760 | Aluminate(1-), tetrahydro-, lithium (1:1), (T-4)- |
| 1327362 | Aluminatesilicate |
| 37316704 | Aluminatesilicate |
| 39457313 | Aluminatesilicate |
| 7429905 | Aluminum |
| 12766459 | Aluminum |
| 37202645 | Aluminum |
| 39302711 | Aluminum |
| 39332622 | Aluminum |
| 80341191 | Aluminum |
| 91728142 | Aluminum |
| 113962666 | Aluminum |
| 121630486 | Aluminum |
| 182260453 | Aluminum |
| 185464373 | Aluminum |
| 257888996 | Aluminum |
| 298688478 | Aluminum |
| 349608511 | Aluminum |
| 477951227 | Aluminum |
| 934749469 | Aluminum |
| 1107614027 | Aluminum |
| 1374563195 | Aluminum |
| 1374563220 | Aluminum |
| 12656438 | Aluminum carbide |
| 7446700 | Aluminum chloride (AlCl3) |
| 41630017 | Aluminum chloride (AlCl3) |
| 125690940 | Aluminum chloride (AlCl3) |
| 195436385 | Aluminum chloride (AlCl3) |
| 255839011 | Aluminum chloride (AlCl3) |
| 1161430814 | Aluminum chloride (AlCl3) |
| 1332483609 | Aluminum chloride (AlCl3) |
| 1327419 | Aluminum chloride, basic |
| 8012666 | Aluminum chloride, basic |
| 11097680 | Aluminum chloride, basic |
| 32056158 | Aluminum chloride, basic |
| 37226463 | Aluminum chloride, basic |
| 39380808 | Aluminum chloride, basic |
| 56803011 | Aluminum chloride, basic |
| 56831664 | Aluminum chloride, basic |
| 64441776 | Aluminum chloride, basic |
| 79586020 | Aluminum chloride, basic |
| 84861983 | Aluminum chloride, basic |
| 101707179 | Aluminum chloride, basic |
| 114442103 | Aluminum chloride, basic |
| 135864709 | Aluminum chloride, basic |
| 143230540 | Aluminum chloride, basic |
| 144388283 | Aluminum chloride, basic |
| 162535151 | Aluminum chloride, basic |
| 167140058 | Aluminum chloride, basic |
| 245064408 | Aluminum chloride, basic |
| 672263853 | Aluminum chloride, basic |
| 745062582 | Aluminum chloride, basic |
| 808739255 | Aluminum chloride, basic |
| 851541974 | Aluminum chloride, basic |
| 929897916 | Aluminum chloride, basic |
| 929897938 | Aluminum chloride, basic |
| 929898033 | Aluminum chloride, basic |
| 929898044 | Aluminum chloride, basic |
| 1123762300 | Aluminum chloride, basic |
| 7784181 | Aluminum fluoride (AlF3) |
| 856859795 | Aluminum fluoride (AlF3) |
| 1202643057 | Aluminum fluoride (AlF3) |
| 1328946662 | Aluminum fluoride (AlF3) |
| 7784216 | Aluminum hydride (AlH3) |
| 957143316 | Aluminum hydride (AlH3) |
| 1302290 | Aluminum hydroxide (Al(OH)3) |
| 8012633 | Aluminum hydroxide (Al(OH)3) |
| 8064004 | Aluminum hydroxide (Al(OH)3) |
| 12040594 | Aluminum hydroxide (Al(OH)3) |
| 12252709 | Aluminum hydroxide (Al(OH)3) |
| 13783169 | Aluminum hydroxide (Al(OH)3) |
| 16657479 | Aluminum hydroxide (Al(OH)3) |
| 21645512 | Aluminum hydroxide (Al(OH)3) |
| 51330224 | Aluminum hydroxide (Al(OH)3) |
| 106152094 | Aluminum hydroxide (Al(OH)3) |
| 128083272 | Aluminum hydroxide (Al(OH)3) |
| 151393941 | Aluminum hydroxide (Al(OH)3) |
| 159704775 | Aluminum hydroxide (Al(OH)3) |
| 227961515 | Aluminum hydroxide (Al(OH)3) |
| 546141622 | Aluminum hydroxide (Al(OH)3) |
| 546141688 | Aluminum hydroxide (Al(OH)3) |
| 1071843349 | Aluminum hydroxide (Al(OH)3) |
| 1344281 | Aluminum oxide (Al2O3) |
| 12522882 | Aluminum oxide (Al2O3) |
| 12737165 | Aluminum oxide (Al2O3) |
| 39354499 | Aluminum oxide (Al2O3) |
| 53809964 | Aluminum oxide (Al2O3) |
| 54352044 | Aluminum oxide (Al2O3) |
| 67853354 | Aluminum oxide (Al2O3) |
| 67894148 | Aluminum oxide (Al2O3) |
| 67894422 | Aluminum oxide (Al2O3) |
| 68189684 | Aluminum oxide (Al2O3) |
| 68389424 | Aluminum oxide (Al2O3) |
| 68389435 | Aluminum oxide (Al2O3) |
| 74871106 | Aluminum oxide (Al2O3) |
| 76363810 | Aluminum oxide (Al2O3) |
| 84149213 | Aluminum oxide (Al2O3) |
| 90669628 | Aluminum oxide (Al2O3) |
| 107462077 | Aluminum oxide (Al2O3) |
| 107874146 | Aluminum oxide (Al2O3) |
| 117314008 | Aluminum oxide (Al2O3) |
| 122784354 | Aluminum oxide (Al2O3) |
| 127361040 | Aluminum oxide (Al2O3) |
| 131689140 | Aluminum oxide (Al2O3) |
| 135152657 | Aluminum oxide (Al2O3) |
| 135667708 | Aluminum oxide (Al2O3) |
| 138361587 | Aluminum oxide (Al2O3) |
| 148619390 | Aluminum oxide (Al2O3) |
| 152743265 | Aluminum oxide (Al2O3) |
| 153858981 | Aluminum oxide (Al2O3) |
| 157516295 | Aluminum oxide (Al2O3) |
| 163581508 | Aluminum oxide (Al2O3) |
| 165390910 | Aluminum oxide (Al2O3) |
| 170448814 | Aluminum oxide (Al2O3) |
| 190401786 | Aluminum oxide (Al2O3) |
| 200295994 | Aluminum oxide (Al2O3) |
| 205316365 | Aluminum oxide (Al2O3) |
| 209552432 | Aluminum oxide (Al2O3) |
| 230616054 | Aluminum oxide (Al2O3) |
| 252756357 | Aluminum oxide (Al2O3) |
| 253606450 | Aluminum oxide (Al2O3) |
| 253606461 | Aluminum oxide (Al2O3) |
| 253606472 | Aluminum oxide (Al2O3) |
| 268724089 | Aluminum oxide (Al2O3) |
| 334869464 | Aluminum oxide (Al2O3) |
| 457654465 | Aluminum oxide (Al2O3) |
| 488831465 | Aluminum oxide (Al2O3) |
| 521982718 | Aluminum oxide (Al2O3) |
| 546141611 | Aluminum oxide (Al2O3) |
| 663170523 | Aluminum oxide (Al2O3) |
| 916225600 | Aluminum oxide (Al2O3) |
| 960377086 | Aluminum oxide (Al2O3) |
| 1011245207 | Aluminum oxide (Al2O3) |
| 1022097819 | Aluminum oxide (Al2O3) |
| 1097999444 | Aluminum oxide (Al2O3) |
| 1197416355 | Aluminum oxide (Al2O3) |
| 1234495705 | Aluminum oxide (Al2O3) |
| 1239586425 | Aluminum oxide (Al2O3) |
| 1346644152 | Aluminum oxide (Al2O3) |
| 1355357833 | Aluminum oxide (Al2O3) |
| 1493598529 | Aluminum oxide (Al2O3) |
| 11074274 | Aluminum oxide silicate (Al6O5(SiO4)2) |
| 12068563 | Aluminum oxide silicate (Al6O5(SiO4)2) |
| 64885489 | Aluminum oxide silicate (Al6O5(SiO4)2) |
| 124567028 | Aluminum oxide silicate (Al6O5(SiO4)2) |
| 163611038 | Aluminum oxide silicate (Al6O5(SiO4)2) |
| 164525319 | Aluminum oxide silicate (Al6O5(SiO4)2) |
| 220914476 | Aluminum oxide silicate (Al6O5(SiO4)2) |
| 1302450 | Aluminum phosphide (AlP) |
| 8005489 | Aluminum phosphide (AlP) |
| 20859738 | Aluminum phosphide (AlP) |
| 71751047 | Aluminum phosphide (AlP) |
| 182321386 | Aluminum phosphide (AlP) |
| 12005480 | Aluminum sodium oxide (Al11NaO17) |
| 155275528 | Aluminum sodium oxide (Al11NaO17) |
| 12005162 | Aluminum sodium oxide (Al5NaO8) |
| 142030 | Aluminum, bis(acetato-.kappa.O)hydroxy- |
| 8000611 | Aluminum, bis(acetato-.kappa.O)hydroxy- |
| 8012382 | Aluminum, bis(acetato-.kappa.O)hydroxy- |
| 7219650 | Aluminum, bis[2-(acetyloxy)benzoato-.kappa.O]hydroxy- |
| 12568728 | Aluminum, bis[2-(acetyloxy)benzoato-.kappa.O]hydroxy- |
| 23413801 | Aluminum, bis[2-(acetyloxy)benzoato-.kappa.O]hydroxy- |
| 61891325 | Aluminum, bis[2-(acetyloxy)benzoato-.kappa.O]hydroxy- |
| 1191157 | Aluminum, hydrobis(2-methylpropyl)- |
| 22537231 | Aluminum, ion (Al3+) |
| 97938 | Aluminum, triethyl- |
| 13482150 | Aluminum, triethyl- |
| 100992 | Aluminum, tris(2-methylpropyl)- |
| 130565627 | Aluminum, tris(2-methylpropyl)- |
| 18917914 | Aluminum, tris[2-(hydroxy-.kappa.O)propanoato-.kappa.O]- |
| 52100626 | Aluminum, tris[2-(hydroxy-.kappa.O)propanoato-.kappa.O]- |
| 13771227 | Aluminum, tris[tetrahydroborato(1-)-.kappa.H,.kappa.H']-, (OC-6-11)- |
| 7440359 | Americium, isotope of mass 241 |
| 14596102 | Americium, isotope of mass 241 |
| 8036484 | Amides, coco, N,N-bis(hydroxyethyl) |
| 8040311 | Amides, coco, N,N-bis(hydroxyethyl) |
| 8040333 | Amides, coco, N,N-bis(hydroxyethyl) |
| 12751063 | Amides, coco, N,N-bis(hydroxyethyl) |
| 53028629 | Amides, coco, N,N-bis(hydroxyethyl) |
| 56448727 | Amides, coco, N,N-bis(hydroxyethyl) |
| 56832667 | Amides, coco, N,N-bis(hydroxyethyl) |
| 63091316 | Amides, coco, N,N-bis(hydroxyethyl) |
| 66984585 | Amides, coco, N,N-bis(hydroxyethyl) |
| 67785108 | Amides, coco, N,N-bis(hydroxyethyl) |
| 67785142 | Amides, coco, N,N-bis(hydroxyethyl) |
| 68603429 | Amides, coco, N,N-bis(hydroxyethyl) |
| 71343516 | Amides, coco, N,N-bis(hydroxyethyl) |
| 71343710 | Amides, coco, N,N-bis(hydroxyethyl) |
| 83652146 | Amides, coco, N,N-bis(hydroxyethyl) |
| 87714189 | Amides, coco, N,N-bis(hydroxyethyl) |
| 90651471 | Amides, coco, N,N-bis(hydroxyethyl) |
| 118104135 | Amides, coco, N,N-bis(hydroxyethyl) |
| 153189696 | Amides, coco, N,N-bis(hydroxyethyl) |
| 186615781 | Amides, coco, N,N-bis(hydroxyethyl) |
| 7664417 | Ammonia |
| 8007576 | Ammonia |
| 208990072 | Ammonia |
| 214478054 | Ammonia |
| 558443520 | Ammonia |
| 7789324 | Ammonium bromide ((NH4)Br) |
| 12124979 | Ammonium bromide ((NH4)Br) |
| 14216865 | Ammonium bromide ((NH4)Br) |
| 80209354 | Ammonium bromide ((NH4)Br) |
| 101215763 | Ammonium bromide ((NH4)Br) |
| 204322883 | Ammonium bromide ((NH4)Br) |
| 252189563 | Ammonium bromide ((NH4)Br) |
| 357290881 | Ammonium bromide ((NH4)Br) |
| 12125029 | Ammonium chloride ((NH4)Cl) |
| 15630612 | Ammonium chloride ((NH4)Cl) |
| 20548087 | Ammonium chloride ((NH4)Cl) |
| 50295880 | Ammonium chloride ((NH4)Cl) |
| 55871051 | Ammonium chloride ((NH4)Cl) |
| 75944364 | Ammonium chloride ((NH4)Cl) |
| 89485847 | Ammonium chloride ((NH4)Cl) |
| 89485858 | Ammonium chloride ((NH4)Cl) |
| 127634246 | Ammonium chloride ((NH4)Cl) |
| 128532423 | Ammonium chloride ((NH4)Cl) |
| 154383489 | Ammonium chloride ((NH4)Cl) |
| 867060751 | Ammonium chloride ((NH4)Cl) |
| 1260366184 | Ammonium chloride ((NH4)Cl) |
| 1336216 | Ammonium hydroxide ((NH4)(OH)) |
| 16393490 | Ammonium hydroxide ((NH4)(OH)) |
| 125888871 | Ammonium hydroxide ((NH4)(OH)) |
| 132103607 | Ammonium hydroxide ((NH4)(OH)) |
| 178115930 | Ammonium hydroxide ((NH4)(OH)) |
| 1252662615 | Ammonium hydroxide ((NH4)(OH)) |
| 1269620598 | Ammonium hydroxide ((NH4)(OH)) |
| 1313584687 | Ammonium hydroxide ((NH4)(OH)) |
| 1398052851 | Ammonium hydroxide ((NH4)(OH)) |
| 52628258 | Ammonium zinc chloride |
| 1318098 | Amphibole-group minerals |
| 1332214 | Amphibole-group minerals |
| 1397893 | Amphotericin B |
| 30652870 | Amphotericin B |
| 57852 | Androst-4-en-3-one, 17-(1-oxopropoxy)-, (17.beta.)- |
| 1050678755 | Androst-4-en-3-one, 17-(1-oxopropoxy)-, (17.beta.)- |
| 79641 | Androst-4-en-3-one, 17-hydroxy-6-methyl-17-(1-propynyl)-, (6.alpha.,17.beta.)- |
| 434071 | Androstan-3-one, 17-hydroxy-2-(hydroxymethylene)-17-methyl-, (5.alpha.,17.beta.)- |
| 120127 | Anthracene |
| 120207 | Anthracene |
| 142041 | Anthracene |
| 602608 | Anthracene, 9-nitro- |
| 1719068 | Anthracene-d10 |
| 17111954 | Antimonate(1-), hexafluoro-, (OC-6-11)- |
| 22359882 | Antimonate(1-), hexafluoro-, (OC-6-11)- |
| 77392724 | Antimonate(1-), hexafluoro-, (OC-6-11)- |
| 304610 | Antimonate(2-), bis[.mu.-[2,3-di(hydroxy-.kappa.O)butanedioato(4-)-.kappa.O1:.kappa.O4]]di-, dipotassium, trihydrate, stereoisomer |
| 1332418 | Antimonate(2-), bis[.mu.-[2,3-di(hydroxy-.kappa.O)butanedioato(4-)-.kappa.O1:.kappa.O4]]di-, dipotassium, trihydrate, stereoisomer |
| 1332430 | Antimonate(2-), bis[.mu.-[2,3-di(hydroxy-.kappa.O)butanedioato(4-)-.kappa.O1:.kappa.O4]]di-, dipotassium, trihydrate, stereoisomer |
| 6780105 | Antimonate(2-), bis[.mu.-[2,3-di(hydroxy-.kappa.O)butanedioato(4-)-.kappa.O1:.kappa.O4]]di-, dipotassium, trihydrate, stereoisomer |
| 8012644 | Antimonate(2-), bis[.mu.-[2,3-di(hydroxy-.kappa.O)butanedioato(4-)-.kappa.O1:.kappa.O4]]di-, dipotassium, trihydrate, stereoisomer |
| 12125109 | Antimonate(2-), bis[.mu.-[2,3-di(hydroxy-.kappa.O)butanedioato(4-)-.kappa.O1:.kappa.O4]]di-, dipotassium, trihydrate, stereoisomer |
| 16039648 | Antimonate(2-), bis[.mu.-[2,3-di(hydroxy-.kappa.O)butanedioato(4-)-.kappa.O1:.kappa.O4]]di-, dipotassium, trihydrate, stereoisomer |
| 26282951 | Antimonate(2-), bis[.mu.-[2,3-di(hydroxy-.kappa.O)butanedioato(4-)-.kappa.O1:.kappa.O4]]di-, dipotassium, trihydrate, stereoisomer |
| 28300745 | Antimonate(2-), bis[.mu.-[2,3-di(hydroxy-.kappa.O)butanedioato(4-)-.kappa.O1:.kappa.O4]]di-, dipotassium, trihydrate, stereoisomer |
| 53318722 | Antimonate(2-), bis[.mu.-[2,3-di(hydroxy-.kappa.O)butanedioato(4-)-.kappa.O1:.kappa.O4]]di-, dipotassium, trihydrate, stereoisomer |
| 255877157 | Antimonate(2-), bis[.mu.-[2,3-di(hydroxy-.kappa.O)butanedioato(4-)-.kappa.O1:.kappa.O4]]di-, dipotassium, trihydrate, stereoisomer |
| 7440360 | Antimony |
| 73063679 | Antimony |
| 117011479 | Antimony |
| 7783702 | Antimony fluoride (SbF5) |
| 1327339 | Antimony oxide |
| 1309644 | Antimony oxide (Sb2O3) |
| 10042996 | Antimony oxide (Sb2O3) |
| 12423584 | Antimony oxide (Sb2O3) |
| 97048221 | Antimony oxide (Sb2O3) |
| 97048232 | Antimony oxide (Sb2O3) |
| 154396415 | Antimony oxide (Sb2O3) |
| 178989930 | Antimony oxide (Sb2O3) |
| 212793414 | Antimony oxide (Sb2O3) |
| 14374799 | Antimony, isotope of mass 122 |
| 14683104 | Antimony, isotope of mass 124 |
| 14234356 | Antimony, isotope of mass 125 |
| 13968508 | Antimony, isotope of mass 127 |
| 1397940 | Antimycin A |
| 37330191 | Antimycin A |
| 50858985 | Antimycin A |
| 506616 | Argentate(1-), bis(cyano-.kappa.C)-, potassium (1:1) |
| 2541675 | Argentate(1-), bis(cyano-.kappa.C)-, potassium (1:1) |
| 1336363 | Aroclor |
| 12767792 | Aroclor |
| 12674112 | Aroclor 1016 |
| 11104282 | Aroclor 1221 |
| 11141165 | Aroclor 1232 |
| 37324235 | Aroclor 1262 |
| 11100144 | Aroclor 1268 |
| 1264238 | Aroclor 5442 |
| 12642238 | Aroclor 5442 |
| 8042566 | Aromatic hydrocarbons |
| 8043978 | Aromatic hydrocarbons |
| 8043989 | Aromatic hydrocarbons |
| 8043990 | Aromatic hydrocarbons |
| 12738497 | Aromatic hydrocarbons |
| 37232045 | Aromatic hydrocarbons |
| 42615236 | Aromatic hydrocarbons |
| 50958286 | Aromatic hydrocarbons |
| 51990148 | Aromatic hydrocarbons |
| 52622885 | Aromatic hydrocarbons |
| 52623402 | Aromatic hydrocarbons |
| 60616980 | Aromatic hydrocarbons |
| 60937737 | Aromatic hydrocarbons |
| 63231516 | Aromatic hydrocarbons |
| 65987748 | Aromatic hydrocarbons |
| 92308140 | Aromatic hydrocarbons |
| 96538511 | Aromatic hydrocarbons |
| 102257318 | Aromatic hydrocarbons |
| 107991242 | Aromatic hydrocarbons |
| 115831873 | Aromatic hydrocarbons |
| 7784465 | Arsenenous acid, sodium salt (1:1) |
| 7440382 | Arsenic |
| 39277515 | Arsenic |
| 55624629 | Arsenic |
| 1327522 | Arsenic acid (H3AsO4) |
| 7778394 | Arsenic acid (H3AsO4) |
| 58076827 | Arsenic acid (H3AsO4) |
| 1333251 | Arsenic acid (H3AsO4), calcium salt (2:3) |
| 7778441 | Arsenic acid (H3AsO4), calcium salt (2:3) |
| 1450620866 | Arsenic acid (H3AsO4), calcium salt (2:3) |
| 10103614 | Arsenic acid (H3AsO4), copper salt (1:?) |
| 56626063 | Arsenic acid (H3AsO4), copper salt (1:?) |
| 10048950 | Arsenic acid (H3AsO4), disodium salt, heptahydrate |
| 7784409 | Arsenic acid (H3AsO4), lead(2+) salt (1:1) |
| 14034765 | Arsenic acid (H3AsO4), lead(2+) salt (1:1) |
| 37196284 | Arsenic acid (H3AsO4), lead(2+) salt (1:1) |
| 7645252 | Arsenic acid (H3AsO4), lead(4+) salt (3:2) |
| 10102484 | Arsenic acid (H3AsO4), lead(4+) salt (3:2) |
| 7631892 | Arsenic acid (H3AsO4), sodium salt (1:?) |
| 11105047 | Arsenic acid (H3AsO4), sodium salt (1:?) |
| 7440382 | Arsenic compounds |
| 8028737 | Arsenic compounds |
| 1327533 | Arsenic oxide (As2O3) |
| 28380383 | Arsenic oxide (As2O3) |
| 856307432 | Arsenic oxide (As2O3) |
| 1303282 | Arsenic oxide (As2O5) |
| 12355850 | Arsenic oxide (As2O5) |
| 13843657 | Arsenic oxide (As2O5) |
| 856565656 | Arsenic oxide (As2O5) |
| 1303339 | Arsenic sulfide (As2S3) |
| 12393612 | Arsenic sulfide (As2S3) |
| 188947559 | Arsenic sulfide (As2S3) |
| 217972775 | Arsenic sulfide (As2S3) |
| 352030729 | Arsenic sulfide (As2S3) |
| 1315336312 | Arsenic sulfide (As2S3) |
| 22541544 | Arsenic, ion (As3+) |
| 22569728 | Arsenic, ion (As3+) |
| 15422590 | Arsenic, isotope of mass 73 |
| 14304780 | Arsenic, isotope of mass 74 |
| 15575209 | Arsenic, isotope of mass 76 |
| 14687617 | Arsenic, isotope of mass 77 |
| 7784341 | Arsenous trichloride |
| 8011674 | Arsenous trichloride |
| 7784421 | Arsine |
| 692422 | Arsine, diethyl- |
| 75605 | Arsinic acid, As,As-dimethyl- |
| 8073107 | Arsinic acid, As,As-dimethyl- |
| 11126731 | Arsinic acid, As,As-dimethyl- |
| 58114731 | Arsinic acid, As,As-dimethyl- |
| 124652 | Arsinic acid, As,As-dimethyl-, sodium salt (1:1) |
| 63665225 | Arsinic acid, As,As-dimethyl-, sodium salt (1:1) |
| 127855 | Arsonic acid, (4-aminophenyl)-, monosodium salt |
| 121197 | Arsonic acid, As-(4-hydroxy-3-nitrophenyl)- |
| 8028226 | Arsonic acid, As-(4-hydroxy-3-nitrophenyl)- |
| 8028237 | Arsonic acid, As-(4-hydroxy-3-nitrophenyl)- |
| 98055 | Arsonic acid, As-phenyl- |
| 50641753 | Arsonic acid, [4-[(aminoacetyl)amino]phenyl]-, bismuth salt, mixt. with N4-(7-chloro-4-quinolinyl)-N1,N1-diethyl-1,4-pentanediamine phosphate, 5,7-diiodo-8-quinolinol and 3-pyridinecarboxamide |
| 121595 | Arsonic acid, [4-[(aminocarbonyl)amino]phenyl]- |
| 1333240 | Arsonic acid, calcium salt (1:1) |
| 52740166 | Arsonic acid, calcium salt (1:1) |
| 75348311 | Arsonic acid, calcium salt (1:1) |
| 117746551 | Arsonic acid, calcium salt (1:1) |
| 124583 | Arsonic acid, methyl-, monosodium salt |
| 2163806 | Arsonic acid, methyl-, monosodium salt |
| 10124502 | Arsonic acid, potassium salt |
| 696286 | Arsonous dichloride, As-phenyl- |
| 1332214 | Asbestos |
| 12413455 | Asbestos |
| 77641599 | Asbestos |
| 329202133 | Asbestos |
| 12001295 | Asbestos, chrysotile |
| 132207320 | Asbestos, chrysotile |
| 68131748 | Ashes (residues) |
| 68308178 | Ashes (residues) |
| 68308189 | Ashes (residues) |
| 68439849 | Ashes (residues) |
| 69012846 | Ashes (residues) |
| 329065125 | Ashes (residues) |
| 8052424 | Asphalt |
| 12197227 | Asphalt |
| 50922300 | Asphalt |
| 308062773 | Asphalt |
| 851786522 | Asphalt |
| 8052424 | Asphalt, cutback |
| 308062762 | Asphalt, cutback |
| 65195553 | Avermectin B1 |
| 71751412 | Avermectin B1 |
| 86753299 | Avermectin B1 |
| 100920727 | Avermectin B1 |
| 122666971 | Avermectin B1 |
| 138794431 | Avermectin B1 |
| 181658855 | Avermectin B1 |
| 4396274 | Azecine, decahydro- |
| 14343692 | Azide |
| 17778880 | Azide |
| 26628228 | Azide |
| 151564 | Aziridine |
| 99932760 | Aziridine |
| 52224 | Aziridine, 1,1',1''-phosphinothioylidynetris- |
| 52244 | Aziridine, 1,1',1''-phosphinothioylidynetris- |
| 75558 | Aziridine, 2-methyl- |
| 18961449 | Aziridine, 2-methyl- |
| 18961450 | Aziridine, 2-methyl- |
| 59204103 | Aziridine, 2-methyl- |
| 50077 | Azirino[2',3':3,4]pyrrolo[1,2-a]indole-4,7-dione, 6-amino-8-[[(aminocarbonyl)oxy]methyl]-1,1a,2,8,8a,8b-hexahydro-8a-methoxy-5-methyl-, (1aS,8S,8aR,8bS)- |
| 7481687 | Azirino[2',3':3,4]pyrrolo[1,2-a]indole-4,7-dione, 6-amino-8-[[(aminocarbonyl)oxy]methyl]-1,1a,2,8,8a,8b-hexahydro-8a-methoxy-5-methyl-, (1aS,8S,8aR,8bS)- |
| 74349487 | Azirino[2',3':3,4]pyrrolo[1,2-a]indole-4,7-dione, 6-amino-8-[[(aminocarbonyl)oxy]methyl]-1,1a,2,8,8a,8b-hexahydro-8a-methoxy-5-methyl-, (1aS,8S,8aR,8bS)- |
| 144085530 | Azirino[2',3':3,4]pyrrolo[1,2-a]indole-4,7-dione, 6-amino-8-[[(aminocarbonyl)oxy]methyl]-1,1a,2,8,8a,8b-hexahydro-8a-methoxy-5-methyl-, (1aS,8S,8aR,8bS)- |
| 7440393 | Barium |
| 10361372 | Barium chloride (BaCl2) |
| 10326279 | Barium chloride (BaCl2), dihydrate |
| 7440393 | Barium compounds |
| 10361372 | Barium compounds |
| 542621 | Barium cyanide (Ba(CN)2) |
| 1304285 | Barium oxide (BaO) |
| 12231515 | Barium oxide (BaO) |
| 1269419455 | Barium oxide (BaO) |
| 13981414 | Barium, isotope of mass 133 |
| 14798084 | Barium, isotope of mass 140 |
| 1318167 | Bauxite |
| 1302789 | Bentonite |
| 10043079 | Bentonite |
| 11004129 | Bentonite |
| 12198924 | Bentonite |
| 12199698 | Bentonite |
| 37320722 | Bentonite |
| 52623662 | Bentonite |
| 70131509 | Bentonite |
| 115628712 | Bentonite |
| 135945016 | Bentonite |
| 850872774 | Bentonite |
| 868047512 | Bentonite |
| 56553 | Benz[a]anthracene |
| 56564 | Benz[a]anthracene, 7,12-dimethyl- |
| 57976 | Benz[a]anthracene, 7,12-dimethyl- |
| 16238565 | Benz[a]anthracene, 7-(bromomethyl)-12-methyl- |
| 517282 | Benz[b]indeno[1,2-d]pyran-3,4,6a,9,10(6H)-pentol, 7,11b-dihydro-, (6aS,11bR)- |
| 1412197 | Benz[b]indeno[1,2-d]pyran-3,4,6a,9,10(6H)-pentol, 7,11b-dihydro-, (6aS,11bR)- |
| 22562636 | Benz[b]indeno[1,2-d]pyran-3,4,6a,9,10(6H)-pentol, 7,11b-dihydro-, (6aS,11bR)- |
| 225514 | Benz[c]acridine |
| 345623496 | Benz[c]acridine |
| 963893 | Benz[c]acridine, 7,9-dimethyl- |
| 205992 | Benz[e]acephenanthrylene |
| 858790600 | Benz[e]acephenanthrylene |
| 56832736 | Benz[e]acephenanthrylene and/or Benzo[k]fluoranthene |
| 56495 | Benz[j]aceanthrylene, 1,2-dihydro-3-methyl- |
| 345299312 | Benz[j]aceanthrylene, 1,2-dihydro-3-methyl- |
| 100527 | Benzaldehyde |
| 4460860 | Benzaldehyde, 2,4,5-trimethoxy- |
| 14374620 | Benzaldehyde, 2,4,5-trimethoxy- |
| 89985 | Benzaldehyde, 2-chloro- |
| 76341690 | Benzaldehyde, 2-chloro-4-hydroxy-3,5-dimethoxy- |
| 529204 | Benzaldehyde, 2-methyl- |
| 120149 | Benzaldehyde, 3,4-dimethoxy- |
| 121324 | Benzaldehyde, 3-ethoxy-4-hydroxy- |
| 620235 | Benzaldehyde, 3-methyl- |
| 939979 | Benzaldehyde, 4-(1,1-dimethylethyl)- |
| 34032412 | Benzaldehyde, 4-(1,1-dimethylethyl)- |
| 104881 | Benzaldehyde, 4-chloro- |
| 68359579 | Benzaldehyde, 4-fluoro-3-phenoxy- |
| 121335 | Benzaldehyde, 4-hydroxy-3-methoxy- |
| 8014424 | Benzaldehyde, 4-hydroxy-3-methoxy- |
| 52447639 | Benzaldehyde, 4-hydroxy-3-methoxy- |
| 1334787 | Benzaldehyde, methyl- |
| 8027790 | Benzaldehyde, methyl- |
| 55210 | Benzamide |
| 27208384 | Benzamide |
| 65452 | Benzamide, 2-hydroxy- |
| 527855 | Benzamide, 2-methyl- |
| 148016 | Benzamide, 2-methyl-3,5-dinitro- |
| 610151 | Benzamide, 2-nitro- |
| 11097113 | Benzamide, 3,5-dichloro-N-(1,1-dimethyl-2-propynyl)- |
| 11097124 | Benzamide, 3,5-dichloro-N-(1,1-dimethyl-2-propynyl)- |
| 23950585 | Benzamide, 3,5-dichloro-N-(1,1-dimethyl-2-propynyl)- |
| 66393622 | Benzamide, 3,5-dichloro-N-(1,1-dimethyl-2-propynyl)- |
| 645090 | Benzamide, 3-nitro- |
| 97325 | Benzamide, 4-methoxy-3-nitro-N-phenyl- |
| 619807 | Benzamide, 4-nitro- |
| 72178020 | Benzamide, 5-[2-chloro-4-(trifluoromethyl)phenoxy]-N-(methylsulfonyl)-2-nitro- |
| 108731700 | Benzamide, 5-[2-chloro-4-(trifluoromethyl)phenoxy]-N-(methylsulfonyl)-2-nitro- |
| 50657 | Benzamide, 5-chloro-N-(2-chloro-4-nitrophenyl)-2-hydroxy-, compound with 2-aminoethanol (1:1) |
| 1420048 | Benzamide, 5-chloro-N-(2-chloro-4-nitrophenyl)-2-hydroxy-, compound with 2-aminoethanol (1:1) |
| 131920 | Benzamide, N,N'-(10,15,16,17-tetrahydro-5,10,15,17-tetraoxo-5H-dinaphtho[2,3-a:2',3'-i]carbazole-4,9-diyl)bis- |
| 11098296 | Benzamide, N,N'-(10,15,16,17-tetrahydro-5,10,15,17-tetraoxo-5H-dinaphtho[2,3-a:2',3'-i]carbazole-4,9-diyl)bis- |
| 134623 | Benzamide, N,N-diethyl-3-methyl- |
| 94271031 | Benzamide, N,N-diethyl-3-methyl- |
| 671169 | Benzamide, N-(1-methylethyl)-4-[(2-methylhydrazino)methyl]- |
| 366701 | Benzamide, N-(1-methylethyl)-4-[(2-methylhydrazino)methyl]-, monohydrochloride |
| 5789720 | Benzamide, N-[(2-amino-6-methyl-3-pyridinyl)methyl]-3,4,5-trimethoxy- |
| 127719 | Benzamide, N-[(4-aminophenyl)sulfonyl]- |
| 35367385 | Benzamide, N-[[(4-chlorophenyl)amino]carbonyl]-2,6-difluoro- |
| 51026041 | Benzamide, N-[[(4-chlorophenyl)amino]carbonyl]-2,6-difluoro- |
| 53026032 | Benzamide, N-[[(4-chlorophenyl)amino]carbonyl]-2,6-difluoro- |
| 66594181 | Benzamide, N-[[(4-chlorophenyl)amino]carbonyl]-2,6-difluoro- |
| 104790810 | Benzamide, N-[[(4-chlorophenyl)amino]carbonyl]-2,6-difluoro- |
| 495181 | Benzamide, N-hydroxy- |
| 1005001 | Benzamide, N-hydroxy- |
| 613934 | Benzamide, N-methyl- |
| 4165611 | Benzen-d5-amine |
| 62533 | Benzenamine |
| 37342168 | Benzenamine |
| 146997946 | Benzenamine |
| 608275 | Benzenamine, 2,3-dichloro- |
| 87592 | Benzenamine, 2,3-dimethyl- |
| 137177 | Benzenamine, 2,4,5-trimethyl- |
| 634935 | Benzenamine, 2,4,6-trichloro- |
| 88051 | Benzenamine, 2,4,6-trimethyl- |
| 489985 | Benzenamine, 2,4,6-trinitro- |
| 1747848 | Benzenamine, 2,4-bis[(4-aminophenyl)methyl]- |
| 25834804 | Benzenamine, 2,4-bis[(4-aminophenyl)methyl]- |
| 85023296 | Benzenamine, 2,4-bis[(4-aminophenyl)methyl]- |
| 367259 | Benzenamine, 2,4-difluoro- |
| 2735048 | Benzenamine, 2,4-dimethoxy- |
| 54150695 | Benzenamine, 2,4-dimethoxy-, hydrochloride |
| 95681 | Benzenamine, 2,4-dimethyl- |
| 97029 | Benzenamine, 2,4-dinitro- |
| 95829 | Benzenamine, 2,5-dichloro- |
| 95783 | Benzenamine, 2,5-dimethyl- |
| 99309 | Benzenamine, 2,6-dichloro-4-nitro- |
| 102307 | Benzenamine, 2,6-dichloro-4-nitro- |
| 58916704 | Benzenamine, 2,6-dichloro-4-nitro- |
| 1135443694 | Benzenamine, 2,6-dichloro-4-nitro- |
| 87627 | Benzenamine, 2,6-dimethyl- |
| 1123533243 | Benzenamine, 2,6-dimethyl- |
| 1582098 | Benzenamine, 2,6-dinitro-N,N-dipropyl-4-(trifluoromethyl)- |
| 39300533 | Benzenamine, 2,6-dinitro-N,N-dipropyl-4-(trifluoromethyl)- |
| 52627528 | Benzenamine, 2,6-dinitro-N,N-dipropyl-4-(trifluoromethyl)- |
| 61373953 | Benzenamine, 2,6-dinitro-N,N-dipropyl-4-(trifluoromethyl)- |
| 71281306 | Benzenamine, 2,6-dinitro-N,N-dipropyl-4-(trifluoromethyl)- |
| 75635233 | Benzenamine, 2,6-dinitro-N,N-dipropyl-4-(trifluoromethyl)- |
| 643287 | Benzenamine, 2-(1-methylethyl)- |
| 1817738 | Benzenamine, 2-bromo-4,6-dinitro- |
| 95512 | Benzenamine, 2-chloro- |
| 108429 | Benzenamine, 2-chloro- |
| 121879 | Benzenamine, 2-chloro-4-nitro- |
| 94702 | Benzenamine, 2-ethoxy- |
| 578541 | Benzenamine, 2-ethyl- |
| 90040 | Benzenamine, 2-methoxy- |
| 134292 | Benzenamine, 2-methoxy- |
| 134292 | Benzenamine, 2-methoxy-, hydrochloride |
| 120718 | Benzenamine, 2-methoxy-5-methyl- |
| 99592 | Benzenamine, 2-methoxy-5-nitro- |
| 52756544 | Benzenamine, 2-methoxy-5-nitro- |
| 95534 | Benzenamine, 2-methyl- |
| 636215 | Benzenamine, 2-methyl-, hydrochloride (1:1) |
| 603838 | Benzenamine, 2-methyl-3-nitro- |
| 97563 | Benzenamine, 2-methyl-4-[2-(2-methylphenyl)diazenyl]- |
| 28676133 | Benzenamine, 2-methyl-4-[2-(2-methylphenyl)diazenyl]- |
| 99525 | Benzenamine, 2-methyl-4-nitro- |
| 99558 | Benzenamine, 2-methyl-5-nitro- |
| 570241 | Benzenamine, 2-methyl-6-nitro- |
| 88744 | Benzenamine, 2-nitro- |
| 119755 | Benzenamine, 2-nitro-N-phenyl- |
| 95761 | Benzenamine, 3,4-dichloro- |
| 6315895 | Benzenamine, 3,4-dimethoxy- |
| 95647 | Benzenamine, 3,4-dimethyl- |
| 108690 | Benzenamine, 3,5-dimethyl- |
| 98168 | Benzenamine, 3-(trifluoromethyl)- |
| 108429 | Benzenamine, 3-chloro- |
| 1083238510 | Benzenamine, 3-chloro- |
| 95749 | Benzenamine, 3-chloro-4-methyl- |
| 621330 | Benzenamine, 3-ethoxy- |
| 536903 | Benzenamine, 3-methoxy- |
| 918666974 | Benzenamine, 3-methoxy- |
| 16452010 | Benzenamine, 3-methoxy-4-methyl- |
| 108441 | Benzenamine, 3-methyl- |
| 638039 | Benzenamine, 3-methyl-, hydrochloride |
| 99092 | Benzenamine, 3-nitro- |
| 12262634 | Benzenamine, 3-nitro- |
| 479732 | Benzenamine, 4,4'-[(4-imino-2,5-cyclohexadien-1-ylidene)methylene]bis-, hydrochloride (1:1) |
| 569619 | Benzenamine, 4,4'-[(4-imino-2,5-cyclohexadien-1-ylidene)methylene]bis-, hydrochloride (1:1) |
| 70426607 | Benzenamine, 4,4'-[(4-imino-2,5-cyclohexadien-1-ylidene)methylene]bis-, hydrochloride (1:1) |
| 131883551 | Benzenamine, 4,4'-[(4-imino-2,5-cyclohexadien-1-ylidene)methylene]bis-, hydrochloride (1:1) |
| 187112409 | Benzenamine, 4,4'-[(4-imino-2,5-cyclohexadien-1-ylidene)methylene]bis-, hydrochloride (1:1) |
| 492808 | Benzenamine, 4,4'-carbonimidoylbis[N,N-dimethyl- |
| 2465272 | Benzenamine, 4,4'-carbonimidoylbis[N,N-dimethyl- |
| 105913608 | Benzenamine, 4,4'-carbonimidoylbis[N,N-dimethyl- |
| 101779 | Benzenamine, 4,4'-methylenebis- |
| 28602611 | Benzenamine, 4,4'-methylenebis- |
| 83712441 | Benzenamine, 4,4'-methylenebis- |
| 120859327 | Benzenamine, 4,4'-methylenebis- |
| 136601304 | Benzenamine, 4,4'-methylenebis- |
| 148263712 | Benzenamine, 4,4'-methylenebis- |
| 13552448 | Benzenamine, 4,4'-methylenebis-, hydrochloride (1:2) |
| 158963907 | Benzenamine, 4,4'-methylenebis-, hydrochloride (1:2) |
| 101144 | Benzenamine, 4,4'-methylenebis[2-chloro- |
| 104144 | Benzenamine, 4,4'-methylenebis[2-chloro- |
| 29371140 | Benzenamine, 4,4'-methylenebis[2-chloro- |
| 51065077 | Benzenamine, 4,4'-methylenebis[2-chloro- |
| 78642656 | Benzenamine, 4,4'-methylenebis[2-chloro- |
| 126699692 | Benzenamine, 4,4'-methylenebis[2-chloro- |
| 142661367 | Benzenamine, 4,4'-methylenebis[2-chloro- |
| 913092918 | Benzenamine, 4,4'-methylenebis[2-chloro- |
| 101611 | Benzenamine, 4,4'-methylenebis[N,N-dimethyl- |
| 30135649 | Benzenamine, 4,4'-methylenebis[N,N-dimethyl- |
| 101804 | Benzenamine, 4,4'-oxybis- |
| 121509793 | Benzenamine, 4,4'-oxybis- |
| 928208611 | Benzenamine, 4,4'-oxybis- |
| 80080 | Benzenamine, 4,4'-sulfonylbis- |
| 1246638152 | Benzenamine, 4,4'-sulfonylbis- |
| 139651 | Benzenamine, 4,4'-thiobis- |
| 101735 | Benzenamine, 4-(1-methylethoxy)-N-phenyl- |
| 33820530 | Benzenamine, 4-(1-methylethyl)-2,6-dinitro-N,N-dipropyl- |
| 34113218 | Benzenamine, 4-(1-methylethyl)-2,6-dinitro-N,N-dipropyl- |
| 60093 | Benzenamine, 4-(2-phenyldiazenyl)- |
| 81691681 | Benzenamine, 4-(2-phenyldiazenyl)- |
| 92364 | Benzenamine, 4-(6-methyl-2-benzothiazolyl)- |
| 632995 | Benzenamine, 4-[(4-aminophenyl)(4-imino-2,5-cyclohexadien-1-ylidene)methyl]-2-methyl-, hydrochloride (1:1) |
| 8053096 | Benzenamine, 4-[(4-aminophenyl)(4-imino-2,5-cyclohexadien-1-ylidene)methyl]-2-methyl-, hydrochloride (1:1) |
| 147299783 | Benzenamine, 4-[(4-aminophenyl)(4-imino-2,5-cyclohexadien-1-ylidene)methyl]-2-methyl-, hydrochloride (1:1) |
| 884244751 | Benzenamine, 4-[(4-aminophenyl)(4-imino-2,5-cyclohexadien-1-ylidene)methyl]-2-methyl-, hydrochloride (1:1) |
| 106401 | Benzenamine, 4-bromo- |
| 26227736 | Benzenamine, 4-butyl-N-[(4-methoxyphenyl)methylene]- |
| 128758963 | Benzenamine, 4-butyl-N-[(4-methoxyphenyl)methylene]- |
| 106478 | Benzenamine, 4-chloro- |
| 95692 | Benzenamine, 4-chloro-2-methyl- |
| 3165933 | Benzenamine, 4-chloro-2-methyl-, hydrochloride (1:1) |
| 89634 | Benzenamine, 4-chloro-2-nitro- |
| 156434 | Benzenamine, 4-ethoxy- |
| 589162 | Benzenamine, 4-ethyl- |
| 104949 | Benzenamine, 4-methoxy- |
| 20265978 | Benzenamine, 4-methoxy-, hydrochloride (1:1) |
| 102501 | Benzenamine, 4-methoxy-2-methyl- |
| 101702 | Benzenamine, 4-methoxy-N-(4-methoxyphenyl)- |
| 106490 | Benzenamine, 4-methyl- |
| 12221033 | Benzenamine, 4-methyl- |
| 540238 | Benzenamine, 4-methyl-, hydrochloride (1:1) |
| 89623 | Benzenamine, 4-methyl-2-nitro- |
| 119324 | Benzenamine, 4-methyl-3-nitro- |
| 100016 | Benzenamine, 4-nitro- |
| 156105 | Benzenamine, 4-nitroso-N-phenyl- |
| 101677 | Benzenamine, 4-octyl-N-(4-octylphenyl)- |
| 95794 | Benzenamine, 5-chloro-2-methyl- |
| 578461 | Benzenamine, 5-methyl-2-nitro- |
| 54886 | Benzenamine, N,N,3-trimethyl-4-(phenylazo)- |
| 91667 | Benzenamine, N,N-diethyl- |
| 54289462 | Benzenamine, N,N-diethyl-4-[2-(5-nitro-2-thiazolyl)diazenyl]- |
| 109048944 | Benzenamine, N,N-diethyl-4-[2-(5-nitro-2-thiazolyl)diazenyl]- |
| 121697 | Benzenamine, N,N-dimethyl- |
| 162744630 | Benzenamine, N,N-dimethyl- |
| 168153217 | Benzenamine, N,N-dimethyl- |
| 171745678 | Benzenamine, N,N-dimethyl- |
| 60117 | Benzenamine, N,N-dimethyl-4-(2-phenyldiazenyl)- |
| 55964959 | Benzenamine, N,N-dimethyl-4-(2-phenyldiazenyl)- |
| 77126002 | Benzenamine, N,N-dimethyl-4-(2-phenyldiazenyl)- |
| 3731393 | Benzenamine, N,N-dimethyl-4-[(2-methylphenyl)azo]- |
| 138896 | Benzenamine, N,N-dimethyl-4-nitroso- |
| 603349 | Benzenamine, N,N-diphenyl- |
| 149006348 | Benzenamine, N,N-diphenyl- |
| 39336602 | Benzenamine, N-(1-ethylpropyl)-3,4-dimethyl-2,6-dinitro- |
| 40487421 | Benzenamine, N-(1-ethylpropyl)-3,4-dimethyl-2,6-dinitro- |
| 64667170 | Benzenamine, N-(1-ethylpropyl)-3,4-dimethyl-2,6-dinitro- |
| 64719411 | Benzenamine, N-(1-ethylpropyl)-3,4-dimethyl-2,6-dinitro- |
| 155421402 | Benzenamine, N-(1-ethylpropyl)-3,4-dimethyl-2,6-dinitro- |
| 768525 | Benzenamine, N-(1-methylethyl)- |
| 24458488 | Benzenamine, N-(2-methyl-2-nitropropyl)-4-nitroso- |
| 29743155 | Benzenamine, N-[(4-butoxyphenyl)methylene]-4-ethyl- |
| 1861401 | Benzenamine, N-butyl-N-ethyl-2,6-dinitro-4-(trifluoromethyl)- |
| 66152770 | Benzenamine, N-butyl-N-ethyl-2,6-dinitro-4-(trifluoromethyl)- |
| 87209903 | Benzenamine, N-butyl-N-ethyl-2,6-dinitro-4-(trifluoromethyl)- |
| 103695 | Benzenamine, N-ethyl- |
| 3665803 | Benzenamine, N-ethyl-4-nitro- |
| 55283686 | Benzenamine, N-ethyl-N-(2-methyl-2-propen-1-yl)-2,6-dinitro-4-(trifluoromethyl)- |
| 612646 | Benzenamine, N-ethyl-N-nitroso- |
| 100652 | Benzenamine, N-hydroxy- |
| 135206 | Benzenamine, N-hydroxy-N-nitroso-, ammonium salt (1:1) |
| 7564707 | Benzenamine, N-hydroxy-N-nitroso-, ammonium salt (1:1) |
| 21255914 | Benzenamine, N-hydroxy-N-nitroso-, ammonium salt (1:1) |
| 125141562 | Benzenamine, N-hydroxy-N-nitroso-, ammonium salt (1:1) |
| 862780685 | Benzenamine, N-hydroxy-N-nitroso-, ammonium salt (1:1) |
| 1313437272 | Benzenamine, N-hydroxy-N-nitroso-, ammonium salt (1:1) |
| 100618 | Benzenamine, N-methyl- |
| 100152 | Benzenamine, N-methyl-4-nitro- |
| 479458 | Benzenamine, N-methyl-N,2,4,6-tetranitro- |
| 614006 | Benzenamine, N-methyl-N-nitroso- |
| 86306 | Benzenamine, N-nitroso-N-phenyl- |
| 156105 | Benzenamine, N-nitroso-N-phenyl- |
| 122394 | Benzenamine, N-phenyl- |
| 1135443741 | Benzenamine, N-phenyl- |
| 1300738 | Benzenamine, ar,ar-dimethyl- |
| 1330738 | Benzenamine, ar,ar-dimethyl- |
| 29191524 | Benzenamine, ar-methoxy- |
| 25640748 | Benzenamine, ar-methyl- |
| 26915128 | Benzenamine, ar-methyl- |
| 142041 | Benzenamine, hydrochloride (1:1) |
| 1415719731 | Benzenamine, hydrochloride (1:1) |
| 71432 | Benzene |
| 54682869 | Benzene |
| 174973661 | Benzene |
| 1053658437 | Benzene |
| 98066 | Benzene, (1,1-dimethylethyl)- |
| 27138212 | Benzene, (1,1-dimethylethyl)methyl- |
| 98839 | Benzene, (1-methylethenyl)- |
| 90828 | Benzene, (1-methylethyl)- |
| 98828 | Benzene, (1-methylethyl)- |
| 98839 | Benzene, (1-methylethyl)- |
| 135988 | Benzene, (1-methylpropyl)- |
| 135989 | Benzene, (1-methylpropyl)- |
| 36383150 | Benzene, (1-methylpropyl)- |
| 7166190 | Benzene, (2-bromo-2-nitroethenyl)- |
| 102965 | Benzene, (2-nitroethenyl)- |
| 100390 | Benzene, (bromomethyl)- |
| 1401918817 | Benzene, (bromomethyl)- |
| 447 | Benzene, (chloromethyl)- |
| 100447 | Benzene, (chloromethyl)- |
| 98873 | Benzene, (dichloromethyl)- |
| 149746 | Benzene, (dichloromethylsilyl)- |
| 155684416 | Benzene, (dichloromethylsilyl)- |
| 199330988 | Benzene, (dichloromethylsilyl)- |
| 3027212 | Benzene, (dimethoxymethylsilyl)- |
| 98077 | Benzene, (trichloromethyl)- |
| 98088 | Benzene, (trifluoromethyl)- |
| 98157 | Benzene, (trifluoromethyl)- |
| 569573 | Benzene, 1,1',1''-(1-chloro-1-ethenyl-2-ylidene)tris[4-methoxy- |
| 58720 | Benzene, 1,1',1''-(1-ethenyl-2-ylidene)tris- |
| 103300 | Benzene, 1,1'-(1E)-1,2-ethenediylbis- |
| 645498 | Benzene, 1,1'-(1Z)-1,2-ethenediylbis- |
| 50293 | Benzene, 1,1'-(2,2,2-trichloroethylidene)bis[4-chloro- |
| 1081843153 | Benzene, 1,1'-(2,2,2-trichloroethylidene)bis[4-chloro- |
| 72435 | Benzene, 1,1'-(2,2,2-trichloroethylidene)bis[4-methoxy- |
| 72548 | Benzene, 1,1'-(2,2-dichloroethylidene)bis[4-chloro- |
| 3547044 | Benzene, 1,1'-(2,2-dichloroethylidene)bis[4-chloro- |
| 6088513 | Benzene, 1,1'-(2,2-dichloroethylidene)bis[4-chloro- |
| 72560 | Benzene, 1,1'-(2,2-dichloroethylidene)bis[4-ethyl- |
| 72559 | Benzene, 1,1'-(dichloroethenylidene)bis[4-chloro- |
| 3547044 | Benzene, 1,1'-(dichloroethenylidene)bis[4-chloro- |
| 37853591 | Benzene, 1,1'-[1,2-ethanediylbis(oxy)]bis[2,4,6-tribromo- |
| 59764362 | Benzene, 1,1'-[1,2-ethanediylbis(oxy)]bis[2,4,6-tribromo- |
| 70226425 | Benzene, 1,1'-[1,2-ethanediylbis(oxy)]bis[2,4,6-tribromo- |
| 1071720507 | Benzene, 1,1'-[1,2-ethanediylbis(oxy)]bis[2,4,6-tribromo- |
| 538749 | Benzene, 1,1'-[thiobis(methylene)]bis- |
| 211578040 | Benzene, 1,1'-ethylidenebis-, isopropylated, distn. residues |
| 101688 | Benzene, 1,1'-methylenebis[4-isocyanato- |
| 140494 | Benzene, 1,1'-methylenebis[4-isocyanato- |
| 53633140 | Benzene, 1,1'-methylenebis[4-isocyanato- |
| 55157410 | Benzene, 1,1'-methylenebis[4-isocyanato- |
| 57460669 | Benzene, 1,1'-methylenebis[4-isocyanato- |
| 77090483 | Benzene, 1,1'-methylenebis[4-isocyanato- |
| 88001949 | Benzene, 1,1'-methylenebis[4-isocyanato- |
| 97568337 | Benzene, 1,1'-methylenebis[4-isocyanato- |
| 142690071 | Benzene, 1,1'-methylenebis[4-isocyanato- |
| 153986891 | Benzene, 1,1'-methylenebis[4-isocyanato- |
| 201528770 | Benzene, 1,1'-methylenebis[4-isocyanato- |
| 1211266599 | Benzene, 1,1'-methylenebis[4-isocyanato- |
| 1211316641 | Benzene, 1,1'-methylenebis[4-isocyanato- |
| 1220313654 | Benzene, 1,1'-methylenebis[4-isocyanato- |
| 1400594708 | Benzene, 1,1'-methylenebis[4-isocyanato- |
| 12125472 | Benzene, 1,1'-methylenebis[isocyanato- |
| 26447405 | Benzene, 1,1'-methylenebis[isocyanato- |
| 28515380 | Benzene, 1,1'-methylenebis[isocyanato- |
| 65916894 | Benzene, 1,1'-methylenebis[isocyanato- |
| 156580595 | Benzene, 1,1'-methylenebis[isocyanato- |
| 327155873 | Benzene, 1,1'-methylenebis[isocyanato- |
| 101848 | Benzene, 1,1'-oxybis- |
| 31242930 | Benzene, 1,1'-oxybis-, hexachloro deriv. |
| 55720995 | Benzene, 1,1'-oxybis-, hexachloro deriv. |
| 32534819 | Benzene, 1,1'-oxybis-, pentabromo deriv. |
| 132405960 | Benzene, 1,1'-oxybis-, pentabromo deriv. |
| 134206432 | Benzene, 1,1'-oxybis-, pentabromo deriv. |
| 95807 | Benzene, 1,1'-oxybis[2,3,4,5,6-pentabromo- |
| 1163195 | Benzene, 1,1'-oxybis[2,3,4,5,6-pentabromo- |
| 109945702 | Benzene, 1,1'-oxybis[2,3,4,5,6-pentabromo- |
| 145538745 | Benzene, 1,1'-oxybis[2,3,4,5,6-pentabromo- |
| 1201677328 | Benzene, 1,1'-oxybis[2,3,4,5,6-pentabromo- |
| 127639 | Benzene, 1,1'-sulfonylbis- |
| 87821 | Benzene, 1,2,3,4,5,6-hexabromo- |
| 118741 | Benzene, 1,2,3,4,5,6-hexachloro- |
| 38380073 | Benzene, 1,2,3,4,5,6-hexachloro- |
| 1135443456 | Benzene, 1,2,3,4,5,6-hexachloro- |
| 87854 | Benzene, 1,2,3,4,5,6-hexamethyl- |
| 46010495 | Benzene, 1,2,3,4,5,6-hexamethyl- |
| 85223 | Benzene, 1,2,3,4,5-pentabromo-6-ethyl- |
| 87832 | Benzene, 1,2,3,4,5-pentabromo-6-methyl- |
| 26101973 | Benzene, 1,2,3,4,5-pentabromo-6-methyl- |
| 608935 | Benzene, 1,2,3,4,5-pentachloro- |
| 82688 | Benzene, 1,2,3,4,5-pentachloro-6-nitro- |
| 39378262 | Benzene, 1,2,3,4,5-pentachloro-6-nitro- |
| 55353349 | Benzene, 1,2,3,4,5-pentachloro-6-nitro- |
| 56573570 | Benzene, 1,2,3,4,5-pentachloro-6-nitro- |
| 1135443489 | Benzene, 1,2,3,4,5-pentachloro-6-nitro- |
| 95943 | Benzene, 1,2,3,4-tetrachloro- |
| 634662 | Benzene, 1,2,3,4-tetrachloro- |
| 89939093 | Benzene, 1,2,3,4-tetrachloro-5-(trichloroethenyl)- |
| 879390 | Benzene, 1,2,3,4-tetrachloro-5-nitro- |
| 634902 | Benzene, 1,2,3,5-tetrachloro- |
| 87616 | Benzene, 1,2,3-trichloro- |
| 108907 | Benzene, 1,2,3-trichloro- |
| 17700093 | Benzene, 1,2,3-trichloro-4-nitro- |
| 526738 | Benzene, 1,2,3-trimethyl- |
| 95943 | Benzene, 1,2,4,5-tetrachloro- |
| 2438882 | Benzene, 1,2,4,5-tetrachloro-3-methoxy-6-nitro- |
| 117180 | Benzene, 1,2,4,5-tetrachloro-3-nitro- |
| 95932 | Benzene, 1,2,4,5-tetramethyl- |
| 120821 | Benzene, 1,2,4-trichloro- |
| 116290 | Benzene, 1,2,4-trichloro-5-[(4-chlorophenyl)sulfonyl]- |
| 89690 | Benzene, 1,2,4-trichloro-5-nitro- |
| 877441 | Benzene, 1,2,4-triethyl- |
| 95636 | Benzene, 1,2,4-trimethyl- |
| 95501 | Benzene, 1,2-dichloro- |
| 3209221 | Benzene, 1,2-dichloro-3-nitro- |
| 99547 | Benzene, 1,2-dichloro-4-nitro- |
| 93152 | Benzene, 1,2-dimethoxy-4-(2-propen-1-yl)- |
| 95476 | Benzene, 1,2-dimethyl- |
| 83410 | Benzene, 1,2-dimethyl-3-nitro- |
| 99514 | Benzene, 1,2-dimethyl-4-nitro- |
| 528290 | Benzene, 1,2-dinitro- |
| 179601231 | Benzene, 1,3(or 1,4)-dimethyl- |
| 108703 | Benzene, 1,3,5-trichloro- |
| 18708708 | Benzene, 1,3,5-trichloro-2-nitro- |
| 108678 | Benzene, 1,3,5-trimethyl- |
| 99354 | Benzene, 1,3,5-trinitro- |
| 856948613 | Benzene, 1,3,5-trinitro- |
| 541731 | Benzene, 1,3-dichloro- |
| 81196 | Benzene, 1,3-dichloro-2-(dichloromethyl)- |
| 108576 | Benzene, 1,3-diethenyl- |
| 91087 | Benzene, 1,3-diisocyanato-2-methyl- |
| 137091340 | Benzene, 1,3-diisocyanato-2-methyl- |
| 1321397 | Benzene, 1,3-diisocyanatomethyl- |
| 25321340 | Benzene, 1,3-diisocyanatomethyl- |
| 26471625 | Benzene, 1,3-diisocyanatomethyl- |
| 29033292 | Benzene, 1,3-diisocyanatomethyl- |
| 50853479 | Benzene, 1,3-diisocyanatomethyl- |
| 50985245 | Benzene, 1,3-diisocyanatomethyl- |
| 71215639 | Benzene, 1,3-diisocyanatomethyl- |
| 72214347 | Benzene, 1,3-diisocyanatomethyl- |
| 80498233 | Benzene, 1,3-diisocyanatomethyl- |
| 89698920 | Benzene, 1,3-diisocyanatomethyl- |
| 104213334 | Benzene, 1,3-diisocyanatomethyl- |
| 110681066 | Benzene, 1,3-diisocyanatomethyl- |
| 136154228 | Benzene, 1,3-diisocyanatomethyl- |
| 1186289235 | Benzene, 1,3-diisocyanatomethyl- |
| 1204229139 | Benzene, 1,3-diisocyanatomethyl- |
| 1204746086 | Benzene, 1,3-diisocyanatomethyl- |
| 1211316674 | Benzene, 1,3-diisocyanatomethyl- |
| 1326716942 | Benzene, 1,3-diisocyanatomethyl- |
| 1421949894 | Benzene, 1,3-diisocyanatomethyl- |
| 1422250416 | Benzene, 1,3-diisocyanatomethyl- |
| 1422343790 | Benzene, 1,3-diisocyanatomethyl- |
| 1432062264 | Benzene, 1,3-diisocyanatomethyl- |
| 108383 | Benzene, 1,3-dimethyl- |
| 81209 | Benzene, 1,3-dimethyl-2-nitro- |
| 99127 | Benzene, 1,3-dimethyl-5-nitro- |
| 99650 | Benzene, 1,3-dinitro- |
| 106467 | Benzene, 1,4-dichloro- |
| 2675776 | Benzene, 1,4-dichloro-2,5-dimethoxy- |
| 105055 | Benzene, 1,4-diethyl- |
| 104494 | Benzene, 1,4-diisocyanato- |
| 51807239 | Benzene, 1,4-diisocyanato- |
| 150787 | Benzene, 1,4-dimethoxy- |
| 106423 | Benzene, 1,4-dimethyl- |
| 89587 | Benzene, 1,4-dimethyl-2-nitro- |
| 35254683 | Benzene, 1,4-dimethyl-2-nitro- |
| 100254 | Benzene, 1,4-dinitro- |
| 83669 | Benzene, 1-(1,1-dimethylethyl)-2-methoxy-4-methyl-3,5-dinitro- |
| 98511 | Benzene, 1-(1,1-dimethylethyl)-4-methyl- |
| 612237 | Benzene, 1-(chloromethyl)-2-nitro- |
| 619238 | Benzene, 1-(chloromethyl)-3-nitro- |
| 100141 | Benzene, 1-(chloromethyl)-4-nitro- |
| 95465 | Benzene, 1-bromo-2-methyl- |
| 591173 | Benzene, 1-bromo-3-methyl- |
| 460004 | Benzene, 1-bromo-4-fluoro- |
| 106387 | Benzene, 1-bromo-4-methyl- |
| 101553 | Benzene, 1-bromo-4-phenoxy- |
| 97007 | Benzene, 1-chloro-2,4-dinitro- |
| 611198 | Benzene, 1-chloro-2-(chloromethyl)- |
| 40380152 | Benzene, 1-chloro-2-(chloromethyl)- |
| 88164 | Benzene, 1-chloro-2-(trifluoromethyl)- |
| 789026 | Benzene, 1-chloro-2-[2,2,2-trichloro-1-(4-chlorophenyl)ethyl]- |
| 58633173 | Benzene, 1-chloro-2-[2,2,2-trichloro-1-(4-chlorophenyl)ethyl]- |
| 3424826 | Benzene, 1-chloro-2-[2,2-dichloro-1-(4-chlorophenyl)ethenyl]- |
| 53190 | Benzene, 1-chloro-2-[2,2-dichloro-1-(4-chlorophenyl)ethyl]- |
| 1331288 | Benzene, 1-chloro-2-ethenyl- |
| 2039874 | Benzene, 1-chloro-2-ethenyl- |
| 95498 | Benzene, 1-chloro-2-methyl- |
| 88733 | Benzene, 1-chloro-2-nitro- |
| 121175 | Benzene, 1-chloro-2-nitro-4-(trifluoromethyl)- |
| 98157 | Benzene, 1-chloro-3-(trifluoromethyl)- |
| 108418 | Benzene, 1-chloro-3-methyl- |
| 121733 | Benzene, 1-chloro-3-nitro- |
| 123091 | Benzene, 1-chloro-4-(methylthio)- |
| 5216251 | Benzene, 1-chloro-4-(trichloromethyl)- |
| 98566 | Benzene, 1-chloro-4-(trifluoromethyl)- |
| 92709165 | Benzene, 1-chloro-4-(trifluoromethyl)- |
| 104121 | Benzene, 1-chloro-4-isocyanato- |
| 106434 | Benzene, 1-chloro-4-methyl- |
| 100005 | Benzene, 1-chloro-4-nitro- |
| 25167935 | Benzene, 1-chloro-4-nitro- |
| 7005723 | Benzene, 1-chloro-4-phenoxy- |
| 611143 | Benzene, 1-ethyl-2-methyl- |
| 620144 | Benzene, 1-ethyl-3-methyl- |
| 622968 | Benzene, 1-ethyl-4-methyl- |
| 70348 | Benzene, 1-fluoro-2,4-dinitro- |
| 91236 | Benzene, 1-methoxy-2-nitro- |
| 35973138 | Benzene, 1-methoxy-2-nitro- |
| 104461 | Benzene, 1-methoxy-4-(1-propen-1-yl)- |
| 8022080 | Benzene, 1-methoxy-4-(1-propen-1-yl)- |
| 12002403 | Benzene, 1-methoxy-4-(1-propen-1-yl)- |
| 140670 | Benzene, 1-methoxy-4-(2-propen-1-yl)- |
| 1407278 | Benzene, 1-methoxy-4-(2-propen-1-yl)- |
| 77525189 | Benzene, 1-methoxy-4-(2-propen-1-yl)- |
| 121142 | Benzene, 1-methyl-2,4-dinitro- |
| 88722 | Benzene, 1-methyl-2-nitro- |
| 57158051 | Benzene, 1-methyl-2-nitro- |
| 99081 | Benzene, 1-methyl-3-nitro- |
| 554847 | Benzene, 1-methyl-3-nitro- |
| 99865 | Benzene, 1-methyl-4-(1-methylethyl)- |
| 99876 | Benzene, 1-methyl-4-(1-methylethyl)- |
| 25155151 | Benzene, 1-methyl-4-(1-methylethyl)- |
| 99990 | Benzene, 1-methyl-4-nitro- |
| 384225 | Benzene, 1-nitro-2-(trifluoromethyl)- |
| 98464 | Benzene, 1-nitro-3-(trifluoromethyl)- |
| 1836755 | Benzene, 2,4-dichloro-1-(4-nitrophenoxy)- |
| 51274078 | Benzene, 2,4-dichloro-1-(4-nitrophenoxy)- |
| 95738 | Benzene, 2,4-dichloro-1-methyl- |
| 611063 | Benzene, 2,4-dichloro-1-nitro- |
| 86919 | Benzene, 2,4-diisocyanato-1-methyl- |
| 584840 | Benzene, 2,4-diisocyanato-1-methyl- |
| 584849 | Benzene, 2,4-diisocyanato-1-methyl- |
| 59539763 | Benzene, 2,4-diisocyanato-1-methyl- |
| 856307567 | Benzene, 2,4-diisocyanato-1-methyl- |
| 1358624380 | Benzene, 2,4-diisocyanato-1-methyl- |
| 89872 | Benzene, 2,4-dimethyl-1-nitro- |
| 25245345 | Benzene, 2-bromo-1,4-dimethoxy- |
| 88880 | Benzene, 2-chloro-1,3,5-trinitro- |
| 393759 | Benzene, 2-chloro-1,3-dinitro-5-(trifluoromethyl)- |
| 42874033 | Benzene, 2-chloro-1-(3-ethoxy-4-nitrophenoxy)-4-(trifluoromethyl)- |
| 55599401 | Benzene, 2-chloro-1-(3-ethoxy-4-nitrophenoxy)-4-(trifluoromethyl)- |
| 55840249 | Benzene, 2-chloro-1-(3-ethoxy-4-nitrophenoxy)-4-(trifluoromethyl)- |
| 118967 | Benzene, 2-methyl-1,3,5-trinitro- |
| 606202 | Benzene, 2-methyl-1,3-dinitro- |
| 28347139 | Benzene, bis(chloromethyl)- |
| 10861 | Benzene, bromo- |
| 108861 | Benzene, bromo- |
| 104518 | Benzene, butyl- |
| 74296325 | Benzene, butyl- |
| 108907 | Benzene, chloro- |
| 1089070 | Benzene, chloro- |
| 50717458 | Benzene, chloro- |
| 1331288 | Benzene, chloroethenyl- |
| 8063965 | Benzene, chloroethenyl- |
| 25338890 | Benzene, chloroethenyl- |
| 27213805 | Benzene, chloroethenyl- |
| 50973643 | Benzene, chloroethenyl- |
| 25168052 | Benzene, chloromethyl- |
| 27987139 | Benzene, chloromethyl- |
| 25167935 | Benzene, chloronitro- |
| 30498352 | Benzene, dichloro(trifluoromethyl)- |
| 25321226 | Benzene, dichloro- |
| 29797408 | Benzene, dichloromethyl- |
| 37808212 | Benzene, dichloromethyl- |
| 1321740 | Benzene, diethenyl- |
| 61804500 | Benzene, diethenyl- |
| 142315591 | Benzene, diethenyl- |
| 1161074323 | Benzene, diethenyl- |
| 1300829 | Benzene, diethyl- |
| 25340174 | Benzene, diethyl- |
| 1330207 | Benzene, dimethyl- |
| 8026093 | Benzene, dimethyl- |
| 36059219 | Benzene, dimethyl-, tetrabromo deriv. |
| 25154545 | Benzene, dinitro- |
| 121013 | Benzene, dodecyl- |
| 123013 | Benzene, dodecyl- |
| 28776387 | Benzene, dodecyl- |
| 97234 | Benzene, ethenyl- |
| 100425 | Benzene, ethenyl- |
| 79637119 | Benzene, ethenyl- |
| 1161074301 | Benzene, ethenyl- |
| 1198090468 | Benzene, ethenyl- |
| 1453489934 | Benzene, ethenyl- |
| 61255810 | Benzene, ethenyl-, heptachloro deriv. |
| 9003536 | Benzene, ethenyl-, homopolymer |
| 9044648 | Benzene, ethenyl-, homopolymer |
| 9055918 | Benzene, ethenyl-, homopolymer |
| 11120460 | Benzene, ethenyl-, homopolymer |
| 12627111 | Benzene, ethenyl-, homopolymer |
| 25038602 | Benzene, ethenyl-, homopolymer |
| 39470876 | Benzene, ethenyl-, homopolymer |
| 40494153 | Benzene, ethenyl-, homopolymer |
| 51609837 | Benzene, ethenyl-, homopolymer |
| 51609871 | Benzene, ethenyl-, homopolymer |
| 52932497 | Benzene, ethenyl-, homopolymer |
| 53112495 | Benzene, ethenyl-, homopolymer |
| 53986848 | Benzene, ethenyl-, homopolymer |
| 54578244 | Benzene, ethenyl-, homopolymer |
| 54596417 | Benzene, ethenyl-, homopolymer |
| 55128068 | Benzene, ethenyl-, homopolymer |
| 55465004 | Benzene, ethenyl-, homopolymer |
| 56451720 | Benzene, ethenyl-, homopolymer |
| 56748620 | Benzene, ethenyl-, homopolymer |
| 57657064 | Benzene, ethenyl-, homopolymer |
| 58033913 | Benzene, ethenyl-, homopolymer |
| 60120163 | Benzene, ethenyl-, homopolymer |
| 60328463 | Benzene, ethenyl-, homopolymer |
| 60880980 | Benzene, ethenyl-, homopolymer |
| 61584892 | Benzene, ethenyl-, homopolymer |
| 61584905 | Benzene, ethenyl-, homopolymer |
| 63849490 | Benzene, ethenyl-, homopolymer |
| 78354479 | Benzene, ethenyl-, homopolymer |
| 81834120 | Benzene, ethenyl-, homopolymer |
| 86090917 | Benzene, ethenyl-, homopolymer |
| 98444305 | Benzene, ethenyl-, homopolymer |
| 105270051 | Benzene, ethenyl-, homopolymer |
| 110866507 | Benzene, ethenyl-, homopolymer |
| 120037992 | Benzene, ethenyl-, homopolymer |
| 120534261 | Benzene, ethenyl-, homopolymer |
| 124229318 | Benzene, ethenyl-, homopolymer |
| 124229487 | Benzene, ethenyl-, homopolymer |
| 130243060 | Benzene, ethenyl-, homopolymer |
| 131495391 | Benzene, ethenyl-, homopolymer |
| 132827431 | Benzene, ethenyl-, homopolymer |
| 137262454 | Benzene, ethenyl-, homopolymer |
| 144637934 | Benzene, ethenyl-, homopolymer |
| 149212191 | Benzene, ethenyl-, homopolymer |
| 155197458 | Benzene, ethenyl-, homopolymer |
| 157243215 | Benzene, ethenyl-, homopolymer |
| 157929027 | Benzene, ethenyl-, homopolymer |
| 161776450 | Benzene, ethenyl-, homopolymer |
| 171022029 | Benzene, ethenyl-, homopolymer |
| 171022096 | Benzene, ethenyl-, homopolymer |
| 172641484 | Benzene, ethenyl-, homopolymer |
| 172867640 | Benzene, ethenyl-, homopolymer |
| 219782522 | Benzene, ethenyl-, homopolymer |
| 260975799 | Benzene, ethenyl-, homopolymer |
| 359762951 | Benzene, ethenyl-, homopolymer |
| 360046704 | Benzene, ethenyl-, homopolymer |
| 373601208 | Benzene, ethenyl-, homopolymer |
| 441772629 | Benzene, ethenyl-, homopolymer |
| 471865108 | Benzene, ethenyl-, homopolymer |
| 487021465 | Benzene, ethenyl-, homopolymer |
| 644984361 | Benzene, ethenyl-, homopolymer |
| 726192116 | Benzene, ethenyl-, homopolymer |
| 730985598 | Benzene, ethenyl-, homopolymer |
| 851588700 | Benzene, ethenyl-, homopolymer |
| 852837173 | Benzene, ethenyl-, homopolymer |
| 1083095639 | Benzene, ethenyl-, homopolymer |
| 1160710791 | Benzene, ethenyl-, homopolymer |
| 1187742342 | Benzene, ethenyl-, homopolymer |
| 1191987173 | Benzene, ethenyl-, homopolymer |
| 1227265555 | Benzene, ethenyl-, homopolymer |
| 1263545749 | Benzene, ethenyl-, homopolymer |
| 1397706692 | Benzene, ethenyl-, homopolymer |
| 1415127068 | Benzene, ethenyl-, homopolymer |
| 1415263614 | Benzene, ethenyl-, homopolymer |
| 1430218840 | Benzene, ethenyl-, homopolymer |
| 1462855566 | Benzene, ethenyl-, homopolymer |
| 1321455 | Benzene, ethenylmethyl- |
| 25013154 | Benzene, ethenylmethyl- |
| 1202865108 | Benzene, ethenylmethyl- |
| 1216569457 | Benzene, ethenylmethyl- |
| 100414 | Benzene, ethyl- |
| 27536896 | Benzene, ethyl-, homopolymer |
| 25154476 | Benzene, ethylmethyl- |
| 25550145 | Benzene, ethylmethyl- |
| 1171156163 | Benzene, ethylmethyl- |
| 462066 | Benzene, fluoro- |
| 103719 | Benzene, isocyanato- |
| 1025436183 | Benzene, isocyanato- |
| 71432 | Benzene, methyl benzene, and dimethyl benzene, total |
| 108883 | Benzene, methyl benzene, and dimethyl benzene, total |
| 1330207 | Benzene, methyl benzene, and dimethyl benzene, total |
| 8030306 | Benzene, methyl benzene, and dimethyl benzene, total |
| 108883 | Benzene, methyl- |
| 1053657774 | Benzene, methyl- |
| 1202864978 | Benzene, methyl- |
| 26898179 | Benzene, methylbis(phenylmethyl)- |
| 51176988 | Benzene, methylbis(phenylmethyl)- |
| 121142 | Benzene, methyldinitro- |
| 25321146 | Benzene, methyldinitro- |
| 29656153 | Benzene, methyldinitro- |
| 99081 | Benzene, methylnitro- |
| 1321126 | Benzene, methylnitro- |
| 98953 | Benzene, nitro- |
| 29082755 | Benzene, pentachloro(2,2-dichloroethenyl)- |
| 61593440 | Benzene, pentachloro(dichloroethenyl)- |
| 2982744 | Benzene, pentachloro(trichloroethenyl)- |
| 29082744 | Benzene, pentachloro(trichloroethenyl)- |
| 29086382 | Benzene, pentachloro[(1E)-1,2-dichloroethenyl]- |
| 29086393 | Benzene, pentachloro[(1Z)-1,2-dichloroethenyl]- |
| 1825214 | Benzene, pentachloromethoxy- |
| 103651 | Benzene, propyl- |
| 74296314 | Benzene, propyl- |
| 12408105 | Benzene, tetrachloro- |
| 25619607 | Benzene, tetramethyl- |
| 37235624 | Benzene, tetramethyl- |
| 50317 | Benzene, trichloro- |
| 12002481 | Benzene, trichloro- |
| 26601650 | Benzene, trichloromethyl- |
| 30583336 | Benzene, trichloromethyl- |
| 2551137 | Benzene, trimethyl- |
| 15551137 | Benzene, trimethyl- |
| 25551137 | Benzene, trimethyl- |
| 1076433 | Benzene-1,2,3,4,5,6-d6 |
| 2199691 | Benzene-1,2,3,4-d4, 5,6-dichloro- |
| 4165575 | Benzene-d5, bromo- |
| 20302265 | Benzene-d5, ethyl- |
| 4165600 | Benzene-d5, nitro- |
| 957517 | Benzeneacetamide, N,N-dimethyl-.alpha.-phenyl- |
| 12697948 | Benzeneacetamide, N,N-dimethyl-.alpha.-phenyl- |
| 73413066 | Benzeneacetamide, N,N-dimethyl-.alpha.-phenyl- |
| 70508 | Benzeneacetic acid, .alpha.-(hydroxymethyl)-, (1.alpha.,2.beta.,4.beta.,5.alpha.,7.beta.)-9-methyl-3-oxa-9-azatricyclo[3.3.1.02,4]non-7-yl ester, hydrobromide (1:1), (.alpha.S)- |
| 114498 | Benzeneacetic acid, .alpha.-(hydroxymethyl)-, (1.alpha.,2.beta.,4.beta.,5.alpha.,7.beta.)-9-methyl-3-oxa-9-azatricyclo[3.3.1.02,4]non-7-yl ester, hydrobromide (1:1), (.alpha.S)- |
| 8013727 | Benzeneacetic acid, .alpha.-(hydroxymethyl)-, (1.alpha.,2.beta.,4.beta.,5.alpha.,7.beta.)-9-methyl-3-oxa-9-azatricyclo[3.3.1.02,4]non-7-yl ester, hydrobromide (1:1), (.alpha.S)- |
| 6533682 | Benzeneacetic acid, .alpha.-(hydroxymethyl)-, (1.alpha.,2.beta.,4.beta.,5.alpha.,7.beta.)-9-methyl-3-oxa-9-azatricyclo[3.3.1.02,4]non-7-yl ester, hydrobromide, trihydrate, (.alpha.S)- |
| 6106816 | Benzeneacetic acid, .alpha.-(hydroxymethyl)-, (1.alpha.,2.beta.,4.beta.,5.alpha.,7.beta.)-9-methyl-9-oxido-3-oxa-9-azatricyclo[3.3.1.02,4]non-7-yl ester, hydrobromide (1:1), (.alpha.S)- |
| 66230044 | Benzeneacetic acid, 4-chloro-.alpha.-(1-methylethyl)-, (S)-cyano(3-phenoxyphenyl)methyl ester, (.alpha.S)- |
| 72650283 | Benzeneacetic acid, 4-chloro-.alpha.-(1-methylethyl)-, (S)-cyano(3-phenoxyphenyl)methyl ester, (.alpha.S)- |
| 51630581 | Benzeneacetic acid, 4-chloro-.alpha.-(1-methylethyl)-, cyano(3-phenoxyphenyl)methyl ester |
| 131641628 | Benzeneacetic acid, 4-chloro-.alpha.-(1-methylethyl)-, cyano(3-phenoxyphenyl)methyl ester |
| 510156 | Benzeneacetic acid, 4-chloro-.alpha.-(4-chlorophenyl)-.alpha.-hydroxy-, ethyl ester |
| 1336363 | Benzeneacetic acid, 4-chloro-.alpha.-(4-chlorophenyl)-.alpha.-hydroxy-, ethyl ester |
| 306081 | Benzeneacetic acid, 4-hydroxy-3-methoxy- |
| 140294 | Benzeneacetonitrile |
| 532285 | Benzeneacetonitrile, .alpha.-hydroxy- |
| 613887 | Benzeneacetonitrile, .alpha.-hydroxy- |
| 610662 | Benzeneacetonitrile, 2-nitro- |
| 305033 | Benzenebutanoic acid, 4-[bis(2-chloroethyl)amino]- |
| 614459 | Benzenecarboperoxoic acid, 1,1-dimethylethyl ester |
| 25376458 | Benzenediamine, ar-methyl- |
| 122098 | Benzeneethanamine, .alpha.,.alpha.-dimethyl- |
| 9008940 | Benzeneethanamine, .alpha.,.alpha.-dimethyl- |
| 12674134 | Benzeneethanamine, .alpha.,.alpha.-dimethyl- |
| 60139 | Benzeneethanamine, .alpha.-methyl-, sulfate |
| 60128 | Benzeneethanol |
| 15121843 | Benzeneethanol, 2-nitro- |
| 100276 | Benzeneethanol, 4-nitro- |
| 100469 | Benzenemethanamine |
| 857483239 | Benzenemethanamine |
| 858831933 | Benzenemethanamine |
| 92591 | Benzenemethanamine, N-ethyl-N-phenyl- |
| 56939 | Benzenemethanaminium, N,N,N-trimethyl-, chloride (1:1) |
| 121540 | Benzenemethanaminium, N,N-dimethyl-N-[2-[2-[4-(1,1,3,3-tetramethylbutyl)phenoxy]ethoxy]ethyl]-, chloride (1:1) |
| 39362384 | Benzenemethanaminium, N,N-dimethyl-N-[2-[2-[4-(1,1,3,3-tetramethylbutyl)phenoxy]ethoxy]ethyl]-, chloride (1:1) |
| 324034095 | Benzenemethanaminium, N,N-dimethyl-N-[2-[2-[4-(1,1,3,3-tetramethylbutyl)phenoxy]ethoxy]ethyl]-, chloride (1:1) |
| 5929099 | Benzenemethanaminium, N,N-dimethyl-N-[2-[2-[4-(1,1,3,3-tetramethylbutyl)phenoxy]ethoxy]ethyl]-, chloride, monohydrate |
| 122190 | Benzenemethanaminium, N,N-dimethyl-N-octadecyl-, chloride (1:1) |
| 37243600 | Benzenemethanaminium, N,N-dimethyl-N-octadecyl-, chloride (1:1) |
| 60650762 | Benzenemethanaminium, N,N-dimethyl-N-octadecyl-, chloride (1:1) |
| 89004386 | Benzenemethanaminium, N,N-dimethyl-N-octadecyl-, chloride (1:1) |
| 1334072 | Benzenemethanaminium, N-ethyl-N-[4-[[4-[ethyl[(3-sulfophenyl)methyl]amino]phenyl](2-sulfophenyl)methylene]-2,5-cyclohexadien-1-ylidene]-3-sulfo-, inner salt, ammonium salt (1:2) |
| 2650182 | Benzenemethanaminium, N-ethyl-N-[4-[[4-[ethyl[(3-sulfophenyl)methyl]amino]phenyl](2-sulfophenyl)methylene]-2,5-cyclohexadien-1-ylidene]-3-sulfo-, inner salt, ammonium salt (1:2) |
| 29519651 | Benzenemethanaminium, N-ethyl-N-[4-[[4-[ethyl[(3-sulfophenyl)methyl]amino]phenyl](2-sulfophenyl)methylene]-2,5-cyclohexadien-1-ylidene]-3-sulfo-, inner salt, ammonium salt (1:2) |
| 37307554 | Benzenemethanaminium, N-ethyl-N-[4-[[4-[ethyl[(3-sulfophenyl)methyl]amino]phenyl](2-sulfophenyl)methylene]-2,5-cyclohexadien-1-ylidene]-3-sulfo-, inner salt, ammonium salt (1:2) |
| 37307565 | Benzenemethanaminium, N-ethyl-N-[4-[[4-[ethyl[(3-sulfophenyl)methyl]amino]phenyl](2-sulfophenyl)methylene]-2,5-cyclohexadien-1-ylidene]-3-sulfo-, inner salt, ammonium salt (1:2) |
| 37307781 | Benzenemethanaminium, N-ethyl-N-[4-[[4-[ethyl[(3-sulfophenyl)methyl]amino]phenyl](2-sulfophenyl)methylene]-2,5-cyclohexadien-1-ylidene]-3-sulfo-, inner salt, ammonium salt (1:2) |
| 51609246 | Benzenemethanaminium, N-ethyl-N-[4-[[4-[ethyl[(3-sulfophenyl)methyl]amino]phenyl](2-sulfophenyl)methylene]-2,5-cyclohexadien-1-ylidene]-3-sulfo-, inner salt, ammonium salt (1:2) |
| 55819299 | Benzenemethanaminium, N-ethyl-N-[4-[[4-[ethyl[(3-sulfophenyl)methyl]amino]phenyl](2-sulfophenyl)methylene]-2,5-cyclohexadien-1-ylidene]-3-sulfo-, inner salt, ammonium salt (1:2) |
| 86924529 | Benzenemethanaminium, N-ethyl-N-[4-[[4-[ethyl[(3-sulfophenyl)methyl]amino]phenyl](2-sulfophenyl)methylene]-2,5-cyclohexadien-1-ylidene]-3-sulfo-, inner salt, ammonium salt (1:2) |
| 99149436 | Benzenemethanaminium, N-ethyl-N-[4-[[4-[ethyl[(3-sulfophenyl)methyl]amino]phenyl](2-sulfophenyl)methylene]-2,5-cyclohexadien-1-ylidene]-3-sulfo-, inner salt, ammonium salt (1:2) |
| 511534546 | Benzenemethanaminium, N-ethyl-N-[4-[[4-[ethyl[(3-sulfophenyl)methyl]amino]phenyl](2-sulfophenyl)methylene]-2,5-cyclohexadien-1-ylidene]-3-sulfo-, inner salt, ammonium salt (1:2) |
| 3844459 | Benzenemethanaminium, N-ethyl-N-[4-[[4-[ethyl[(3-sulfophenyl)methyl]amino]phenyl](2-sulfophenyl)methylene]-2,5-cyclohexadien-1-ylidene]-3-sulfo-, inner salt, sodium salt (1:2) |
| 70992302 | Benzenemethanaminium, N-ethyl-N-[4-[[4-[ethyl[(3-sulfophenyl)methyl]amino]phenyl](2-sulfophenyl)methylene]-2,5-cyclohexadien-1-ylidene]-3-sulfo-, inner salt, sodium salt (1:2) |
| 73319025 | Benzenemethanaminium, N-ethyl-N-[4-[[4-[ethyl[(3-sulfophenyl)methyl]amino]phenyl](2-sulfophenyl)methylene]-2,5-cyclohexadien-1-ylidene]-3-sulfo-, inner salt, sodium salt (1:2) |
| 82526327 | Benzenemethanaminium, N-ethyl-N-[4-[[4-[ethyl[(3-sulfophenyl)methyl]amino]phenyl](2-sulfophenyl)methylene]-2,5-cyclohexadien-1-ylidene]-3-sulfo-, inner salt, sodium salt (1:2) |
| 83155139 | Benzenemethanaminium, N-ethyl-N-[4-[[4-[ethyl[(3-sulfophenyl)methyl]amino]phenyl](2-sulfophenyl)methylene]-2,5-cyclohexadien-1-ylidene]-3-sulfo-, inner salt, sodium salt (1:2) |
| 145087805 | Benzenemethanaminium, N-ethyl-N-[4-[[4-[ethyl[(3-sulfophenyl)methyl]amino]phenyl](2-sulfophenyl)methylene]-2,5-cyclohexadien-1-ylidene]-3-sulfo-, inner salt, sodium salt (1:2) |
| 511534535 | Benzenemethanaminium, N-ethyl-N-[4-[[4-[ethyl[(3-sulfophenyl)methyl]amino]phenyl](2-sulfophenyl)methylene]-2,5-cyclohexadien-1-ylidene]-3-sulfo-, inner salt, sodium salt (1:2) |
| 1314116658 | Benzenemethanaminium, N-ethyl-N-[4-[[4-[ethyl[(3-sulfophenyl)methyl]amino]phenyl](2-sulfophenyl)methylene]-2,5-cyclohexadien-1-ylidene]-3-sulfo-, inner salt, sodium salt (1:2) |
| 4857834 | Benzenemethanaminium, N-ethyl-N-[4-[[4-[ethyl[(3-sulfophenyl)methyl]amino]phenyl](4-sulfophenyl)methylene]-2,5-cyclohexadien-1-ylidene]-3-sulfo-, inner salt, sodium salt (1:2) |
| 5141208 | Benzenemethanaminium, N-ethyl-N-[4-[[4-[ethyl[(3-sulfophenyl)methyl]amino]phenyl](4-sulfophenyl)methylene]-2,5-cyclohexadien-1-ylidene]-3-sulfo-, inner salt, sodium salt (1:2) |
| 4680788 | Benzenemethanaminium, N-ethyl-N-[4-[[4-[ethyl[(3-sulfophenyl)methyl]amino]phenyl]phenylmethylene]-2,5-cyclohexadien-1-ylidene]-3-sulfo-, inner salt, sodium salt (1:1) |
| 260057952 | Benzenemethanaminium, N-ethyl-N-[4-[[4-[ethyl[(3-sulfophenyl)methyl]amino]phenyl]phenylmethylene]-2,5-cyclohexadien-1-ylidene]-3-sulfo-, inner salt, sodium salt (1:1) |
| 100516 | Benzenemethanol |
| 1336272 | Benzenemethanol |
| 185532712 | Benzenemethanol |
| 134601 | Benzenemethanol, .alpha.-[(1R)-1-aminoethyl]-, (.alpha.S)-rel- |
| 700652 | Benzenemethanol, .alpha.-[(1R)-1-aminoethyl]-, (.alpha.S)-rel- |
| 14838154 | Benzenemethanol, .alpha.-[(1R)-1-aminoethyl]-, (.alpha.S)-rel- |
| 36393574 | Benzenemethanol, .alpha.-[(1R)-1-aminoethyl]-, (.alpha.S)-rel- |
| 134725 | Benzenemethanol, .alpha.-[(1S)-1-(methylamino)ethyl]-, (.alpha.R)-, sulfate (2:1) |
| 8048371 | Benzenemethanol, .alpha.-[(1S)-1-(methylamino)ethyl]-, (.alpha.R)-, sulfate (2:1) |
| 8052220 | Benzenemethanol, .alpha.-[(1S)-1-(methylamino)ethyl]-, (.alpha.R)-, sulfate (2:1) |
| 17140500 | Benzenemethanol, .alpha.-[(1S)-1-(methylamino)ethyl]-, (.alpha.R)-, sulfate (2:1) |
| 33096525 | Benzenemethanol, .alpha.-[(1S)-1-(methylamino)ethyl]-, (.alpha.R)-, sulfate (2:1) |
| 95330226 | Benzenemethanol, .alpha.-[(1S)-1-(methylamino)ethyl]-, (.alpha.R)-, sulfate (2:1) |
| 909278779 | Benzenemethanol, .alpha.-[(1S)-1-(methylamino)ethyl]-, (.alpha.R)-, sulfate (2:1) |
| 553695 | Benzenemethanol, .alpha.-[(2-pyridinylamino)methyl]- |
| 98851 | Benzenemethanol, .alpha.-methyl- |
| 13323814 | Benzenemethanol, .alpha.-methyl- |
| 61767 | Benzenemethanol, 3-hydroxy-.alpha.-[(methylamino)methyl]-, hydrochloride (1:1), (.alpha.R)- |
| 644224 | Benzenemethanol, 3-hydroxy-.alpha.-[(methylamino)methyl]-, hydrochloride (1:1), (.alpha.R)- |
| 827623 | Benzenemethanol, 3-hydroxy-.alpha.-[(methylamino)methyl]-, hydrochloride (1:1), (.alpha.R)- |
| 50741769 | Benzenemethanol, 3-hydroxy-.alpha.-[(methylamino)methyl]-, hydrochloride (1:1), (.alpha.R)- |
| 115322 | Benzenemethanol, 4-chloro-.alpha.-(4-chlorophenyl)-.alpha.-(trichloromethyl)- |
| 55599547 | Benzenemethanol, 4-chloro-.alpha.-(4-chlorophenyl)-.alpha.-(trichloromethyl)- |
| 395288 | Benzenemethanol, 4-hydroxy-.alpha.-[1-[(1-methyl-2-phenoxyethyl)amino]ethyl]- |
| 395299 | Benzenemethanol, 4-hydroxy-.alpha.-[1-[(1-methyl-2-phenoxyethyl)amino]ethyl]- |
| 1134470 | Benzenepropanoic acid, .beta.-(aminomethyl)-4-chloro- |
| 33069624 | Benzenepropanoic acid, .beta.-(benzoylamino)-.alpha.-hydroxy-, (2aR,4S,4aS,6R,9S,11S,12S,12aR,12bS)-6,12b-bis(acetyloxy)-12-(benzoyloxy)-2a,3,4,4a,5,6,9,10,11,12,12a,12b-dodecahydro-4,11-dihydroxy-4a,8,13,13-tetramethyl-5-oxo-7,11-methano-1H-cyclodeca[3,4]benz[1,2-b]oxet-9-yl ester, (.alpha.R,.beta.S)- |
| 2021285 | Benzenepropanoic acid, ethyl ester |
| 103059 | Benzenepropanol, .alpha.,.alpha.-dimethyl- |
| 64902723 | Benzenesulfonamide, 2-chloro-N-[[(4-methoxy-6-methyl-1,3,5-triazin-2-yl)amino]carbonyl]- |
| 112143778 | Benzenesulfonamide, 2-chloro-N-[[(4-methoxy-6-methyl-1,3,5-triazin-2-yl)amino]carbonyl]- |
| 19044883 | Benzenesulfonamide, 4-(dipropylamino)-3,5-dinitro- |
| 968810 | Benzenesulfonamide, 4-acetyl-N-[(cyclohexylamino)carbonyl]- |
| 8054328 | Benzenesulfonamide, 4-acetyl-N-[(cyclohexylamino)carbonyl]- |
| 63741 | Benzenesulfonamide, 4-amino- |
| 1337366 | Benzenesulfonamide, 4-amino- |
| 1337399 | Benzenesulfonamide, 4-amino- |
| 12765809 | Benzenesulfonamide, 4-amino- |
| 24706250 | Benzenesulfonamide, 4-amino- |
| 102489349 | Benzenesulfonamide, 4-amino- |
| 127695 | Benzenesulfonamide, 4-amino-N-(3,4-dimethyl-5-isoxazolyl)- |
| 207522063 | Benzenesulfonamide, 4-amino-N-(3,4-dimethyl-5-isoxazolyl)- |
| 57681 | Benzenesulfonamide, 4-amino-N-(4,6-dimethyl-2-pyrimidinyl)- |
| 144821 | Benzenesulfonamide, 4-amino-N-(5-methyl-1,3,4-thiadiazol-2-yl)- |
| 723466 | Benzenesulfonamide, 4-amino-N-(5-methyl-3-isoxazolyl)- |
| 129378898 | Benzenesulfonamide, 4-amino-N-(5-methyl-3-isoxazolyl)- |
| 72140 | Benzenesulfonamide, 4-amino-N-2-thiazolyl- |
| 6052331 | Benzenesulfonamide, 4-amino-N-2-thiazolyl- |
| 158269466 | Benzenesulfonamide, 4-amino-N-2-thiazolyl- |
| 859037277 | Benzenesulfonamide, 4-amino-N-2-thiazolyl- |
| 94202 | Benzenesulfonamide, 4-chloro-N-[(propylamino)carbonyl]- |
| 64777 | Benzenesulfonamide, N-[(butylamino)carbonyl]-4-methyl- |
| 100735340 | Benzenesulfonamide, N-[(butylamino)carbonyl]-4-methyl- |
| 1156190 | Benzenesulfonamide, N-[[(hexahydro-1H-azepin-1-yl)amino]carbonyl]-4-methyl- |
| 3622842 | Benzenesulfonamide, N-butyl- |
| 1028684141 | Benzenesulfonamide, N-butyl- |
| 80308 | Benzenesulfonamide, N-cyclohexyl-4-methyl- |
| 8047992 | Benzenesulfonamide, N-ethyl-2(or 4)-methyl- |
| 80397 | Benzenesulfonamide, N-ethyl-4-methyl- |
| 825629310 | Benzenesulfonamide, N-ethyl-4-methyl- |
| 5183788 | Benzenesulfonamide, N-methyl- |
| 98113 | Benzenesulfonic acid |
| 81118 | Benzenesulfonic acid, 2,2'-(1,2-ethenediyl)bis[5-amino- |
| 65941982 | Benzenesulfonic acid, 2,2'-(1,2-ethenediyl)bis[5-amino- |
| 7336201 | Benzenesulfonic acid, 2,2'-(1,2-ethenediyl)bis[5-amino-, sodium salt (1:2) |
| 465534694 | Benzenesulfonic acid, 2,2'-(1,2-ethenediyl)bis[5-amino-, sodium salt (1:2) |
| 88211 | Benzenesulfonic acid, 2-amino- |
| 121471 | Benzenesulfonic acid, 3-amino- |
| 96673 | Benzenesulfonic acid, 3-amino-2-hydroxy-5-nitro- |
| 861511935 | Benzenesulfonic acid, 3-amino-2-hydroxy-5-nitro- |
| 98373 | Benzenesulfonic acid, 3-amino-4-hydroxy- |
| 96935 | Benzenesulfonic acid, 3-amino-4-hydroxy-5-nitro- |
| 88233 | Benzenesulfonic acid, 3-amino-5-chloro-2-hydroxy- |
| 547580 | Benzenesulfonic acid, 4-[2-[4-(dimethylamino)phenyl]diazenyl]-, sodium salt (1:1) |
| 1342241 | Benzenesulfonic acid, 4-[2-[4-(dimethylamino)phenyl]diazenyl]-, sodium salt (1:1) |
| 66777171 | Benzenesulfonic acid, 4-[2-[4-(dimethylamino)phenyl]diazenyl]-, sodium salt (1:1) |
| 121573 | Benzenesulfonic acid, 4-amino- |
| 856062061 | Benzenesulfonic acid, 4-amino- |
| 98679 | Benzenesulfonic acid, 4-hydroxy- |
| 104154 | Benzenesulfonic acid, 4-methyl- |
| 402471 | Benzenesulfonic acid, 4-methyl- |
| 51506297 | Benzenesulfonic acid, 4-methyl- |
| 100901722 | Benzenesulfonic acid, 4-methyl- |
| 114213966 | Benzenesulfonic acid, 4-methyl- |
| 126033270 | Benzenesulfonic acid, 4-methyl- |
| 128739800 | Benzenesulfonic acid, 4-methyl- |
| 144647927 | Benzenesulfonic acid, 4-methyl- |
| 156627462 | Benzenesulfonic acid, 4-methyl- |
| 185568483 | Benzenesulfonic acid, 4-methyl- |
| 210357816 | Benzenesulfonic acid, 4-methyl- |
| 227313497 | Benzenesulfonic acid, 4-methyl- |
| 369371255 | Benzenesulfonic acid, 4-methyl- |
| 613262310 | Benzenesulfonic acid, 4-methyl- |
| 1023356140 | Benzenesulfonic acid, 4-methyl- |
| 6373746 | Benzenesulfonic acid, 5-[(2,4-dinitrophenyl)amino]-2-(phenylamino)-, sodium salt (1:1) |
| 74968368 | Benzenesulfonic acid, 5-[(2,4-dinitrophenyl)amino]-2-(phenylamino)-, sodium salt (1:1) |
| 5160021 | Benzenesulfonic acid, 5-chloro-2-[2-(2-hydroxy-1-naphthalenyl)diazenyl]-4-methyl-, barium salt (2:1) |
| 12237524 | Benzenesulfonic acid, 5-chloro-2-[2-(2-hydroxy-1-naphthalenyl)diazenyl]-4-methyl-, barium salt (2:1) |
| 12238390 | Benzenesulfonic acid, 5-chloro-2-[2-(2-hydroxy-1-naphthalenyl)diazenyl]-4-methyl-, barium salt (2:1) |
| 12238414 | Benzenesulfonic acid, 5-chloro-2-[2-(2-hydroxy-1-naphthalenyl)diazenyl]-4-methyl-, barium salt (2:1) |
| 12238436 | Benzenesulfonic acid, 5-chloro-2-[2-(2-hydroxy-1-naphthalenyl)diazenyl]-4-methyl-, barium salt (2:1) |
| 24777239 | Benzenesulfonic acid, 5-chloro-2-[2-(2-hydroxy-1-naphthalenyl)diazenyl]-4-methyl-, barium salt (2:1) |
| 52627686 | Benzenesulfonic acid, 5-chloro-2-[2-(2-hydroxy-1-naphthalenyl)diazenyl]-4-methyl-, barium salt (2:1) |
| 68894031 | Benzenesulfonic acid, 5-chloro-2-[2-(2-hydroxy-1-naphthalenyl)diazenyl]-4-methyl-, barium salt (2:1) |
| 42615292 | Benzenesulfonic acid, alkyl derivs. |
| 1300727 | Benzenesulfonic acid, dimethyl-, sodium salt (1:1) |
| 39340937 | Benzenesulfonic acid, dimethyl-, sodium salt (1:1) |
| 1323122 | Benzenesulfonic acid, dodecyl- |
| 1886813 | Benzenesulfonic acid, dodecyl- |
| 27157977 | Benzenesulfonic acid, dodecyl- |
| 27176870 | Benzenesulfonic acid, dodecyl- |
| 37321087 | Benzenesulfonic acid, dodecyl- |
| 39355458 | Benzenesulfonic acid, dodecyl- |
| 54824361 | Benzenesulfonic acid, dodecyl- |
| 61400713 | Benzenesulfonic acid, dodecyl- |
| 106602895 | Benzenesulfonic acid, dodecyl- |
| 111839635 | Benzenesulfonic acid, dodecyl- |
| 112509316 | Benzenesulfonic acid, dodecyl- |
| 124743211 | Benzenesulfonic acid, dodecyl- |
| 147625749 | Benzenesulfonic acid, dodecyl- |
| 175069519 | Benzenesulfonic acid, dodecyl- |
| 210106051 | Benzenesulfonic acid, dodecyl- |
| 219316004 | Benzenesulfonic acid, dodecyl- |
| 220880999 | Benzenesulfonic acid, dodecyl- |
| 313478896 | Benzenesulfonic acid, dodecyl- |
| 811862518 | Benzenesulfonic acid, dodecyl- |
| 889890180 | Benzenesulfonic acid, dodecyl- |
| 1232441143 | Benzenesulfonic acid, dodecyl- |
| 98099 | Benzenesulfonyl chloride |
| 11441579 | Benzenesulfonyl chloride |
| 114415791 | Benzenesulfonyl chloride |
| 108955 | Benzenethiol |
| 108985 | Benzenethiol |
| 50328 | Benzo[a]pyrene |
| 819804289 | Benzo[a]pyrene |
| 63466717 | Benzo[a]pyrene-d12 |
| 192972 | Benzo[e]pyrene |
| 85029 | Benzo[f]quinoline |
| 191242 | Benzo[ghi]perylene |
| 205823 | Benzo[j]fluoranthene |
| 207089 | Benzo[k]fluoranthene |
| 68756796 | Benzo[k]fluoranthene |
| 189559 | Benzo[rst]pentaphene |
| 112307730 | Benzo[rst]pentaphene |
| 271896 | Benzofuran |
| 65850 | Benzoic acid |
| 8013636 | Benzoic acid |
| 331473086 | Benzoic acid |
| 1918009 | Benzoic acid, 2,5-dichloro-3-hydroxy-6-methoxy- |
| 7600502 | Benzoic acid, 2,5-dichloro-3-hydroxy-6-methoxy- |
| 50782 | Benzoic acid, 2-(acetyloxy)- |
| 2349942 | Benzoic acid, 2-(acetyloxy)- |
| 11126355 | Benzoic acid, 2-(acetyloxy)- |
| 11126377 | Benzoic acid, 2-(acetyloxy)- |
| 26914136 | Benzoic acid, 2-(acetyloxy)- |
| 98201606 | Benzoic acid, 2-(acetyloxy)- |
| 8003030 | Benzoic acid, 2-(acetyloxy)-, mixt. with 3,7-dihydro-1,3,7-trimethyl-1H-purine-2,6-dione and N-(4-ethoxyphenyl)acetamide |
| 90982324 | Benzoic acid, 2-[[[[(4-chloro-6-methoxy-2-pyrimidinyl)amino]carbonyl]amino]sulfonyl]-, ethyl ester |
| 94365910 | Benzoic acid, 2-[[[[(4-chloro-6-methoxy-2-pyrimidinyl)amino]carbonyl]amino]sulfonyl]-, ethyl ester |
| 95754339 | Benzoic acid, 2-[[[[(4-chloro-6-methoxy-2-pyrimidinyl)amino]carbonyl]amino]sulfonyl]-, ethyl ester |
| 101200480 | Benzoic acid, 2-[[[[(4-methoxy-6-methyl-1,3,5-triazin-2-yl)methylamino]carbonyl]amino]sulfonyl]-, methyl ester |
| 25311711 | Benzoic acid, 2-[[ethoxy[(1-methylethyl)amino]phosphinothioyl]oxy]-, 1-methylethyl ester |
| 52907241 | Benzoic acid, 2-[[ethoxy[(1-methylethyl)amino]phosphinothioyl]oxy]-, 1-methylethyl ester |
| 61711635 | Benzoic acid, 2-[[ethoxy[(1-methylethyl)amino]phosphinothioyl]oxy]-, 1-methylethyl ester |
| 117176666 | Benzoic acid, 2-[[ethoxy[(1-methylethyl)amino]phosphinothioyl]oxy]-, 1-methylethyl ester |
| 118923 | Benzoic acid, 2-amino- |
| 80206344 | Benzoic acid, 2-amino- |
| 7779773 | Benzoic acid, 2-amino-, 2-methylpropyl ester |
| 133186 | Benzoic acid, 2-amino-, 2-phenylethyl ester |
| 7493632 | Benzoic acid, 2-amino-, 2-propenyl ester |
| 7756969 | Benzoic acid, 2-amino-, butyl ester |
| 7779160 | Benzoic acid, 2-amino-, cyclohexyl ester |
| 87252 | Benzoic acid, 2-amino-, ethyl ester |
| 134203 | Benzoic acid, 2-amino-, methyl ester |
| 619170 | Benzoic acid, 2-amino-4-nitro- |
| 3577637 | Benzoic acid, 2-amino-5-sulfo- |
| 118912 | Benzoic acid, 2-chloro- |
| 118569 | Benzoic acid, 2-hydroxy-, 3,3,5-trimethylcyclohexyl ester |
| 8045714 | Benzoic acid, 2-hydroxy-, 3,3,5-trimethylcyclohexyl ester |
| 50610407 | Benzoic acid, 2-hydroxy-, 3,3,5-trimethylcyclohexyl ester |
| 52253937 | Benzoic acid, 2-hydroxy-, 3,3,5-trimethylcyclohexyl ester |
| 194304239 | Benzoic acid, 2-hydroxy-, 3,3,5-trimethylcyclohexyl ester |
| 57647 | Benzoic acid, 2-hydroxy-, compd. with (3aS,8aR)-1,2,3,3a,8,8a-hexahydro-1,3a,8-trimethylpyrrolo[2,3-b]indol-5-yl N-methylcarbamate (1:1) |
| 11033048 | Benzoic acid, 2-hydroxy-, compd. with (3aS,8aR)-1,2,3,3a,8,8a-hexahydro-1,3a,8-trimethylpyrrolo[2,3-b]indol-5-yl N-methylcarbamate (1:1) |
| 11036661 | Benzoic acid, 2-hydroxy-, compd. with (3aS,8aR)-1,2,3,3a,8,8a-hexahydro-1,3a,8-trimethylpyrrolo[2,3-b]indol-5-yl N-methylcarbamate (1:1) |
| 119368 | Benzoic acid, 2-hydroxy-, methyl ester |
| 8022864 | Benzoic acid, 2-hydroxy-, methyl ester |
| 8024542 | Benzoic acid, 2-hydroxy-, methyl ester |
| 68917759 | Benzoic acid, 2-hydroxy-, methyl ester |
| 648434075 | Benzoic acid, 2-hydroxy-, methyl ester |
| 118558 | Benzoic acid, 2-hydroxy-, phenyl ester |
| 118581 | Benzoic acid, 2-hydroxy-, phenylmethyl ester |
| 599791 | Benzoic acid, 2-hydroxy-5-[[4-[(2-pyridinylamino)sulfonyl]phenyl]azo]- |
| 1975504 | Benzoic acid, 2-methyl-3-nitro- |
| 1975526 | Benzoic acid, 2-methyl-5-nitro- |
| 13506768 | Benzoic acid, 2-methyl-6-nitro- |
| 552169 | Benzoic acid, 2-nitro- |
| 149917 | Benzoic acid, 3,4,5-trihydroxy- |
| 121799 | Benzoic acid, 3,4,5-trihydroxy-, propyl ester |
| 56274954 | Benzoic acid, 3,4,5-trihydroxy-, propyl ester |
| 51445 | Benzoic acid, 3,4-dichloro- |
| 5473165 | Benzoic acid, 3,5-dinitro-, compd.with cyclohexanamine (1:1) |
| 1918009 | Benzoic acid, 3,6-dichloro-2-methoxy- |
| 62610393 | Benzoic acid, 3,6-dichloro-2-methoxy- |
| 856565781 | Benzoic acid, 3,6-dichloro-2-methoxy- |
| 2300665 | Benzoic acid, 3,6-dichloro-2-methoxy-, compd. with N-methylmethanamine (1:1) |
| 136365678 | Benzoic acid, 3,6-dichloro-2-methoxy-, compd. with N-methylmethanamine (1:1) |
| 1982690 | Benzoic acid, 3,6-dichloro-2-methoxy-, sodium salt (1:1) |
| 133904 | Benzoic acid, 3-amino-2,5-dichloro- |
| 6201861 | Benzoic acid, 3-amino-2-hydroxy-5-sulfo- |
| 535808 | Benzoic acid, 3-chloro- |
| 5437387 | Benzoic acid, 3-methyl-2-nitro- |
| 3113711 | Benzoic acid, 3-methyl-4-nitro- |
| 121926 | Benzoic acid, 3-nitro- |
| 34139623 | Benzoic acid, 3-nitro-, compd. with cyclohexanamine (1:1) |
| 98737 | Benzoic acid, 4-(1,1-dimethylethyl)- |
| 2493847 | Benzoic acid, 4-(octyloxy)- |
| 3782807 | Benzoic acid, 4-[([1,1'-biphenyl]-4-ylmethylene)amino]-, ethyl ester |
| 80137 | Benzoic acid, 4-[(dichloroamino)sulfonyl]- |
| 57669 | Benzoic acid, 4-[(dipropylamino)sulfonyl]- |
| 150130 | Benzoic acid, 4-amino- |
| 8014651 | Benzoic acid, 4-amino- |
| 94257 | Benzoic acid, 4-amino-, butyl ester |
| 586765 | Benzoic acid, 4-bromo- |
| 74113 | Benzoic acid, 4-chloro- |
| 96980 | Benzoic acid, 4-methyl-3-nitro- |
| 62237 | Benzoic acid, 4-nitro- |
| 29788292 | Benzoic acid, 4-nitro- |
| 34067500 | Benzoic acid, 4-nitro-, compd. with cyclohexanamine (1:1) |
| 54319 | Benzoic acid, 5-(aminosulfonyl)-4-chloro-2-((2-furanylmethyl)amino)- |
| 6265152 | Benzoic acid, 5-[(4-aminobenzoyl)amino]-2-hydroxy-3-methyl- |
| 6637883 | Benzoic acid, 5-[2-[4'-[2-(2,6-diamino-3-methyl-5-sulfophenyl)diazenyl]-3,3'-dimethyl[1,1'-biphenyl]-4-yl]diazenyl]-2-hydroxy-, sodium salt (1:2) |
| 61814855 | Benzoic acid, 5-[2-[4'-[2-(2,6-diamino-3-methyl-5-sulfophenyl)diazenyl]-3,3'-dimethyl[1,1'-biphenyl]-4-yl]diazenyl]-2-hydroxy-, sodium salt (1:2) |
| 2429825 | Benzoic acid, 5-[2-[4'-[2-(7-amino-1-hydroxy-3-sulfo-2-naphthalenyl)diazenyl][1,1'-biphenyl]-4-yl]diazenyl]-2-hydroxy-, sodium salt (1:2) |
| 1092061318 | Benzoic acid, 5-[2-[4'-[2-(7-amino-1-hydroxy-3-sulfo-2-naphthalenyl)diazenyl][1,1'-biphenyl]-4-yl]diazenyl]-2-hydroxy-, sodium salt (1:2) |
| 50594666 | Benzoic acid, 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitro- |
| 62476599 | Benzoic acid, 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitro- |
| 94128048 | Benzoic acid, 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitro- |
| 77501634 | Benzoic acid, 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitro-, 2-ethoxy-1-methyl-2-oxoethyl ester |
| 83513604 | Benzoic acid, 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitro-, 2-ethoxy-1-methyl-2-oxoethyl ester |
| 143956870 | Benzoic acid, 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitro-, 2-ethoxy-1-methyl-2-oxoethyl ester |
| 62476599 | Benzoic acid, 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitro-, sodium salt (1:1) |
| 63748594 | Benzoic acid, 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitro-, sodium salt (1:1) |
| 74434449 | Benzoic acid, 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitro-, sodium salt (1:1) |
| 94128037 | Benzoic acid, 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitro-, sodium salt (1:1) |
| 6201872 | Benzoic acid, 5-amino-2-hydroxy-3-sulfo- |
| 3113722 | Benzoic acid, 5-methyl-2-nitro- |
| 26264095 | Benzoic acid, chloro- |
| 3129928 | Benzoic acid, compd. with cyclohexanamine (1:1) |
| 120514 | Benzoic acid, phenylmethyl ester |
| 120558 | Benzoic acid, phenylmethyl ester |
| 100470 | Benzonitrile |
| 529191 | Benzonitrile, 2-methyl- |
| 1689845 | Benzonitrile, 3,5-dibromo-4-hydroxy- |
| 620224 | Benzonitrile, 3-methyl- |
| 104858 | Benzonitrile, 4-methyl- |
| 191242 | Benzoperylene |
| 11057457 | Benzoperylene |
| 73467762 | Benzopyrene |
| 95169 | Benzothiazole |
| 128366289 | Benzothiazole |
| 120785 | Benzothiazole, 2,2'-dithiobis- |
| 109767808 | Benzothiazole, 2,2'-dithiobis- |
| 137497188 | Benzothiazole, 2,2'-dithiobis- |
| 258278976 | Benzothiazole, 2,2'-dithiobis- |
| 615225 | Benzothiazole, 2-(methylthio)- |
| 98884 | Benzoyl chloride |
| 1258517804 | Benzoyl chloride |
| 393522 | Benzoyl chloride, 2-fluoro- |
| 610140 | Benzoyl chloride, 2-nitro- |
| 121904 | Benzoyl chloride, 3-nitro- |
| 122043 | Benzoyl chloride, 4-nitro- |
| 63923 | Benzylamine, N-(2-chloroethyl)-N-(1-methyl-2-phenoxyethyl)-, hydrochloride |
| 2399873 | Beryllate(1-), [N,N-bis(carboxymethyl)glycinato(3-)-N,O,O',O'']-, potassium, (T-4)- |
| 18983727 | Beryllate(1-), [N,N-bis(carboxymethyl)glycinato(3-)-N,O,O',O'']-, potassium, (T-4)- |
| 7440417 | Beryllium |
| 1312815261 | Beryllium |
| 7787475 | Beryllium chloride (BeCl2) |
| 7440417 | Beryllium compounds |
| 7787497 | Beryllium fluoride (BeF2) |
| 12323056 | Beryllium fluoride (BeF2) |
| 1304569 | Beryllium oxide (BeO) |
| 61279730 | Beryllium oxide (BeO) |
| 61279741 | Beryllium oxide (BeO) |
| 61279752 | Beryllium oxide (BeO) |
| 61279763 | Beryllium oxide (BeO) |
| 14390897 | Beryllium, isotope of mass 10 |
| 13966024 | Beryllium, isotope of mass 7 |
| 12587472 | Beta particle |
| 16219753 | Bicyclo[2.2.1]hept-2-ene, 5-ethylidene- |
| 59006745 | Bicyclo[2.2.1]hept-2-ene, 5-ethylidene- |
| 62181742 | Bicyclo[2.2.1]hept-2-ene, 5-ethylidene- |
| 1135584950 | Bicyclo[2.2.1]hept-2-ene, 5-ethylidene- |
| 115286 | Bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid, 1,4,5,6,7,7-hexachloro- |
| 5343975 | Bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid, 1,4,5,6,7,7-hexachloro- |
| 7374789 | Bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid, 1,4,5,6,7,7-hexachloro- |
| 888949131 | Bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid, 1,4,5,6,7,7-hexachloro- |
| 3389717 | Bicyclo[2.2.1]hepta-2,5-diene, 1,2,3,4,7,7-hexachloro- |
| 76222 | Bicyclo[2.2.1]heptan-2-one, 1,7,7-trimethyl- |
| 464482 | Bicyclo[2.2.1]heptan-2-one, 1,7,7-trimethyl- |
| 8013556 | Bicyclo[2.2.1]heptan-2-one, 1,7,7-trimethyl- |
| 8022773 | Bicyclo[2.2.1]heptan-2-one, 1,7,7-trimethyl- |
| 21368683 | Bicyclo[2.2.1]heptan-2-one, 1,7,7-trimethyl- |
| 48113220 | Bicyclo[2.2.1]heptan-2-one, 1,7,7-trimethyl- |
| 80568 | Bicyclo[3.1.1]hept-2-ene, 2,6,6-trimethyl- |
| 2437958 | Bicyclo[3.1.1]hept-2-ene, 2,6,6-trimethyl- |
| 127913 | Bicyclo[3.1.1]heptane, 6,6-dimethyl-2-methylene- |
| 23089329 | Bicyclo[3.1.1]heptane, 6,6-dimethyl-2-methylene- |
| 4424060 | Bisbenzimidazo[2,1-b:2',1'-i]benzo[lmn][3,8]phenanthroline-8,17-dione |
| 42612215 | Bisbenzimidazo[2,1-b:2',1'-i]benzo[lmn][3,8]phenanthroline-8,17-dione |
| 67053854 | Bisbenzimidazo[2,1-b:2',1'-i]benzo[lmn][3,8]phenanthroline-8,17-dione |
| 75662418 | Bisbenzimidazo[2,1-b:2',1'-i]benzo[lmn][3,8]phenanthroline-8,17-dione |
| 79586962 | Bisbenzimidazo[2,1-b:2',1'-i]benzo[lmn][3,8]phenanthroline-8,17-dione |
| 104432602 | Bisbenzimidazo[2,1-b:2',1'-i]benzo[lmn][3,8]phenanthroline-8,17-dione |
| 126602786 | Bisbenzimidazo[2,1-b:2',1'-i]benzo[lmn][3,8]phenanthroline-8,17-dione |
| 136298094 | Bisbenzimidazo[2,1-b:2',1'-i]benzo[lmn][3,8]phenanthroline-8,17-dione |
| 156841348 | Bisbenzimidazo[2,1-b:2',1'-i]benzo[lmn][3,8]phenanthroline-8,17-dione |
| 7440699 | Bismuth |
| 24267489 | Bismuth |
| 25243769 | Bismuth |
| 1304763 | Bismuth oxide (Bi2O3) |
| 11090098 | Bismuth oxide (Bi2O3) |
| 163831490 | Bismuth oxide (Bi2O3) |
| 477850832 | Bismuth oxide (Bi2O3) |
| 1304821 | Bismuth telluride (Bi2Te3) |
| 1269232645 | Bismuth telluride (Bi2Te3) |
| 15776199 | Bismuth, isotope of mass 206 |
| 13982382 | Bismuth, isotope of mass 207 |
| 14331794 | Bismuth, isotope of mass 210 |
| 14913496 | Bismuth, isotope of mass 212 |
| 14733030 | Bismuth, isotope of mass 214 |
| 11056067 | Bleomycin |
| 5967373 | Borane, tribromo- |
| 10294334 | Borane, tribromo- |
| 10294345 | Borane, trichloro- |
| 31012041 | Borane, trichloro- |
| 102943645 | Borane, trichloro- |
| 372850 | Borane, trifluoro- |
| 7637072 | Borane, trifluoro- |
| 109704872 | Borane, trifluoro- |
| 155123447 | Borane, trifluoro- |
| 1303679 | Borate(1-), tetrafluoro-, hydrogen (1:1) |
| 13767367 | Borate(1-), tetrafluoro-, hydrogen (1:1) |
| 16872110 | Borate(1-), tetrafluoro-, hydrogen (1:1) |
| 36835640 | Borate(1-), tetrafluoro-, hydrogen (1:1) |
| 65814439 | Borate(1-), tetrafluoro-, hydrogen (1:1) |
| 67116136 | Borate(1-), tetrafluoro-, hydrogen (1:1) |
| 72802723 | Borate(1-), tetrafluoro-, hydrogen (1:1) |
| 74618512 | Borate(1-), tetrafluoro-, hydrogen (1:1) |
| 81586245 | Borate(1-), tetrafluoro-, hydrogen (1:1) |
| 96958962 | Borate(1-), tetrafluoro-, hydrogen (1:1) |
| 102931964 | Borate(1-), tetrafluoro-, hydrogen (1:1) |
| 122141735 | Borate(1-), tetrafluoro-, hydrogen (1:1) |
| 127408008 | Borate(1-), tetrafluoro-, hydrogen (1:1) |
| 133097004 | Borate(1-), tetrafluoro-, hydrogen (1:1) |
| 133951389 | Borate(1-), tetrafluoro-, hydrogen (1:1) |
| 140148874 | Borate(1-), tetrafluoro-, hydrogen (1:1) |
| 172515296 | Borate(1-), tetrafluoro-, hydrogen (1:1) |
| 172908188 | Borate(1-), tetrafluoro-, hydrogen (1:1) |
| 183135742 | Borate(1-), tetrafluoro-, hydrogen (1:1) |
| 191665415 | Borate(1-), tetrafluoro-, hydrogen (1:1) |
| 350009051 | Borate(1-), tetrafluoro-, hydrogen (1:1) |
| 496925145 | Borate(1-), tetrafluoro-, hydrogen (1:1) |
| 547767066 | Borate(1-), tetrafluoro-, hydrogen (1:1) |
| 845825709 | Borate(1-), tetrafluoro-, hydrogen (1:1) |
| 900178907 | Borate(1-), tetrafluoro-, hydrogen (1:1) |
| 1056477098 | Borate(1-), tetrafluoro-, hydrogen (1:1) |
| 1178564641 | Borate(1-), tetrafluoro-, hydrogen (1:1) |
| 1262801477 | Borate(1-), tetrafluoro-, hydrogen (1:1) |
| 1414852519 | Borate(1-), tetrafluoro-, hydrogen (1:1) |
| 1303964 | Borax (B4Na2O7.10H2O) |
| 1344907 | Borax (B4Na2O7.10H2O) |
| 12322859 | Borax (B4Na2O7.10H2O) |
| 12447404 | Borax (B4Na2O7.10H2O) |
| 61028248 | Borax (B4Na2O7.10H2O) |
| 71377021 | Borax (B4Na2O7.10H2O) |
| 910783710 | Borax (B4Na2O7.10H2O) |
| 950582602 | Borax (B4Na2O7.10H2O) |
| 1242163036 | Borax (B4Na2O7.10H2O) |
| 1443500228 | Borax (B4Na2O7.10H2O) |
| 10043353 | Boric acid (H3BO3) |
| 12795049 | Boric acid (H3BO3) |
| 30698987 | Boric acid (H3BO3) |
| 688744 | Boric acid (H3BO3), tributyl ester |
| 13453695 | Boric acid (HBO2), lithium salt (1:1) |
| 56626449 | Boric acid (HBO2), lithium salt (1:1) |
| 891827682 | Boric acid (HBO2), lithium salt (1:1) |
| 950582544 | Boric acid (HBO2), lithium salt (1:1) |
| 11121167 | Boric acid, aluminum salt |
| 12794911 | Boric acid, aluminum salt |
| 134914322 | Boric acid, aluminum salt |
| 7440428 | Boron |
| 1416162123 | Boron |
| 12007602 | Boron lithium oxide (B4Li2O7) |
| 12688516 | Boron lithium oxide (B4Li2O7) |
| 108662777 | Boron lithium oxide (B4Li2O7) |
| 110271562 | Boron lithium oxide (B4Li2O7) |
| 796879317 | Boron lithium oxide (B4Li2O7) |
| 1303862 | Boron oxide (B2O3) |
| 12640425 | Boron oxide (B2O3) |
| 56116042 | Boron oxide (B2O3) |
| 56145449 | Boron oxide (B2O3) |
| 56312915 | Boron oxide (B2O3) |
| 56312926 | Boron oxide (B2O3) |
| 56312937 | Boron oxide (B2O3) |
| 56312948 | Boron oxide (B2O3) |
| 91863273 | Boron oxide (B2O3) |
| 102967737 | Boron oxide (B2O3) |
| 144919642 | Boron oxide (B2O3) |
| 163701880 | Boron oxide (B2O3) |
| 353424 | Boron, trifluoro[oxybis[methane]]-, (T-4)- |
| 19306593 | Boron, trifluoro[oxybis[methane]]-, (T-4)- |
| 121263578 | Boron, trifluoro[oxybis[methane]]-, (T-4)- |
| 139754817 | Boron, trifluoro[oxybis[methane]]-, (T-4)- |
| 342905924 | Boron, trifluoro[oxybis[methane]]-, (T-4)- |
| 707542878 | Boron, trifluoro[oxybis[methane]]-, (T-4)- |
| 879635628 | Boron, trifluoro[oxybis[methane]]-, (T-4)- |
| 15541454 | Bromate |
| 7758012 | Bromic acid, potassium salt (1:1) |
| 24959679 | Bromide |
| 405267472 | Bromide |
| 7726956 | Bromine |
| 7726965 | Bromine |
| 7926956 | Bromine |
| 23724814 | Bromine |
| 13863417 | Bromine chloride (BrCl) |
| 7789302 | Bromine fluoride (BrF5) |
| 14686692 | Bromine, isotope of mass 82 |
| 123728 | Butanal |
| 590863 | Butanal, 3-methyl- |
| 6358856 | Butanamide, 2,2'-[(3,3'-dichloro[1,1'-biphenyl]-4,4'-diyl)bis(2,1-diazenediyl)]bis[3-oxo-N-phenyl- |
| 82197931 | Butanamide, 2,2'-[(3,3'-dichloro[1,1'-biphenyl]-4,4'-diyl)bis(2,1-diazenediyl)]bis[3-oxo-N-phenyl- |
| 82249352 | Butanamide, 2,2'-[(3,3'-dichloro[1,1'-biphenyl]-4,4'-diyl)bis(2,1-diazenediyl)]bis[3-oxo-N-phenyl- |
| 97794075 | Butanamide, 2,2'-[(3,3'-dichloro[1,1'-biphenyl]-4,4'-diyl)bis(2,1-diazenediyl)]bis[3-oxo-N-phenyl- |
| 127546116 | Butanamide, 2,2'-[(3,3'-dichloro[1,1'-biphenyl]-4,4'-diyl)bis(2,1-diazenediyl)]bis[3-oxo-N-phenyl- |
| 142583275 | Butanamide, 2,2'-[(3,3'-dichloro[1,1'-biphenyl]-4,4'-diyl)bis(2,1-diazenediyl)]bis[3-oxo-N-phenyl- |
| 912849924 | Butanamide, 2,2'-[(3,3'-dichloro[1,1'-biphenyl]-4,4'-diyl)bis(2,1-diazenediyl)]bis[3-oxo-N-phenyl- |
| 6358312 | Butanamide, 2-[2-(2-methoxy-4-nitrophenyl)diazenyl]-N-(2-methoxyphenyl)-3-oxo- |
| 15792297 | Butanamide, 2-[2-(2-methoxy-4-nitrophenyl)diazenyl]-N-(2-methoxyphenyl)-3-oxo- |
| 57769752 | Butanamide, 2-[2-(2-methoxy-4-nitrophenyl)diazenyl]-N-(2-methoxyphenyl)-3-oxo- |
| 68859596 | Butanamide, 2-[2-(2-methoxy-4-nitrophenyl)diazenyl]-N-(2-methoxyphenyl)-3-oxo- |
| 95660494 | Butanamide, 2-[2-(2-methoxy-4-nitrophenyl)diazenyl]-N-(2-methoxyphenyl)-3-oxo- |
| 96352248 | Butanamide, 2-[2-(2-methoxy-4-nitrophenyl)diazenyl]-N-(2-methoxyphenyl)-3-oxo- |
| 807629761 | Butanamide, 2-[2-(2-methoxy-4-nitrophenyl)diazenyl]-N-(2-methoxyphenyl)-3-oxo- |
| 865089221 | Butanamide, 2-[2-(2-methoxy-4-nitrophenyl)diazenyl]-N-(2-methoxyphenyl)-3-oxo- |
| 885613638 | Butanamide, 2-[2-(2-methoxy-4-nitrophenyl)diazenyl]-N-(2-methoxyphenyl)-3-oxo- |
| 904293272 | Butanamide, 2-[2-(2-methoxy-4-nitrophenyl)diazenyl]-N-(2-methoxyphenyl)-3-oxo- |
| 904293283 | Butanamide, 2-[2-(2-methoxy-4-nitrophenyl)diazenyl]-N-(2-methoxyphenyl)-3-oxo- |
| 1309890047 | Butanamide, 2-[2-(2-methoxy-4-nitrophenyl)diazenyl]-N-(2-methoxyphenyl)-3-oxo- |
| 102012 | Butanamide, 3-oxo-N-phenyl- |
| 77656 | Butanamide, N-(aminocarbonyl)-2-bromo-2-ethyl- |
| 106978 | Butane |
| 142961 | Butane, 1,1'-oxybis- |
| 110565 | Butane, 1,4-dichloro- |
| 109693 | Butane, 1-chloro- |
| 627054 | Butane, 1-nitro- |
| 75832 | Butane, 2,2-dimethyl- |
| 79298 | Butane, 2,2-dimethyl- |
| 78784 | Butane, 2-methyl- |
| 68923444 | Butane, 2-methyl- |
| 92046463 | Butane, 2-methyl- |
| 1326305741 | Butane, 2-methyl- |
| 141529320 | Butane, pentafluoro- |
| 83547960 | Butane-1,1,2,2,3,3,4,4-d8, 1,4-dichloro- |
| 110612 | Butanedinitrile |
| 191362217 | Butanedinitrile |
| 3333526 | Butanedinitrile, tetramethyl- |
| 1634782 | Butanedioic acid, ((dimethoxyphosphinyl)thio)-, diethyl ester |
| 4345033 | Butanedioic acid, 1-[(2R)-3,4-dihydro-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-2H-1-benzopyran-6-yl] ester |
| 53532120 | Butanedioic acid, 1-[(2R)-3,4-dihydro-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-2H-1-benzopyran-6-yl] ester |
| 55134515 | Butanedioic acid, 1-[(2R)-3,4-dihydro-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-2H-1-benzopyran-6-yl] ester |
| 120246471 | Butanedioic acid, 1-[(2R)-3,4-dihydro-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-2H-1-benzopyran-6-yl] ester |
| 121755 | Butanedioic acid, [(dimethoxyphosphinothioyl)thio]-, diethyl ester |
| 11096676 | Butanedioic acid, [(dimethoxyphosphinothioyl)thio]-, diethyl ester |
| 11130602 | Butanedioic acid, [(dimethoxyphosphinothioyl)thio]-, diethyl ester |
| 12737198 | Butanedioic acid, [(dimethoxyphosphinothioyl)thio]-, diethyl ester |
| 12767623 | Butanedioic acid, [(dimethoxyphosphinothioyl)thio]-, diethyl ester |
| 75513836 | Butanedioic acid, [(dimethoxyphosphinothioyl)thio]-, diethyl ester |
| 141263969 | Butanedioic acid, [(dimethoxyphosphinothioyl)thio]-, diethyl ester |
| 562107 | Butanedioic acid, compd. with N,N-dimethyl-2-[1-phenyl-1-(2-pyridinyl)ethoxy]ethanamine (1:1) |
| 8064775 | Butanedioic acid, compd. with N,N-dimethyl-2-[1-phenyl-1-(2-pyridinyl)ethoxy]ethanamine (1:1), mixt. with 2-(diethylamino)ethyl [1,1'-bicyclohexyl]-1-carboxylate hydrochloride and 5-hydroxy-6-methyl-3,4-pyridinedimethanol hydrochloride |
| 1596845 | Butanedioic acid, mono(2,2-dimethylhydrazide) |
| 1861263 | Butanedioic acid, mono(2,2-dimethylhydrazide) |
| 74913158 | Butanedioic acid, mono(2,2-dimethylhydrazide) |
| 982570 | Butanedioic acid, mono[(2R,3R)-2-[(dichloroacetyl)amino]-3-hydroxy-3-(4-nitrophenyl)propyl] ester, monosodium salt |
| 70198297 | Butanedioic acid, polymer with 4-hydroxy-2,2,6,6-tetramethyl-1-piperidineethanol |
| 71990595 | Butanedioic acid, polymer with 4-hydroxy-2,2,6,6-tetramethyl-1-piperidineethanol |
| 76633200 | Butanedioic acid, polymer with 4-hydroxy-2,2,6,6-tetramethyl-1-piperidineethanol |
| 98388466 | Butanedioic acid, polymer with 4-hydroxy-2,2,6,6-tetramethyl-1-piperidineethanol |
| 182071767 | Butanedioic acid, polymer with 4-hydroxy-2,2,6,6-tetramethyl-1-piperidineethanol |
| 439590075 | Butanedioic acid, polymer with 4-hydroxy-2,2,6,6-tetramethyl-1-piperidineethanol |
| 848843094 | Butanedioic acid, polymer with 4-hydroxy-2,2,6,6-tetramethyl-1-piperidineethanol |
| 896469946 | Butanedioic acid, polymer with 4-hydroxy-2,2,6,6-tetramethyl-1-piperidineethanol |
| 1213835518 | Butanedioic acid, polymer with 4-hydroxy-2,2,6,6-tetramethyl-1-piperidineethanol |
| 1262431526 | Butanedioic acid, polymer with 4-hydroxy-2,2,6,6-tetramethyl-1-piperidineethanol |
| 109740 | Butanenitrile |
| 107926 | Butanoic acid |
| 37558160 | Butanoic acid, (1aR,1bS,4aR,7aS,7bS,8R,9R,9aS)-1,1a,1b,4,4a,5,7a,7b,8,9-decahydro-4a,7b-dihydroxy-3-(hydroxymethyl)-1,1,6,8-tetramethyl-5-oxo-9aH-cyclopropa[3,4]benz[1,2-e]azulene-9,9a-diyl ester |
| 2835394 | Butanoic acid, 3-methyl-, 2-propen-1-yl ester |
| 94826 | Butanoic acid, 4-(2,4-dichlorophenoxy)- |
| 94815 | Butanoic acid, 4-(4-chloro-2-methylphenoxy)- |
| 141753 | Butanoyl chloride |
| 25167673 | Butene |
| 11069195 | Butene, dichloro- |
| 61703057 | C.I. Direct Black 114 |
| 1325377 | C.I. Direct Yellow 11 |
| 37279553 | C.I. Direct Yellow 11 |
| 59764124 | C.I. Direct Yellow 11 |
| 93820667 | C.I. Direct Yellow 11 |
| 1299883 | C.I. Pigment Green 21 |
| 11075324 | C.I. Pigment Green 21 |
| 12002038 | C.I. Pigment Green 21 |
| 12224941 | C.I. Pigment Green 36 |
| 12224963 | C.I. Pigment Green 36 |
| 12236601 | C.I. Pigment Green 36 |
| 14302137 | C.I. Pigment Green 36 |
| 53124893 | C.I. Pigment Green 36 |
| 71819722 | C.I. Pigment Green 36 |
| 96956513 | C.I. Pigment Green 36 |
| 99149470 | C.I. Pigment Green 36 |
| 186811563 | C.I. Pigment Green 36 |
| 872217782 | C.I. Pigment Green 36 |
| 1328536 | C.I. Pigment Green 7 |
| 11118595 | C.I. Pigment Green 7 |
| 11129832 | C.I. Pigment Green 7 |
| 12224952 | C.I. Pigment Green 7 |
| 12240118 | C.I. Pigment Green 7 |
| 12619691 | C.I. Pigment Green 7 |
| 16143810 | C.I. Pigment Green 7 |
| 37340128 | C.I. Pigment Green 7 |
| 39362522 | C.I. Pigment Green 7 |
| 39380659 | C.I. Pigment Green 7 |
| 50642994 | C.I. Pigment Green 7 |
| 51653135 | C.I. Pigment Green 7 |
| 52499704 | C.I. Pigment Green 7 |
| 64333626 | C.I. Pigment Green 7 |
| 67053865 | C.I. Pigment Green 7 |
| 72779625 | C.I. Pigment Green 7 |
| 73560404 | C.I. Pigment Green 7 |
| 81180930 | C.I. Pigment Green 7 |
| 85256457 | C.I. Pigment Green 7 |
| 90651642 | C.I. Pigment Green 7 |
| 97380886 | C.I. Pigment Green 7 |
| 104492026 | C.I. Pigment Green 7 |
| 108137026 | C.I. Pigment Green 7 |
| 109319611 | C.I. Pigment Green 7 |
| 127546069 | C.I. Pigment Green 7 |
| 128281890 | C.I. Pigment Green 7 |
| 194554648 | C.I. Pigment Green 7 |
| 914378317 | C.I. Pigment Green 7 |
| 1342489 | C.I. Pigment Yellow 100 |
| 12225217 | C.I. Pigment Yellow 100 |
| 12227699 | C.I. Pigment Yellow 100 |
| 15790064 | C.I. Pigment Yellow 100 |
| 53026634 | C.I. Pigment Yellow 100 |
| 8005014 | C.I. Solvent Black 5 |
| 11099039 | C.I. Solvent Black 5 |
| 52276978 | C.I. Solvent Black 5 |
| 88651756 | C.I. Solvent Black 5 |
| 94335941 | C.I. Solvent Black 5 |
| 114654294 | C.I. Solvent Black 5 |
| 8005025 | C.I. Solvent Black 7 |
| 12227804 | C.I. Solvent Black 7 |
| 53802383 | C.I. Solvent Black 7 |
| 59494267 | C.I. Solvent Black 7 |
| 65721984 | C.I. Solvent Black 7 |
| 70431571 | C.I. Solvent Black 7 |
| 72626245 | C.I. Solvent Black 7 |
| 87003358 | C.I. Solvent Black 7 |
| 114013319 | C.I. Solvent Black 7 |
| 162731499 | C.I. Solvent Black 7 |
| 8002877 | C.I. Solvent Yellow 33 |
| 8003223 | C.I. Solvent Yellow 33 |
| 18432547 | Cadmate(1-), [N,N-bis[(carboxy-.kappa.O)methyl]glycinato(3-)-.kappa.N,.kappa.O]-, (T-4)- |
| 7440439 | Cadmium |
| 39638329 | Cadmium |
| 7789426 | Cadmium bromide (CdBr2) |
| 53168835 | Cadmium bromide (CdBr2) |
| 10108642 | Cadmium chloride (CdCl2) |
| 1306190 | Cadmium oxide (CdO) |
| 1436666975 | Cadmium oxide (CdO) |
| 14109321 | Cadmium, isotope of mass 109 |
| 14336664 | Cadmium, isotope of mass 113m(14.1 yr) |
| 378253442 | Cadmium, isotope of mass 113m(14.1 yr) |
| 14336686 | Cadmium, isotope of mass 115 |
| 14336686 | Cadmium, isotope of mass 115m(44.6 d) |
| 378253453 | Cadmium, isotope of mass 115m(44.6 d) |
| 7440702 | Calcium |
| 8047594 | Calcium |
| 10043524 | Calcium chloride (CaCl2) |
| 139468932 | Calcium chloride (CaCl2) |
| 592018 | Calcium cyanide (Ca(CN)2) |
| 18724704 | Calcium cyanide (Ca(CN)2) |
| 7789755 | Calcium fluoride (CaF2) |
| 29070153 | Calcium fluoride (CaF2) |
| 1357089758 | Calcium fluoride (CaF2) |
| 1414597935 | Calcium fluoride (CaF2) |
| 1305620 | Calcium hydroxide (Ca(OH)2) |
| 1333295 | Calcium hydroxide (Ca(OH)2) |
| 7719019 | Calcium hydroxide (Ca(OH)2) |
| 1305788 | Calcium oxide (CaO) |
| 12610149 | Calcium oxide (CaO) |
| 60873850 | Calcium oxide (CaO) |
| 104624966 | Calcium oxide (CaO) |
| 245321522 | Calcium oxide (CaO) |
| 13966057 | Calcium, isotope of mass 45 |
| 1439992 | Calcium, isotope of mass 47 |
| 14391992 | Calcium, isotope of mass 47 |
| 78444 | Carbamic acid, (1-methylethyl)-, 2-[[(aminocarbonyl)oxy]methyl]-2-methylpentyl ester |
| 8053632 | Carbamic acid, (1-methylethyl)-, 2-[[(aminocarbonyl)oxy]methyl]-2-methylpentyl ester |
| 1918189 | Carbamic acid, (3,4-dichlorophenyl)-, methyl ester |
| 101213 | Carbamic acid, (3-chlorophenyl)-, 1-methylethyl ester |
| 11097022 | Carbamic acid, (3-chlorophenyl)-, 1-methylethyl ester |
| 101279 | Carbamic acid, (3-chlorophenyl)-, 4-chloro-2-butynyl ester |
| 13684565 | Carbamic acid, (3-methylphenyl)-, 3-[(methoxycarbonyl)amino]phenyl ester |
| 13684634 | Carbamic acid, (3-methylphenyl)-, 3-[(methoxycarbonyl)amino]phenyl ester |
| 35067675 | Carbamic acid, (3-methylphenyl)-, 3-[(methoxycarbonyl)amino]phenyl ester |
| 14255879 | Carbamic acid, (5-butyl-1H-benzimidazol-2-yl)-, methyl ester |
| 10605217 | Carbamic acid, N-1H-benzimidazol-2-yl-, methyl ester |
| 39413199 | Carbamic acid, N-1H-benzimidazol-2-yl-, methyl ester |
| 59758951 | Carbamic acid, N-1H-benzimidazol-2-yl-, methyl ester |
| 63090404 | Carbamic acid, N-1H-benzimidazol-2-yl-, methyl ester |
| 63278706 | Carbamic acid, N-1H-benzimidazol-2-yl-, methyl ester |
| 102040017 | Carbamic acid, N-1H-benzimidazol-2-yl-, methyl ester |
| 105268959 | Carbamic acid, N-1H-benzimidazol-2-yl-, methyl ester |
| 110342671 | Carbamic acid, N-1H-benzimidazol-2-yl-, methyl ester |
| 212384286 | Carbamic acid, N-1H-benzimidazol-2-yl-, methyl ester |
| 276680081 | Carbamic acid, N-1H-benzimidazol-2-yl-, methyl ester |
| 1135441267 | Carbamic acid, N-1H-benzimidazol-2-yl-, methyl ester |
| 1155875947 | Carbamic acid, N-1H-benzimidazol-2-yl-, methyl ester |
| 1203557883 | Carbamic acid, N-1H-benzimidazol-2-yl-, methyl ester |
| 17804352 | Carbamic acid, N-[1-[(butylamino)carbonyl]-1H-benzimidazol-2-yl]-, methyl ester |
| 39357409 | Carbamic acid, N-[1-[(butylamino)carbonyl]-1H-benzimidazol-2-yl]-, methyl ester |
| 52683564 | Carbamic acid, N-[1-[(butylamino)carbonyl]-1H-benzimidazol-2-yl]-, methyl ester |
| 1135441256 | Carbamic acid, N-[1-[(butylamino)carbonyl]-1H-benzimidazol-2-yl]-, methyl ester |
| 55406536 | Carbamic acid, N-butyl-, 3-iodo-2-propyn-1-yl ester |
| 84826915 | Carbamic acid, N-butyl-, 3-iodo-2-propyn-1-yl ester |
| 85045096 | Carbamic acid, N-butyl-, 3-iodo-2-propyn-1-yl ester |
| 104732425 | Carbamic acid, N-butyl-, 3-iodo-2-propyn-1-yl ester |
| 161849418 | Carbamic acid, N-butyl-, 3-iodo-2-propyn-1-yl ester |
| 1129415 | Carbamic acid, N-methyl-, 3-methylphenyl ester |
| 105408 | Carbamic acid, N-methyl-, ethyl ester |
| 615532 | Carbamic acid, N-methyl-N-nitroso-, ethyl ester |
| 122249 | Carbamic acid, N-phenyl-, 1-methylethyl ester |
| 122429 | Carbamic acid, N-phenyl-, 1-methylethyl ester |
| 55285148 | Carbamic acid, [(dibutylamino)thio]methyl-, 2,3-dihydro-2,2-dimethyl-7-benzofuranyl ester |
| 73468618 | Carbamic acid, [(dibutylamino)thio]methyl-, 2,3-dihydro-2,2-dimethyl-7-benzofuranyl ester |
| 23564069 | Carbamic acid, [1,2-phenylenebis(iminocarbonothioyl)]bis-, diethyl ester |
| 37233548 | Carbamic acid, [1,2-phenylenebis(iminocarbonothioyl)]bis-, diethyl ester |
| 37359516 | Carbamic acid, [1,2-phenylenebis(iminocarbonothioyl)]bis-, diethyl ester |
| 39300544 | Carbamic acid, [1,2-phenylenebis(iminocarbonothioyl)]bis-, diethyl ester |
| 23564058 | Carbamic acid, [1,2-phenylenebis(iminocarbonothioyl)]bis-, dimethyl ester |
| 50814125 | Carbamic acid, [1,2-phenylenebis(iminocarbonothioyl)]bis-, dimethyl ester |
| 17804352 | Carbamic acid, [1-[(butylamino)carbonyl]-1H-benzimidazol-2-yl]-, methyl ester and methyl 1H-benzimidazol-2-ylcarbamate, total |
| 72490018 | Carbamic acid, [2-(4-phenoxyphenoxy)ethyl]-, ethyl ester |
| 79127803 | Carbamic acid, [2-(4-phenoxyphenoxy)ethyl]-, ethyl ester |
| 13684565 | Carbamic acid, [3-[[(phenylamino)carbonyl]oxy]phenyl]-, ethyl ester |
| 125579955 | Carbamic acid, [3-[[(phenylamino)carbonyl]oxy]phenyl]-, ethyl ester |
| 153703696 | Carbamic acid, [3-[[(phenylamino)carbonyl]oxy]phenyl]-, ethyl ester |
| 31430189 | Carbamic acid, [5-(2-thienylcarbonyl)-1H-benzimidazol-2-yl]-, methyl ester |
| 644644 | Carbamic acid, dimethyl-, 1-[(dimethylamino)carbonyl]-5-methyl-1H-pyrazol-3-yl ester |
| 23103982 | Carbamic acid, dimethyl-, 2-(dimethylamino)-5,6-dimethyl-4-pyrimidinyl ester |
| 119380 | Carbamic acid, dimethyl-, 3-methyl-1-(1-methylethyl)-1H-pyrazol-5-yl ester |
| 51796 | Carbamic acid, ethyl ester |
| 121382272 | Carbamic acid, ethyl ester |
| 614959 | Carbamic acid, ethylnitroso-, ethyl ester |
| 598550 | Carbamic acid, methyl ester |
| 88108 | Carbamic chloride, N,N-diethyl- |
| 79447 | Carbamic chloride, N,N-dimethyl- |
| 342009250 | Carbamic chloride, N,N-dimethyl- |
| 51026289 | Carbamodithioic acid, (hydroxymethyl)methyl-, monopotassium salt |
| 34731323 | Carbamodithioic acid, 1,2-ethanediyl ester |
| 111546 | Carbamodithioic acid, 1,2-ethanediylbis- |
| 111546 | Carbamodithioic acid, 1,2-ethanediylbis-, salts and esters |
| 142596 | Carbamodithioic acid, N,N'-1,2-ethanediylbis-, sodium salt (1:2) |
| 148185 | Carbamodithioic acid, N,N-diethyl-, sodium salt (1:1) |
| 19622061 | Carbamodithioic acid, N,N-diethyl-, sodium salt (1:1) |
| 143189633 | Carbamodithioic acid, N,N-diethyl-, sodium salt (1:1) |
| 149099810 | Carbamodithioic acid, N,N-diethyl-, sodium salt (1:1) |
| 1086257944 | Carbamodithioic acid, N,N-diethyl-, sodium salt (1:1) |
| 1240386508 | Carbamodithioic acid, N,N-diethyl-, sodium salt (1:1) |
| 128030 | Carbamodithioic acid, N,N-dimethyl-, potassium salt (1:1) |
| 81990014 | Carbamodithioic acid, N,N-dimethyl-, potassium salt (1:1) |
| 128041 | Carbamodithioic acid, N,N-dimethyl-, sodium salt (1:1) |
| 8000962 | Carbamodithioic acid, N,N-dimethyl-, sodium salt (1:1) |
| 122544461 | Carbamodithioic acid, N,N-dimethyl-, sodium salt (1:1) |
| 165724027 | Carbamodithioic acid, N,N-dimethyl-, sodium salt (1:1) |
| 191490263 | Carbamodithioic acid, N,N-dimethyl-, sodium salt (1:1) |
| 138932 | Carbamodithioic acid, cyano-, disodium salt |
| 95067 | Carbamodithioic acid, diethyl-, 2-chloro-2-propenyl ester |
| 4384821 | Carbamodithioic acid, ion(1-) |
| 137417 | Carbamodithioic acid, methyl-, monopotassium salt |
| 137428 | Carbamodithioic acid, methyl-, monosodium salt |
| 6734801 | Carbamodithioic acid, methyl-, monosodium salt |
| 118939687 | Carbamodithioic acid, methyl-, monosodium salt |
| 2008415 | Carbamothioic acid, N,N-bis(2-methylpropyl)-, S-ethyl ester |
| 759944 | Carbamothioic acid, N,N-dipropyl-, S-ethyl ester |
| 2398961 | Carbamothioic acid, N-methyl-N-(3-methylphenyl)-, O-2-naphthalenyl ester |
| 94256641 | Carbamothioic acid, N-methyl-N-(3-methylphenyl)-, O-2-naphthalenyl ester |
| 2303175 | Carbamothioic acid, bis(1-methylethyl)-, S-(2,3,3-trichloro-2-propenyl) ester |
| 2303164 | Carbamothioic acid, bis(1-methylethyl)-, S-(2,3-dichloro-2-propenyl) ester |
| 1114712 | Carbamothioic acid, butylethyl-, S-propyl ester |
| 1134232 | Carbamothioic acid, cyclohexylethyl-, S-ethyl ester |
| 71330397 | Carbamothioic acid, cyclohexylethyl-, S-ethyl ester |
| 102827021 | Carbamothioic acid, cyclohexylethyl-, S-ethyl ester |
| 11099664 | Carbamothioic acid, diethyl-, S-[(4-chlorophenyl)methyl] ester |
| 28249776 | Carbamothioic acid, diethyl-, S-[(4-chlorophenyl)methyl] ester |
| 52888809 | Carbamothioic acid, dipropyl-, S-(phenylmethyl) ester |
| 123780416 | Carbamothioic acid, dipropyl-, S-(phenylmethyl) ester |
| 1929777 | Carbamothioic acid, dipropyl-, S-propyl ester |
| 7440440 | Carbon |
| 12789229 | Carbon |
| 26837672 | Carbon |
| 37196295 | Carbon |
| 39422043 | Carbon |
| 39434349 | Carbon |
| 67167413 | Carbon |
| 76416610 | Carbon |
| 76543732 | Carbon |
| 82600586 | Carbon |
| 83138287 | Carbon |
| 90452985 | Carbon |
| 114680001 | Carbon |
| 116788820 | Carbon |
| 130960031 | Carbon |
| 137322215 | Carbon |
| 208519328 | Carbon |
| 208728205 | Carbon |
| 263716832 | Carbon |
| 798556124 | Carbon |
| 798556146 | Carbon |
| 1173019221 | Carbon |
| 1194406524 | Carbon |
| 1431285936 | Carbon |
| 1333864 | Carbon black |
| 1343039 | Carbon black |
| 7440440 | Carbon black |
| 12768988 | Carbon black |
| 52623242 | Carbon black |
| 53095526 | Carbon black |
| 53851028 | Carbon black |
| 55353429 | Carbon black |
| 55607959 | Carbon black |
| 56257795 | Carbon black |
| 56257808 | Carbon black |
| 56274590 | Carbon black |
| 56729250 | Carbon black |
| 56729261 | Carbon black |
| 58517296 | Carbon black |
| 61512592 | Carbon black |
| 63661314 | Carbon black |
| 64427561 | Carbon black |
| 72536891 | Carbon black |
| 73560380 | Carbon black |
| 75026754 | Carbon black |
| 76632923 | Carbon black |
| 79921098 | Carbon black |
| 97708446 | Carbon black |
| 97793378 | Carbon black |
| 101239809 | Carbon black |
| 106907704 | Carbon black |
| 109766769 | Carbon black |
| 124760061 | Carbon black |
| 131640454 | Carbon black |
| 133136502 | Carbon black |
| 138464412 | Carbon black |
| 147335737 | Carbon black |
| 179607251 | Carbon black |
| 181719824 | Carbon black |
| 186708929 | Carbon black |
| 186708963 | Carbon black |
| 208728216 | Carbon black |
| 214540860 | Carbon black |
| 334869088 | Carbon black |
| 429685074 | Carbon black |
| 566149766 | Carbon black |
| 681225934 | Carbon black |
| 914651142 | Carbon black |
| 1228663533 | Carbon black |
| 124389 | Carbon dioxide |
| 18923201 | Carbon dioxide |
| 957761352 | Carbon dioxide |
| 1053656668 | Carbon dioxide |
| 1053659601 | Carbon dioxide |
| 1202865277 | Carbon dioxide |
| 75150 | Carbon disulfide |
| 355120853 | Carbon disulfide |
| 630080 | Carbon monoxide |
| 18421608 | Carbon monoxide |
| 82063465 | Carbon monoxide |
| 153929545 | Carbon monoxide |
| 155399523 | Carbon monoxide |
| 162342485 | Carbon monoxide |
| 167416300 | Carbon monoxide |
| 192819800 | Carbon monoxide |
| 724693690 | Carbon monoxide |
| 740776492 | Carbon monoxide |
| 807306747 | Carbon monoxide |
| 463581 | Carbon oxide sulfide (COS) |
| 20684882 | Carbon oxide sulfide (COS) |
| 14762755 | Carbon, isotope of mass 14 |
| 22143164 | Carbon, isotope of mass 14 |
| 7440440 | Carbon, organic |
| 3812326 | Carbonate |
| 71523 | Carbonate, hydrogen |
| 471341 | Carbonic acid calcium salt (1:1) |
| 39454552 | Carbonic acid calcium salt (1:1) |
| 60083796 | Carbonic acid calcium salt (1:1) |
| 63660979 | Carbonic acid calcium salt (1:1) |
| 71060883 | Carbonic acid calcium salt (1:1) |
| 72608129 | Carbonic acid calcium salt (1:1) |
| 114453699 | Carbonic acid calcium salt (1:1) |
| 137803942 | Carbonic acid calcium salt (1:1) |
| 146358954 | Carbonic acid calcium salt (1:1) |
| 148092937 | Carbonic acid calcium salt (1:1) |
| 166516014 | Carbonic acid calcium salt (1:1) |
| 172307276 | Carbonic acid calcium salt (1:1) |
| 180616313 | Carbonic acid calcium salt (1:1) |
| 197809384 | Carbonic acid calcium salt (1:1) |
| 198352339 | Carbonic acid calcium salt (1:1) |
| 251358288 | Carbonic acid calcium salt (1:1) |
| 459411100 | Carbonic acid calcium salt (1:1) |
| 878759263 | Carbonic acid calcium salt (1:1) |
| 1352815510 | Carbonic acid calcium salt (1:1) |
| 144558 | Carbonic acid sodium salt (1:1) |
| 151127729 | Carbonic acid sodium salt (1:1) |
| 172672172 | Carbonic acid sodium salt (1:1) |
| 196216689 | Carbonic acid sodium salt (1:1) |
| 199723767 | Carbonic acid sodium salt (1:1) |
| 246180972 | Carbonic acid sodium salt (1:1) |
| 1182403480 | Carbonic acid sodium salt (1:1) |
| 497198 | Carbonic acid sodium salt (1:2) |
| 1332576 | Carbonic acid sodium salt (1:2) |
| 1314087392 | Carbonic acid sodium salt (1:2) |
| 20227923 | Carbonic acid, compd. with cyclohexanamine |
| 105588 | Carbonic acid, diethyl ester |
| 554132 | Carbonic acid, lithium salt (1:2) |
| 12767190 | Carbonic acid, lithium salt (1:2) |
| 216964613 | Carbonic acid, lithium salt (1:2) |
| 1312765653 | Carbonic acid, lithium salt (1:2) |
| 534087 | Carbonic acid, potassium salt (1:2) |
| 584087 | Carbonic acid, potassium salt (1:2) |
| 30095944 | Carbonic acid, potassium salt (1:2) |
| 6533739 | Carbonic acid, thallium(1+) salt (1:2) |
| 75445 | Carbonic dichloride |
| 957761045 | Carbonic dichloride |
| 353504 | Carbonic difluoride |
| 497187 | Carbonic dihydrazide |
| 108236 | Carbonochloridic acid, 1-methylethyl ester |
| 94274223 | Carbonochloridic acid, 1-methylethyl ester |
| 541413 | Carbonochloridic acid, ethyl ester |
| 52803299 | Carbonochloridic acid, ethyl ester |
| 503842497 | Carbonochloridic acid, ethyl ester |
| 79221 | Carbonochloridic acid, methyl ester |
| 109615 | Carbonochloridic acid, propyl ester |
| 2812739 | Carbonochloridothioic acid |
| 16890850 | Carbonochloridothioic acid |
| 2941642 | Carbonochloridothioic acid, S-ethyl ester |
| 1082068754 | Carbonochloridothioic acid, S-ethyl ester |
| 13889924 | Carbonochloridothioic acid, S-propyl ester |
| 463718 | Carbonothioic dichloride |
| 9000402 | Carob gum |
| 9010359 | Carob gum |
| 9010519 | Carob gum |
| 37231315 | Carob gum |
| 37231326 | Carob gum |
| 72980804 | Carob gum |
| 73379789 | Carob gum |
| 8001794 | Castor oil |
| 8013567 | Castor oil |
| 8015574 | Castor oil |
| 8021372 | Castor oil |
| 8036086 | Castor oil |
| 8041223 | Castor oil |
| 8041950 | Castor oil |
| 89958327 | Castor oil |
| 151438721 | Castor oil |
| 898831113 | Castor oil |
| 9004346 | Cellulose |
| 9012195 | Cellulose |
| 9037507 | Cellulose |
| 9076306 | Cellulose |
| 12656529 | Cellulose |
| 39394439 | Cellulose |
| 51395767 | Cellulose |
| 58968675 | Cellulose |
| 61991217 | Cellulose |
| 61991228 | Cellulose |
| 67016755 | Cellulose |
| 67016766 | Cellulose |
| 68073052 | Cellulose |
| 70225795 | Cellulose |
| 74623168 | Cellulose |
| 75398833 | Cellulose |
| 77907701 | Cellulose |
| 84503753 | Cellulose |
| 89468666 | Cellulose |
| 99331825 | Cellulose |
| 152231691 | Cellulose |
| 189398865 | Cellulose |
| 209533959 | Cellulose |
| 324745495 | Cellulose |
| 358787629 | Cellulose |
| 1161712522 | Cellulose |
| 1374408522 | Cellulose |
| 9004675 | Cellulose, methyl ether |
| 39384651 | Cellulose, methyl ether |
| 53568346 | Cellulose, methyl ether |
| 71812196 | Cellulose, methyl ether |
| 88402840 | Cellulose, methyl ether |
| 99638592 | Cellulose, methyl ether |
| 730985587 | Cellulose, methyl ether |
| 1339760 | Cellulose, nitrate |
| 8050699 | Cellulose, nitrate |
| 8050702 | Cellulose, nitrate |
| 9004700 | Cellulose, nitrate |
| 37228312 | Cellulose, nitrate |
| 37317489 | Cellulose, nitrate |
| 60649572 | Cellulose, nitrate |
| 72026643 | Cellulose, nitrate |
| 72026687 | Cellulose, nitrate |
| 88386258 | Cellulose, nitrate |
| 124362830 | Cellulose, nitrate |
| 152264125 | Cellulose, nitrate |
| 188626791 | Cellulose, nitrate |
| 246848293 | Cellulose, nitrate |
| 353274563 | Cellulose, nitrate |
| 909342547 | Cellulose, nitrate |
| 7440451 | Cerium |
| 110123494 | Cerium |
| 196959418 | Cerium |
| 13967743 | Cerium, isotope of mass 141 |
| 14119198 | Cerium, isotope of mass 143 |
| 14762788 | Cerium, isotope of mass 144 |
| 7440462 | Cesium |
| 24347124 | Cesium |
| 1093650975 | Cesium |
| 1308470 | Cesium hydroxide (Cs(OH)) |
| 21351791 | Cesium hydroxide (Cs(OH)) |
| 14914762 | Cesium, isotope of mass 131 |
| 13967709 | Cesium, isotope of mass 134 |
| 15726304 | Cesium, isotope of mass 135 |
| 14234298 | Cesium, isotope of mass 136 |
| 10045973 | Cesium, isotope of mass 137 |
| 17032303 | Cesium, isotope of mass 137 |
| 100045973 | Cesium, isotope of mass 137 |
| 55867 | Chloramide |
| 10599903 | Chloramide |
| 1428979514 | Chloramide |
| 14866683 | Chlorate |
| 12789036 | Chlordane, technical |
| 15477335 | Chloric acid, aluminum salt |
| 7775099 | Chloric acid, sodium salt (1:1) |
| 11096450 | Chloric acid, sodium salt (1:1) |
| 38869737 | Chloric acid, sodium salt (1:1) |
| 38869748 | Chloric acid, sodium salt (1:1) |
| 8012837 | Chloric acid, sodium salt, mixt. with boric acid (HBO2) sodium salt |
| 51990115 | Chloric acid, sodium salt, mixt. with boric acid (HBO2) sodium salt |
| 52623844 | Chloric acid, sodium salt, mixt. with boric acid (HBO2) sodium salt |
| 16887006 | Chloride |
| 68188885 | Chloride |
| 405267461 | Chloride |
| 136677093 | Chlorinated dibenzo-p-dioxins |
| 75003 | Chlorine |
| 7782505 | Chlorine |
| 7790912 | Chlorine fluoride (ClF3) |
| 12422229 | Chlorine fluoride (ClF3) |
| 12526022 | Chlorine fluoride (ClF3) |
| 7791211 | Chlorine oxide (Cl2O) |
| 1333819 | Chlorine oxide (ClO2) |
| 10049044 | Chlorine oxide (ClO2) |
| 24518476 | Chlorine oxide (ClO2) |
| 56310066 | Chlorine oxide (ClO2) |
| 69049770 | Chlorine oxide (ClO2) |
| 70134371 | Chlorine oxide (ClO2) |
| 72061906 | Chlorine oxide (ClO2) |
| 74296110 | Chlorine oxide (ClO2) |
| 77546179 | Chlorine oxide (ClO2) |
| 77546180 | Chlorine oxide (ClO2) |
| 93085224 | Chlorine oxide (ClO2) |
| 155808176 | Chlorine oxide (ClO2) |
| 744149539 | Chlorine oxide (ClO2) |
| 807261605 | Chlorine oxide (ClO2) |
| 1002158679 | Chlorine oxide (ClO2) |
| 1014743760 | Chlorine oxide (ClO2) |
| 1018807914 | Chlorine oxide (ClO2) |
| 1428979525 | Chlorine oxide (ClO2) |
| 13981436 | Chlorine, isotope of mass 36 |
| 14998277 | Chlorite |
| 7647010 | Chlorofluorocarbons |
| 11003455 | Chlorophyll c |
| 12777503 | Chlorophyll c |
| 7758192 | Chlorous acid, sodium salt (1:1) |
| 66554516 | Chlorous acid, sodium salt (1:1) |
| 1352826562 | Chlorous acid, sodium salt (1:1) |
| 434139 | Cholan-24-oic acid, 3-hydroxy-, (3.alpha.,5.beta.)- |
| 3546109 | Cholest-5-en-3-ol (3.beta.)-, 4-[bis(2-chloroethyl)amino]benzeneacetate |
| 9007265 | Cholestyramine |
| 11041126 | Cholestyramine |
| 58391370 | Cholestyramine |
| 12381485 | Chromate (CrO42-) |
| 13907454 | Chromate (CrO42-) |
| 76055691 | Chromate (CrO42-) |
| 795254943 | Chromate (CrO42-) |
| 13530682 | Chromic acid (H2Cr2O7) |
| 30441384 | Chromic acid (H2Cr2O7) |
| 7789095 | Chromic acid (H2Cr2O7), ammonium salt (1:2) |
| 7778509 | Chromic acid (H2Cr2O7), potassium salt (1:2) |
| 10588019 | Chromic acid (H2Cr2O7), sodium salt (1:2) |
| 12018325 | Chromic acid (H2Cr2O7), sodium salt (1:2) |
| 1018900849 | Chromic acid (H2Cr2O7), sodium salt (1:2) |
| 1088355138 | Chromic acid (H2Cr2O7), sodium salt (1:2) |
| 1391351000 | Chromic acid (H2Cr2O7), sodium salt (1:2) |
| 7738945 | Chromic acid (H2CrO4) |
| 9044104 | Chromic acid (H2CrO4) |
| 11115745 | Chromic acid (H2CrO4) |
| 24934609 | Chromic acid (H2CrO4) |
| 199384582 | Chromic acid (H2CrO4) |
| 237391945 | Chromic acid (H2CrO4) |
| 7788989 | Chromic acid (H2CrO4), ammonium salt (1:2) |
| 50929823 | Chromic acid (H2CrO4), ammonium salt (1:2) |
| 10294403 | Chromic acid (H2CrO4), barium salt (1:1) |
| 12000349 | Chromic acid (H2CrO4), barium salt (1:1) |
| 12231184 | Chromic acid (H2CrO4), barium salt (1:1) |
| 1189851 | Chromic acid (H2CrO4), bis(1,1-dimethylethyl) ester |
| 13765190 | Chromic acid (H2CrO4), calcium salt (1:1) |
| 8012757 | Chromic acid (H2CrO4), calcium salt (1:1), dihydrate |
| 10060089 | Chromic acid (H2CrO4), calcium salt (1:1), dihydrate |
| 12640685 | Chromic acid (H2CrO4), compd. with cyclohexanamine |
| 20736645 | Chromic acid (H2CrO4), compd. with cyclohexanamine |
| 7758976 | Chromic acid (H2CrO4), lead(2+) salt (1:1) |
| 8049647 | Chromic acid (H2CrO4), lead(2+) salt (1:1) |
| 18454121 | Chromic acid (H2CrO4), lead(2+) salt (1:1) |
| 181768989 | Chromic acid (H2CrO4), lead(2+) salt (1:1) |
| 14307358 | Chromic acid (H2CrO4), lithium salt (1:2) |
| 7789006 | Chromic acid (H2CrO4), potassium salt (1:2) |
| 7775113 | Chromic acid (H2CrO4), sodium salt (1:2) |
| 7789062 | Chromic acid (H2CrO4), strontium salt (1:1) |
| 54322600 | Chromic acid (H2CrO4), strontium salt (1:1) |
| 166269552 | Chromic acid (H2CrO4), strontium salt (1:1) |
| 1308130 | Chromic acid (H2CrO4), zinc salt (1:1) |
| 1328672 | Chromic acid (H2CrO4), zinc salt (1:1) |
| 13530659 | Chromic acid (H2CrO4), zinc salt (1:1) |
| 14675413 | Chromic acid (H2CrO4), zinc salt (1:1) |
| 7440473 | Chromium |
| 188785877 | Chromium |
| 195161821 | Chromium |
| 13007926 | Chromium carbonyl (Cr(CO)6), (OC-6-11)- |
| 13930944 | Chromium carbonyl (Cr(CO)6), (OC-6-11)- |
| 51053453 | Chromium carbonyl (Cr(CO)6), (OC-6-11)- |
| 848779191 | Chromium carbonyl (Cr(CO)6), (OC-6-11)- |
| 10025737 | Chromium chloride (CrCl3) |
| 7440473 | Chromium compounds |
| 1308141 | Chromium hydroxide (Cr(OH)3) |
| 1331820 | Chromium oxide (CrO3) |
| 1333820 | Chromium oxide (CrO3) |
| 7738945 | Chromium oxide (CrO3) |
| 12324059 | Chromium oxide (CrO3) |
| 12324082 | Chromium oxide (CrO3) |
| 7791142 | Chromium, dichlorodioxo-, (T-4)- |
| 14977618 | Chromium, dichlorodioxo-, (T-4)- |
| 34848094 | Chromium, dichlorodioxo-, (T-4)- |
| 7788967 | Chromium, difluorodioxo-, (T-4)- |
| 22030462 | Chromium, difluorodioxo-, (T-4)- |
| 7440473 | Chromium, ion (Cr3+) |
| 16065831 | Chromium, ion (Cr3+) |
| 18540299 | Chromium, ion (Cr6+) |
| 14392020 | Chromium, isotope of mass 51 |
| 122123 | Chromium, tetrachloro-.mu.-hydroxy[.mu.-(octadecanoato-.kappa.O:.kappa.O')]di- |
| 1338450 | Chromium, tetrachloro-.mu.-hydroxy[.mu.-(octadecanoato-.kappa.O:.kappa.O')]di- |
| 12295920 | Chromium, tetrachloro-.mu.-hydroxy[.mu.-(octadecanoato-.kappa.O:.kappa.O')]di- |
| 15242963 | Chromium, tetrachloro-.mu.-hydroxy[.mu.-(octadecanoato-.kappa.O:.kappa.O')]di- |
| 29543860 | Chromium, tetrachloro-.mu.-hydroxy[.mu.-(octadecanoato-.kappa.O:.kappa.O')]di- |
| 39279920 | Chromium, tetrachloro-.mu.-hydroxy[.mu.-(octadecanoato-.kappa.O:.kappa.O')]di- |
| 113285624 | Chromium, tetrachloro-.mu.-hydroxy[.mu.-(octadecanoato-.kappa.O:.kappa.O')]di- |
| 1271245 | Chromocene |
| 218019 | Chrysene |
| 27274051 | Chrysene |
| 1719035 | Chrysene-d12 |
| 12001295 | Chrysotile (Mg3H2(SiO4)2.H2O) |
| 12426981 | Chrysotile (Mg3H2(SiO4)2.H2O) |
| 61076979 | Chrysotile (Mg3H2(SiO4)2.H2O) |
| 132207320 | Chrysotile (Mg3H2(SiO4)2.H2O) |
| 56542 | Cinchonan-9-ol, 6'-methoxy-, (9S)- |
| 11010734 | Cinchonan-9-ol, 6'-methoxy-, (9S)- |
| 500225456 | Cinchonan-9-ol, 6'-methoxy-, (9S)- |
| 845886648 | Cinchonan-9-ol, 6'-methoxy-, (9S)- |
| 882741471 | Cinchonan-9-ol, 6'-methoxy-, (9S)- |
| 883881014 | Cinchonan-9-ol, 6'-methoxy-, (9S)- |
| 898814001 | Cinchonan-9-ol, 6'-methoxy-, (9S)- |
| 910899513 | Cinchonan-9-ol, 6'-methoxy-, (9S)- |
| 126851283 | Clam-Trol CT 1 |
| 193700059 | Clam-trol CT-2 |
| 7440484 | Cobalt |
| 132965607 | Cobalt |
| 177256358 | Cobalt |
| 184637910 | Cobalt |
| 195161796 | Cobalt |
| 335349434 | Cobalt |
| 1245817406 | Cobalt |
| 1262528324 | Cobalt |
| 7440484 | Cobalt compounds |
| 1307966 | Cobalt oxide (CoO) |
| 185461932 | Cobalt oxide (CoO) |
| 186373013 | Cobalt oxide (CoO) |
| 1317426 | Cobalt sulfide (CoS) |
| 23319519 | Cobalt, [N,N-bis(carboxymethyl)glycinato(3-)-N,O,O',O'']- |
| 57693024 | Cobalt, [[2,2'-[1,2-ethanediylbis[(nitrilo-.kappa.N)methylidyne]]bis[6-fluorophenolato-.kappa.O]](2-)]-, (SP-4-2)- |
| 62207765 | Cobalt, [[2,2'-[1,2-ethanediylbis[(nitrilo-.kappa.N)methylidyne]]bis[6-fluorophenolato-.kappa.O]](2-)]-, (SP-4-2)- |
| 10210681 | Cobalt, di-.mu.-carbonylhexacarbonyldi-, (Co-Co) |
| 12553616 | Cobalt, di-.mu.-carbonylhexacarbonyldi-, (Co-Co) |
| 14525269 | Cobalt, di-.mu.-carbonylhexacarbonyldi-, (Co-Co) |
| 19998880 | Cobalt, di-.mu.-carbonylhexacarbonyldi-, (Co-Co) |
| 24917042 | Cobalt, di-.mu.-carbonylhexacarbonyldi-, (Co-Co) |
| 90043995 | Cobalt, di-.mu.-carbonylhexacarbonyldi-, (Co-Co) |
| 13981505 | Cobalt, isotope of mass 57 |
| 13981389 | Cobalt, isotope of mass 58 |
| 7440484 | Cobalt, isotope of mass 60 |
| 10198400 | Cobalt, isotope of mass 60 |
| 16842038 | Cobalt, tetracarbonylhydro- |
| 53108502 | Cobaltate(1-), [N,N-bis[(carboxy-.kappa.O)methyl]glycinato(3-)-.kappa.N,.kappa.O]-, hydrogen (1:1), (T-4)- |
| 1277436 | Cobaltocene |
| 78206334 | Cobaltocene |
| 8007452 | Coke oven emissions -- CAA 112B |
| 7440508 | Copper |
| 65555900 | Copper |
| 72514831 | Copper |
| 133353465 | Copper |
| 133353476 | Copper |
| 195161809 | Copper |
| 7440508 | Copper 90th percentile exceedance |
| 7758896 | Copper chloride (CuCl) |
| 11093688 | Copper chloride (CuCl) |
| 12258967 | Copper chloride (CuCl) |
| 12622241 | Copper chloride (CuCl) |
| 53906700 | Copper chloride (CuCl) |
| 53906711 | Copper chloride (CuCl) |
| 53906722 | Copper chloride (CuCl) |
| 53906733 | Copper chloride (CuCl) |
| 1344678 | Copper chloride (CuCl2) |
| 7447394 | Copper chloride (CuCl2) |
| 423724634 | Copper chloride (CuCl2) |
| 8011776 | Copper chloride hydroxide (Cu2Cl(OH)3), mixt. with copper hydroxide sulfate (Cu4(OH)6(SO4)) |
| 8012699 | Copper chloride hydroxide (Cu2Cl(OH)3), mixt. with copper hydroxide sulfate (Cu4(OH)6(SO4)) |
| 7440508 | Copper compounds |
| 544923 | Copper cyanide (Cu(CN)) |
| 13092676 | Copper cyanide (Cu(CN)) |
| 1308572 | Copper hydroxide (Cu(OH)2) |
| 12191172 | Copper hydroxide (Cu(OH)2) |
| 20427592 | Copper hydroxide (Cu(OH)2) |
| 42616637 | Copper hydroxide (Cu(OH)2) |
| 177322393 | Copper hydroxide (Cu(OH)2) |
| 1135443536 | Copper hydroxide (Cu(OH)2) |
| 1317391 | Copper oxide (Cu2O) |
| 633343789 | Copper oxide (Cu2O) |
| 1317380 | Copper oxide (CuO) |
| 185461921 | Copper oxide (CuO) |
| 147148 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
| 10482390 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
| 11097566 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
| 11129843 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
| 12767678 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
| 34567549 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
| 37223817 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
| 39378751 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
| 39473104 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
| 51331329 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
| 53028776 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
| 53802065 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
| 55819493 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
| 57425522 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
| 57916968 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
| 59518911 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
| 59966880 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
| 60880515 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
| 60937793 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
| 61489665 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
| 61489778 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
| 61537108 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
| 64333579 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
| 66121195 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
| 69431772 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
| 78170271 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
| 78413599 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
| 85255954 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
| 85256775 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
| 90452203 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
| 92909143 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
| 95660314 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
| 95917741 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
| 96024350 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
| 104921995 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
| 109675776 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
| 109766952 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
| 115284429 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
| 143350474 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
| 158853862 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
| 172308315 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
| 172826469 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
| 175386671 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
| 177529543 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
| 177646058 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
| 184007781 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
| 209343486 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
| 211564975 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
| 211925803 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
| 213190864 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
| 220971302 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
| 244244868 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
| 281664468 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
| 345338752 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
| 392718626 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
| 681847789 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
| 807622862 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
| 819860690 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
| 819860850 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
| 863781220 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
| 876132977 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
| 878390739 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
| 898287575 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
| 924902001 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
| 929875821 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
| 1082606323 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
| 1200437053 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
| 1314884837 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
| 1400683455 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
| 191071 | Coronene |
| 65426279 | Coronene |
| 8001294 | Cottonseed oil |
| 84650011 | Cottonseed oil |
| 89997977 | Cottonseed oil |
| 94279693 | Cottonseed oil |
| 94279706 | Cottonseed oil |
| 8001589 | Creosote |
| 8021394 | Creosote |
| 8001589 | Creosote, wood |
| 8021394 | Creosote, wood |
| 1317482 | Cristobalite (SiO2) |
| 14464461 | Cristobalite (SiO2) |
| 105269703 | Cristobalite (SiO2) |
| 1344758 | Cryolite (Na3(AlF6)) |
| 15096523 | Cryolite (Na3(AlF6)) |
| 10300740 | Cuprate(2-), [2-hydroxy-5-[2-[4'-[2-[2-(hydroxy-.kappa.O)-6-hydroxy-3-[2-[2-(hydroxy-.kappa.O)-5-sulfophenyl]diazenyl-.kappa.N1]phenyl]diazenyl][1,1'-biphenyl]-4-yl]diazenyl]benzoato(4-)]-, sodium (1:2) |
| 16071866 | Cuprate(2-), [2-hydroxy-5-[2-[4'-[2-[2-(hydroxy-.kappa.O)-6-hydroxy-3-[2-[2-(hydroxy-.kappa.O)-5-sulfophenyl]diazenyl-.kappa.N1]phenyl]diazenyl][1,1'-biphenyl]-4-yl]diazenyl]benzoato(4-)]-, sodium (1:2) |
| 39403888 | Cuprate(2-), [2-hydroxy-5-[2-[4'-[2-[2-(hydroxy-.kappa.O)-6-hydroxy-3-[2-[2-(hydroxy-.kappa.O)-5-sulfophenyl]diazenyl-.kappa.N1]phenyl]diazenyl][1,1'-biphenyl]-4-yl]diazenyl]benzoato(4-)]-, sodium (1:2) |
| 58601879 | Cuprate(2-), [2-hydroxy-5-[2-[4'-[2-[2-(hydroxy-.kappa.O)-6-hydroxy-3-[2-[2-(hydroxy-.kappa.O)-5-sulfophenyl]diazenyl-.kappa.N1]phenyl]diazenyl][1,1'-biphenyl]-4-yl]diazenyl]benzoato(4-)]-, sodium (1:2) |
| 76199832 | Cuprate(2-), [2-hydroxy-5-[2-[4'-[2-[2-(hydroxy-.kappa.O)-6-hydroxy-3-[2-[2-(hydroxy-.kappa.O)-5-sulfophenyl]diazenyl-.kappa.N1]phenyl]diazenyl][1,1'-biphenyl]-4-yl]diazenyl]benzoato(4-)]-, sodium (1:2) |
| 10401500 | Cuprate(4-), [.mu.-[[3,3'-[[3,3'-di(hydroxy-.kappa.O)[1,1'-biphenyl]-4,4'-diyl]bis(2,1-diazenediyl-.kappa.N1)]bis[5-amino-4-(hydroxy-.kappa.O)-2,7-naphthalenedisulfonato]](8-)]]di-, sodium (1:4) |
| 23909662 | Cuprate(4-), [.mu.-[[3,3'-[[3,3'-di(hydroxy-.kappa.O)[1,1'-biphenyl]-4,4'-diyl]bis(2,1-diazenediyl-.kappa.N1)]bis[5-amino-4-(hydroxy-.kappa.O)-2,7-naphthalenedisulfonato]](8-)]]di-, sodium (1:4) |
| 27569079 | Cuprate(4-), [.mu.-[[3,3'-[[3,3'-di(hydroxy-.kappa.O)[1,1'-biphenyl]-4,4'-diyl]bis(2,1-diazenediyl-.kappa.N1)]bis[5-amino-4-(hydroxy-.kappa.O)-2,7-naphthalenedisulfonato]](8-)]]di-, sodium (1:4) |
| 28407376 | Cuprate(4-), [.mu.-[[3,3'-[[3,3'-di(hydroxy-.kappa.O)[1,1'-biphenyl]-4,4'-diyl]bis(2,1-diazenediyl-.kappa.N1)]bis[5-amino-4-(hydroxy-.kappa.O)-2,7-naphthalenedisulfonato]](8-)]]di-, sodium (1:4) |
| 72882281 | Cuprate(4-), [.mu.-[[3,3'-[[3,3'-di(hydroxy-.kappa.O)[1,1'-biphenyl]-4,4'-diyl]bis(2,1-diazenediyl-.kappa.N1)]bis[5-amino-4-(hydroxy-.kappa.O)-2,7-naphthalenedisulfonato]](8-)]]di-, sodium (1:4) |
| 190258210 | Cuprate(4-), [.mu.-[[3,3'-[[3,3'-di(hydroxy-.kappa.O)[1,1'-biphenyl]-4,4'-diyl]bis(2,1-diazenediyl-.kappa.N1)]bis[5-amino-4-(hydroxy-.kappa.O)-2,7-naphthalenedisulfonato]](8-)]]di-, sodium (1:4) |
| 420042 | Cyanamide |
| 4200042 | Cyanamide |
| 32729718 | Cyanamide |
| 65931455 | Cyanamide |
| 1467794 | Cyanamide, N,N-dimethyl- |
| 156627 | Cyanamide, calcium salt (1:1) |
| 1015936910 | Cyanamide, calcium salt (1:1) |
| 1202864945 | Cyanamide, calcium salt (1:1) |
| 1203558433 | Cyanamide, calcium salt (1:1) |
| 661201 | Cyanate |
| 16610289 | Cyanate |
| 420053 | Cyanic acid |
| 661201 | Cyanic acid |
| 590283 | Cyanic acid, potassium salt (1:1) |
| 15586002 | Cyanic acid, potassium salt (1:1) |
| 40750901 | Cyanic acid, potassium salt (1:1) |
| 917613 | Cyanic acid, sodium salt (1:1) |
| 16910853 | Cyanic acid, sodium salt (1:1) |
| 64256366 | Cyanic acid, sodium salt (1:1) |
| 159334164 | Cyanic acid, sodium salt (1:1) |
| 57125 | Cyanide |
| 373513 | Cyanide |
| 143339 | Cyanide compounds |
| 506683 | Cyanogen bromide ((CN)Br) |
| 506774 | Cyanogen chloride ((CN)Cl) |
| 3194556 | Cyclododecane, hexabromo- |
| 22374578 | Cyclododecane, hexabromo- |
| 25637994 | Cyclododecane, hexabromo- |
| 108918 | Cyclohexanamine |
| 143247750 | Cyclohexanamine |
| 157973609 | Cyclohexanamine |
| 1761713 | Cyclohexanamine, 4,4'-methylenebis- |
| 123203350 | Cyclohexanamine, 4,4'-methylenebis- |
| 101837 | Cyclohexanamine, N-cyclohexyl- |
| 111487888 | Cyclohexanamine, N-cyclohexyl- |
| 111487935 | Cyclohexanamine, N-cyclohexyl- |
| 111522942 | Cyclohexanamine, N-cyclohexyl- |
| 157973632 | Cyclohexanamine, N-cyclohexyl- |
| 856793276 | Cyclohexanamine, N-cyclohexyl- |
| 3882062 | Cyclohexanamine, N-cyclohexyl-, nitrate |
| 3129917 | Cyclohexanamine, N-cyclohexyl-, nitrite (1:1) |
| 12640765 | Cyclohexanamine, N-cyclohexyl-, nitrite (1:1) |
| 75635313 | Cyclohexanamine, N-cyclohexyl-, nitrite (1:1) |
| 85531006 | Cyclohexanamine, N-cyclohexyl-, nitrite (1:1) |
| 108314121 | Cyclohexanamine, N-cyclohexyl-, nitrite (1:1) |
| 123789162 | Cyclohexanamine, N-cyclohexyl-, nitrite (1:1) |
| 856577725 | Cyclohexanamine, N-cyclohexyl-, nitrite (1:1) |
| 947922 | Cyclohexanamine, N-cyclohexyl-N-nitroso- |
| 110827 | Cyclohexane |
| 319846 | Cyclohexane |
| 5124301 | Cyclohexane, 1,1'-methylenebis[4-isocyanato- |
| 68966632 | Cyclohexane, 1,1'-methylenebis[4-isocyanato- |
| 73156157 | Cyclohexane, 1,1'-methylenebis[4-isocyanato- |
| 88504761 | Cyclohexane, 1,1'-methylenebis[4-isocyanato- |
| 103072215 | Cyclohexane, 1,1'-methylenebis[4-isocyanato- |
| 107314169 | Cyclohexane, 1,1'-methylenebis[4-isocyanato- |
| 123773488 | Cyclohexane, 1,1'-methylenebis[4-isocyanato- |
| 190601979 | Cyclohexane, 1,1'-methylenebis[4-isocyanato- |
| 201536778 | Cyclohexane, 1,1'-methylenebis[4-isocyanato- |
| 280144174 | Cyclohexane, 1,1'-methylenebis[4-isocyanato- |
| 1081805584 | Cyclohexane, 1,1'-methylenebis[4-isocyanato- |
| 608731 | Cyclohexane, 1,2,3,4,5,6-hexachloro- |
| 319858 | Cyclohexane, 1,2,3,4,5,6-hexachloro-, (1.alpha.,2.alpha.,3.alpha.,4.beta.,5.alpha.,6.beta.)- |
| 319868 | Cyclohexane, 1,2,3,4,5,6-hexachloro-, (1.alpha.,2.alpha.,3.alpha.,4.beta.,5.alpha.,6.beta.)- |
| 89609198 | Cyclohexane, 1,2,3,4,5,6-hexachloro-, (1.alpha.,2.alpha.,3.alpha.,4.beta.,5.alpha.,6.beta.)- |
| 58899 | Cyclohexane, 1,2,3,4,5,6-hexachloro-, (1.alpha.,2.alpha.,3.beta.,4.alpha.,5.alpha.,6.beta.)- |
| 8007429 | Cyclohexane, 1,2,3,4,5,6-hexachloro-, (1.alpha.,2.alpha.,3.beta.,4.alpha.,5.alpha.,6.beta.)- |
| 8073232 | Cyclohexane, 1,2,3,4,5,6-hexachloro-, (1.alpha.,2.alpha.,3.beta.,4.alpha.,5.alpha.,6.beta.)- |
| 25897487 | Cyclohexane, 1,2,3,4,5,6-hexachloro-, (1.alpha.,2.alpha.,3.beta.,4.alpha.,5.alpha.,6.beta.)- |
| 53529376 | Cyclohexane, 1,2,3,4,5,6-hexachloro-, (1.alpha.,2.alpha.,3.beta.,4.alpha.,5.alpha.,6.beta.)- |
| 55963796 | Cyclohexane, 1,2,3,4,5,6-hexachloro-, (1.alpha.,2.alpha.,3.beta.,4.alpha.,5.alpha.,6.beta.)- |
| 319846 | Cyclohexane, 1,2,3,4,5,6-hexachloro-, (1.alpha.,2.alpha.,3.beta.,4.alpha.,5.beta.,6.beta.)- |
| 20437972 | Cyclohexane, 1,2,3,4,5,6-hexachloro-, (1.alpha.,2.alpha.,3.beta.,4.alpha.,5.beta.,6.beta.)- |
| 60291329 | Cyclohexane, 1,2,3,4,5,6-hexachloro-, (1.alpha.,2.alpha.,3.beta.,4.alpha.,5.beta.,6.beta.)- |
| 319857 | Cyclohexane, 1,2,3,4,5,6-hexachloro-, (1.alpha.,2.beta.,3.alpha.,4.beta.,5.alpha.,6.beta.)- |
| 87843 | Cyclohexane, 1,2,3,4,5-pentabromo-6-chloro- |
| 25495992 | Cyclohexane, 1,2,3,4,5-pentabromo-6-chloro- |
| 3322938 | Cyclohexane, 1,2-dibromo-4-(1,2-dibromoethyl)- |
| 99821 | Cyclohexane, 1-methyl-4-(1-methylethyl)- |
| 374781461 | Cyclohexane, 1-methyl-4-(1-methylethyl)- |
| 4098719 | Cyclohexane, 5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethyl- |
| 26602937 | Cyclohexane, 5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethyl- |
| 50974997 | Cyclohexane, 5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethyl- |
| 52985930 | Cyclohexane, 5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethyl- |
| 63793408 | Cyclohexane, 5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethyl- |
| 66708074 | Cyclohexane, 5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethyl- |
| 70936979 | Cyclohexane, 5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethyl- |
| 74091637 | Cyclohexane, 5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethyl- |
| 74520926 | Cyclohexane, 5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethyl- |
| 88778749 | Cyclohexane, 5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethyl- |
| 101701808 | Cyclohexane, 5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethyl- |
| 102771744 | Cyclohexane, 5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethyl- |
| 105439029 | Cyclohexane, 5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethyl- |
| 110648356 | Cyclohexane, 5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethyl- |
| 111093755 | Cyclohexane, 5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethyl- |
| 124961520 | Cyclohexane, 5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethyl- |
| 129212175 | Cyclohexane, 5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethyl- |
| 146282599 | Cyclohexane, 5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethyl- |
| 146665385 | Cyclohexane, 5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethyl- |
| 149579362 | Cyclohexane, 5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethyl- |
| 194936840 | Cyclohexane, 5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethyl- |
| 1186289224 | Cyclohexane, 5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethyl- |
| 1199811147 | Cyclohexane, 5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethyl- |
| 1211316629 | Cyclohexane, 5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethyl- |
| 27154445 | Cyclohexane, hexachloro- |
| 69865470 | Cyclohexane, hexachloro- |
| 86752990 | Cyclohexane, hexachloro- |
| 86753926 | Cyclohexane, hexachloro- |
| 88161755 | Cyclohexane, hexachloro- |
| 99684238 | Cyclohexane, hexachloro- |
| 137497611 | Cyclohexane, hexachloro- |
| 139203319 | Cyclohexane, hexachloro- |
| 142443956 | Cyclohexane, hexachloro- |
| 146909559 | Cyclohexane, hexachloro- |
| 159940280 | Cyclohexane, hexachloro- |
| 186554450 | Cyclohexane, hexachloro- |
| 108872 | Cyclohexane, methyl- |
| 1122607 | Cyclohexane, nitro- |
| 931975 | Cyclohexanecarbonitrile, 1-hydroxy- |
| 4802204 | Cyclohexaneethanethiol, 3-mercapto-.beta.,4-dimethyl- |
| 7487312 | Cyclohexaneethanethiol, 3-mercapto-.beta.,4-dimethyl- |
| 31354968 | Cyclohexaneethanethiol, 3-mercapto-.beta.,4-dimethyl- |
| 80524 | Cyclohexanemethanamine, 4-amino-.alpha.,.alpha.,4-trimethyl- |
| 14720048 | Cyclohexanemethanamine, 4-amino-.alpha.,.alpha.,4-trimethyl- |
| 1569693 | Cyclohexanethiol |
| 108930 | Cyclohexanol |
| 67970 | Cyclohexanol, 3-[(2E)-2-[(1R,3aS,7aR)-1-[(1R)-1,5-dimethylhexyl]octahydro-7a-methyl-4H-inden-4-ylidene]ethylidene]-4-methylene-, (1S,3Z)- |
| 8024199 | Cyclohexanol, 3-[(2E)-2-[(1R,3aS,7aR)-1-[(1R)-1,5-dimethylhexyl]octahydro-7a-methyl-4H-inden-4-ylidene]ethylidene]-4-methylene-, (1S,3Z)- |
| 8050677 | Cyclohexanol, 3-[(2E)-2-[(1R,3aS,7aR)-1-[(1R)-1,5-dimethylhexyl]octahydro-7a-methyl-4H-inden-4-ylidene]ethylidene]-4-methylene-, (1S,3Z)- |
| 89781 | Cyclohexanol, 5-methyl-2-(1-methylethyl)-, (1R,2S,5R)-rel- |
| 15356704 | Cyclohexanol, 5-methyl-2-(1-methylethyl)-, (1R,2S,5R)-rel- |
| 1331233 | Cyclohexanol, methyl- |
| 25639423 | Cyclohexanol, methyl- |
| 108941 | Cyclohexanone |
| 583608 | Cyclohexanone, 2-methyl- |
| 24965842 | Cyclohexanone, 2-methyl- |
| 110838 | Cyclohexene |
| 33004067 | Cyclohexene |
| 138863 | Cyclohexene, 1-methyl-4-(1-methylethenyl)- |
| 555088 | Cyclohexene, 1-methyl-4-(1-methylethenyl)- |
| 7705148 | Cyclohexene, 1-methyl-4-(1-methylethenyl)- |
| 8022900 | Cyclohexene, 1-methyl-4-(1-methylethenyl)- |
| 8050326 | Cyclohexene, 1-methyl-4-(1-methylethenyl)- |
| 5989275 | Cyclohexene, 1-methyl-4-(1-methylethenyl)-, (4R)- |
| 7705137 | Cyclohexene, 1-methyl-4-(1-methylethenyl)-, (4R)- |
| 94765750 | Cyclohexene, 1-methyl-4-(1-methylethenyl)-, (4R)- |
| 95327983 | Cyclohexene, 1-methyl-4-(1-methylethenyl)-, (4R)- |
| 1051930869 | Cyclohexene, 1-methyl-4-(1-methylethenyl)-, (4R)- |
| 100403 | Cyclohexene, 4-ethenyl- |
| 92619437 | Cyclohexene, 4-ethenyl- |
| 1162658 | Cyclopenta(c)furo(3',2':4,5)furo(2,3-h)(1)benzopyran-1,11-dione, 2,3,6a,9a-tetrahydro-4-methoxy-, (6aR,9aS)- |
| 27208373 | Cyclopenta[cd]pyrene |
| 287923 | Cyclopentane |
| 96377 | Cyclopentane, methyl- |
| 120923 | Cyclopentanone |
| 142290 | Cyclopentene |
| 33004056 | Cyclopentene |
| 706785 | Cyclopentene, octachloro- |
| 75194 | Cyclopropane |
| 151821328 | Cyclopropane |
| 39515418 | Cyclopropanecarboxylic acid, 2,2,3,3-tetramethyl-, cyano(3-phenoxyphenyl)methyl ester |
| 64257847 | Cyclopropanecarboxylic acid, 2,2,3,3-tetramethyl-, cyano(3-phenoxyphenyl)methyl ester |
| 2735980 | Cyclopropanecarboxylic acid, 2,2-dimethyl-3-(2-methyl-1-propenyl)-, (1,3,4,5,6,7-hexahydro-1,3-dioxo-2H-isoindol-2-yl)methyl ester |
| 7696120 | Cyclopropanecarboxylic acid, 2,2-dimethyl-3-(2-methyl-1-propenyl)-, (1,3,4,5,6,7-hexahydro-1,3-dioxo-2H-isoindol-2-yl)methyl ester |
| 16047226 | Cyclopropanecarboxylic acid, 2,2-dimethyl-3-(2-methyl-1-propenyl)-, (1,3,4,5,6,7-hexahydro-1,3-dioxo-2H-isoindol-2-yl)methyl ester |
| 28643676 | Cyclopropanecarboxylic acid, 2,2-dimethyl-3-(2-methyl-1-propenyl)-, (1,3,4,5,6,7-hexahydro-1,3-dioxo-2H-isoindol-2-yl)methyl ester |
| 28752934 | Cyclopropanecarboxylic acid, 2,2-dimethyl-3-(2-methyl-1-propenyl)-, (1,3,4,5,6,7-hexahydro-1,3-dioxo-2H-isoindol-2-yl)methyl ester |
| 66525277 | Cyclopropanecarboxylic acid, 2,2-dimethyl-3-(2-methyl-1-propenyl)-, (1,3,4,5,6,7-hexahydro-1,3-dioxo-2H-isoindol-2-yl)methyl ester |
| 22467863 | Cyclopropanecarboxylic acid, 2,2-dimethyl-3-(2-methyl-1-propenyl)-, (1S)-2-methyl-4-oxo-3-(2-propenyl)-2-cyclopenten-1-yl ester, (1R,3R)- |
| 28057489 | Cyclopropanecarboxylic acid, 2,2-dimethyl-3-(2-methyl-1-propenyl)-, (1S)-2-methyl-4-oxo-3-(2-propenyl)-2-cyclopenten-1-yl ester, (1R,3R)- |
| 28434006 | Cyclopropanecarboxylic acid, 2,2-dimethyl-3-(2-methyl-1-propenyl)-, (1S)-2-methyl-4-oxo-3-(2-propenyl)-2-cyclopenten-1-yl ester, (1R,3R)- |
| 28991277 | Cyclopropanecarboxylic acid, 2,2-dimethyl-3-(2-methyl-1-propenyl)-, (1S)-2-methyl-4-oxo-3-(2-propenyl)-2-cyclopenten-1-yl ester, (1R,3R)- |
| 121211 | Cyclopropanecarboxylic acid, 2,2-dimethyl-3-(2-methyl-1-propenyl)-, (1S)-2-methyl-4-oxo-3-(2Z)-2,4-pentadienyl-2-cyclopenten-1-yl ester, (1R,3R)- |
| 3903693 | Cyclopropanecarboxylic acid, 2,2-dimethyl-3-(2-methyl-1-propenyl)-, (1S)-2-methyl-4-oxo-3-(2Z)-2,4-pentadienyl-2-cyclopenten-1-yl ester, (1R,3R)- |
| 39668014 | Cyclopropanecarboxylic acid, 2,2-dimethyl-3-(2-methyl-1-propenyl)-, (1S)-2-methyl-4-oxo-3-(2Z)-2,4-pentadienyl-2-cyclopenten-1-yl ester, (1R,3R)- |
| 70382 | Cyclopropanecarboxylic acid, 2,2-dimethyl-3-(2-methyl-1-propenyl)-, (2,4-dimethylphenyl)methyl ester |
| 26002802 | Cyclopropanecarboxylic acid, 2,2-dimethyl-3-(2-methyl-1-propenyl)-, (3-phenoxyphenyl)methyl ester |
| 53528328 | Cyclopropanecarboxylic acid, 2,2-dimethyl-3-(2-methyl-1-propenyl)-, (3-phenoxyphenyl)methyl ester |
| 73170793 | Cyclopropanecarboxylic acid, 2,2-dimethyl-3-(2-methyl-1-propenyl)-, (3-phenoxyphenyl)methyl ester |
| 10453868 | Cyclopropanecarboxylic acid, 2,2-dimethyl-3-(2-methyl-1-propenyl)-, [5-(phenylmethyl)-3-furanyl]methyl ester |
| 24004077 | Cyclopropanecarboxylic acid, 2,2-dimethyl-3-(2-methyl-1-propenyl)-, [5-(phenylmethyl)-3-furanyl]methyl ester |
| 52918635 | Cyclopropanecarboxylic acid, 3-(2,2-dibromoethenyl)-2,2-dimethyl-, (S)-cyano(3-phenoxyphenyl)methyl ester, (1R,3R)- |
| 55700964 | Cyclopropanecarboxylic acid, 3-(2,2-dibromoethenyl)-2,2-dimethyl-, (S)-cyano(3-phenoxyphenyl)methyl ester, (1R,3R)- |
| 62229770 | Cyclopropanecarboxylic acid, 3-(2,2-dibromoethenyl)-2,2-dimethyl-, (S)-cyano(3-phenoxyphenyl)methyl ester, (1R,3R)- |
| 52645531 | Cyclopropanecarboxylic acid, 3-(2,2-dichloroethenyl)-2,2-dimethyl-, (3-phenoxyphenyl)methyl ester |
| 57608045 | Cyclopropanecarboxylic acid, 3-(2,2-dichloroethenyl)-2,2-dimethyl-, (3-phenoxyphenyl)methyl ester |
| 60018942 | Cyclopropanecarboxylic acid, 3-(2,2-dichloroethenyl)-2,2-dimethyl-, (3-phenoxyphenyl)methyl ester |
| 63364001 | Cyclopropanecarboxylic acid, 3-(2,2-dichloroethenyl)-2,2-dimethyl-, (3-phenoxyphenyl)methyl ester |
| 75497642 | Cyclopropanecarboxylic acid, 3-(2,2-dichloroethenyl)-2,2-dimethyl-, (3-phenoxyphenyl)methyl ester |
| 93388660 | Cyclopropanecarboxylic acid, 3-(2,2-dichloroethenyl)-2,2-dimethyl-, (3-phenoxyphenyl)methyl ester |
| 52341329 | Cyclopropanecarboxylic acid, 3-(2,2-dichloroethenyl)-2,2-dimethyl-, (3-phenoxyphenyl)methyl ester, (1R,3S)-rel- |
| 61949777 | Cyclopropanecarboxylic acid, 3-(2,2-dichloroethenyl)-2,2-dimethyl-, (3-phenoxyphenyl)methyl ester, (1R,3S)-rel- |
| 68359375 | Cyclopropanecarboxylic acid, 3-(2,2-dichloroethenyl)-2,2-dimethyl-, cyano(4-fluoro-3-phenoxyphenyl)methyl ester |
| 83855463 | Cyclopropanecarboxylic acid, 3-(2,2-dichloroethenyl)-2,2-dimethyl-, cyano(4-fluoro-3-phenoxyphenyl)methyl ester |
| 85782827 | Cyclopropanecarboxylic acid, 3-(2,2-dichloroethenyl)-2,2-dimethyl-, cyano(4-fluoro-3-phenoxyphenyl)methyl ester |
| 68085858 | Cyclopropanecarboxylic acid, 3-(2-chloro-3,3,3-trifluoro-1-propenyl)-2,2-dimethyl-, cyano(3-phenoxyphenyl)methyl ester |
| 149436997 | Cyclopropanecarboxylic acid, 3-(2-chloro-3,3,3-trifluoro-1-propenyl)-2,2-dimethyl-, cyano(3-phenoxyphenyl)methyl ester |
| 255725861 | Cyclopropanecarboxylic acid, 3-(2-chloro-3,3,3-trifluoro-1-propenyl)-2,2-dimethyl-, cyano(3-phenoxyphenyl)methyl ester |
| 121299 | Cyclopropanecarboxylic acid, 3-[(1E)-3-methoxy-2-methyl-3-oxo-1-propen-1-yl]-2,2-dimethyl-, (1S)-2-methyl-4-oxo-3-(2Z)-2,4-pentadien-1-yl-2-cyclopenten-1-yl ester, (1R,3R)- |
| 39668025 | Cyclopropanecarboxylic acid, 3-[(1E)-3-methoxy-2-methyl-3-oxo-1-propen-1-yl]-2,2-dimethyl-, (1S)-2-methyl-4-oxo-3-(2Z)-2,4-pentadien-1-yl-2-cyclopenten-1-yl ester, (1R,3R)- |
| 79538322 | Cyclopropanecarboxylic acid, 3-[(1Z)-2-chloro-3,3,3-trifluoro-1-propenyl]-2,2-dimethyl-, (2,3,5,6-tetrafluoro-4-methylphenyl)methyl ester, (1R,3R)-rel- |
| 82657043 | Cyclopropanecarboxylic acid, 3-[(1Z)-2-chloro-3,3,3-trifluoro-1-propenyl]-2,2-dimethyl-, (2-methyl[1,1'-biphenyl]-3-yl)methyl ester, (1R,3R)-rel- |
| 88671890 | Cyclopropanecarboxylic acid, 3-[(1Z)-2-chloro-3,3,3-trifluoro-1-propenyl]-2,2-dimethyl-, (2-methyl[1,1'-biphenyl]-3-yl)methyl ester, (1R,3R)-rel- |
| 92880790 | Cyclopropanecarboxylic acid, 3-[(1Z)-2-chloro-3,3,3-trifluoro-1-propenyl]-2,2-dimethyl-, (2-methyl[1,1'-biphenyl]-3-yl)methyl ester, (1R,3R)-rel- |
| 107497609 | Cyclopropanecarboxylic acid, 3-[(1Z)-2-chloro-3,3,3-trifluoro-1-propenyl]-2,2-dimethyl-, (2-methyl[1,1'-biphenyl]-3-yl)methyl ester, (1R,3R)-rel- |
| 107538329 | Cyclopropanecarboxylic acid, 3-[(1Z)-2-chloro-3,3,3-trifluoro-1-propenyl]-2,2-dimethyl-, (2-methyl[1,1'-biphenyl]-3-yl)methyl ester, (1R,3R)-rel- |
| 59865133 | Cyclosporin A |
| 556672 | Cyclotetrasiloxane, 2,2,4,4,6,6,8,8-octamethyl- |
| 83874628 | Cyclotetrasiloxane, 2,2,4,4,6,6,8,8-octamethyl- |
| 104986370 | Cyclotetrasiloxane, 2,2,4,4,6,6,8,8-octamethyl- |
| 117563663 | Cyclotetrasiloxane, 2,2,4,4,6,6,8,8-octamethyl- |
| 1257661598 | Cyclotetrasiloxane, 2,2,4,4,6,6,8,8-octamethyl- |
| 10356760 | Cytidine, 2'-deoxy-5-fluoro- |
| 527071 | D-Gluconic acid, sodium salt (1:1) |
| 15537845 | D-Gluconic acid, sodium salt (1:1) |
| 22808657 | D-Gluconic acid, sodium salt (1:1) |
| 24551744 | D-Gluconic acid, sodium salt (1:1) |
| 252255371 | D-Gluconic acid, sodium salt (1:1) |
| 14906979 | D-Gluconic acid, sodium salt (1:?) |
| 16916782 | D-Gluconic acid, sodium salt (1:?) |
| 735332602 | D-Gluconic acid, sodium salt (1:?) |
| 18883664 | D-Glucose, 2-deoxy-2-[[(methylnitrosoamino)carbonyl]amino]- |
| 63423 | D-Glucose, 4-O-.beta.-D-galactopyranosyl- |
| 1336909 | D-Glucose, 4-O-.beta.-D-galactopyranosyl- |
| 35396146 | D-Glucose, 4-O-.beta.-D-galactopyranosyl- |
| 36570806 | D-Glucose, 4-O-.beta.-D-galactopyranosyl- |
| 73824632 | D-Glucose, 4-O-.beta.-D-galactopyranosyl- |
| 89466762 | D-Glucose, 4-O-.beta.-D-galactopyranosyl- |
| 200734903 | D-Glucose, 4-O-.beta.-D-galactopyranosyl- |
| 396716099 | D-Glucose, 4-O-.beta.-D-galactopyranosyl- |
| 1065027179 | D-Glucose, 4-O-.beta.-D-galactopyranosyl- |
| 488415 | D-Mannitol, 1,6-dibromo-1,6-dideoxy- |
| 673063 | D-Phenylalanine |
| 10549118 | D-Phenylalanine |
| 298395 | D-Streptamine, O-2-deoxy-2-(methylamino)-.alpha.-L-glucopyranosyl-(1.fwdarw.2)-O-5-deoxy-3-C-formyl-.alpha.-L-lyxofuranosyl-(1.fwdarw.4)-N1,N3-bis(aminoiminomethyl)-, sulfate (2:3) |
| 3810740 | D-Streptamine, O-2-deoxy-2-(methylamino)-.alpha.-L-glucopyranosyl-(1.fwdarw.2)-O-5-deoxy-3-C-formyl-.alpha.-L-lyxofuranosyl-(1.fwdarw.4)-N1,N3-bis(aminoiminomethyl)-, sulfate (2:3) |
| 8018051 | D-Streptamine, O-2-deoxy-2-(methylamino)-.alpha.-L-glucopyranosyl-(1.fwdarw.2)-O-5-deoxy-3-C-formyl-.alpha.-L-lyxofuranosyl-(1.fwdarw.4)-N1,N3-bis(aminoiminomethyl)-, sulfate (2:3) |
| 15105938 | D-Streptamine, O-2-deoxy-2-(methylamino)-.alpha.-L-glucopyranosyl-(1.fwdarw.2)-O-5-deoxy-3-C-formyl-.alpha.-L-lyxofuranosyl-(1.fwdarw.4)-N1,N3-bis(aminoiminomethyl)-, sulfate (2:3) |
| 67479327 | D-Streptamine, O-2-deoxy-2-(methylamino)-.alpha.-L-glucopyranosyl-(1.fwdarw.2)-O-5-deoxy-3-C-formyl-.alpha.-L-lyxofuranosyl-(1.fwdarw.4)-N1,N3-bis(aminoiminomethyl)-, sulfate (2:3) |
| 82115933 | D-Streptamine, O-2-deoxy-2-(methylamino)-.alpha.-L-glucopyranosyl-(1.fwdarw.2)-O-5-deoxy-3-C-formyl-.alpha.-L-lyxofuranosyl-(1.fwdarw.4)-N1,N3-bis(aminoiminomethyl)-, sulfate (2:3) |
| 85027845 | D-Streptamine, O-2-deoxy-2-(methylamino)-.alpha.-L-glucopyranosyl-(1.fwdarw.2)-O-5-deoxy-3-C-formyl-.alpha.-L-lyxofuranosyl-(1.fwdarw.4)-N1,N3-bis(aminoiminomethyl)-, sulfate (2:3) |
| 153946 | D-Tryptophan |
| 9000162 | Dammar |
| 1304025 | Decaborane(14) |
| 12707298 | Decaborane(14) |
| 17702419 | Decaborane(14) |
| 27340438 | Decaborane(14) |
| 52340097 | Decaborane(14) |
| 106996536 | Decaborane(14) |
| 112312 | Decanal |
| 124185 | Decane |
| 41556267 | Decanedioic acid, 1,10-bis(1,2,2,6,6-pentamethyl-4-piperidinyl) ester |
| 83931720 | Decanedioic acid, 1,10-bis(1,2,2,6,6-pentamethyl-4-piperidinyl) ester |
| 93793670 | Decanedioic acid, 1,10-bis(1,2,2,6,6-pentamethyl-4-piperidinyl) ester |
| 95078958 | Decanedioic acid, 1,10-bis(1,2,2,6,6-pentamethyl-4-piperidinyl) ester |
| 95918482 | Decanedioic acid, 1,10-bis(1,2,2,6,6-pentamethyl-4-piperidinyl) ester |
| 134868705 | Decanedioic acid, 1,10-bis(1,2,2,6,6-pentamethyl-4-piperidinyl) ester |
| 52829079 | Decanedioic acid, 1,10-bis(2,2,6,6-tetramethyl-4-piperidinyl) ester |
| 64104434 | Decanedioic acid, 1,10-bis(2,2,6,6-tetramethyl-4-piperidinyl) ester |
| 91450214 | Decanedioic acid, 1,10-bis(2,2,6,6-tetramethyl-4-piperidinyl) ester |
| 115621653 | Decanedioic acid, 1,10-bis(2,2,6,6-tetramethyl-4-piperidinyl) ester |
| 121449001 | Decanedioic acid, 1,10-bis(2,2,6,6-tetramethyl-4-piperidinyl) ester |
| 127510036 | Decanedioic acid, 1,10-bis(2,2,6,6-tetramethyl-4-piperidinyl) ester |
| 149264426 | Decanedioic acid, 1,10-bis(2,2,6,6-tetramethyl-4-piperidinyl) ester |
| 152787047 | Decanedioic acid, 1,10-bis(2,2,6,6-tetramethyl-4-piperidinyl) ester |
| 331982980 | Decanedioic acid, 1,10-bis(2,2,6,6-tetramethyl-4-piperidinyl) ester |
| 908343486 | Decanedioic acid, 1,10-bis(2,2,6,6-tetramethyl-4-piperidinyl) ester |
| 122623 | Decanedioic acid, 1,10-bis(2-ethylhexyl) ester |
| 28986405 | Decanedioic acid, 1,10-bis(2-ethylhexyl) ester |
| 131170177 | Decanedioic acid, 1,10-bis(2-ethylhexyl) ester |
| 334485 | Decanoic acid |
| 1562943 | Diazene, 1,2-bis(4-methoxyphenyl)-, 1-oxide |
| 74123210 | Diazene, 1,2-bis(4-methoxyphenyl)-, 1-oxide |
| 93485768 | Diazene, 1,2-bis(4-methoxyphenyl)-, 1-oxide |
| 1081826358 | Diazene, 1,2-bis(4-methoxyphenyl)-, 1-oxide |
| 103333 | Diazene, 1,2-diphenyl- |
| 495487 | Diazene, 1,2-diphenyl-, 1-oxide |
| 55599321 | Diazene, 1,2-diphenyl-, 1-oxide |
| 8074702 | Diazene, 1-(4-butylphenyl)-2-(4-methoxyphenyl)-, monooxide |
| 11106540 | Diazene, 1-(4-butylphenyl)-2-(4-methoxyphenyl)-, monooxide |
| 11115745 | Diazene, 1-(4-butylphenyl)-2-(4-methoxyphenyl)-, monooxide |
| 53469173 | Diazene, 1-(4-butylphenyl)-2-(4-methoxyphenyl)-, monooxide |
| 56214961 | Diazene, 1-(4-butylphenyl)-2-(4-methoxyphenyl)-, monooxide |
| 56728188 | Diazene, 1-(4-butylphenyl)-2-(4-methoxyphenyl)-, monooxide |
| 68992881 | Diazene, 1-(4-butylphenyl)-2-(4-methoxyphenyl)-, monooxide |
| 25843452 | Diazene, dimethyl-, 1-oxide |
| 140567 | Diazenesulfonic acid, [4-(dimethylamino)phenyl]-, sodium salt |
| 226368 | Dibenz[a,h]acridine |
| 53703 | Dibenz[a,h]anthracene |
| 224420 | Dibenz[a,j]acridine |
| 19408743 | Dibenzo-p-dioxin, 1,2,3,7,8,9-hexachloro- |
| 189640 | Dibenzo[b,def]chrysene |
| 189644 | Dibenzo[b,def]chrysene |
| 128665 | Dibenzo[b,def]chrysene-7,14-dione |
| 12772520 | Dibenzo[b,def]chrysene-7,14-dione |
| 39280745 | Dibenzo[b,def]chrysene-7,14-dione |
| 115685466 | Dibenzo[b,def]chrysene-7,14-dione |
| 662165697 | Dibenzo[b,def]chrysene-7,14-dione |
| 262124 | Dibenzo[b,e][1,4]dioxin |
| 35822469 | Dibenzo[b,e][1,4]dioxin, 1,2,3,4,6,7,8-heptachloro- |
| 5820070 | Dibenzo[b,e][1,4]dioxin, 1,2,3,4,6,7,9-heptachloro- |
| 58200707 | Dibenzo[b,e][1,4]dioxin, 1,2,3,4,6,7,9-heptachloro- |
| 39227286 | Dibenzo[b,e][1,4]dioxin, 1,2,3,4,7,8-hexachloro- |
| 57653857 | Dibenzo[b,e][1,4]dioxin, 1,2,3,4,7,8-hexachloro- |
| 30746588 | Dibenzo[b,e][1,4]dioxin, 1,2,3,4-tetrachloro- |
| 34465468 | Dibenzo[b,e][1,4]dioxin, 1,2,3,6,7,8-hexachloro- |
| 57653857 | Dibenzo[b,e][1,4]dioxin, 1,2,3,6,7,8-hexachloro- |
| 40321764 | Dibenzo[b,e][1,4]dioxin, 1,2,3,7,8-pentachloro- |
| 1745016 | Dibenzo[b,e][1,4]dioxin, 2,3,7,8-tetrachloro- |
| 1746016 | Dibenzo[b,e][1,4]dioxin, 2,3,7,8-tetrachloro- |
| 56795676 | Dibenzo[b,e][1,4]dioxin, 2,3,7,8-tetrachloro- |
| 33857282 | Dibenzo[b,e][1,4]dioxin, 2,3,7-trichloro- |
| 33857260 | Dibenzo[b,e][1,4]dioxin, 2,7-dichloro- |
| 37871004 | Dibenzo[b,e][1,4]dioxin, heptachloro- |
| 34464432 | Dibenzo[b,e][1,4]dioxin, hexachloro- |
| 34465468 | Dibenzo[b,e][1,4]dioxin, hexachloro- |
| 3268879 | Dibenzo[b,e][1,4]dioxin, octachloro- |
| 36088229 | Dibenzo[b,e][1,4]dioxin, pentachloro- |
| 41903575 | Dibenzo[b,e][1,4]dioxin, tetrachloro- |
| 191264 | Dibenzo[def,mno]chrysene |
| 132649 | Dibenzofuran |
| 214827482 | Dibenzofuran |
| 67562394 | Dibenzofuran, 1,2,3,4,6,7,8-heptachloro- |
| 67652394 | Dibenzofuran, 1,2,3,4,6,7,8-heptachloro- |
| 55673897 | Dibenzofuran, 1,2,3,4,7,8,9-heptachloro- |
| 70648269 | Dibenzofuran, 1,2,3,4,7,8-hexachloro- |
| 57117449 | Dibenzofuran, 1,2,3,6,7,8-hexachloro- |
| 72918219 | Dibenzofuran, 1,2,3,7,8,9-hexachloro- |
| 57117416 | Dibenzofuran, 1,2,3,7,8-pentachloro- |
| 60851345 | Dibenzofuran, 2,3,4,6,7,8-hexachloro- |
| 57117314 | Dibenzofuran, 2,3,4,7,8-pentachloro- |
| 51207310 | Dibenzofuran, 2,3,7,8-tetrachloro- |
| 51207319 | Dibenzofuran, 2,3,7,8-tetrachloro- |
| 42934532 | Dibenzofuran, chloro derivs. |
| 136677106 | Dibenzofuran, chloro derivs. |
| 38998753 | Dibenzofuran, heptachloro- |
| 55684941 | Dibenzofuran, hexachloro- |
| 39001020 | Dibenzofuran, octachloro- |
| 30402154 | Dibenzofuran, pentachloro- |
| 30402143 | Dibenzofuran, tetrachloro- |
| 42934532 | Dibenzofuran, tetrachloro- |
| 55722275 | Dibenzofuran, tetrachloro- |
| 43048006 | Dibenzofuran, trichloro- |
| 132649 | Dibenzofurans, derivs. |
| 54889440 | Dibenzothiophene, 1,2,3,4-Tetrahydro-8-methyl- |
| 1304003 | Diborane(6) |
| 16970813 | Diborane(6) |
| 19287457 | Diborane(6) |
| 19287888 | Diborane(6) |
| 133441460 | Diborane(6) |
| 849231169 | Diborane(6) |
| 17101369 | Diphosphite |
| 152169 | Diphosphoramide, N,N,N',N',N'',N'',N''',N'''-octamethyl- |
| 2466093 | Diphosphoric acid |
| 7722885 | Diphosphoric acid, sodium salt (1:4) |
| 93269171 | Diphosphoric acid, sodium salt (1:4) |
| 156460730 | Diphosphoric acid, sodium salt (1:4) |
| 1269628796 | Diphosphoric acid, sodium salt (1:4) |
| 107493 | Diphosphoric acid, tetraethyl ester |
| 2764729 | Dipyrido[1,2-a:2',1'-c]pyrazinediium, 6,7-dihydro- |
| 67994938 | Dipyrido[1,2-a:2',1'-c]pyrazinediium, 6,7-dihydro- |
| 85007 | Dipyrido[1,2-a:2',1'-c]pyrazinediium, 6,7-dihydro-, dibromide |
| 2764729 | Dipyrido[1,2-a:2',1'-c]pyrazinediium, 6,7-dihydro-, dibromide |
| 107460 | Disiloxane, 1,1,1,3,3,3-hexamethyl- |
| 864719971 | Disiloxane, 1,1,1,3,3,3-hexamethyl- |
| 1463472970 | Disiloxane, 1,1,1,3,3,3-hexamethyl- |
| 2627954 | Disiloxane, 1,3-diethenyl-1,1,3,3-tetramethyl- |
| 846574605 | Disiloxane, 1,3-diethenyl-1,1,3,3-tetramethyl- |
| 56359 | Distannoxane, 1,1,1,3,3,3-hexabutyl- |
| 1353053969 | Distannoxane, 1,1,1,3,3,3-hexabutyl- |
| 12684285 | Distannoxane, 1,1,1,3,3,3-hexakis(2-methyl-2-phenylpropyl)- |
| 13356086 | Distannoxane, 1,1,1,3,3,3-hexakis(2-methyl-2-phenylpropyl)- |
| 57547758 | Distannoxane, 1,1,1,3,3,3-hexakis(2-methyl-2-phenylpropyl)- |
| 68410004 | Distillates (petroleum), crude oil |
| 64742525 | Distillates (petroleum), hydrotreated heavy naphthenic |
| 74742887 | Distillates (petroleum), hydrotreated heavy naphthenic |
| 64742478 | Distillates (petroleum), hydrotreated light |
| 101795055 | Distillates (petroleum), hydrotreated light |
| 68425296 | Distillates (petroleum), naphtha-raffinate pyrolyzate-derived, gasoline-blending |
| 64741884 | Distillates (petroleum), solvent-refined heavy paraffinic |
| 2179591 | Disulfide, 2-propenyl propyl |
| 624920 | Disulfide, dimethyl |
| 7681574 | Disulfurous acid, sodium salt (1:2) |
| 15771296 | Disulfurous acid, sodium salt (1:2) |
| 1287784104 | Disulfurous acid, sodium salt (1:2) |
| 629970 | Docosane |
| 142789 | Dodecanamide, N-(2-hydroxyethyl)- |
| 8028851 | Dodecanamide, N-(2-hydroxyethyl)- |
| 15517654 | Dodecanamide, N-(2-hydroxyethyl)- |
| 65256271 | Dodecanamide, N-(2-hydroxyethyl)- |
| 123175086 | Dodecanamide, N-(2-hydroxyethyl)- |
| 112403 | Dodecane |
| 143077 | Dodecanoic acid |
| 7632486 | Dodecanoic acid |
| 8000622 | Dodecanoic acid |
| 8045270 | Dodecanoic acid |
| 203714072 | Dodecanoic acid |
| 77587 | Dodecanoic acid, 1,1'-(dibutylstannylene) ester |
| 358509 | Dodecanoic acid, 1,1'-(dibutylstannylene) ester |
| 7428797 | Dodecanoic acid, 1,1'-(dibutylstannylene) ester |
| 8028839 | Dodecanoic acid, 1,1'-(dibutylstannylene) ester |
| 70620289 | Dodecanoic acid, 1,1'-(dibutylstannylene) ester |
| 125199873 | Dodecanoic acid, 1,1'-(dibutylstannylene) ester |
| 185915280 | Dodecanoic acid, 1,1'-(dibutylstannylene) ester |
| 211990099 | Dodecanoic acid, 1,1'-(dibutylstannylene) ester |
| 120401 | Dodecanoic acid, compd. with 2,2'-iminobis[ethanol] (1:1) |
| 7487798 | Dodecanoic acid, compd. with 2,2'-iminobis[ethanol] (1:1) |
| 25378227 | Dodecene |
| 15840014 | Dysprosium, isotope of mass 166 |
| 112958 | Eicosane |
| 860208839 | Eicosane |
| 15840138 | Erbium, isotope of mass 169 |
| 379793 | Ergotaman-3',6',18-trione, 12'-hydroxy-2'-methyl-5'-(phenylmethyl)-, (5.alpha.)-, (2R,3R)-2,3-dihydroxybutanedioate (2:1) |
| 98260312 | Ergotaman-3',6',18-trione, 12'-hydroxy-2'-methyl-5'-(phenylmethyl)-, (5.alpha.)-, (2R,3R)-2,3-dihydroxybutanedioate (2:1) |
| 12510428 | Erionite ((K0-1Na0-1Ca0-0.5)10(Al10Si26O72).30H2O) |
| 66733219 | Erionite ((K0-1Na0-1Ca0-0.5)10(Al10Si26O72).30H2O) |
| 643221 | Erythromycin octadecanoate (salt) |
| 68583222 | Escherichia coli |
| 2529648 | Estra-1,3,5(10)-trien-17-ol, (17.beta.)- |
| 53167 | Estra-1,3,5(10)-trien-17-one, 3-hydroxy- |
| 37242414 | Estra-1,3,5(10)-trien-17-one, 3-hydroxy- |
| 50282 | Estra-1,3,5(10)-triene-3,17-diol (17.beta.)- |
| 22966796 | Estra-1,3,5(10)-triene-3,17-diol (17.beta.)-, bis[4-[bis(2-chloroethyl)amino]benzeneacetate] |
| 75047 | Ethanamine |
| 43031216 | Ethanamine |
| 85404166 | Ethanamine |
| 85404224 | Ethanamine |
| 147240 | Ethanamine, 2-(diphenylmethoxy)-N,N-dimethyl-, hydrochloride |
| 911455 | Ethanamine, 2-[4-(2-chloro-1,2-diphenylethenyl)phenoxy]-N,N-diethyl- |
| 555771 | Ethanamine, 2-chloro-N,N-bis(2-chloroethyl)- |
| 538078 | Ethanamine, 2-chloro-N-(2-chloroethyl)-N-ethyl- |
| 51752 | Ethanamine, 2-chloro-N-(2-chloroethyl)-N-methyl- |
| 55867 | Ethanamine, 2-chloro-N-(2-chloroethyl)-N-methyl-, hydrochloride |
| 121448 | Ethanamine, N,N-diethyl- |
| 144514147 | Ethanamine, N,N-diethyl- |
| 168277994 | Ethanamine, N,N-diethyl- |
| 172227746 | Ethanamine, N,N-diethyl- |
| 449752618 | Ethanamine, N,N-diethyl- |
| 750564568 | Ethanamine, N,N-diethyl- |
| 1200828449 | Ethanamine, N,N-diethyl- |
| 469216 | Ethanamine, N,N-dimethyl-2-[1-phenyl-1-(2-pyridinyl)ethoxy]- |
| 92126 | Ethanamine, N,N-dimethyl-2-[2-(phenylmethyl)phenoxy]- |
| 9008951 | Ethanamine, N,N-dimethyl-2-[2-(phenylmethyl)phenoxy]- |
| 109897 | Ethanamine, N-ethyl- |
| 3710847 | Ethanamine, N-ethyl-N-hydroxy- |
| 55185 | Ethanamine, N-ethyl-N-nitroso- |
| 71272 | Ethanaminium, 2,2'-[(1,4-dioxo-1,4-butanediyl)bis(oxy)]bis[N,N,N-trimethyl-, dichloride |
| 999815 | Ethanaminium, 2-chloro-N,N,N-trimethyl-, chloride (1:1) |
| 8073209 | Ethanaminium, 2-chloro-N,N,N-trimethyl-, chloride (1:1) |
| 39394213 | Ethanaminium, 2-chloro-N,N,N-trimethyl-, chloride (1:1) |
| 360577259 | Ethanaminium, 2-chloro-N,N,N-trimethyl-, chloride (1:1) |
| 67481 | Ethanaminium, 2-hydroxy-N,N,N-trimethyl-, chloride (1:1) |
| 129179 | Ethanaminium, N-[4-[[4-(diethylamino)phenyl](2,4-disulfophenyl)methylene]-2,5-cyclohexadien-1-ylidene]-N-ethyl-, inner salt, sodium salt (1:1) |
| 66554696 | Ethanaminium, N-[4-[[4-(diethylamino)phenyl](2,4-disulfophenyl)methylene]-2,5-cyclohexadien-1-ylidene]-N-ethyl-, inner salt, sodium salt (1:1) |
| 81604537 | Ethanaminium, N-[4-[[4-(diethylamino)phenyl](2,4-disulfophenyl)methylene]-2,5-cyclohexadien-1-ylidene]-N-ethyl-, inner salt, sodium salt (1:1) |
| 220750196 | Ethanaminium, N-[4-[[4-(diethylamino)phenyl](2,4-disulfophenyl)methylene]-2,5-cyclohexadien-1-ylidene]-N-ethyl-, inner salt, sodium salt (1:1) |
| 856315349 | Ethanaminium, N-[4-[[4-(diethylamino)phenyl](2,4-disulfophenyl)methylene]-2,5-cyclohexadien-1-ylidene]-N-ethyl-, inner salt, sodium salt (1:1) |
| 74840 | Ethane |
| 78840 | Ethane |
| 624895 | Ethane, (methylthio)- |
| 111911 | Ethane, 1,1'-[methylenebis(oxy)]bis[2-chloro- |
| 60297 | Ethane, 1,1'-oxybis- |
| 7578394 | Ethane, 1,1'-oxybis- |
| 74446438 | Ethane, 1,1'-oxybis- |
| 927820244 | Ethane, 1,1'-oxybis- |
| 111444 | Ethane, 1,1'-oxybis[2-chloro- |
| 52438912 | Ethane, 1,1'-oxybis[2-chloro- |
| 92091286 | Ethane, 1,1'-oxybis[2-chloro- |
| 111966 | Ethane, 1,1'-oxybis[2-methoxy- |
| 54631708 | Ethane, 1,1'-oxybis[2-methoxy- |
| 70992868 | Ethane, 1,1'-oxybis[2-methoxy- |
| 142939397 | Ethane, 1,1'-oxybis[2-methoxy- |
| 627543 | Ethane, 1,1'-tellurobis- |
| 352932 | Ethane, 1,1'-thiobis- |
| 505602 | Ethane, 1,1'-thiobis[2-chloro- |
| 39472407 | Ethane, 1,1'-thiobis[2-chloro- |
| 68157620 | Ethane, 1,1'-thiobis[2-chloro- |
| 69020377 | Ethane, 1,1'-thiobis[2-chloro- |
| 172672707 | Ethane, 1,1'-thiobis[2-chloro- |
| 67721 | Ethane, 1,1,1,2,2,2-hexachloro- |
| 76017 | Ethane, 1,1,1,2,2-pentachloro- |
| 354336 | Ethane, 1,1,1,2,2-pentafluoro- |
| 630206 | Ethane, 1,1,1,2-tetrachloro- |
| 76119 | Ethane, 1,1,1,2-tetrachloro-2,2-difluoro- |
| 354110 | Ethane, 1,1,1,2-tetrachloro-2-fluoro- |
| 811972 | Ethane, 1,1,1,2-tetrafluoro- |
| 71556 | Ethane, 1,1,1-trichloro- |
| 74552833 | Ethane, 1,1,1-trichloro- |
| 354585 | Ethane, 1,1,1-trichloro-2,2,2-trifluoro- |
| 420462 | Ethane, 1,1,1-trifluoro- |
| 1445450 | Ethane, 1,1,1-trimethoxy- |
| 79276 | Ethane, 1,1,2,2-tetrabromo- |
| 79345 | Ethane, 1,1,2,2-tetrachloro- |
| 79435 | Ethane, 1,1,2,2-tetrachloro- |
| 76120 | Ethane, 1,1,2,2-tetrachloro-1,2-difluoro- |
| 354143 | Ethane, 1,1,2,2-tetrachloro-1-fluoro- |
| 134237324 | Ethane, 1,1,2,2-tetrachloro-1-fluoro- |
| 76131 | Ethane, 1,1,2-trichloro- |
| 79005 | Ethane, 1,1,2-trichloro- |
| 43207 | Ethane, 1,1,2-trichloro-1,2,2-trifluoro- |
| 76131 | Ethane, 1,1,2-trichloro-1,2,2-trifluoro- |
| 761313 | Ethane, 1,1,2-trichloro-1,2,2-trifluoro- |
| 39349945 | Ethane, 1,1,2-trichloro-1,2,2-trifluoro- |
| 56996613 | Ethane, 1,1,2-trichloro-1,2,2-trifluoro- |
| 57762342 | Ethane, 1,1,2-trichloro-1,2,2-trifluoro- |
| 59948560 | Ethane, 1,1,2-trichloro-1,2,2-trifluoro- |
| 557915 | Ethane, 1,1-dibromo- |
| 75343 | Ethane, 1,1-dichloro- |
| 306832 | Ethane, 1,1-dichloro-1,2,2,2-tetrafluoro- |
| 374072 | Ethane, 1,1-dichloro-1,2,2,2-tetrafluoro- |
| 812044 | Ethane, 1,1-dichloro-1,2,2-trifluoro- |
| 171006 | Ethane, 1,1-dichloro-1-fluoro- |
| 1717006 | Ethane, 1,1-dichloro-1-fluoro- |
| 594729 | Ethane, 1,1-dichloro-1-nitro- |
| 619330 | Ethane, 1,1-dichloro-2,2-diethoxy- |
| 75376 | Ethane, 1,1-difluoro- |
| 71281715 | Ethane, 1,1-difluoro- |
| 354212 | Ethane, 1,2,2-trichloro-1,1-difluoro- |
| 62549182 | Ethane, 1,2,2-trichloro-1,1-difluoro- |
| 134237335 | Ethane, 1,2,2-trichloro-1,1-difluoro- |
| 712351741 | Ethane, 1,2,2-trichloro-1,1-difluoro- |
| 112265 | Ethane, 1,2-bis(2-chloroethoxy)- |
| 106934 | Ethane, 1,2-dibromo- |
| 8003074 | Ethane, 1,2-dibromo- |
| 56729216 | Ethane, 1,2-dibromo- |
| 625084379 | Ethane, 1,2-dibromo- |
| 124732 | Ethane, 1,2-dibromo-1,1,2,2-tetrafluoro- |
| 76199558 | Ethane, 1,2-dibromo-1,1,2,2-tetrafluoro- |
| 107062 | Ethane, 1,2-dichloro- |
| 52399936 | Ethane, 1,2-dichloro- |
| 76142 | Ethane, 1,2-dichloro-1,1,2,2-tetrafluoro- |
| 354234 | Ethane, 1,2-dichloro-1,1,2-trifluoro- |
| 1649087 | Ethane, 1,2-dichloro-1,1-difluoro- |
| 431061 | Ethane, 1,2-dichloro-1,2-difluoro- |
| 629141 | Ethane, 1,2-diethoxy- |
| 110714 | Ethane, 1,2-dimethoxy- |
| 7644393 | Ethane, 1,2-dimethoxy- |
| 173201804 | Ethane, 1,2-dimethoxy- |
| 107040 | Ethane, 1-bromo-2-chloro- |
| 76153 | Ethane, 1-chloro-1,1,2,2,2-pentafluoro- |
| 12770911 | Ethane, 1-chloro-1,1,2,2,2-pentafluoro- |
| 354256 | Ethane, 1-chloro-1,1,2,2-tetrafluoro- |
| 75683 | Ethane, 1-chloro-1,1-difluoro- |
| 65762256 | Ethane, 1-chloro-1,1-difluoro- |
| 306832 | Ethane, 2,2-dichloro-1,1,1-trifluoro- |
| 76380 | Ethane, 2,2-dichloro-1,1-difluoro-1-methoxy- |
| 8056959 | Ethane, 2,2-dichloro-1,1-difluoro-1-methoxy- |
| 683534 | Ethane, 2-bromo-1,1-dichloro- |
| 421012 | Ethane, 2-bromo-1-chloro-1,1-difluoro- |
| 151677 | Ethane, 2-bromo-2-chloro-1,1,1-trifluoro- |
| 2837890 | Ethane, 2-chloro-1,1,1,2-tetrafluoro- |
| 2873890 | Ethane, 2-chloro-1,1,1,2-tetrafluoro- |
| 75887 | Ethane, 2-chloro-1,1,1-trifluoro- |
| 13838169 | Ethane, 2-chloro-1-(difluoromethoxy)-1,1,2-trifluoro- |
| 132998915 | Ethane, 2-chloro-1-(difluoromethoxy)-1,1,2-trifluoro- |
| 74964 | Ethane, bromo- |
| 68411723 | Ethane, chloro derivs. |
| 68583573 | Ethane, chloro derivs. |
| 68909115 | Ethane, chloro derivs. |
| 75003 | Ethane, chloro- |
| 63938103 | Ethane, chlorotetrafluoro- |
| 1300216 | Ethane, dichloro- |
| 90454185 | Ethane, dichloro-1,1,2-trifluoro- |
| 25167888 | Ethane, dichlorofluoro- |
| 76142 | Ethane, dichlorotetrafluoro- |
| 1320372 | Ethane, dichlorotetrafluoro- |
| 34077877 | Ethane, dichlorotrifluoro- |
| 79243 | Ethane, nitro- |
| 79345 | Ethane, tetrachloro- |
| 1299907 | Ethane, tetrachloro- |
| 25322207 | Ethane, tetrachloro- |
| 71556 | Ethane, trichloro- |
| 1299894 | Ethane, trichloro- |
| 25323891 | Ethane, trichloro- |
| 1320394 | Ethane, trichlorotrifluoro- |
| 26523648 | Ethane, trichlorotrifluoro- |
| 29463705 | Ethane, trichlorotrifluoro- |
| 107222 | Ethanedial |
| 83513308 | Ethanedial |
| 460195 | Ethanedinitrile |
| 144627 | Ethanedioic acid |
| 63504289 | Ethanedioic acid |
| 97993787 | Ethanedioic acid |
| 216451386 | Ethanedioic acid |
| 79210 | Ethaneperoxoic acid |
| 89370718 | Ethaneperoxoic acid |
| 232259028 | Ethaneperoxoic acid |
| 107686 | Ethanesulfonic acid, 2-(methylamino)- |
| 142363539 | Ethanesulfonic acid, 2-[(2,6-diethylphenyl)(methoxymethyl)amino]-2-oxo- |
| 107357 | Ethanesulfonic acid, 2-amino- |
| 91105792 | Ethanesulfonic acid, 2-amino- |
| 1365481055 | Ethanesulfonic acid, 2-amino- |
| 62555 | Ethanethioamide |
| 1482800 | Ethanethioamide |
| 75081 | Ethanethiol |
| 23135220 | Ethanimidothioic acid, 2-(dimethylamino)-N-[[(methylamino)carbonyl]oxy]-2-oxo-, methyl ester |
| 30558431 | Ethanimidothioic acid, 2-(dimethylamino)-N-hydroxy-2-oxo-, methyl ester |
| 76274469 | Ethanimidothioic acid, 2-(dimethylamino)-N-hydroxy-2-oxo-, methyl ester |
| 59669260 | Ethanimidothioic acid, N,N'-[thiobis[(methylimino)carbonyloxy]]bis-, dimethyl ester |
| 65154623 | Ethanimidothioic acid, N,N'-[thiobis[(methylimino)carbonyloxy]]bis-, dimethyl ester |
| 16752775 | Ethanimidothioic acid, N-[[(methylamino)carbonyl]oxy]-, methyl ester |
| 22224937 | Ethanimidothioic acid, N-[[(methylamino)carbonyl]oxy]-, methyl ester |
| 136511074 | Ethanimidothioic acid, N-[[(methylamino)carbonyl]oxy]-, methyl ester |
| 136799445 | Ethanimidothioic acid, N-[[(methylamino)carbonyl]oxy]-, methyl ester |
| 64175 | Ethanol |
| 8000166 | Ethanol |
| 8024451 | Ethanol |
| 121182783 | Ethanol |
| 102716 | Ethanol, 2,2',2''-nitrilotris- |
| 36549538 | Ethanol, 2,2',2''-nitrilotris- |
| 36549549 | Ethanol, 2,2',2''-nitrilotris- |
| 36549550 | Ethanol, 2,2',2''-nitrilotris- |
| 36659797 | Ethanol, 2,2',2''-nitrilotris- |
| 105655274 | Ethanol, 2,2',2''-nitrilotris- |
| 126068675 | Ethanol, 2,2',2''-nitrilotris- |
| 464917268 | Ethanol, 2,2',2''-nitrilotris- |
| 105599 | Ethanol, 2,2'-(methylimino)bis- |
| 511262763 | Ethanol, 2,2'-(methylimino)bis- |
| 944314721 | Ethanol, 2,2'-(methylimino)bis- |
| 1116547 | Ethanol, 2,2'-(nitrosoimino)bis- |
| 112276 | Ethanol, 2,2'-[1,2-ethanediylbis(oxy)]bis- |
| 676186 | Ethanol, 2,2'-[1,2-ethanediylbis(oxy)]bis- |
| 118662309 | Ethanol, 2,2'-[1,2-ethanediylbis(oxy)]bis- |
| 121202297 | Ethanol, 2,2'-[1,2-ethanediylbis(oxy)]bis- |
| 939972017 | Ethanol, 2,2'-[1,2-ethanediylbis(oxy)]bis- |
| 111217 | Ethanol, 2,2'-[1,2-ethanediylbis(oxy)]bis-, 1,1'-diacetate |
| 2784943 | Ethanol, 2,2'-[[4-(methylamino)-3-nitrophenyl]imino]bis- |
| 33229344 | Ethanol, 2,2'-[[4-[(2-hydroxyethyl)amino]-3-nitrophenyl]imino]bis- |
| 111422 | Ethanol, 2,2'-iminobis- |
| 8033736 | Ethanol, 2,2'-iminobis- |
| 111466 | Ethanol, 2,2'-oxybis- |
| 4669265 | Ethanol, 2,2'-oxybis- |
| 5952261 | Ethanol, 2,2'-oxybis-, 1,1'-dicarbamate |
| 693210 | Ethanol, 2,2'-oxybis-, 1,1'-dinitrate |
| 66492771 | Ethanol, 2,2'-oxybis-, 1,1'-dinitrate |
| 109591 | Ethanol, 2-(1-methylethoxy)- |
| 136787 | Ethanol, 2-(2,4-dichlorophenoxy)-, hydrogen sulfate, sodium salt |
| 112345 | Ethanol, 2-(2-butoxyethoxy)- |
| 210818089 | Ethanol, 2-(2-butoxyethoxy)- |
| 875421797 | Ethanol, 2-(2-butoxyethoxy)- |
| 124174 | Ethanol, 2-(2-butoxyethoxy)-, 1-acetate |
| 124177 | Ethanol, 2-(2-butoxyethoxy)-, 1-acetate |
| 98100700 | Ethanol, 2-(2-butoxyethoxy)-, 1-acetate |
| 111900 | Ethanol, 2-(2-ethoxyethoxy)- |
| 111773 | Ethanol, 2-(2-methoxyethoxy)- |
| 102818 | Ethanol, 2-(dibutylamino)- |
| 100378 | Ethanol, 2-(diethylamino)- |
| 102802006 | Ethanol, 2-(diethylamino)- |
| 108010 | Ethanol, 2-(dimethylamino)- |
| 116134099 | Ethanol, 2-(dimethylamino)- |
| 156681253 | Ethanol, 2-(dimethylamino)- |
| 112254 | Ethanol, 2-(hexyloxy)- |
| 109831 | Ethanol, 2-(methylamino)- |
| 1428190924 | Ethanol, 2-(methylamino)- |
| 111411 | Ethanol, 2-[(2-aminoethyl)amino]- |
| 51251980 | Ethanol, 2-[(2-aminoethyl)amino]- |
| 2871014 | Ethanol, 2-[(4-amino-2-nitrophenyl)amino]- |
| 143226 | Ethanol, 2-[2-(2-butoxyethoxy)ethoxy]- |
| 68882 | Ethanol, 2-[2-[4-[(4-chlorophenyl)phenylmethyl]-1-piperazinyl]ethoxy]- |
| 147152214 | Ethanol, 2-[2-[4-[(4-chlorophenyl)phenylmethyl]-1-piperazinyl]ethoxy]- |
| 141435 | Ethanol, 2-amino- |
| 9007334 | Ethanol, 2-amino- |
| 540512 | Ethanol, 2-bromo- |
| 1867114 | Ethanol, 2-bromo- |
| 111762 | Ethanol, 2-butoxy- |
| 107461825 | Ethanol, 2-butoxy- |
| 161279909 | Ethanol, 2-butoxy- |
| 78513 | Ethanol, 2-butoxy-, 1,1',1''-phosphate |
| 19040507 | Ethanol, 2-butoxy-, 1,1',1''-phosphate |
| 31227664 | Ethanol, 2-butoxy-, 1,1',1''-phosphate |
| 119166982 | Ethanol, 2-butoxy-, 1,1',1''-phosphate |
| 112072 | Ethanol, 2-butoxy-, 1-acetate |
| 107073 | Ethanol, 2-chloro- |
| 1867090 | Ethanol, 2-chloro- |
| 1253945559 | Ethanol, 2-chloro- |
| 140089 | Ethanol, 2-chloro-, 1,1',1''-phosphite |
| 115968 | Ethanol, 2-chloro-, phosphate (3:1) |
| 21343840 | Ethanol, 2-chloro-, phosphate (3:1) |
| 110805 | Ethanol, 2-ethoxy- |
| 96231366 | Ethanol, 2-ethoxy- |
| 111159 | Ethanol, 2-ethoxy-, 1-acetate |
| 371620 | Ethanol, 2-fluoro- |
| 60242 | Ethanol, 2-mercapto- |
| 99748784 | Ethanol, 2-mercapto- |
| 109864 | Ethanol, 2-methoxy- |
| 110496 | Ethanol, 2-methoxy-, 1-acetate |
| 625489 | Ethanol, 2-nitro- |
| 122996 | Ethanol, 2-phenoxy- |
| 37220498 | Ethanol, 2-phenoxy- |
| 56257900 | Ethanol, 2-phenoxy- |
| 1020398735 | Ethanol, 2-phenoxy- |
| 2807309 | Ethanol, 2-propoxy- |
| 83855850 | Ethanol, 2-propoxy- |
| 555759 | Ethanol, aluminum salt (3:1) |
| 2835429 | Ethanol, aluminum salt (3:1) |
| 82948467 | Ethanol, aluminum salt (3:1) |
| 112388360 | Ethanol, aluminum salt (3:1) |
| 139984228 | Ethanol, aluminum salt (3:1) |
| 858823968 | Ethanol, aluminum salt (3:1) |
| 1091602924 | Ethanol, aluminum salt (3:1) |
| 7725931 | Ethanone, 1-(2,3-dihydro-4-methyl-2-thioxo-5-thiazolyl)- |
| 88283414 | Ethanone, 1-(2,4-dichlorophenyl)-2-(3-pyridinyl)-, O-methyloxime |
| 577593 | Ethanone, 1-(2-nitrophenyl)- |
| 121891 | Ethanone, 1-(3-nitrophenyl)- |
| 100196 | Ethanone, 1-(4-nitrophenyl)- |
| 1122549 | Ethanone, 1-(4-pyridinyl)- |
| 81141 | Ethanone, 1-[4-(1,1-dimethylethyl)-2,6-dimethyl-3,5-dinitrophenyl]- |
| 765435 | Ethanone, 1-cyclopropyl- |
| 98862 | Ethanone, 1-phenyl- |
| 41903508 | Ethanone, 1-phenyl-, monohydroxy deriv. |
| 532274 | Ethanone, 2-chloro-1-phenyl- |
| 119539 | Ethanone, 2-hydroxy-1,2-diphenyl- |
| 579442 | Ethanone, 2-hydroxy-1,2-diphenyl- |
| 4549400 | Ethenamine, N-methyl-N-nitroso- |
| 72559 | Ethene |
| 74851 | Ethene |
| 33060309 | Ethene |
| 87701642 | Ethene |
| 87701653 | Ethene |
| 110758 | Ethene, (2-chloroethoxy)- |
| 127184 | Ethene, 1,1,2,2-tetrachloro- |
| 116143 | Ethene, 1,1,2,2-tetrafluoro- |
| 9014839 | Ethene, 1,1,2,2-tetrafluoro- |
| 79016 | Ethene, 1,1,2-trichloro- |
| 52037464 | Ethene, 1,1,2-trichloro- |
| 593920 | Ethene, 1,1-dibromo- |
| 75054 | Ethene, 1,1-dichloro- |
| 75354 | Ethene, 1,1-dichloro- |
| 75387 | Ethene, 1,1-difluoro- |
| 1272398818 | Ethene, 1,1-difluoro- |
| 540498 | Ethene, 1,2-dibromo- |
| 540590 | Ethene, 1,2-dichloro- |
| 156605 | Ethene, 1,2-dichloro-, (1E)- |
| 156606 | Ethene, 1,2-dichloro-, (1E)- |
| 43695790 | Ethene, 1,2-dichloro-, (1E)- |
| 156592 | Ethene, 1,2-dichloro-, (1Z)- |
| 1438395686 | Ethene, 1,2-dichloro-, (1Z)- |
| 598732 | Ethene, 1-bromo-1,2,2-trifluoro- |
| 79389 | Ethene, 1-chloro-1,2,2-trifluoro- |
| 593602 | Ethene, bromo- |
| 75014 | Ethene, chloro- |
| 107062 | Ethene, chloro- |
| 1187028370 | Ethene, chloro- |
| 8063943 | Ethene, chloro-, homopolymer |
| 9002862 | Ethene, chloro-, homopolymer |
| 9006091 | Ethene, chloro-, homopolymer |
| 9036811 | Ethene, chloro-, homopolymer |
| 9041558 | Ethene, chloro-, homopolymer |
| 9043474 | Ethene, chloro-, homopolymer |
| 9043485 | Ethene, chloro-, homopolymer |
| 9072177 | Ethene, chloro-, homopolymer |
| 9072393 | Ethene, chloro-, homopolymer |
| 11097919 | Ethene, chloro-, homopolymer |
| 11111947 | Ethene, chloro-, homopolymer |
| 11119270 | Ethene, chloro-, homopolymer |
| 25038464 | Ethene, chloro-, homopolymer |
| 37349647 | Ethene, chloro-, homopolymer |
| 37357612 | Ethene, chloro-, homopolymer |
| 39287893 | Ethene, chloro-, homopolymer |
| 39296178 | Ethene, chloro-, homopolymer |
| 39387434 | Ethene, chloro-, homopolymer |
| 39389565 | Ethene, chloro-, homopolymer |
| 39393594 | Ethene, chloro-, homopolymer |
| 50642892 | Ethene, chloro-, homopolymer |
| 50935778 | Ethene, chloro-, homopolymer |
| 51281460 | Ethene, chloro-, homopolymer |
| 51540751 | Ethene, chloro-, homopolymer |
| 51569450 | Ethene, chloro-, homopolymer |
| 53029144 | Ethene, chloro-, homopolymer |
| 53112417 | Ethene, chloro-, homopolymer |
| 54328277 | Ethene, chloro-, homopolymer |
| 54328288 | Ethene, chloro-, homopolymer |
| 55465753 | Ethene, chloro-, homopolymer |
| 59678578 | Ethene, chloro-, homopolymer |
| 59740408 | Ethene, chloro-, homopolymer |
| 59740420 | Ethene, chloro-, homopolymer |
| 60281994 | Ethene, chloro-, homopolymer |
| 62132303 | Ethene, chloro-, homopolymer |
| 62931082 | Ethene, chloro-, homopolymer |
| 63440299 | Ethene, chloro-, homopolymer |
| 66988601 | Ethene, chloro-, homopolymer |
| 68441747 | Ethene, chloro-, homopolymer |
| 68858775 | Ethene, chloro-, homopolymer |
| 72751145 | Ethene, chloro-, homopolymer |
| 74192237 | Ethene, chloro-, homopolymer |
| 74504793 | Ethene, chloro-, homopolymer |
| 76012298 | Ethene, chloro-, homopolymer |
| 79103676 | Ethene, chloro-, homopolymer |
| 80044128 | Ethene, chloro-, homopolymer |
| 90452372 | Ethene, chloro-, homopolymer |
| 93050829 | Ethene, chloro-, homopolymer |
| 94928208 | Ethene, chloro-, homopolymer |
| 96353763 | Ethene, chloro-, homopolymer |
| 96726771 | Ethene, chloro-, homopolymer |
| 97123541 | Ethene, chloro-, homopolymer |
| 97343787 | Ethene, chloro-, homopolymer |
| 98865431 | Ethene, chloro-, homopolymer |
| 117079842 | Ethene, chloro-, homopolymer |
| 121870608 | Ethene, chloro-, homopolymer |
| 124149628 | Ethene, chloro-, homopolymer |
| 139074741 | Ethene, chloro-, homopolymer |
| 142804840 | Ethene, chloro-, homopolymer |
| 148880095 | Ethene, chloro-, homopolymer |
| 155422176 | Ethene, chloro-, homopolymer |
| 161051907 | Ethene, chloro-, homopolymer |
| 161279965 | Ethene, chloro-, homopolymer |
| 172929214 | Ethene, chloro-, homopolymer |
| 172929225 | Ethene, chloro-, homopolymer |
| 187247434 | Ethene, chloro-, homopolymer |
| 202218766 | Ethene, chloro-, homopolymer |
| 203460553 | Ethene, chloro-, homopolymer |
| 206072562 | Ethene, chloro-, homopolymer |
| 220323682 | Ethene, chloro-, homopolymer |
| 221007074 | Ethene, chloro-, homopolymer |
| 221007085 | Ethene, chloro-, homopolymer |
| 226986750 | Ethene, chloro-, homopolymer |
| 237753456 | Ethene, chloro-, homopolymer |
| 819078472 | Ethene, chloro-, homopolymer |
| 944150612 | Ethene, chloro-, homopolymer |
| 1151920498 | Ethene, chloro-, homopolymer |
| 1202645337 | Ethene, chloro-, homopolymer |
| 107062 | Ethene, dichloro- |
| 25323302 | Ethene, dichloro- |
| 109922 | Ethene, ethoxy- |
| 75025 | Ethene, fluoro- |
| 9002884 | Ethene, homopolymer |
| 9041321 | Ethene, homopolymer |
| 9082159 | Ethene, homopolymer |
| 11098285 | Ethene, homopolymer |
| 11119247 | Ethene, homopolymer |
| 11119258 | Ethene, homopolymer |
| 12728299 | Ethene, homopolymer |
| 37310977 | Ethene, homopolymer |
| 37331401 | Ethene, homopolymer |
| 37349692 | Ethene, homopolymer |
| 37353949 | Ethene, homopolymer |
| 39307012 | Ethene, homopolymer |
| 39421915 | Ethene, homopolymer |
| 51274114 | Ethene, homopolymer |
| 51329761 | Ethene, homopolymer |
| 51329830 | Ethene, homopolymer |
| 52434227 | Ethene, homopolymer |
| 53238849 | Ethene, homopolymer |
| 53568471 | Ethene, homopolymer |
| 53850978 | Ethene, homopolymer |
| 56833206 | Ethene, homopolymer |
| 57158095 | Ethene, homopolymer |
| 58391665 | Ethene, homopolymer |
| 61614286 | Ethene, homopolymer |
| 62449676 | Ethene, homopolymer |
| 63100663 | Ethene, homopolymer |
| 64296522 | Ethene, homopolymer |
| 66797044 | Ethene, homopolymer |
| 66829229 | Ethene, homopolymer |
| 67383000 | Ethene, homopolymer |
| 67462866 | Ethene, homopolymer |
| 70431242 | Ethene, homopolymer |
| 71212210 | Ethene, homopolymer |
| 73247151 | Ethene, homopolymer |
| 73730004 | Ethene, homopolymer |
| 73989658 | Ethene, homopolymer |
| 74238849 | Ethene, homopolymer |
| 74238850 | Ethene, homopolymer |
| 74238872 | Ethene, homopolymer |
| 74812172 | Ethene, homopolymer |
| 79806012 | Ethene, homopolymer |
| 79818932 | Ethene, homopolymer |
| 81544072 | Ethene, homopolymer |
| 81604673 | Ethene, homopolymer |
| 86089976 | Ethene, homopolymer |
| 86168389 | Ethene, homopolymer |
| 87521128 | Ethene, homopolymer |
| 91449159 | Ethene, homopolymer |
| 91728255 | Ethene, homopolymer |
| 95327267 | Ethene, homopolymer |
| 95918197 | Ethene, homopolymer |
| 95918266 | Ethene, homopolymer |
| 101484633 | Ethene, homopolymer |
| 101484757 | Ethene, homopolymer |
| 101484826 | Ethene, homopolymer |
| 103843114 | Ethene, homopolymer |
| 106705264 | Ethene, homopolymer |
| 110736464 | Ethene, homopolymer |
| 112041357 | Ethene, homopolymer |
| 112821111 | Ethene, homopolymer |
| 112821133 | Ethene, homopolymer |
| 113690269 | Ethene, homopolymer |
| 114013557 | Ethene, homopolymer |
| 114451171 | Ethene, homopolymer |
| 114471099 | Ethene, homopolymer |
| 121761953 | Ethene, homopolymer |
| 126040162 | Ethene, homopolymer |
| 126040173 | Ethene, homopolymer |
| 126879401 | Ethene, homopolymer |
| 131461842 | Ethene, homopolymer |
| 131461853 | Ethene, homopolymer |
| 136958800 | Ethene, homopolymer |
| 142985613 | Ethene, homopolymer |
| 150632749 | Ethene, homopolymer |
| 151595174 | Ethene, homopolymer |
| 153302160 | Ethene, homopolymer |
| 156799290 | Ethene, homopolymer |
| 159251500 | Ethene, homopolymer |
| 160612771 | Ethene, homopolymer |
| 161051678 | Ethene, homopolymer |
| 163751846 | Ethene, homopolymer |
| 172451637 | Ethene, homopolymer |
| 174594048 | Ethene, homopolymer |
| 176365961 | Ethene, homopolymer |
| 177529725 | Ethene, homopolymer |
| 177771903 | Ethene, homopolymer |
| 177893377 | Ethene, homopolymer |
| 183076462 | Ethene, homopolymer |
| 184182056 | Ethene, homopolymer |
| 187175957 | Ethene, homopolymer |
| 187619938 | Ethene, homopolymer |
| 189120954 | Ethene, homopolymer |
| 191490321 | Ethene, homopolymer |
| 199128499 | Ethene, homopolymer |
| 201948427 | Ethene, homopolymer |
| 202876242 | Ethene, homopolymer |
| 208196832 | Ethene, homopolymer |
| 211174402 | Ethene, homopolymer |
| 211866910 | Ethene, homopolymer |
| 211866976 | Ethene, homopolymer |
| 212134140 | Ethene, homopolymer |
| 213018576 | Ethene, homopolymer |
| 214692407 | Ethene, homopolymer |
| 220674431 | Ethene, homopolymer |
| 252039682 | Ethene, homopolymer |
| 253608558 | Ethene, homopolymer |
| 263163593 | Ethene, homopolymer |
| 265646933 | Ethene, homopolymer |
| 273402645 | Ethene, homopolymer |
| 286388872 | Ethene, homopolymer |
| 303981046 | Ethene, homopolymer |
| 339991934 | Ethene, homopolymer |
| 345581206 | Ethene, homopolymer |
| 362051283 | Ethene, homopolymer |
| 391249802 | Ethene, homopolymer |
| 438467211 | Ethene, homopolymer |
| 500354847 | Ethene, homopolymer |
| 558440236 | Ethene, homopolymer |
| 583878744 | Ethene, homopolymer |
| 592532815 | Ethene, homopolymer |
| 602330972 | Ethene, homopolymer |
| 602330994 | Ethene, homopolymer |
| 658081904 | Ethene, homopolymer |
| 662139051 | Ethene, homopolymer |
| 851974599 | Ethene, homopolymer |
| 851974602 | Ethene, homopolymer |
| 852465215 | Ethene, homopolymer |
| 853066792 | Ethene, homopolymer |
| 862280248 | Ethene, homopolymer |
| 863603978 | Ethene, homopolymer |
| 866927471 | Ethene, homopolymer |
| 881176347 | Ethene, homopolymer |
| 895130833 | Ethene, homopolymer |
| 910450270 | Ethene, homopolymer |
| 917487037 | Ethene, homopolymer |
| 922501368 | Ethene, homopolymer |
| 940910770 | Ethene, homopolymer |
| 945217094 | Ethene, homopolymer |
| 1010857018 | Ethene, homopolymer |
| 1021428034 | Ethene, homopolymer |
| 1137119095 | Ethene, homopolymer |
| 1187527292 | Ethene, homopolymer |
| 1208346831 | Ethene, homopolymer |
| 1227178235 | Ethene, homopolymer |
| 1228118986 | Ethene, homopolymer |
| 1256781573 | Ethene, homopolymer |
| 1281939841 | Ethene, homopolymer |
| 1365657573 | Ethene, homopolymer |
| 1365657584 | Ethene, homopolymer |
| 1383916560 | Ethene, homopolymer |
| 1393813701 | Ethene, homopolymer |
| 1429741581 | Ethene, homopolymer |
| 107255 | Ethene, methoxy- |
| 9002895 | Ethenol, homopolymer |
| 9014146 | Ethenol, homopolymer |
| 9050537 | Ethenol, homopolymer |
| 9066051 | Ethenol, homopolymer |
| 25038511 | Ethenol, homopolymer |
| 39320291 | Ethenol, homopolymer |
| 53241160 | Ethenol, homopolymer |
| 58740504 | Ethenol, homopolymer |
| 61584381 | Ethenol, homopolymer |
| 73298530 | Ethenol, homopolymer |
| 75923487 | Ethenol, homopolymer |
| 82428088 | Ethenol, homopolymer |
| 98002483 | Ethenol, homopolymer |
| 106442335 | Ethenol, homopolymer |
| 110736475 | Ethenol, homopolymer |
| 118168835 | Ethenol, homopolymer |
| 147827369 | Ethenol, homopolymer |
| 151439020 | Ethenol, homopolymer |
| 152987514 | Ethenol, homopolymer |
| 153569701 | Ethenol, homopolymer |
| 155421526 | Ethenol, homopolymer |
| 162261316 | Ethenol, homopolymer |
| 172452038 | Ethenol, homopolymer |
| 176742146 | Ethenol, homopolymer |
| 353276423 | Ethenol, homopolymer |
| 372077139 | Ethenol, homopolymer |
| 416899995 | Ethenol, homopolymer |
| 551960180 | Ethenol, homopolymer |
| 860310936 | Ethenol, homopolymer |
| 875587238 | Ethenol, homopolymer |
| 1159795773 | Ethenol, homopolymer |
| 1221137854 | Ethenol, homopolymer |
| 1251055034 | Ethenol, homopolymer |
| 1360538164 | Ethenol, homopolymer |
| 1360617282 | Ethenol, homopolymer |
| 1379820548 | Ethenol, homopolymer |
| 1391975953 | Ethenol, homopolymer |
| 1417904881 | Ethenol, homopolymer |
| 1422717369 | Ethenol, homopolymer |
| 463514 | Ethenone |
| 32834278 | Ethenone |
| 32834358 | Ethenone |
| 74862 | Ethyne |
| 57113743 | Ethyne |
| 7572294 | Ethyne, dichloro- |
| 14683239 | Europium, isotope of mass 152 |
| 15585101 | Europium, isotope of mass 154 |
| 14391163 | Europium, isotope of mass 155 |
| 14280354 | Europium, isotope of mass 156 |
| 64742047 | Extracts (petroleum), heavy paraffinic distillate solvent |
| 8039438 | Fatty acids |
| 12624101 | Fatty acids |
| 60572001 | Fatty acids |
| 67254799 | Fatty acids |
| 13408623 | Ferrate(3-), hexakis(cyano-.kappa.C)-, (OC-6-11)- |
| 13408634 | Ferrate(4-), hexakis(cyano-.kappa.C)-, (OC-6-11)- |
| 55318235 | Ferrate(4-), hexakis(cyano-.kappa.C)-, (OC-6-11)- |
| 55448403 | Ferrate(4-), hexakis(cyano-.kappa.C)-, (OC-6-11)- |
| 60927302 | Ferrate(4-), hexakis(cyano-.kappa.C)-, (OC-6-11)- |
| 25869005 | Ferrate(4-), hexakis(cyano-.kappa.C)-, ammonium iron(3+) (1:1:1), (OC-6-11)- |
| 31095144 | Ferrate(4-), hexakis(cyano-.kappa.C)-, ammonium iron(3+) (1:1:1), (OC-6-11)- |
| 102545 | Ferrocene |
| 51364126 | Ferrocene |
| 55404687 | Ferrocene |
| 774583141 | Ferrocene |
| 856324920 | Ferrocene |
| 856780217 | Ferrocene |
| 1080518860 | Ferrocene |
| 12252334 | Fiberglass |
| 36355018 | FireMaster BP 6 |
| 59536651 | FireMaster BP 6 |
| 59536651 | FireMaster FF 1 |
| 67774327 | FireMaster FF 1 |
| 206440 | Fluoranthene |
| 7782414 | Fluoride |
| 16984488 | Fluoride |
| 405267450 | Fluoride |
| 7782414 | Fluorine |
| 28077976 | Fluorine |
| 719993314 | Fluorine |
| 50000 | Formaldehyde |
| 8005387 | Formaldehyde |
| 8006073 | Formaldehyde |
| 8013136 | Formaldehyde |
| 112068710 | Formaldehyde |
| 1053659792 | Formaldehyde |
| 1156543564 | Formaldehyde |
| 1158237025 | Formaldehyde |
| 1227476289 | Formaldehyde |
| 1416946650 | Formaldehyde |
| 75127 | Formamide |
| 23296415 | Formamide |
| 1156543553 | Formamide |
| 1158234151 | Formamide |
| 26644462 | Formamide, N,N'-[1,4-piperazinediylbis(2,2,2-trichloroethylidene)]bis- |
| 68122 | Formamide, N,N-dimethyl- |
| 15175630 | Formamide, N,N-dimethyl- |
| 15175776 | Formamide, N,N-dimethyl- |
| 33513427 | Formamide, N,N-dimethyl- |
| 114057157 | Formamide, N,N-dimethyl- |
| 24554265 | Formamide, N-[4-(5-nitro-2-furanyl)-2-thiazolyl]- |
| 103708 | Formamide, N-phenyl- |
| 64186 | Formic acid |
| 8006937 | Formic acid |
| 67382927 | Formic acid |
| 82069145 | Formic acid |
| 1016316601 | Formic acid |
| 625558 | Formic acid, 1-methylethyl ester |
| 109944 | Formic acid, ethyl ester |
| 556638 | Formic acid, lithium salt (1:1) |
| 107313 | Formic acid, methyl ester |
| 1053659554 | Formic acid, methyl ester |
| 1173023738 | Formic acid, methyl ester |
| 141537 | Formic acid, sodium salt (1:1) |
| 84050157 | Formic acid, sodium salt (1:1) |
| 84050168 | Formic acid, sodium salt (1:1) |
| 84050179 | Formic acid, sodium salt (1:1) |
| 1015855658 | Formic acid, sodium salt (1:1) |
| 68476302 | Fuel oil, no. 2 |
| 68476802 | Fuel oil, no. 2 |
| 68476313 | Fuel oil, no. 4 |
| 8008206 | Fuel oil, no. 5 |
| 70892114 | Fuel oil, no. 5 |
| 68334305 | Fuels, diesel |
| 68512903 | Fuels, diesel |
| 110009 | Furan |
| 625865 | Furan, 2,5-dimethyl- |
| 109999 | Furan, tetrahydro- |
| 77392702 | Furan, tetrahydro- |
| 55957103 | Fyrquel 220 |
| 14276654 | Gadolinium, isotope of mass 153 |
| 10318260 | Galactitol, 1,6-dibromo-1,6-dideoxy- |
| 7440553 | Gallium |
| 1303000 | Gallium arsenide (GaAs) |
| 12254954 | Gallium arsenide (GaAs) |
| 106495925 | Gallium arsenide (GaAs) |
| 116443039 | Gallium arsenide (GaAs) |
| 385800124 | Gallium arsenide (GaAs) |
| 817163738 | Gallium arsenide (GaAs) |
| 888030715 | Gallium arsenide (GaAs) |
| 959925101 | Gallium arsenide (GaAs) |
| 1018852646 | Gallium arsenide (GaAs) |
| 1099648868 | Gallium arsenide (GaAs) |
| 1434046679 | Gallium arsenide (GaAs) |
| 12024214 | Gallium oxide (Ga2O3) |
| 1246736651 | Gallium oxide (Ga2O3) |
| 8006619 | Gasoline |
| 86290815 | Gasoline |
| 8006619 | Gasoline, aviation |
| 308082099 | Gasoline, aviation |
| 8006619 | Gasoline, natural |
| 7782652 | Germane |
| 7440564 | Germanium |
| 129827754 | Germanium |
| 14374813 | Germanium, isotope of mass 71 |
| 77065 | Gibb-3-ene-1,10-dicarboxylic acid, 2,4a,7-trihydroxy-1-methyl-8-methylene-, 1,4a-lactone, (1.alpha.,2.beta.,4a.alpha.,4b.beta.,10.beta.)- |
| 1405965 | Gibb-3-ene-1,10-dicarboxylic acid, 2,4a,7-trihydroxy-1-methyl-8-methylene-, 1,4a-lactone, (1.alpha.,2.beta.,4a.alpha.,4b.beta.,10.beta.)- |
| 7121553 | Gibb-3-ene-1,10-dicarboxylic acid, 2,4a,7-trihydroxy-1-methyl-8-methylene-, 1,4a-lactone, (1.alpha.,2.beta.,4a.alpha.,4b.beta.,10.beta.)- |
| 16202203 | Gibb-3-ene-1,10-dicarboxylic acid, 2,4a,7-trihydroxy-1-methyl-8-methylene-, 1,4a-lactone, (1.alpha.,2.beta.,4a.alpha.,4b.beta.,10.beta.)- |
| 58915449 | Gibb-3-ene-1,10-dicarboxylic acid, 2,4a,7-trihydroxy-1-methyl-8-methylene-, 1,4a-lactone, (1.alpha.,2.beta.,4a.alpha.,4b.beta.,10.beta.)- |
| 192662672 | Gibb-3-ene-1,10-dicarboxylic acid, 2,4a,7-trihydroxy-1-methyl-8-methylene-, 1,4a-lactone, (1.alpha.,2.beta.,4a.alpha.,4b.beta.,10.beta.)- |
| 295313574 | Gibb-3-ene-1,10-dicarboxylic acid, 2,4a,7-trihydroxy-1-methyl-8-methylene-, 1,4a-lactone, (1.alpha.,2.beta.,4a.alpha.,4b.beta.,10.beta.)- |
| 474760457 | Gibb-3-ene-1,10-dicarboxylic acid, 2,4a,7-trihydroxy-1-methyl-8-methylene-, 1,4a-lactone, (1.alpha.,2.beta.,4a.alpha.,4b.beta.,10.beta.)- |
| 859282716 | Gibb-3-ene-1,10-dicarboxylic acid, 2,4a,7-trihydroxy-1-methyl-8-methylene-, 1,4a-lactone, (1.alpha.,2.beta.,4a.alpha.,4b.beta.,10.beta.)- |
| 1423015911 | Gibb-3-ene-1,10-dicarboxylic acid, 2,4a,7-trihydroxy-1-methyl-8-methylene-, 1,4a-lactone, (1.alpha.,2.beta.,4a.alpha.,4b.beta.,10.beta.)- |
| 12002436 | Gilsonite |
| 56406 | Glycine |
| 52955632 | Glycine |
| 57678190 | Glycine |
| 87867945 | Glycine |
| 848646457 | Glycine |
| 1119449363 | Glycine |
| 1173020115 | Glycine |
| 1196157784 | Glycine |
| 60004 | Glycine, N,N'-1,2-ethanediylbis[N-(carboxymethyl)- |
| 64028 | Glycine, N,N'-1,2-ethanediylbis[N-(carboxymethyl)- |
| 13440783 | Glycine, N,N'-1,2-ethanediylbis[N-(carboxymethyl)- |
| 20539279 | Glycine, N,N'-1,2-ethanediylbis[N-(carboxymethyl)- |
| 26627463 | Glycine, N,N'-1,2-ethanediylbis[N-(carboxymethyl)- |
| 30485871 | Glycine, N,N'-1,2-ethanediylbis[N-(carboxymethyl)- |
| 30485882 | Glycine, N,N'-1,2-ethanediylbis[N-(carboxymethyl)- |
| 30485906 | Glycine, N,N'-1,2-ethanediylbis[N-(carboxymethyl)- |
| 32757101 | Glycine, N,N'-1,2-ethanediylbis[N-(carboxymethyl)- |
| 94108755 | Glycine, N,N'-1,2-ethanediylbis[N-(carboxymethyl)- |
| 161122334 | Glycine, N,N'-1,2-ethanediylbis[N-(carboxymethyl)- |
| 402925671 | Glycine, N,N'-1,2-ethanediylbis[N-(carboxymethyl)- |
| 675141169 | Glycine, N,N'-1,2-ethanediylbis[N-(carboxymethyl)- |
| 7379262 | Glycine, N,N'-1,2-ethanediylbis[N-(carboxymethyl)-, ammonium salt (1:?) |
| 150389 | Glycine, N,N'-1,2-ethanediylbis[N-(carboxymethyl)-, sodium salt (1:3) |
| 8014662 | Glycine, N,N'-1,2-ethanediylbis[N-(carboxymethyl)-, sodium salt (1:3) |
| 97928922 | Glycine, N,N'-1,2-ethanediylbis[N-(carboxymethyl)-, sodium salt (1:3) |
| 64028 | Glycine, N,N'-1,2-ethanediylbis[N-(carboxymethyl)-, sodium salt (1:4) |
| 8013512 | Glycine, N,N'-1,2-ethanediylbis[N-(carboxymethyl)-, sodium salt (1:4) |
| 8023210 | Glycine, N,N'-1,2-ethanediylbis[N-(carboxymethyl)-, sodium salt (1:4) |
| 50809353 | Glycine, N,N'-1,2-ethanediylbis[N-(carboxymethyl)-, sodium salt (1:4) |
| 70699535 | Glycine, N,N'-1,2-ethanediylbis[N-(carboxymethyl)-, sodium salt (1:4) |
| 97928933 | Glycine, N,N'-1,2-ethanediylbis[N-(carboxymethyl)-, sodium salt (1:4) |
| 139139 | Glycine, N,N-bis(carboxymethyl)- |
| 26627441 | Glycine, N,N-bis(carboxymethyl)- |
| 26627452 | Glycine, N,N-bis(carboxymethyl)- |
| 80751515 | Glycine, N,N-bis(carboxymethyl)- |
| 18105038 | Glycine, N,N-bis(carboxymethyl)-, mercury(2+) salt (2:3) |
| 5064313 | Glycine, N,N-bis(carboxymethyl)-, sodium salt (1:3) |
| 37291819 | Glycine, N,N-bis(carboxymethyl)-, sodium salt (1:3) |
| 18662538 | Glycine, N,N-bis(carboxymethyl)-, trisodium salt, monohydrate |
| 38727558 | Glycine, N-(chloroacetyl)-N-(2,6-diethylphenyl)-, ethyl ester |
| 51142202 | Glycine, N-(chloroacetyl)-N-(2,6-diethylphenyl)-, ethyl ester |
| 52002014 | Glycine, N-(chloroacetyl)-N-(2,6-diethylphenyl)-, ethyl ester |
| 62180863 | Glycine, N-(chloroacetyl)-N-(2,6-diethylphenyl)-, ethyl ester |
| 1071536 | Glycine, N-(phosphonomethyl)- |
| 1071836 | Glycine, N-(phosphonomethyl)- |
| 37337603 | Glycine, N-(phosphonomethyl)- |
| 42618097 | Glycine, N-(phosphonomethyl)- |
| 75241086 | Glycine, N-(phosphonomethyl)- |
| 107971 | Glycine, N-methyl- |
| 783292499 | Glycine, N-methyl- |
| 13256229 | Glycine, N-methyl-N-nitroso- |
| 7440575 | Gold |
| 33019351 | Gold |
| 1093282279 | Gold |
| 14914160 | Gold, isotope of mass 196 |
| 1337800 | Gold, isotope of mass 198 |
| 8031503 | Gold, isotope of mass 198 |
| 10043499 | Gold, isotope of mass 198 |
| 102067 | Guanidine, N,N'-diphenyl- |
| 20277923 | Guanidine, N,N'-diphenyl- |
| 25323697 | Guanidine, N,N'-diphenyl- |
| 33505703 | Guanidine, N,N'-diphenyl- |
| 39291219 | Guanidine, N,N'-diphenyl- |
| 55556100 | Guanidine, N,N'-diphenyl- |
| 368867996 | Guanidine, N,N'-diphenyl- |
| 67953542 | Guanidine, N-cyano-, polymer with N1-(2-aminoethyl)-1,2-ethanediamine and 2-(chloromethyl)oxirane |
| 2439103 | Guanidine, N-dodecyl-, acetate (1:1) |
| 15880996 | Guanidine, N-dodecyl-, acetate (1:1) |
| 51426085 | Guanidine, N-dodecyl-, acetate (1:1) |
| 96923045 | Guanidine, N-dodecyl-, acetate (1:1) |
| 1135443229 | Guanidine, N-dodecyl-, acetate (1:1) |
| 70257 | Guanidine, N-methyl-N'-nitro-N-nitroso- |
| 100234535 | Guanidine, N-methyl-N'-nitro-N-nitroso- |
| 556887 | Guanidine, N-nitro- |
| 506934 | Guanidine, nitrate (1:1) |
| 6609934 | Guanidine, nitrate (1:1) |
| 24011903 | Guanidine, nitrate (1:1) |
| 64039276 | Guanosine, 2'-deoxy-6-thio-, monohydrate |
| 9000300 | Guar gum |
| 9008177 | Guar gum |
| 9010508 | Guar gum |
| 9049336 | Guar gum |
| 9066073 | Guar gum |
| 53986279 | Guar gum |
| 57406685 | Guar gum |
| 57406710 | Guar gum |
| 63799542 | Guar gum |
| 85510163 | Guar gum |
| 1312293381 | Guar gum |
| 8047378 | Gum arabic |
| 8047389 | Gum arabic |
| 9000015 | Gum arabic |
| 37316555 | Gum arabic |
| 37316566 | Gum arabic |
| 39378444 | Gum arabic |
| 39378455 | Gum arabic |
| 10101414 | Gypsum (Ca(SO4).2H2O) |
| 13397245 | Gypsum (Ca(SO4).2H2O) |
| 70513701 | Gypsum (Ca(SO4).2H2O) |
| 77030592 | Gypsum (Ca(SO4).2H2O) |
| 7440586 | Hafnium |
| 412316008 | Hafnium |
| 14900211 | Hafnium, isotope of mass 181 |
| 58718664 | Halowax 1000 |
| 58718675 | Halowax 1001 |
| 39450050 | Halowax 1099 |
| 7440597 | Helium |
| 494798311 | Helium |
| 1312815283 | Helium |
| 1317608 | Hematite (Fe2O3) |
| 629947 | Heneicosane |
| 76448 | Heptachlor and its epoxide -- RCRA T |
| 629787 | Heptadecane |
| 111717 | Heptanal |
| 142825 | Heptane |
| 142845 | Heptane |
| 8031332 | Heptane |
| 44607138 | Heptane |
| 592278 | Heptane, 2-methyl- |
| 589811 | Heptane, 3-methyl- |
| 116502433 | Heptane, 3-methyl- |
| 25339564 | Heptene |
| 630013 | Hexacosane |
| 544763 | Hexadecane |
| 555351 | Hexadecanoic acid, aluminum salt (3:1) |
| 69646000 | Hexadecanoic acid, aluminum salt (3:1) |
| 66251 | Hexanal |
| 123057 | Hexanal, 2-ethyl- |
| 58712008 | Hexanal, 2-ethyl- |
| 628024 | Hexanamide |
| 100543 | Hexane |
| 110543 | Hexane |
| 8031343 | Hexane |
| 822060 | Hexane, 1,6-diisocyanato- |
| 53192271 | Hexane, 1,6-diisocyanato- |
| 57350773 | Hexane, 1,6-diisocyanato- |
| 63525906 | Hexane, 1,6-diisocyanato- |
| 66368965 | Hexane, 1,6-diisocyanato- |
| 88357624 | Hexane, 1,6-diisocyanato- |
| 133394599 | Hexane, 1,6-diisocyanato- |
| 243121019 | Hexane, 1,6-diisocyanato- |
| 280144196 | Hexane, 1,6-diisocyanato- |
| 824958443 | Hexane, 1,6-diisocyanato- |
| 1196968383 | Hexane, 1,6-diisocyanato- |
| 1199811169 | Hexane, 1,6-diisocyanato- |
| 1447694907 | Hexane, 1,6-diisocyanato- |
| 544105 | Hexane, 1-chloro- |
| 646140 | Hexane, 1-nitro- |
| 591764 | Hexane, 2-methyl- |
| 589344 | Hexane, 3-methyl- |
| 116502455 | Hexane, 3-methyl- |
| 25495903 | Hexane, chloro- |
| 628944 | Hexanediamide |
| 111693 | Hexanedinitrile |
| 55462970 | Hexanedinitrile |
| 103231 | Hexanedioic acid, 1,6-bis(2-ethylhexyl) ester |
| 39393674 | Hexanedioic acid, 1,6-bis(2-ethylhexyl) ester |
| 63637489 | Hexanedioic acid, 1,6-bis(2-ethylhexyl) ester |
| 70147216 | Hexanedioic acid, 1,6-bis(2-ethylhexyl) ester |
| 141048 | Hexanedioic acid, 1,6-bis(2-methylpropyl) ester |
| 53659851 | Hexanedioic acid, 1,6-bis(2-methylpropyl) ester |
| 141173 | Hexanedioic acid, 1,6-bis[2-(2-butoxyethoxy)ethyl] ester |
| 62863074 | Hexanedioic acid, 1,6-bis[2-(2-butoxyethoxy)ethyl] ester |
| 79806001 | Hexanedioic acid, 1,6-bis[2-(2-butoxyethoxy)ethyl] ester |
| 130455639 | Hexanedioic acid, 1,6-bis[2-(2-butoxyethoxy)ethyl] ester |
| 194548851 | Hexanedioic acid, 1,6-bis[2-(2-butoxyethoxy)ethyl] ester |
| 105997 | Hexanedioic acid, 1,6-dibutyl ester |
| 849990 | Hexanedioic acid, 1,6-dicyclohexyl ester |
| 105975 | Hexanedioic acid, 1,6-didecyl ester |
| 141286 | Hexanedioic acid, 1,6-diethyl ester |
| 27178161 | Hexanedioic acid, 1,6-diisodecyl ester |
| 29761328 | Hexanedioic acid, 1,6-diisodecyl ester |
| 105557173 | Hexanedioic acid, 1,6-diisodecyl ester |
| 1330865 | Hexanedioic acid, 1,6-diisooctyl ester |
| 108778229 | Hexanedioic acid, 1,6-diisooctyl ester |
| 627930 | Hexanedioic acid, 1,6-dimethyl ester |
| 111366611 | Hexanedioic acid, 1,6-dimethyl ester |
| 151326 | Hexanedioic acid, 1,6-dinonyl ester |
| 123795 | Hexanedioic acid, 1,6-dioctyl ester |
| 106194 | Hexanedioic acid, 1,6-dipropyl ester |
| 22707353 | Hexanedioic acid, 1-decyl 6-hexyl ester |
| 110292 | Hexanedioic acid, 1-decyl 6-octyl ester |
| 110327 | Hexanedioic acid, bis(2-(hexyloxy)ethyl) ester |
| 10022603 | Hexanedioic acid, bis(2-ethylbutyl) ester |
| 7790070 | Hexanedioic acid, bis[2-(2-ethylbutoxy)ethyl] ester |
| 4337659 | Hexanedioic acid, mono(2-ethylhexyl) ester |
| 25101035 | Hexanedioic acid, polymer with 1,2-propanediol |
| 63149702 | Hexanedioic acid, polymer with 1,2-propanediol |
| 1446491980 | Hexanedioic acid, polymer with 1,2-propanediol |
| 142621 | Hexanoic acid |
| 53896267 | Hexanoic acid |
| 149575 | Hexanoic acid, 2-ethyl- |
| 83829689 | Hexanoic acid, 2-ethyl- |
| 202054395 | Hexanoic acid, 2-ethyl- |
| 18540299 | Hexavalent chromium compounds |
| 26266682 | Hexenal, 2-ethyl- |
| 25264931 | Hexene |
| 26266024 | Hexene |
| 13967652 | Holmium, isotope of mass 166 |
| 13967652 | Holmium, isotope of mass 166m(1.2E+03 yr) |
| 378751792 | Holmium, isotope of mass 166m(1.2E+03 yr) |
| 67210 | Homocysteine, S-ethyl- |
| 302012 | Hydrazine |
| 31886267 | Hydrazine |
| 75013580 | Hydrazine |
| 78206914 | Hydrazine |
| 119775109 | Hydrazine |
| 51718 | Hydrazine, (2-phenylethyl)- |
| 57147 | Hydrazine, 1,1-dimethyl- |
| 108316 | Hydrazine, 1,1-dimethyl- |
| 88733282 | Hydrazine, 1,1-dimethyl- |
| 1615801 | Hydrazine, 1,2-diethyl- |
| 40738 | Hydrazine, 1,2-dimethyl- |
| 540738 | Hydrazine, 1,2-dimethyl- |
| 122667 | Hydrazine, 1,2-diphenyl- |
| 60343 | Hydrazine, methyl- |
| 60344 | Hydrazine, methyl- |
| 7803578 | Hydrazine, monohydrate |
| 10217524 | Hydrazine, monohydrate |
| 100630 | Hydrazine, phenyl- |
| 1057722403 | Hydrazine, phenyl- |
| 10034932 | Hydrazine, sulfate (1:1) |
| 95416152 | Hydrazine, sulfate (1:1) |
| 79196 | Hydrazinecarbothioamide |
| 57567 | Hydrazinecarboxamide |
| 563417 | Hydrazinecarboxamide |
| 59870 | Hydrazinecarboxamide, 2-[(5-nitro-2-furanyl)methylene]- |
| 8027712 | Hydrazinecarboxamide, 2-[(5-nitro-2-furanyl)methylene]- |
| 60051856 | Hydrazinecarboxamide, 2-[(5-nitro-2-furanyl)methylene]- |
| 563417 | Hydrazinecarboxamide, hydrochloride (1:1) |
| 13284076 | Hydrazinecarboximidamide, 2,2'-[carbonylbis(imino-4,1-phenyleneethylidyne)]bis- |
| 38848769 | Hydrazinium, 1-(2-hydroxypropyl)-1,1-dimethyl-2-(1-oxotetradecyl)-, inner salt |
| 17341401 | Hydrazinium, 1-(2-hydroxypropyl)-1,1-dimethyl-2-(2-methyl-1-oxo-2-propen-1-yl)-, inner salt |
| 56652494 | Hydrazinium, 1-(2-hydroxypropyl)-1,1-dimethyl-2-(2-methyl-1-oxo-2-propen-1-yl)-, inner salt |
| 68912174 | Hydrazinium, 1-(2-hydroxypropyl)-1,1-dimethyl-2-(2-methyl-1-oxo-2-propen-1-yl)-, inner salt |
| 73486507 | Hydrazinium, 1-(2-hydroxypropyl)-1,1-dimethyl-2-(2-methyl-1-oxo-2-propen-1-yl)-, inner salt |
| 92267599 | Hydrazinium, 1-(2-hydroxypropyl)-1,1-dimethyl-2-(2-methyl-1-oxo-2-propen-1-yl)-, inner salt |
| 122919646 | Hydrazinium, 1-(2-hydroxypropyl)-1,1-dimethyl-2-(2-methyl-1-oxo-2-propen-1-yl)-, inner salt |
| 159833417 | Hydrazinium, 1-(2-hydroxypropyl)-1,1-dimethyl-2-(2-methyl-1-oxo-2-propen-1-yl)-, inner salt |
| 10035106 | Hydrobromic acid |
| 62140561 | Hydrobromic acid |
| 64742898 | Hydrocarbons |
| 308067530 | Hydrocarbons |
| 68920069 | Hydrocarbons, C7-9 |
| 8012951 | Hydrocarbons, petroleum |
| 7647010 | Hydrochloric acid |
| 7647100 | Hydrochloric acid |
| 7647372 | Hydrochloric acid |
| 8007565 | Hydrochloric acid |
| 51005197 | Hydrochloric acid |
| 61674622 | Hydrochloric acid |
| 113962655 | Hydrochloric acid |
| 218625684 | Hydrochloric acid |
| 74908 | Hydrocyanic acid |
| 191234227 | Hydrocyanic acid |
| 341972314 | Hydrocyanic acid |
| 7664393 | Hydrofluoric acid |
| 32057093 | Hydrofluoric acid |
| 326604755 | Hydrofluoric acid |
| 1333740 | Hydrogen |
| 725200577 | Hydrogen |
| 12408025 | Hydrogen ion |
| 7722841 | Hydrogen peroxide (H2O2) |
| 8007305 | Hydrogen peroxide (H2O2) |
| 37355843 | Hydrogen peroxide (H2O2) |
| 66554505 | Hydrogen peroxide (H2O2) |
| 97929732 | Hydrogen peroxide (H2O2) |
| 218625720 | Hydrogen peroxide (H2O2) |
| 7783075 | Hydrogen selenide (H2Se) |
| 7783064 | Hydrogen sulfide (H2S) |
| 11144153 | Hydrogen sulfide (H2S) |
| 75912 | Hydroperoxide, 1,1-dimethylethyl |
| 80477 | Hydroperoxide, 1-methyl-1-(4-methylcyclohexyl)ethyl |
| 80159 | Hydroperoxide, 1-methyl-1-phenylethyl |
| 79568788 | Hydroperoxide, 1-methyl-1-phenylethyl |
| 14280309 | Hydroxide |
| 58390082 | Hydroxide |
| 58721689 | Hydroxide |
| 3352576 | Hydroxyl |
| 7803498 | Hydroxylamine |
| 593566 | Hydroxylamine, O-methyl-, hydrochloride (1:1) |
| 73151129 | Hydroxylamine, O-methyl-, hydrochloride (1:1) |
| 253880852 | Hydroxylamine, O-methyl-, hydrochloride (1:1) |
| 400605405 | Hydroxylamine, O-methyl-, hydrochloride (1:1) |
| 5470111 | Hydroxylamine, hydrochloride (1:1) |
| 379722733 | Hydroxylamine, hydrochloride (1:1) |
| 10046001 | Hydroxylamine, sulfate (1:1) |
| 72033433 | Hydroxylamine, sulfate (1:1) |
| 10039540 | Hydroxylamine, sulfate (2:1) |
| 120893789 | Hydroxylamine, sulfate (2:1) |
| 14380611 | Hypochlorite |
| 7681529 | Hypochlorous acid, sodium salt (1:1) |
| 8007598 | Hypochlorous acid, sodium salt (1:1) |
| 56172577 | Hypochlorous acid, sodium salt (1:1) |
| 102324787 | Hypochlorous acid, sodium salt (1:1) |
| 227453692 | Hypochlorous acid, sodium salt (1:1) |
| 834286 | Imidodicarbonimidic diamide, N-(2-phenylethyl)-, monohydrochloride |
| 193395 | Indeno[1,2,3-cd]pyrene |
| 348085461 | Indeno[1,2,3-cd]pyrene |
| 173584446 | Indeno[1,2-e][1,3,4]oxadiazine-4a(3H)-carboxylic acid, 7-chloro-2,5-dihydro-2-[[(methoxycarbonyl)[4-(trifluoromethoxy)phenyl]amino]carbonyl]-, methyl ester, (4aS)- |
| 174060414 | Indeno[1,2-e][1,3,4]oxadiazine-4a(3H)-carboxylic acid, 7-chloro-2,5-dihydro-2-[[(methoxycarbonyl)[4-(trifluoromethoxy)phenyl]amino]carbonyl]-, methyl ester, (4aS)- |
| 7440746 | Indium |
| 14191710 | Indium, isotope of mass 115 |
| 342698 | Inosine, 6-S-methyl-6-thio- |
| 20461545 | Iodide |
| 7553562 | Iodine |
| 8012815 | Iodine |
| 8012859 | Iodine |
| 8031478 | Iodine |
| 24503900 | Iodine |
| 506785 | Iodine cyanide (I(CN)) |
| 7783666 | Iodine fluoride (IF5) |
| 14158328 | Iodine, isotope of mass 126 |
| 15046841 | Iodine, isotope of mass 129, at. |
| 10043660 | Iodine, isotope of mass 131, at. |
| 24267569 | Iodine, isotope of mass 131, at. |
| 14683160 | Iodine, isotope of mass 132, at. |
| 7439885 | Iridium |
| 14981910 | Iridium, isotope of mass 190 |
| 14694690 | Iridium, isotope of mass 192 |
| 15128093 | Iridium, isotope of mass 192 |
| 25384116 | Iridium, isotope of mass 192 |
| 7439896 | Iron |
| 8011798 | Iron |
| 8053609 | Iron |
| 15438310 | Iron |
| 39344713 | Iron |
| 70884354 | Iron |
| 73135383 | Iron |
| 129048517 | Iron |
| 161135393 | Iron |
| 190454138 | Iron |
| 195161832 | Iron |
| 199281226 | Iron |
| 443783526 | Iron |
| 675141170 | Iron |
| 13463406 | Iron carbonyl (Fe(CO)5), (TB-5-11)- |
| 36823355 | Iron carbonyl (Fe(CO)5), (TB-5-11)- |
| 37220421 | Iron carbonyl (Fe(CO)5), (TB-5-11)- |
| 540770454 | Iron carbonyl (Fe(CO)5), (TB-5-11)- |
| 848779179 | Iron carbonyl (Fe(CO)5), (TB-5-11)- |
| 7758943 | Iron chloride (FeCl2) |
| 612850325 | Iron chloride (FeCl2) |
| 7705080 | Iron chloride (FeCl3) |
| 12178835 | Iron chloride (FeCl3) |
| 130622207 | Iron chloride (FeCl3) |
| 774583107 | Iron chloride (FeCl3) |
| 8012473 | Iron dextran |
| 8050939 | Iron dextran |
| 9004664 | Iron dextran |
| 9009885 | Iron dextran |
| 9044580 | Iron dextran |
| 9061476 | Iron dextran |
| 11129478 | Iron dextran |
| 37318948 | Iron dextran |
| 37349147 | Iron dextran |
| 50643000 | Iron dextran |
| 53858585 | Iron dextran |
| 1332372 | Iron oxide |
| 1333372 | Iron oxide |
| 8075669 | Iron oxide |
| 1198473265 | Iron oxide |
| 1309371 | Iron oxide (Fe2O3) |
| 1343095 | Iron oxide (Fe2O3) |
| 8011970 | Iron oxide (Fe2O3) |
| 8049501 | Iron oxide (Fe2O3) |
| 12000930 | Iron oxide (Fe2O3) |
| 12002174 | Iron oxide (Fe2O3) |
| 12227871 | Iron oxide (Fe2O3) |
| 60880866 | Iron oxide (Fe2O3) |
| 65455449 | Iron oxide (Fe2O3) |
| 65637710 | Iron oxide (Fe2O3) |
| 88528261 | Iron oxide (Fe2O3) |
| 90452214 | Iron oxide (Fe2O3) |
| 110736419 | Iron oxide (Fe2O3) |
| 118277319 | Iron oxide (Fe2O3) |
| 129131595 | Iron oxide (Fe2O3) |
| 131874414 | Iron oxide (Fe2O3) |
| 135507538 | Iron oxide (Fe2O3) |
| 147229901 | Iron oxide (Fe2O3) |
| 147229912 | Iron oxide (Fe2O3) |
| 160186107 | Iron oxide (Fe2O3) |
| 177715241 | Iron oxide (Fe2O3) |
| 185464442 | Iron oxide (Fe2O3) |
| 188357780 | Iron oxide (Fe2O3) |
| 220787064 | Iron oxide (Fe2O3) |
| 253310520 | Iron oxide (Fe2O3) |
| 448923715 | Iron oxide (Fe2O3) |
| 741267312 | Iron oxide (Fe2O3) |
| 1115688113 | Iron oxide (Fe2O3) |
| 1146982117 | Iron oxide (Fe2O3) |
| 1210992565 | Iron oxide (Fe2O3) |
| 1382787021 | Iron oxide (Fe2O3) |
| 1397708803 | Iron oxide (Fe2O3) |
| 1430053954 | Iron oxide (Fe2O3) |
| 1317619 | Iron oxide (Fe3O4) |
| 73905814 | Iron oxide (Fe3O4) |
| 107720809 | Iron oxide (Fe3O4) |
| 118440509 | Iron oxide (Fe3O4) |
| 122391586 | Iron oxide (Fe3O4) |
| 139660109 | Iron oxide (Fe3O4) |
| 144856042 | Iron oxide (Fe3O4) |
| 170277368 | Iron oxide (Fe3O4) |
| 207621214 | Iron oxide (Fe3O4) |
| 208666799 | Iron oxide (Fe3O4) |
| 219674870 | Iron oxide (Fe3O4) |
| 224310081 | Iron oxide (Fe3O4) |
| 253310519 | Iron oxide (Fe3O4) |
| 514204116 | Iron oxide (Fe3O4) |
| 940941195 | Iron oxide (Fe3O4) |
| 942194221 | Iron oxide (Fe3O4) |
| 954415691 | Iron oxide (Fe3O4) |
| 1433983766 | Iron oxide (Fe3O4) |
| 1481694603 | Iron oxide (Fe3O4) |
| 15438310 | Iron, ion (Fe2+) |
| 14681595 | Iron, isotope of mass 55 |
| 14596124 | Iron, isotope of mass 59 |
| 301053 | Iron, tris(N,N-dimethylcarbamodithioato-.kappa.S,.kappa.S')-, (OC-6-11)- |
| 13494274 | Iron, tris(N,N-dimethylcarbamodithioato-.kappa.S,.kappa.S')-, (OC-6-11)- |
| 14484641 | Iron, tris(N,N-dimethylcarbamodithioato-.kappa.S,.kappa.S')-, (OC-6-11)- |
| 64070924 | Iron, tris(N,N-dimethylcarbamodithioato-.kappa.S,.kappa.S')-, (OC-6-11)- |
| 1135443069 | Iron, tris(N,N-dimethylcarbamodithioato-.kappa.S,.kappa.S')-, (OC-6-11)- |
| 9016879 | Isocyanic acid, polymethylenepolyphenylene ester |
| 37291693 | Isocyanic acid, polymethylenepolyphenylene ester |
| 37370302 | Isocyanic acid, polymethylenepolyphenylene ester |
| 39278756 | Isocyanic acid, polymethylenepolyphenylene ester |
| 50814421 | Isocyanic acid, polymethylenepolyphenylene ester |
| 51059166 | Isocyanic acid, polymethylenepolyphenylene ester |
| 51810209 | Isocyanic acid, polymethylenepolyphenylene ester |
| 54018198 | Isocyanic acid, polymethylenepolyphenylene ester |
| 56273495 | Isocyanic acid, polymethylenepolyphenylene ester |
| 59392733 | Isocyanic acid, polymethylenepolyphenylene ester |
| 61642522 | Isocyanic acid, polymethylenepolyphenylene ester |
| 66174310 | Isocyanic acid, polymethylenepolyphenylene ester |
| 69345955 | Isocyanic acid, polymethylenepolyphenylene ester |
| 71061206 | Isocyanic acid, polymethylenepolyphenylene ester |
| 74315870 | Isocyanic acid, polymethylenepolyphenylene ester |
| 75026141 | Isocyanic acid, polymethylenepolyphenylene ester |
| 76600867 | Isocyanic acid, polymethylenepolyphenylene ester |
| 81031803 | Isocyanic acid, polymethylenepolyphenylene ester |
| 81406011 | Isocyanic acid, polymethylenepolyphenylene ester |
| 83271425 | Isocyanic acid, polymethylenepolyphenylene ester |
| 83271436 | Isocyanic acid, polymethylenepolyphenylene ester |
| 83512907 | Isocyanic acid, polymethylenepolyphenylene ester |
| 85497207 | Isocyanic acid, polymethylenepolyphenylene ester |
| 86473203 | Isocyanic acid, polymethylenepolyphenylene ester |
| 87139886 | Isocyanic acid, polymethylenepolyphenylene ester |
| 87347646 | Isocyanic acid, polymethylenepolyphenylene ester |
| 88385528 | Isocyanic acid, polymethylenepolyphenylene ester |
| 88651687 | Isocyanic acid, polymethylenepolyphenylene ester |
| 94469815 | Isocyanic acid, polymethylenepolyphenylene ester |
| 96595709 | Isocyanic acid, polymethylenepolyphenylene ester |
| 97397198 | Isocyanic acid, polymethylenepolyphenylene ester |
| 101840817 | Isocyanic acid, polymethylenepolyphenylene ester |
| 103106612 | Isocyanic acid, polymethylenepolyphenylene ester |
| 103812904 | Isocyanic acid, polymethylenepolyphenylene ester |
| 107231856 | Isocyanic acid, polymethylenepolyphenylene ester |
| 108021949 | Isocyanic acid, polymethylenepolyphenylene ester |
| 111310306 | Isocyanic acid, polymethylenepolyphenylene ester |
| 116439260 | Isocyanic acid, polymethylenepolyphenylene ester |
| 120528463 | Isocyanic acid, polymethylenepolyphenylene ester |
| 120797377 | Isocyanic acid, polymethylenepolyphenylene ester |
| 129406026 | Isocyanic acid, polymethylenepolyphenylene ester |
| 133686814 | Isocyanic acid, polymethylenepolyphenylene ester |
| 137397934 | Isocyanic acid, polymethylenepolyphenylene ester |
| 138069644 | Isocyanic acid, polymethylenepolyphenylene ester |
| 141255789 | Isocyanic acid, polymethylenepolyphenylene ester |
| 143476942 | Isocyanic acid, polymethylenepolyphenylene ester |
| 147445258 | Isocyanic acid, polymethylenepolyphenylene ester |
| 153190024 | Isocyanic acid, polymethylenepolyphenylene ester |
| 154102111 | Isocyanic acid, polymethylenepolyphenylene ester |
| 154609093 | Isocyanic acid, polymethylenepolyphenylene ester |
| 154766264 | Isocyanic acid, polymethylenepolyphenylene ester |
| 160477361 | Isocyanic acid, polymethylenepolyphenylene ester |
| 162355206 | Isocyanic acid, polymethylenepolyphenylene ester |
| 162628811 | Isocyanic acid, polymethylenepolyphenylene ester |
| 172826969 | Isocyanic acid, polymethylenepolyphenylene ester |
| 178464283 | Isocyanic acid, polymethylenepolyphenylene ester |
| 183563248 | Isocyanic acid, polymethylenepolyphenylene ester |
| 184539091 | Isocyanic acid, polymethylenepolyphenylene ester |
| 203743048 | Isocyanic acid, polymethylenepolyphenylene ester |
| 203944483 | Isocyanic acid, polymethylenepolyphenylene ester |
| 208196650 | Isocyanic acid, polymethylenepolyphenylene ester |
| 209252368 | Isocyanic acid, polymethylenepolyphenylene ester |
| 211991832 | Isocyanic acid, polymethylenepolyphenylene ester |
| 212569272 | Isocyanic acid, polymethylenepolyphenylene ester |
| 219753205 | Isocyanic acid, polymethylenepolyphenylene ester |
| 283603338 | Isocyanic acid, polymethylenepolyphenylene ester |
| 300852588 | Isocyanic acid, polymethylenepolyphenylene ester |
| 315680138 | Isocyanic acid, polymethylenepolyphenylene ester |
| 379692850 | Isocyanic acid, polymethylenepolyphenylene ester |
| 478809084 | Isocyanic acid, polymethylenepolyphenylene ester |
| 484655096 | Isocyanic acid, polymethylenepolyphenylene ester |
| 612824052 | Isocyanic acid, polymethylenepolyphenylene ester |
| 667447281 | Isocyanic acid, polymethylenepolyphenylene ester |
| 875453933 | Isocyanic acid, polymethylenepolyphenylene ester |
| 912469295 | Isocyanic acid, polymethylenepolyphenylene ester |
| 913174251 | Isocyanic acid, polymethylenepolyphenylene ester |
| 1228530764 | Isocyanic acid, polymethylenepolyphenylene ester |
| 1342796193 | Isocyanic acid, polymethylenepolyphenylene ester |
| 1352205754 | Isocyanic acid, polymethylenepolyphenylene ester |
| 1422250405 | Isocyanic acid, polymethylenepolyphenylene ester |
| 12758520 | Isodecanol |
| 25339177 | Isodecanol |
| 50973085 | Isodecanol |
| 1281998 | Isooctane |
| 11070056 | Isooctane |
| 26635643 | Isooctane |
| 1341419 | Isooctanol |
| 8031467 | Isooctanol |
| 26952216 | Isooctanol |
| 61256 | Isoquinoline, 1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxy-, hydrochloride (1:1) |
| 8001206 | Kerosine (petroleum) |
| 8008206 | Kerosine (petroleum) |
| 50815004 | Kerosine (petroleum) |
| 55465935 | Kerosine (petroleum) |
| 63241543 | Kerosine (petroleum) |
| 111941107 | Kerosine (petroleum) |
| 13983272 | Krypton, isotope of mass 85 |
| 70226027 | Kwik Seal |
| 50817 | L-Ascorbic acid |
| 14536175 | L-Ascorbic acid |
| 30208618 | L-Ascorbic acid |
| 50976755 | L-Ascorbic acid |
| 56172555 | L-Ascorbic acid |
| 56533052 | L-Ascorbic acid |
| 57304742 | L-Ascorbic acid |
| 57606403 | L-Ascorbic acid |
| 88845265 | L-Ascorbic acid |
| 89924696 | L-Ascorbic acid |
| 129940972 | L-Ascorbic acid |
| 154170908 | L-Ascorbic acid |
| 259133783 | L-Ascorbic acid |
| 623158952 | L-Ascorbic acid |
| 882690917 | L-Ascorbic acid |
| 884381695 | L-Ascorbic acid |
| 885512243 | L-Ascorbic acid |
| 1018124032 | L-Ascorbic acid |
| 2757906 | L-Glutamic acid, 5-[2-[4-(hydroxymethyl)phenyl]hydrazide] |
| 528745 | L-Glutamic acid, N-[3,5-dichloro-4-[[(2,4-diamino-6-pteridinyl)methyl]methylamino]benzoyl]- |
| 54626 | L-Glutamic acid, N-[4-[[(2,4-diamino-6-pteridinyl)methyl]amino]benzoyl]- |
| 64801554 | L-Glutamic acid, N-[4-[[(2,4-diamino-6-pteridinyl)methyl]amino]benzoyl]- |
| 120382787 | L-Glutamic acid, N-[4-[[(2,4-diamino-6-pteridinyl)methyl]amino]benzoyl]- |
| 59052 | L-Glutamic acid, N-[4-[[(2,4-diamino-6-pteridinyl)methyl]methylamino]benzoyl]- |
| 1082707843 | L-Glutamic acid, N-[4-[[(2,4-diamino-6-pteridinyl)methyl]methylamino]benzoyl]- |
| 3054362 | L-Glutamic acid, compd. with L-arginine (1:1) |
| 4320303 | L-Glutamic acid, compd. with L-arginine (1:1) |
| 91250270 | L-Glutamic acid, compd. with L-arginine (1:1) |
| 94601782 | L-Glutamic acid, compd. with L-arginine (1:1) |
| 142472 | L-Glutamic acid, sodium salt (1:1) |
| 51959412 | L-Glutamic acid, sodium salt (1:1) |
| 56974540 | L-Glutamic acid, sodium salt (1:1) |
| 116268418 | L-Glutamic acid, sodium salt (1:1) |
| 59518 | L-Methionine |
| 63683 | L-Methionine |
| 7005187 | L-Methionine |
| 24425783 | L-Methionine |
| 1437870988 | L-Methionine |
| 1463481017 | L-Methionine |
| 1463481062 | L-Methionine |
| 1463481153 | L-Methionine |
| 1463481197 | L-Methionine |
| 1463481233 | L-Methionine |
| 1463481277 | L-Methionine |
| 1463481313 | L-Methionine |
| 1463481379 | L-Methionine |
| 1463481415 | L-Methionine |
| 1463481460 | L-Methionine |
| 1463481517 | L-Methionine |
| 1463481584 | L-Methionine |
| 1463481733 | L-Methionine |
| 1463481802 | L-Methionine |
| 1463481891 | L-Methionine |
| 1463610754 | L-Methionine |
| 1463610765 | L-Methionine |
| 1466415575 | L-Methionine |
| 63912 | L-Phenylalanine |
| 3617445 | L-Phenylalanine |
| 5297029 | L-Phenylalanine |
| 10549094 | L-Phenylalanine |
| 67675336 | L-Phenylalanine |
| 801204115 | L-Phenylalanine |
| 148823 | L-Phenylalanine, 4-[bis(2-chloroethyl)amino]- |
| 8057258 | L-Phenylalanine, 4-[bis(2-chloroethyl)amino]- |
| 303479 | L-Phenylalanine, N-[[(3R)-5-chloro-3,4-dihydro-8-hydroxy-3-methyl-1-oxo-1H-2-benzopyran-7-yl]carbonyl]- |
| 115026 | L-Serine, diazoacetate (ester) |
| 438493222 | L-Serine, diazoacetate (ester) |
| 73223 | L-Tryptophan |
| 6912863 | L-Tryptophan |
| 80206300 | L-Tryptophan |
| 154635355 | L-Tryptophan |
| 56699 | L-Tryptophan, 5-hydroxy- |
| 4350098 | L-Tryptophan, 5-hydroxy- |
| 34953849 | L-Tryptophan, 5-hydroxy- |
| 1228817955 | L-Tryptophan, 5-hydroxy- |
| 555306 | L-Tyrosine, 3-hydroxy-.alpha.-methyl- |
| 779088 | L-Tyrosine, 3-hydroxy-.alpha.-methyl- |
| 1339759 | L-Tyrosine, 3-hydroxy-.alpha.-methyl- |
| 4290088 | L-Tyrosine, 3-hydroxy-.alpha.-methyl- |
| 88620568 | L-Tyrosine, 3-hydroxy-.alpha.-methyl- |
| 133161543 | L-Tyrosine, 3-hydroxy-.alpha.-methyl- |
| 7439910 | Lanthanum |
| 14762711 | Lanthanum |
| 110123483 | Lanthanum |
| 881842020 | Lanthanum |
| 13981287 | Lanthanum, isotope of mass 140 |
| 7439921 | Lead |
| 724427661 | Lead |
| 1308298 | Lead chromate oxide (Pb2(CrO4)O) |
| 18454121 | Lead chromate oxide (Pb2(CrO4)O) |
| 1323950282 | Lead chromate oxide (Pb2(CrO4)O) |
| 1335257 | Lead oxide |
| 469906250 | Lead oxide |
| 1309597 | Lead oxide (PbO) |
| 1317368 | Lead oxide (PbO) |
| 12359238 | Lead oxide (PbO) |
| 1309600 | Lead oxide (PbO2) |
| 60525544 | Lead oxide (PbO2) |
| 301075 | Lead, bis(N,N-dimethylcarbamodithioato-.kappa.S,.kappa.S')-, (T-4)- |
| 19010663 | Lead, bis(N,N-dimethylcarbamodithioato-.kappa.S,.kappa.S')-, (T-4)- |
| 1335326 | Lead, bis(acetato-.kappa.O)tetrahydroxytri- |
| 14687253 | Lead, isotope of mass 203 |
| 14255040 | Lead, isotope of mass 210 |
| 15092941 | Lead, isotope of mass 212 |
| 15067284 | Lead, isotope of mass 214 |
| 68131986 | Leather, scrap |
| 68424679 | Leather, scrap |
| 8062155 | Lignosulfonic acid |
| 58318459 | Lignosulfonic acid |
| 92680767 | Lignosulfonic acid |
| 1222186642 | Lignosulfonic acid |
| 8061516 | Lignosulfonic acid, sodium salt |
| 8077007 | Lignosulfonic acid, sodium salt |
| 9009750 | Lignosulfonic acid, sodium salt |
| 39392671 | Lignosulfonic acid, sodium salt |
| 53241331 | Lignosulfonic acid, sodium salt |
| 54511090 | Lignosulfonic acid, sodium salt |
| 57308175 | Lignosulfonic acid, sodium salt |
| 57308197 | Lignosulfonic acid, sodium salt |
| 58252372 | Lignosulfonic acid, sodium salt |
| 69913082 | Lignosulfonic acid, sodium salt |
| 70620303 | Lignosulfonic acid, sodium salt |
| 71124419 | Lignosulfonic acid, sodium salt |
| 89800419 | Lignosulfonic acid, sodium salt |
| 91728062 | Lignosulfonic acid, sodium salt |
| 94766037 | Lignosulfonic acid, sodium salt |
| 102188954 | Lignosulfonic acid, sodium salt |
| 112938995 | Lignosulfonic acid, sodium salt |
| 118367854 | Lignosulfonic acid, sodium salt |
| 122178103 | Lignosulfonic acid, sodium salt |
| 122784490 | Lignosulfonic acid, sodium salt |
| 172672592 | Lignosulfonic acid, sodium salt |
| 218433411 | Lignosulfonic acid, sodium salt |
| 290349154 | Lignosulfonic acid, sodium salt |
| 913371194 | Lignosulfonic acid, sodium salt |
| 8030306 | Ligroine |
| 8031069 | Ligroine |
| 8032324 | Ligroine |
| 7439932 | Lithium |
| 7782890 | Lithium amide (Li(NH2)) |
| 12135170 | Lithium amide (Li(NH2)) |
| 7550358 | Lithium bromide (LiBr) |
| 14644350 | Lithium bromide (LiBr) |
| 59217628 | Lithium bromide (LiBr) |
| 128084720 | Lithium bromide (LiBr) |
| 7447418 | Lithium chloride (LiCl) |
| 404596801 | Lithium chloride (LiCl) |
| 1220508633 | Lithium chloride (LiCl) |
| 1309791761 | Lithium chloride (LiCl) |
| 7789244 | Lithium fluoride (LiF) |
| 12285653 | Lithium fluoride (LiF) |
| 40619189 | Lithium fluoride (LiF) |
| 64975457 | Lithium fluoride (LiF) |
| 7580678 | Lithium hydride (LiH) |
| 64975424 | Lithium hydride (LiH) |
| 159577727 | Lithium hydride (LiH) |
| 1310652 | Lithium hydroxide (Li(OH)) |
| 55622305 | Lithium hydroxide (Li(OH)) |
| 10377512 | Lithium iodide (LiI) |
| 59216976 | Lithium iodide (LiI) |
| 12057248 | Lithium oxide (Li2O) |
| 37382391 | Lithium oxide (Li2O) |
| 216588679 | Lithium oxide (Li2O) |
| 1492921126 | Lithium oxide (Li2O) |
| 70514124 | Lubricating oils, used |
| 14265759 | Lutetium, isotope of mass 177 |
| 7439954 | Magnesium |
| 14147081 | Magnesium |
| 67208780 | Magnesium |
| 199281204 | Magnesium |
| 298688489 | Magnesium |
| 7786303 | Magnesium chloride (MgCl2) |
| 12285346 | Magnesium chloride (MgCl2) |
| 77069228 | Magnesium chloride (MgCl2) |
| 1122625868 | Magnesium chloride (MgCl2) |
| 7783406 | Magnesium fluoride (MgF2) |
| 1309484 | Magnesium oxide (MgO) |
| 1309488 | Magnesium oxide (MgO) |
| 13589167 | Magnesium oxide (MgO) |
| 52933730 | Magnesium oxide (MgO) |
| 82375777 | Magnesium oxide (MgO) |
| 185461910 | Magnesium oxide (MgO) |
| 187036802 | Magnesium oxide (MgO) |
| 227961491 | Magnesium oxide (MgO) |
| 1193320896 | Magnesium oxide (MgO) |
| 519620 | Magnesium, [(2E,7R,11R)-3,7,11,15-tetramethyl-2-hexadecenyl (3S,4S,21R)-9-ethenyl-14-ethyl-13-formyl-21-(methoxycarbonyl)-4,8,18-trimethyl-20-oxo-3-phorbinepropanoato(2-)-.kappa.N23,.kappa.N24,.kappa.N25,.kappa.N26]-, (SP-4-2)- |
| 16103803 | Magnesium, [(2E,7R,11R)-3,7,11,15-tetramethyl-2-hexadecenyl (3S,4S,21R)-9-ethenyl-14-ethyl-13-formyl-21-(methoxycarbonyl)-4,8,18-trimethyl-20-oxo-3-phorbinepropanoato(2-)-.kappa.N23,.kappa.N24,.kappa.N25,.kappa.N26]-, (SP-4-2)- |
| 22088171 | Magnesium, [(2E,7R,11R)-3,7,11,15-tetramethyl-2-hexadecenyl (3S,4S,21R)-9-ethenyl-14-ethyl-13-formyl-21-(methoxycarbonyl)-4,8,18-trimethyl-20-oxo-3-phorbinepropanoato(2-)-.kappa.N23,.kappa.N24,.kappa.N25,.kappa.N26]-, (SP-4-2)- |
| 479618 | Magnesium, [(2E,7R,11R)-3,7,11,15-tetramethyl-2-hexadecenyl (3S,4S,21R)-9-ethenyl-14-ethyl-21-(methoxycarbonyl)-4,8,13,18-tetramethyl-20-oxo-3-phorbinepropanoato(2-)-.kappa.N23,.kappa.N24,.kappa.N25,.kappa.N26]-, (SP-4-2)- |
| 1407416 | Magnesium, [(2E,7R,11R)-3,7,11,15-tetramethyl-2-hexadecenyl (3S,4S,21R)-9-ethenyl-14-ethyl-21-(methoxycarbonyl)-4,8,13,18-tetramethyl-20-oxo-3-phorbinepropanoato(2-)-.kappa.N23,.kappa.N24,.kappa.N25,.kappa.N26]-, (SP-4-2)- |
| 10579949 | Magnesium, [(2E,7R,11R)-3,7,11,15-tetramethyl-2-hexadecenyl (3S,4S,21R)-9-ethenyl-14-ethyl-21-(methoxycarbonyl)-4,8,13,18-tetramethyl-20-oxo-3-phorbinepropanoato(2-)-.kappa.N23,.kappa.N24,.kappa.N25,.kappa.N26]-, (SP-4-2)- |
| 11012218 | Magnesium, [(2E,7R,11R)-3,7,11,15-tetramethyl-2-hexadecenyl (3S,4S,21R)-9-ethenyl-14-ethyl-21-(methoxycarbonyl)-4,8,13,18-tetramethyl-20-oxo-3-phorbinepropanoato(2-)-.kappa.N23,.kappa.N24,.kappa.N25,.kappa.N26]-, (SP-4-2)- |
| 22088091 | Magnesium, [(2E,7R,11R)-3,7,11,15-tetramethyl-2-hexadecenyl (3S,4S,21R)-9-ethenyl-14-ethyl-21-(methoxycarbonyl)-4,8,13,18-tetramethyl-20-oxo-3-phorbinepropanoato(2-)-.kappa.N23,.kappa.N24,.kappa.N25,.kappa.N26]-, (SP-4-2)- |
| 23389175 | Magnesium, [(2E,7R,11R)-3,7,11,15-tetramethyl-2-hexadecenyl (3S,4S,21R)-9-ethenyl-14-ethyl-21-(methoxycarbonyl)-4,8,13,18-tetramethyl-20-oxo-3-phorbinepropanoato(2-)-.kappa.N23,.kappa.N24,.kappa.N25,.kappa.N26]-, (SP-4-2)- |
| 7439965 | Manganese |
| 8031401 | Manganese |
| 8075396 | Manganese |
| 17375029 | Manganese |
| 39303065 | Manganese |
| 195161785 | Manganese |
| 8064140 | Manganese alloy, base, Mn 74-82,Fe 8-19,C 6.9-7.5,Si 0-1.2,P 0-0.4 (ASTM A99) |
| 12604534 | Manganese alloy, base, Mn 74-82,Fe 8-19,C 6.9-7.5,Si 0-1.2,P 0-0.4 (ASTM A99) |
| 37188300 | Manganese alloy, base, Mn 74-82,Fe 8-19,C 6.9-7.5,Si 0-1.2,P 0-0.4 (ASTM A99) |
| 52966957 | Manganese alloy, base, Mn 74-82,Fe 8-19,C 6.9-7.5,Si 0-1.2,P 0-0.4 (ASTM A99) |
| 7439965 | Manganese compounds |
| 1317346 | Manganese oxide (Mn2O3) |
| 39432478 | Manganese oxide (Mn2O3) |
| 1317357 | Manganese oxide (Mn3O4) |
| 339311307 | Manganese oxide (Mn3O4) |
| 1313139 | Manganese oxide (MnO2) |
| 301678046 | Manganese oxide (MnO2) |
| 1363198042 | Manganese oxide (MnO2) |
| 301031 | Manganese, [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']- |
| 11004492 | Manganese, [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']- |
| 12125336 | Manganese, [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']- |
| 12427382 | Manganese, [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']- |
| 20316067 | Manganese, [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']- |
| 28355568 | Manganese, [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']- |
| 133317063 | Manganese, [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']- |
| 1338870 | Manganese, [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']-, mixt. with [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']zinc |
| 2234562 | Manganese, [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']-, mixt. with [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']zinc |
| 8018017 | Manganese, [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']-, mixt. with [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']zinc |
| 8064366 | Manganese, [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']-, mixt. with [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']zinc |
| 8065676 | Manganese, [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']-, mixt. with [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']zinc |
| 8065950 | Manganese, [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']-, mixt. with [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']zinc |
| 8069510 | Manganese, [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']-, mixt. with [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']zinc |
| 12001342 | Manganese, [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']-, mixt. with [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']zinc |
| 12656698 | Manganese, [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']-, mixt. with [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']zinc |
| 14376546 | Manganese, [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']-, mixt. with [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']zinc |
| 39432694 | Manganese, [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']-, mixt. with [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']zinc |
| 56532435 | Manganese, [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']-, mixt. with [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']zinc |
| 62712145 | Manganese, [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']-, mixt. with [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']zinc |
| 67071607 | Manganese, [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']-, mixt. with [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']zinc |
| 75789547 | Manganese, [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']-, mixt. with [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']zinc |
| 84070122 | Manganese, [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']-, mixt. with [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']zinc |
| 172672412 | Manganese, [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']-, mixt. with [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']zinc |
| 6379471 | Manganese, bis(dimethylcarbamodithioato-.kappa.S,.kappa.S')-, (T-4)- |
| 7786336 | Manganese, bis(dimethylcarbamodithioato-.kappa.S,.kappa.S')-, (T-4)- |
| 10198455 | Manganese, bis(dimethylcarbamodithioato-.kappa.S,.kappa.S')-, (T-4)- |
| 15339363 | Manganese, bis(dimethylcarbamodithioato-.kappa.S,.kappa.S')-, (T-4)- |
| 60226962 | Manganese, bis(dimethylcarbamodithioato-.kappa.S,.kappa.S')-, (T-4)- |
| 13966319 | Manganese, isotope of mass 54 |
| 12079651 | Manganese, tricarbonyl(.eta.5-2,4-cyclopentadien-1-yl)- |
| 12108133 | Manganese, tricarbonyl[(1,2,3,4,5-.eta.)-1-methyl-2,4-cyclopentadien-1-yl]- |
| 41536429 | Manganese, tricarbonyl[(1,2,3,4,5-.eta.)-1-methyl-2,4-cyclopentadien-1-yl]- |
| 69658 | Mannitol |
| 87785 | Mannitol |
| 133437 | Mannitol |
| 5149406 | Mannitol |
| 36413613 | Mannitol |
| 54648 | Mercurate(1-), ethyl[2-(mercapto-.kappa.S)benzoato(2-)-.kappa.O]-, sodium (1:1) |
| 2141277 | Mercurate(1-), ethyl[2-(mercapto-.kappa.S)benzoato(2-)-.kappa.O]-, sodium (1:1) |
| 8030328 | Mercurate(1-), ethyl[2-(mercapto-.kappa.S)benzoato(2-)-.kappa.O]-, sodium (1:1) |
| 8030339 | Mercurate(1-), ethyl[2-(mercapto-.kappa.S)benzoato(2-)-.kappa.O]-, sodium (1:1) |
| 11004812 | Mercurate(1-), ethyl[2-(mercapto-.kappa.S)benzoato(2-)-.kappa.O]-, sodium (1:1) |
| 23065352 | Mercurate(1-), ethyl[2-(mercapto-.kappa.S)benzoato(2-)-.kappa.O]-, sodium (1:1) |
| 25948509 | Mercurate(1-), ethyl[2-(mercapto-.kappa.S)benzoato(2-)-.kappa.O]-, sodium (1:1) |
| 77536619 | Mercurate(1-), ethyl[2-(mercapto-.kappa.S)benzoato(2-)-.kappa.O]-, sodium (1:1) |
| 113170857 | Mercurate(1-), ethyl[2-(mercapto-.kappa.S)benzoato(2-)-.kappa.O]-, sodium (1:1) |
| 130995492 | Mercurate(1-), ethyl[2-(mercapto-.kappa.S)benzoato(2-)-.kappa.O]-, sodium (1:1) |
| 362653085 | Mercurate(1-), ethyl[2-(mercapto-.kappa.S)benzoato(2-)-.kappa.O]-, sodium (1:1) |
| 878791130 | Mercurate(1-), ethyl[2-(mercapto-.kappa.S)benzoato(2-)-.kappa.O]-, sodium (1:1) |
| 7439976 | Mercury |
| 8030646 | Mercury |
| 8031274 | Mercury |
| 51887479 | Mercury |
| 92355345 | Mercury |
| 92786624 | Mercury |
| 123720036 | Mercury |
| 149038915 | Mercury |
| 7487947 | Mercury chloride (HgCl2) |
| 1344452 | Mercury oxide (HgO) |
| 8028340 | Mercury oxide (HgO) |
| 21908532 | Mercury oxide (HgO) |
| 22967926 | Mercury(1+), methyl- |
| 62384 | Mercury, (acetato-.kappa.O)phenyl- |
| 1337060 | Mercury, (acetato-.kappa.O)phenyl- |
| 7487947 | Mercury, (acetato-.kappa.O)phenyl- |
| 7775099 | Mercury, (acetato-.kappa.O)phenyl- |
| 8013476 | Mercury, (acetato-.kappa.O)phenyl- |
| 61840457 | Mercury, (acetato-.kappa.O)phenyl- |
| 64684453 | Mercury, (acetato-.kappa.O)phenyl- |
| 73588735 | Mercury, (acetato-.kappa.O)phenyl- |
| 112415595 | Mercury, (acetato-.kappa.O)phenyl- |
| 151382 | Mercury, (acetato?.kappa.O)(2?methoxyethyl)- |
| 12798322 | Mercury, (acetato?.kappa.O)(2?methoxyethyl)- |
| 502396 | Mercury, (cyanoguanidinato-.kappa.N')methyl- |
| 12542904 | Mercury, (cyanoguanidinato-.kappa.N')methyl- |
| 28519246 | Mercury, (cyanoguanidinato-.kappa.N')methyl- |
| 55685 | Mercury, (nitrato-.kappa.O)phenyl- |
| 628864 | Mercury, bis(fulminato-.kappa.C)- |
| 20820455 | Mercury, bis(fulminato-.kappa.C)- |
| 42240200 | Mercury, bis(fulminato-.kappa.C)- |
| 92114960 | Mercury, bis(fulminato-.kappa.C)- |
| 123886 | Mercury, chloro(2-methoxyethyl)- |
| 115093 | Mercury, chloromethyl- |
| 143362 | Mercury, chloromethyl- |
| 1184572 | Mercury, hydroxymethyl- |
| 8012144 | Metaphosphoric acid (H6P6O18), sodium salt (1:6) |
| 10124568 | Metaphosphoric acid (H6P6O18), sodium salt (1:6) |
| 16210450 | Metaphosphoric acid (H6P6O18), sodium salt (1:6) |
| 20517559 | Metaphosphoric acid (H6P6O18), sodium salt (1:6) |
| 193678443 | Metaphosphoric acid (H6P6O18), sodium salt (1:6) |
| 1357387917 | Metaphosphoric acid (H6P6O18), sodium salt (1:6) |
| 74895 | Methanamine |
| 42939708 | Methanamine |
| 85404177 | Methanamine |
| 119775096 | Methanamine |
| 1391413981 | Methanamine |
| 75503 | Methanamine, N,N-dimethyl- |
| 4558127 | Methanamine, N,N-dimethyl- |
| 124403 | Methanamine, N-methyl- |
| 62759 | Methanamine, N-methyl-N-nitroso- |
| 95476 | Methanamine, N-methyl-N-nitroso- |
| 75592 | Methanaminium, N,N,N-trimethyl-, hydroxide (1:1) |
| 78017875 | Methanaminium, N,N,N-trimethyl-, hydroxide (1:1) |
| 93615680 | Methanaminium, N,N,N-trimethyl-, hydroxide (1:1) |
| 104422119 | Methanaminium, N,N,N-trimethyl-, hydroxide (1:1) |
| 105468357 | Methanaminium, N,N,N-trimethyl-, hydroxide (1:1) |
| 117277880 | Methanaminium, N,N,N-trimethyl-, hydroxide (1:1) |
| 123626971 | Methanaminium, N,N,N-trimethyl-, hydroxide (1:1) |
| 129653914 | Methanaminium, N,N,N-trimethyl-, hydroxide (1:1) |
| 129654611 | Methanaminium, N,N,N-trimethyl-, hydroxide (1:1) |
| 143549795 | Methanaminium, N,N,N-trimethyl-, hydroxide (1:1) |
| 154636596 | Methanaminium, N,N,N-trimethyl-, hydroxide (1:1) |
| 195460174 | Methanaminium, N,N,N-trimethyl-, hydroxide (1:1) |
| 950683291 | Methanaminium, N,N,N-trimethyl-, hydroxide (1:1) |
| 1239135842 | Methanaminium, N,N,N-trimethyl-, hydroxide (1:1) |
| 510134 | Methanaminium, N-[4-[[4-(dimethylamino)phenyl]phenylmethylene]-2,5-cyclohexadien-1-ylidene]-N-methyl-, chloride (1:1) |
| 569642 | Methanaminium, N-[4-[[4-(dimethylamino)phenyl]phenylmethylene]-2,5-cyclohexadien-1-ylidene]-N-methyl-, chloride (1:1) |
| 596642 | Methanaminium, N-[4-[[4-(dimethylamino)phenyl]phenylmethylene]-2,5-cyclohexadien-1-ylidene]-N-methyl-, chloride (1:1) |
| 8004873 | Methanaminium, N-[4-[[4-(dimethylamino)phenyl]phenylmethylene]-2,5-cyclohexadien-1-ylidene]-N-methyl-, chloride (1:1) |
| 55172504 | Methanaminium, N-[4-[[4-(dimethylamino)phenyl]phenylmethylene]-2,5-cyclohexadien-1-ylidene]-N-methyl-, chloride (1:1) |
| 548629 | Methanaminium, N-[4-[bis[4-(dimethylamino)phenyl]methylene]-2,5-cyclohexadien-1-ylidene]-N-methyl-, chloride (1:1) |
| 7077318 | Methanaminium, N-[4-[bis[4-(dimethylamino)phenyl]methylene]-2,5-cyclohexadien-1-ylidene]-N-methyl-, chloride (1:1) |
| 8004873 | Methanaminium, N-[4-[bis[4-(dimethylamino)phenyl]methylene]-2,5-cyclohexadien-1-ylidene]-N-methyl-, chloride (1:1) |
| 23355477 | Methanaminium, N-[4-[bis[4-(dimethylamino)phenyl]methylene]-2,5-cyclohexadien-1-ylidene]-N-methyl-, chloride (1:1) |
| 74828 | Methane |
| 131452567 | Methane |
| 115106 | Methane, 1,1'-oxybis- |
| 157621619 | Methane, 1,1'-oxybis- |
| 451449675 | Methane, 1,1'-oxybis- |
| 542881 | Methane, 1,1'-oxybis[1-chloro- |
| 67685 | Methane, 1,1'-sulfinylbis- |
| 8070539 | Methane, 1,1'-sulfinylbis- |
| 164071414 | Methane, 1,1'-sulfinylbis- |
| 705301219 | Methane, 1,1'-sulfinylbis- |
| 3064708 | Methane, 1,1'-sulfonylbis[1,1,1-trichloro- |
| 75183 | Methane, 1,1'-thiobis- |
| 956465013 | Methane, 1,1'-thiobis- |
| 74839 | Methane, bromo- |
| 74795 | Methane, bromochloro- |
| 74975 | Methane, bromochloro- |
| 83847498 | Methane, bromochloro- |
| 353593 | Methane, bromochlorodifluoro- |
| 421012 | Methane, bromochlorodifluoro- |
| 11104737 | Methane, bromochlorodifluoro- |
| 75274 | Methane, bromodichloro- |
| 75638 | Methane, bromotrifluoro- |
| 62395259 | Methane, bromotrifluoro- |
| 1452383173 | Methane, bromotrifluoro- |
| 74873 | Methane, chloro- |
| 75456 | Methane, chlorodifluoro- |
| 25497294 | Methane, chlorodifluoro- |
| 73666770 | Methane, chlorodifluoro- |
| 134191961 | Methane, chlorodifluoro- |
| 191542015 | Methane, chlorodifluoro- |
| 593704 | Methane, chlorofluoro- |
| 107302 | Methane, chloromethoxy- |
| 75729 | Methane, chlorotrifluoro- |
| 185009432 | Methane, chlorotrifluoro- |
| 334883 | Methane, diazo- |
| 463605 | Methane, diazo- |
| 16835997 | Methane, diazo- |
| 62024162 | Methane, diazo- |
| 74953 | Methane, dibromo- |
| 106914 | Methane, dibromo- |
| 124481 | Methane, dibromochloro- |
| 594183 | Methane, dibromodichloro- |
| 75616 | Methane, dibromodifluoro- |
| 75092 | Methane, dichloro- |
| 75718 | Methane, dichlorodifluoro- |
| 62185711 | Methane, dichlorodifluoro- |
| 185009396 | Methane, dichlorodifluoro- |
| 1256919171 | Methane, dichlorodifluoro- |
| 75434 | Methane, dichlorofluoro- |
| 39289286 | Methane, dichlorofluoro- |
| 594047 | Methane, dichloroiodo- |
| 75105 | Methane, difluoro- |
| 75116 | Methane, diiodo- |
| 103883814 | Methane, diiodo- |
| 109375 | Methane, dimethoxy- |
| 109875 | Methane, dimethoxy- |
| 74884 | Methane, iodo- |
| 147937073 | Methane, iodo- |
| 624839 | Methane, isocyanato- |
| 593759 | Methane, isocyano- |
| 556616 | Methane, isothiocyanato- |
| 75525 | Methane, nitro- |
| 104306481 | Methane, nitro- |
| 558134 | Methane, tetrabromo- |
| 56235 | Methane, tetrachloro- |
| 75730 | Methane, tetrafluoro- |
| 509148 | Methane, tetranitro- |
| 75252 | Methane, tribromo- |
| 464108 | Methane, tribromonitro- |
| 57578 | Methane, trichloro- |
| 67663 | Methane, trichloro- |
| 8013545 | Methane, trichloro- |
| 75694 | Methane, trichlorofluoro- |
| 62185700 | Methane, trichlorofluoro- |
| 79620410 | Methane, trichlorofluoro- |
| 83589406 | Methane, trichlorofluoro- |
| 91315616 | Methane, trichlorofluoro- |
| 76062 | Methane, trichloronitro- |
| 75478 | Methane, triiodo- |
| 149735 | Methane, trimethoxy- |
| 251301356 | Methane, trimethoxy- |
| 32488509 | Methane-13C, tetrachloro- |
| 3149744 | Methane-d2, bromochloro- |
| 1665005 | Methane-d2, dichloro- |
| 75707 | Methanesulfenyl chloride, trichloro- |
| 594423 | Methanesulfenyl chloride, trichloro- |
| 20434917 | Methanesulfenyl chloride, trichloro- |
| 344328672 | Methanesulfenyl chloride, trichloro- |
| 75752 | Methanesulfonic acid |
| 44209645 | Methanesulfonic acid |
| 44209725 | Methanesulfonic acid |
| 62203241 | Methanesulfonic acid |
| 87128903 | Methanesulfonic acid |
| 98527298 | Methanesulfonic acid |
| 115449984 | Methanesulfonic acid |
| 125756914 | Methanesulfonic acid |
| 1129867340 | Methanesulfonic acid |
| 333277 | Methanesulfonic acid, 1,1,1-trifluoro-, methyl ester |
| 62500 | Methanesulfonic acid, ethyl ester |
| 101946081 | Methanesulfonic acid, ethyl ester |
| 126318 | Methanesulfonic acid, iodo-, sodium salt |
| 66273 | Methanesulfonic acid, methyl ester |
| 74921 | Methanethiol |
| 74931 | Methanethiol |
| 74941 | Methanethiol |
| 63933471 | Methanethiol |
| 505027725 | Methanethiol |
| 75707 | Methanethiol, trichloro- |
| 594423 | Methanethiol, trichloro- |
| 409314701 | Methanethiol, trichloro- |
| 33089611 | Methanimidamide, N'-(2,4-dimethylphenyl)-N-[[(2,4-dimethylphenyl)imino]methyl]-N-methyl- |
| 6164983 | Methanimidamide, N'-(4-chloro-2-methylphenyl)-N,N-dimethyl- |
| 17702577 | Methanimidamide, N,N-dimethyl-N'-[2-methyl-4-[[(methylamino)carbonyl]oxy]phenyl]- |
| 29811265 | Methanimidamide, N,N-dimethyl-N'-[2-methyl-4-[[(methylamino)carbonyl]oxy]phenyl]- |
| 18413177 | Methanimidamide, N,N-dimethyl-N'-[3-[[(methylamino)carbonyl]oxy]phenyl]-, hydrochloride (1:1) |
| 23422539 | Methanimidamide, N,N-dimethyl-N'-[3-[[(methylamino)carbonyl]oxy]phenyl]-, hydrochloride (1:1) |
| 26445738 | Methanimidamide, N,N-dimethyl-N'-[3-[[(methylamino)carbonyl]oxy]phenyl]-, hydrochloride (1:1) |
| 67561 | Methanol |
| 54841713 | Methanol |
| 1173023830 | Methanol |
| 592621 | Methanol, (methyl-ONN-azoxy)-, acetate (ester) |
| 131533 | Methanone, (2-hydroxy-4-methoxyphenyl)(2-hydroxyphenyl)- |
| 186100798 | Methanone, (2-hydroxy-4-methoxyphenyl)(2-hydroxyphenyl)- |
| 131577 | Methanone, (2-hydroxy-4-methoxyphenyl)phenyl- |
| 14375372 | Methanone, (2-hydroxy-4-methoxyphenyl)phenyl- |
| 58392157 | Methanone, (2-hydroxy-4-methoxyphenyl)phenyl- |
| 58392226 | Methanone, (2-hydroxy-4-methoxyphenyl)phenyl- |
| 138464230 | Methanone, (2-hydroxy-4-methoxyphenyl)phenyl- |
| 153859735 | Methanone, (2-hydroxy-4-methoxyphenyl)phenyl- |
| 897050189 | Methanone, (2-hydroxy-4-methoxyphenyl)phenyl- |
| 90948 | Methanone, bis[4-(dimethylamino)phenyl]- |
| 119619 | Methanone, diphenyl- |
| 852361036 | Methanone, diphenyl- |
| 9006422 | Metiram |
| 12001262 | Mica-group minerals |
| 12003382 | Mica-group minerals |
| 53112508 | Mica-group minerals |
| 56902411 | Mica-group minerals |
| 65589459 | Mica-group minerals |
| 66814582 | Mica-group minerals |
| 66814593 | Mica-group minerals |
| 68859132 | Mica-group minerals |
| 69237338 | Mica-group minerals |
| 71587161 | Mica-group minerals |
| 361539608 | Mica-group minerals |
| 7631950 | Molybdate (MoO42-), sodium (1:2), (T-4)- |
| 14666912 | Molybdate (MoO42-), sodium (1:2), (T-4)- |
| 106463336 | Molybdate (MoO42-), sodium (1:2), (T-4)- |
| 1224508557 | Molybdate (MoO42-), sodium (1:2), (T-4)- |
| 1351977280 | Molybdate (MoO42-), sodium (1:2), (T-4)- |
| 7439987 | Molybdenum |
| 1313275 | Molybdenum oxide (MoO3) |
| 12412214 | Molybdenum oxide (MoO3) |
| 12412225 | Molybdenum oxide (MoO3) |
| 37376479 | Molybdenum oxide (MoO3) |
| 77835702 | Molybdenum oxide (MoO3) |
| 114316517 | Molybdenum oxide (MoO3) |
| 114663842 | Molybdenum oxide (MoO3) |
| 199790619 | Molybdenum oxide (MoO3) |
| 252368255 | Molybdenum oxide (MoO3) |
| 278186893 | Molybdenum oxide (MoO3) |
| 390388973 | Molybdenum oxide (MoO3) |
| 14119132 | Molybdenum, isotope of mass 93 |
| 14119154 | Molybdenum, isotope of mass 99 |
| 76573 | Morphinan-6-ol, 7,8-didehydro-4,5-epoxy-3-methoxy-17-methyl-, (5.alpha.,6.alpha.)- |
| 52288 | Morphinan-6-ol, 7,8-didehydro-4,5-epoxy-3-methoxy-17-methyl-, (5.alpha.,6.alpha.)-, phosphate (1:1) (salt) |
| 110918 | Morpholine |
| 1440615 | Morpholine |
| 88542818 | Morpholine |
| 96122951 | Morpholine |
| 99108562 | Morpholine |
| 147366312 | Morpholine |
| 854893202 | Morpholine |
| 141913 | Morpholine, 2,6-dimethyl- |
| 100743 | Morpholine, 4-ethyl- |
| 59892 | Morpholine, 4-nitroso- |
| 8030306 | Naphtha |
| 8030317 | Naphtha |
| 8032324 | Naphtha |
| 50813735 | Naphtha |
| 54847971 | Naphtha |
| 64475850 | Naphtha |
| 116010527 | Naphtha |
| 121448837 | Naphtha |
| 345960909 | Naphtha |
| 1217187524 | Naphtha |
| 64741419 | Naphtha (petroleum), heavy straight-run |
| 64741668 | Naphtha (petroleum), light alkylate |
| 91203 | Naphthalene |
| 72931454 | Naphthalene |
| 2234131 | Naphthalene, 1,2,3,4,5,6,7,8-octachloro- |
| 119642 | Naphthalene, 1,2,3,4-tetrahydro- |
| 523477 | Naphthalene, 1,2,4a,5,8,8a-hexahydro-4,7-dimethyl-1-(1-methylethyl)-, (1S,4aR,8aS)- |
| 606371 | Naphthalene, 1,3-dinitro- |
| 605710 | Naphthalene, 1,5-dinitro- |
| 602380 | Naphthalene, 1,8-dinitro- |
| 90131 | Naphthalene, 1-chloro- |
| 321380 | Naphthalene, 1-fluoro- |
| 551064 | Naphthalene, 1-isothiocyanato- |
| 90120 | Naphthalene, 1-methyl- |
| 86577 | Naphthalene, 1-nitro- |
| 91587 | Naphthalene, 2-chloro- |
| 939275 | Naphthalene, 2-ethyl- |
| 90120 | Naphthalene, 2-methyl- |
| 91576 | Naphthalene, 2-methyl- |
| 881038 | Naphthalene, 2-methyl-1-nitro- |
| 91178 | Naphthalene, decahydro- |
| 29350730 | Naphthalene, decahydro-1,6-dimethyl-4-(1-methylethyl)-, (1S,4S,4aS,6S,8aS)-, didehydro deriv. |
| 108910538 | Naphthalene, decahydro-1,6-dimethyl-4-(1-methylethyl)-, (1S,4S,4aS,6S,8aS)-, didehydro deriv. |
| 25551284 | Naphthalene, diisocyanato- |
| 39394451 | Naphthalene, diisocyanato- |
| 1335939 | Naphthalene, dimethyl- |
| 27457314 | Naphthalene, dimethyl- |
| 28804888 | Naphthalene, dimethyl- |
| 65338047 | Naphthalene, dimethyl- |
| 65338081 | Naphthalene, dimethyl- |
| 1335871 | Naphthalene, hexachloro- |
| 30402165 | Naphthalene, hexachloro- |
| 1321944 | Naphthalene, methyl- |
| 1321648 | Naphthalene, pentachloro- |
| 1335882 | Naphthalene, tetrachloro- |
| 1321659 | Naphthalene, trichloro- |
| 1338245 | Naphthenic acids |
| 51806612 | Naphthenic acids, cobalt salts |
| 61789513 | Naphthenic acids, cobalt salts |
| 161279658 | Naphthenic acids, cobalt salts |
| 20020024 | Napthalene, 1,2,3,4-tetrachloro- |
| 26761455 | Neodecanoic acid, 2-oxiranylmethyl ester |
| 14269740 | Neodymium, isotope of mass 147 |
| 39409455 | Neptune Blue |
| 7440020 | Nickel |
| 7440022 | Nickel |
| 8049318 | Nickel |
| 17375041 | Nickel |
| 39303463 | Nickel |
| 53527814 | Nickel |
| 112084170 | Nickel |
| 134631462 | Nickel |
| 195161843 | Nickel |
| 623574572 | Nickel |
| 1250376705 | Nickel |
| 1250376738 | Nickel |
| 1262528313 | Nickel |
| 1437722774 | Nickel |
| 1437723062 | Nickel |
| 1437723368 | Nickel |
| 12612554 | Nickel carbonyl (Ni(CO)4), (T-4)- |
| 13005317 | Nickel carbonyl (Ni(CO)4), (T-4)- |
| 13463393 | Nickel carbonyl (Ni(CO)4), (T-4)- |
| 14875957 | Nickel carbonyl (Ni(CO)4), (T-4)- |
| 36252605 | Nickel carbonyl (Ni(CO)4), (T-4)- |
| 42126465 | Nickel carbonyl (Ni(CO)4), (T-4)- |
| 71327123 | Nickel carbonyl (Ni(CO)4), (T-4)- |
| 848779180 | Nickel carbonyl (Ni(CO)4), (T-4)- |
| 7718549 | Nickel chloride (NiCl2) |
| 7440020 | Nickel compounds |
| 557197 | Nickel cyanide (Ni(CN)2) |
| 99601920 | Nickel cyanide (Ni(CN)2) |
| 99601931 | Nickel cyanide (Ni(CN)2) |
| 1314063 | Nickel oxide (Ni2O3) |
| 34875542 | Nickel oxide (Ni2O3) |
| 164144916 | Nickel oxide (Ni2O3) |
| 203212673 | Nickel oxide (Ni2O3) |
| 1313991 | Nickel oxide (NiO) |
| 185461965 | Nickel oxide (NiO) |
| 203645174 | Nickel oxide (NiO) |
| 339311410 | Nickel oxide (NiO) |
| 12035368 | Nickel oxide (NiO2) |
| 12035722 | Nickel sulfide (Ni3S2) |
| 22965602 | Nickel, [N,N-bis[(carboxy-.kappa.O)methyl]glycinato(3-)-.kappa.N,.kappa.O]- |
| 1295358 | Nickel, bis[(1,2,5,6-.eta.)-1,5-cyclooctadiene]- |
| 14336700 | Nickel, isotope of mass 59 |
| 13981378 | Nickel, isotope of mass 63 |
| 34831033 | Nickelate(1-), [N,N-bis[(carboxy-.kappa.O)methyl]glycinato(3-)-.kappa.N,.kappa.O]-, hydrogen (1:1), (T-4)- |
| 1271289 | Nickelocene |
| 51269444 | Nickelocene |
| 1080518917 | Nickelocene |
| 7440031 | Niobium |
| 26842137 | Niobium |
| 13967765 | Niobium, isotope of mass 95 |
| 14797558 | Nitrate |
| 23746181 | Nitrate |
| 34236356 | Nitrate |
| 73394839 | Nitrate |
| 84145824 | Nitrate |
| 7697372 | Nitric acid |
| 78989432 | Nitric acid |
| 218625708 | Nitric acid |
| 802862595 | Nitric acid |
| 1053657183 | Nitric acid |
| 1173016700 | Nitric acid |
| 1431325802 | Nitric acid |
| 6484522 | Nitric acid ammonium salt (1:1) |
| 7783202 | Nitric acid ammonium salt (1:1) |
| 95255406 | Nitric acid ammonium salt (1:1) |
| 893438761 | Nitric acid ammonium salt (1:1) |
| 7761888 | Nitric acid silver(1+) salt (1:1) |
| 8012122 | Nitric acid silver(1+) salt (1:1) |
| 31890207 | Nitric acid silver(1+) salt (1:1) |
| 7631994 | Nitric acid sodium salt (1:1) |
| 862599222 | Nitric acid sodium salt (1:1) |
| 1401517041 | Nitric acid sodium salt (1:1) |
| 13473900 | Nitric acid, aluminum salt (3:1) |
| 25295243 | Nitric acid, aluminum salt (3:1) |
| 220685698 | Nitric acid, aluminum salt (3:1) |
| 1313195435 | Nitric acid, aluminum salt (3:1) |
| 1469908915 | Nitric acid, aluminum salt (3:1) |
| 13597994 | Nitric acid, beryllium salt (2:1) |
| 10124375 | Nitric acid, calcium salt (2:1) |
| 56532059 | Nitric acid, calcium salt (2:1) |
| 94079751 | Nitric acid, calcium salt (2:1) |
| 95680754 | Nitric acid, calcium salt (2:1) |
| 260792083 | Nitric acid, calcium salt (2:1) |
| 292135478 | Nitric acid, calcium salt (2:1) |
| 13548384 | Nitric acid, chromium(3+) salt (3:1) |
| 20249212 | Nitric acid, chromium(3+) salt (3:1) |
| 10026229 | Nitric acid, cobalt(2+) salt, hexahydrate |
| 13494901 | Nitric acid, gallium salt (3:1) |
| 27425770 | Nitric acid, gallium salt (3:1) |
| 33836974 | Nitric acid, gallium salt (3:1) |
| 39394166 | Nitric acid, gallium salt (3:1) |
| 10277437 | Nitric acid, lanthanum(3+) salt, hexahydrate |
| 7790694 | Nitric acid, lithium salt (1:1) |
| 1314087121 | Nitric acid, lithium salt (1:1) |
| 10377603 | Nitric acid, magnesium salt (2:1) |
| 50908844 | Nitric acid, magnesium salt (2:1) |
| 627134 | Nitric acid, propyl ester |
| 10102451 | Nitric acid, thallium(1+) salt (1:1) |
| 10102440 | Nitrite |
| 12183969 | Nitrite |
| 14797558 | Nitrite |
| 14797650 | Nitrite |
| 114466534 | Nitrite |
| 7664417 | Nitrogen |
| 7727379 | Nitrogen |
| 93037139 | Nitrogen |
| 156457453 | Nitrogen |
| 161728274 | Nitrogen |
| 263005658 | Nitrogen |
| 745765075 | Nitrogen |
| 778548564 | Nitrogen |
| 794449540 | Nitrogen |
| 882528565 | Nitrogen |
| 951778248 | Nitrogen |
| 1119449410 | Nitrogen |
| 1384252827 | Nitrogen |
| 7783542 | Nitrogen fluoride (NF3) |
| 7727379 | Nitrogen oxide |
| 11104931 | Nitrogen oxide |
| 11129694 | Nitrogen oxide |
| 10024972 | Nitrogen oxide (N2O) |
| 126386650 | Nitrogen oxide (N2O) |
| 129451496 | Nitrogen oxide (N2O) |
| 130835711 | Nitrogen oxide (N2O) |
| 147527079 | Nitrogen oxide (N2O) |
| 175876445 | Nitrogen oxide (N2O) |
| 794457855 | Nitrogen oxide (N2O) |
| 847968132 | Nitrogen oxide (N2O) |
| 850203008 | Nitrogen oxide (N2O) |
| 10102440 | Nitrogen oxide (N2O4) |
| 10544726 | Nitrogen oxide (N2O4) |
| 1220110473 | Nitrogen oxide (N2O4) |
| 10102439 | Nitrogen oxide (NO) |
| 51005200 | Nitrogen oxide (NO) |
| 51005211 | Nitrogen oxide (NO) |
| 53851197 | Nitrogen oxide (NO) |
| 90452292 | Nitrogen oxide (NO) |
| 10102440 | Nitrogen oxide (NO2) |
| 50443931 | Nitrogen oxide (NO2) |
| 56003839 | Nitrogen oxide (NO2) |
| 66252286 | Nitrogen oxide (NO2) |
| 78246056 | Nitrogen oxide (NO2) |
| 119990113 | Nitrogen oxide (NO2) |
| 127999626 | Nitrogen oxide (NO2) |
| 542563 | Nitrous acid, 2-methylpropyl ester |
| 110463 | Nitrous acid, 3-methylbutyl ester |
| 463047 | Nitrous acid, 3-methylbutyl ester |
| 109955 | Nitrous acid, ethyl ester |
| 8013589 | Nitrous acid, ethyl ester |
| 463047 | Nitrous acid, pentyl ester |
| 7632000 | Nitrous acid, sodium salt (1:1) |
| 32863153 | Nitrous acid, sodium salt (1:1) |
| 56227204 | Nitrous acid, sodium salt (1:1) |
| 82497436 | Nitrous acid, sodium salt (1:1) |
| 82998401 | Nitrous acid, sodium salt (1:1) |
| 629925 | Nonadecane |
| 124196 | Nonanal |
| 918959883 | Nonanal |
| 111842 | Nonane |
| 875820943 | Nonane |
| 630024 | Octacosane |
| 593453 | Octadecane |
| 57114 | Octadecanoic acid |
| 8013283 | Octadecanoic acid |
| 8023061 | Octadecanoic acid |
| 8037409 | Octadecanoic acid |
| 8037830 | Octadecanoic acid |
| 8039518 | Octadecanoic acid |
| 8039529 | Octadecanoic acid |
| 8039530 | Octadecanoic acid |
| 8039541 | Octadecanoic acid |
| 39390619 | Octadecanoic acid |
| 58392668 | Octadecanoic acid |
| 82497276 | Octadecanoic acid |
| 134503336 | Octadecanoic acid |
| 197923107 | Octadecanoic acid |
| 294203079 | Octadecanoic acid |
| 294203159 | Octadecanoic acid |
| 1245726946 | Octadecanoic acid |
| 5829481 | Octadecanoic acid, 9,10-dichloro- |
| 31135634 | Octadecanoic acid, 9,10-dichloro- |
| 637127 | Octadecanoic acid, aluminum salt (3:1) |
| 65324358 | Octadecanoic acid, aluminum salt (3:1) |
| 2223930 | Octadecanoic acid, cadmium salt (2:1) |
| 4568289 | Octadecanoic acid, compd. with 2,2',2''-nitrilotris[ethanol] (1:1) |
| 557051 | Octadecanoic acid, zinc salt (2:1) |
| 8028873 | Octadecanoic acid, zinc salt (2:1) |
| 72535558 | Octadecanoic acid, zinc salt (2:1) |
| 124130 | Octanal |
| 111659 | Octane |
| 31372915 | Octane |
| 629823 | Octane, 1,1'-oxybis- |
| 1166299586 | Octane, 1,1'-oxybis- |
| 124072 | Octanoic acid |
| 3825261 | Octanoic acid, 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro-, ammonium salt (1:1) |
| 77751769 | Octanoic acid, 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro-, ammonium salt (1:1) |
| 95328997 | Octanoic acid, 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro-, ammonium salt (1:1) |
| 1689992 | Octanoic acid, 2,6-dibromo-4-cyanophenyl ester |
| 33964248 | Octanoic acid, 2,6-dibromo-4-cyanophenyl ester |
| 86702809 | Octanoic acid, 2,6-dibromo-4-cyanophenyl ester |
| 68916392 | Oils, Hamamelis virginiana |
| 8001283 | Oils, croton |
| 8024371 | Oils, curcuma |
| 1317711 | Olivine-group minerals |
| 7440042 | Osmium |
| 7446131 | Osmium oxide (OsO4), (T-4)- |
| 12060194 | Osmium oxide (OsO4), (T-4)- |
| 20816120 | Osmium oxide (OsO4), (T-4)- |
| 15766504 | Osmium, isotope of mass 185 |
| 14119245 | Osmium, isotope of mass 191 |
| 16057775 | Osmium, isotope of mass 193 |
| 503300 | Oxetane |
| 75218 | Oxirane |
| 19034083 | Oxirane |
| 37341052 | Oxirane |
| 99932759 | Oxirane |
| 142175324 | Oxirane |
| 184288322 | Oxirane |
| 436859788 | Oxirane |
| 2186245 | Oxirane, ((4-methylphenoxy)methyl)- |
| 26447143 | Oxirane, ((4-methylphenoxy)methyl)- |
| 5926909 | Oxirane, ((hexyloxy)methyl)- |
| 503093 | Oxirane, (fluoromethyl)- |
| 3083236 | Oxirane, (trichloromethyl)- |
| 1675543 | Oxirane, 2,2'-[(1-methylethylidene)bis(4,1-phenyleneoxymethylene)]bis- |
| 47424124 | Oxirane, 2,2'-[(1-methylethylidene)bis(4,1-phenyleneoxymethylene)]bis- |
| 64339511 | Oxirane, 2,2'-[(1-methylethylidene)bis(4,1-phenyleneoxymethylene)]bis- |
| 85101004 | Oxirane, 2,2'-[(1-methylethylidene)bis(4,1-phenyleneoxymethylene)]bis- |
| 116161207 | Oxirane, 2,2'-[(1-methylethylidene)bis(4,1-phenyleneoxymethylene)]bis- |
| 170962546 | Oxirane, 2,2'-[(1-methylethylidene)bis(4,1-phenyleneoxymethylene)]bis- |
| 220756605 | Oxirane, 2,2'-[(1-methylethylidene)bis(4,1-phenyleneoxymethylene)]bis- |
| 1018476179 | Oxirane, 2,2'-[(1-methylethylidene)bis(4,1-phenyleneoxymethylene)]bis- |
| 1226906553 | Oxirane, 2,2'-[(1-methylethylidene)bis(4,1-phenyleneoxymethylene)]bis- |
| 1253646320 | Oxirane, 2,2'-[(1-methylethylidene)bis(4,1-phenyleneoxymethylene)]bis- |
| 1416960741 | Oxirane, 2,2'-[(1-methylethylidene)bis(4,1-phenyleneoxymethylene)]bis- |
| 17557232 | Oxirane, 2,2'-[(2,2-dimethyl-1,3-propanediyl)bis(oxymethylene)]bis- |
| 101906 | Oxirane, 2,2'-[1,3-phenylenebis(oxymethylene)]bis- |
| 168331520 | Oxirane, 2,2'-[1,3-phenylenebis(oxymethylene)]bis- |
| 2425798 | Oxirane, 2,2'-[1,4-butanediylbis(oxymethylene)]bis- |
| 54350593 | Oxirane, 2,2'-[1,4-butanediylbis(oxymethylene)]bis- |
| 162786245 | Oxirane, 2,2'-[1,4-butanediylbis(oxymethylene)]bis- |
| 39817099 | Oxirane, 2,2'-[methylenebis(phenyleneoxymethylene)]bis- |
| 87110767 | Oxirane, 2,2'-[methylenebis(phenyleneoxymethylene)]bis- |
| 2238075 | Oxirane, 2,2'-[oxybis(methylene)]bis- |
| 186354950 | Oxirane, 2,2'-[oxybis(methylene)]bis- |
| 5076200 | Oxirane, 2,2,3,3-tetramethyl- |
| 428591 | Oxirane, 2,2,3-trifluoro-3-(trifluoromethyl)- |
| 75579383 | Oxirane, 2,2,3-trifluoro-3-(trifluoromethyl)- |
| 3583479 | Oxirane, 2,3-bis(chloromethyl)- |
| 3266237 | Oxirane, 2,3-dimethyl- |
| 3083258 | Oxirane, 2-(2,2,2-trichloroethyl)- |
| 3132647 | Oxirane, 2-(bromomethyl)- |
| 31324637 | Oxirane, 2-(bromomethyl)- |
| 82584734 | Oxirane, 2-(bromomethyl)- |
| 2426086 | Oxirane, 2-(butoxymethyl)- |
| 85858602 | Oxirane, 2-(butoxymethyl)- |
| 144376830 | Oxirane, 2-(butoxymethyl)- |
| 921213378 | Oxirane, 2-(butoxymethyl)- |
| 106898 | Oxirane, 2-(chloromethyl)- |
| 9009125 | Oxirane, 2-(chloromethyl)- |
| 13403377 | Oxirane, 2-(chloromethyl)- |
| 36250814 | Oxirane, 2-(chloromethyl)- |
| 109351748 | Oxirane, 2-(chloromethyl)- |
| 930370 | Oxirane, 2-(methoxymethyl)- |
| 126872182 | Oxirane, 2-(methoxymethyl)- |
| 122601 | Oxirane, 2-(phenoxymethyl)- |
| 66527933 | Oxirane, 2-(phenoxymethyl)- |
| 7665727 | Oxirane, 2-[(1,1-dimethylethoxy)methyl]- |
| 126753057 | Oxirane, 2-[(1,1-dimethylethoxy)methyl]- |
| 4016142 | Oxirane, 2-[(1-methylethoxy)methyl]- |
| 126753035 | Oxirane, 2-[(1-methylethoxy)methyl]- |
| 2210799 | Oxirane, 2-[(2-methylphenoxy)methyl]- |
| 80076455 | Oxirane, 2-[(2-methylphenoxy)methyl]- |
| 106293 | Oxirane, 2-[(2-propen-1-yloxy)methyl]- |
| 106923 | Oxirane, 2-[(2-propen-1-yloxy)methyl]- |
| 90907930 | Oxirane, 2-[(2-propen-1-yloxy)methyl]- |
| 112186068 | Oxirane, 2-[(2-propen-1-yloxy)methyl]- |
| 2461189 | Oxirane, 2-[(dodecyloxy)methyl]- |
| 60616935 | Oxirane, 2-[(dodecyloxy)methyl]- |
| 136959085 | Oxirane, 2-[(dodecyloxy)methyl]- |
| 2461156 | Oxirane, 2-[[(2-ethylhexyl)oxy]methyl]- |
| 98913532 | Oxirane, 2-[[(2-ethylhexyl)oxy]methyl]- |
| 102640368 | Oxirane, 2-[[(2-ethylhexyl)oxy]methyl]- |
| 145928912 | Oxirane, 2-[[(2-ethylhexyl)oxy]methyl]- |
| 388080793 | Oxirane, 2-[[(2-ethylhexyl)oxy]methyl]- |
| 845755342 | Oxirane, 2-[[(2-ethylhexyl)oxy]methyl]- |
| 3101608 | Oxirane, 2-[[4-(1,1-dimethylethyl)phenoxy]methyl]- |
| 71281679 | Oxirane, 2-[[4-(1,1-dimethylethyl)phenoxy]methyl]- |
| 99938815 | Oxirane, 2-[[4-(1,1-dimethylethyl)phenoxy]methyl]- |
| 124632413 | Oxirane, 2-[[4-(1,1-dimethylethyl)phenoxy]methyl]- |
| 128994014 | Oxirane, 2-[[4-(1,1-dimethylethyl)phenoxy]methyl]- |
| 260047367 | Oxirane, 2-[[4-(1,1-dimethylethyl)phenoxy]methyl]- |
| 877129425 | Oxirane, 2-[[4-(1,1-dimethylethyl)phenoxy]methyl]- |
| 61578049 | Oxirane, 2-[[4-(1-methyl-1-phenylethyl)phenoxy]methyl]- |
| 2855198 | Oxirane, 2-decyl- |
| 128900210 | Oxirane, 2-decyl- |
| 3234284 | Oxirane, 2-dodecyl- |
| 130321674 | Oxirane, 2-dodecyl- |
| 930223 | Oxirane, 2-ethenyl- |
| 22910583 | Oxirane, 2-ethenyl- |
| 88416313 | Oxirane, 2-ethenyl- |
| 106887 | Oxirane, 2-ethyl- |
| 26249207 | Oxirane, 2-ethyl- |
| 55555969 | Oxirane, 2-ethyl- |
| 7390810 | Oxirane, 2-hexadecyl- |
| 165323660 | Oxirane, 2-hexadecyl- |
| 75569 | Oxirane, 2-methyl- |
| 16033719 | Oxirane, 2-methyl- |
| 2404446 | Oxirane, 2-octyl- |
| 67210451 | Oxirane, 2-octyl- |
| 71077708 | Oxirane, 2-octyl- |
| 96093 | Oxirane, 2-phenyl- |
| 62497636 | Oxirane, 2-phenyl- |
| 67253490 | Oxirane, 2-phenyl- |
| 7320378 | Oxirane, 2-tetradecyl- |
| 151284105 | Oxirane, 2-tetradecyl- |
| 765344 | Oxiranecarboxaldehyde |
| 103729459 | Oxiranecarboxaldehyde |
| 2443392 | Oxiraneoctanoic acid, 3-octyl- |
| 52275146 | Oxiraneoctanoic acid, 3-octyl- |
| 54075762 | Oxonium, trimethyl-, (OC-6-11)-hexachloroantimonate(1-) (1:1) |
| 1338938 | Oxygen |
| 7782447 | Oxygen |
| 14797707 | Oxygen |
| 80217987 | Oxygen |
| 80937333 | Oxygen |
| 1053656931 | Oxygen |
| 1173018524 | Oxygen |
| 7783417 | Oxygen fluoride (OF2) |
| 10028156 | Ozone |
| 74087868 | Ozone |
| 412908408 | Ozone |
| 728855478 | Ozone |
| 855426801 | Ozone |
| 11104293 | PCB 1242 |
| 53449219 | PCB 1242 |
| 53469219 | PCB 1242 |
| 12672296 | PCB 1248 |
| 262371357 | PCB 1248 |
| 11097691 | PCB 1254 |
| 11096825 | PCB 1260 |
| 11196825 | PCB 1260 |
| 7440053 | Palladium |
| 7647101 | Palladium chloride (PdCl2) |
| 14967681 | Palladium, isotope of mass 103 |
| 17637999 | Palladium, isotope of mass 107 |
| 1337764 | Palygorskite ([Mg(Al0.5-1Fe0-0.5)]Si4(OH)O10.4H2O) |
| 12174117 | Palygorskite ([Mg(Al0.5-1Fe0-0.5)]Si4(OH)O10.4H2O) |
| 12174286 | Palygorskite ([Mg(Al0.5-1Fe0-0.5)]Si4(OH)O10.4H2O) |
| 37189507 | Palygorskite ([Mg(Al0.5-1Fe0-0.5)]Si4(OH)O10.4H2O) |
| 61180550 | Palygorskite ([Mg(Al0.5-1Fe0-0.5)]Si4(OH)O10.4H2O) |
| 64418162 | Palygorskite ([Mg(Al0.5-1Fe0-0.5)]Si4(OH)O10.4H2O) |
| 71396548 | Palygorskite ([Mg(Al0.5-1Fe0-0.5)]Si4(OH)O10.4H2O) |
| 137546919 | Palygorskite ([Mg(Al0.5-1Fe0-0.5)]Si4(OH)O10.4H2O) |
| 8012951 | Paraffin oil |
| 8015596 | Paraffin oil |
| 8033894 | Paraffin oil |
| 8038048 | Paraffin oil |
| 8039143 | Paraffin oil |
| 8039756 | Paraffin oil |
| 8043785 | Paraffin oil |
| 37231699 | Paraffin oil |
| 37232056 | Paraffin oil |
| 37232067 | Paraffin oil |
| 37232078 | Paraffin oil |
| 39290238 | Paraffin oil |
| 39296258 | Paraffin oil |
| 39355083 | Paraffin oil |
| 39355094 | Paraffin oil |
| 39355356 | Paraffin oil |
| 39464772 | Paraffin oil |
| 39464783 | Paraffin oil |
| 50935858 | Paraffin oil |
| 50935950 | Paraffin oil |
| 51004581 | Paraffin oil |
| 51109967 | Paraffin oil |
| 52012278 | Paraffin oil |
| 52012289 | Paraffin oil |
| 53028743 | Paraffin oil |
| 58391381 | Paraffin oil |
| 58615808 | Paraffin oil |
| 60327802 | Paraffin oil |
| 74870909 | Paraffin oil |
| 79956368 | Paraffin oil |
| 83046053 | Paraffin oil |
| 97048209 | Paraffin oil |
| 99551141 | Paraffin oil |
| 102819987 | Paraffin oil |
| 106803310 | Paraffin oil |
| 115251268 | Paraffin oil |
| 116357369 | Paraffin oil |
| 122176992 | Paraffin oil |
| 124448528 | Paraffin oil |
| 146908772 | Paraffin oil |
| 172307107 | Paraffin oil |
| 187112192 | Paraffin oil |
| 188832179 | Paraffin oil |
| 219686290 | Paraffin oil |
| 261380103 | Paraffin oil |
| 331464541 | Paraffin oil |
| 8002742 | Paraffin waxes and Hydrocarbon waxes |
| 8035629 | Paraffin waxes and Hydrocarbon waxes |
| 8044028 | Paraffin waxes and Hydrocarbon waxes |
| 8044799 | Paraffin waxes and Hydrocarbon waxes |
| 9083414 | Paraffin waxes and Hydrocarbon waxes |
| 12704915 | Paraffin waxes and Hydrocarbon waxes |
| 12704926 | Paraffin waxes and Hydrocarbon waxes |
| 12795754 | Paraffin waxes and Hydrocarbon waxes |
| 37220238 | Paraffin waxes and Hydrocarbon waxes |
| 37339803 | Paraffin waxes and Hydrocarbon waxes |
| 39355221 | Paraffin waxes and Hydrocarbon waxes |
| 39373789 | Paraffin waxes and Hydrocarbon waxes |
| 51331352 | Paraffin waxes and Hydrocarbon waxes |
| 54692421 | Paraffin waxes and Hydrocarbon waxes |
| 57572437 | Paraffin waxes and Hydrocarbon waxes |
| 57608841 | Paraffin waxes and Hydrocarbon waxes |
| 58057117 | Paraffin waxes and Hydrocarbon waxes |
| 68607089 | Paraffin waxes and Hydrocarbon waxes |
| 68649503 | Paraffin waxes and Hydrocarbon waxes |
| 70431264 | Paraffin waxes and Hydrocarbon waxes |
| 72993885 | Paraffin waxes and Hydrocarbon waxes |
| 72993896 | Paraffin waxes and Hydrocarbon waxes |
| 72993909 | Paraffin waxes and Hydrocarbon waxes |
| 105054931 | Paraffin waxes and Hydrocarbon waxes |
| 105845087 | Paraffin waxes and Hydrocarbon waxes |
| 115251235 | Paraffin waxes and Hydrocarbon waxes |
| 115251246 | Paraffin waxes and Hydrocarbon waxes |
| 160936345 | Paraffin waxes and Hydrocarbon waxes |
| 401516345 | Paraffin waxes and Hydrocarbon waxes |
| 8029398 | Paraffin waxes and Hydrocarbon waxes, chloro |
| 11098332 | Paraffin waxes and Hydrocarbon waxes, chloro |
| 37187409 | Paraffin waxes and Hydrocarbon waxes, chloro |
| 39279657 | Paraffin waxes and Hydrocarbon waxes, chloro |
| 39406092 | Paraffin waxes and Hydrocarbon waxes, chloro |
| 39444365 | Paraffin waxes and Hydrocarbon waxes, chloro |
| 50646907 | Paraffin waxes and Hydrocarbon waxes, chloro |
| 51990126 | Paraffin waxes and Hydrocarbon waxes, chloro |
| 52276525 | Paraffin waxes and Hydrocarbon waxes, chloro |
| 52555472 | Paraffin waxes and Hydrocarbon waxes, chloro |
| 52622669 | Paraffin waxes and Hydrocarbon waxes, chloro |
| 52677733 | Paraffin waxes and Hydrocarbon waxes, chloro |
| 52677744 | Paraffin waxes and Hydrocarbon waxes, chloro |
| 52677755 | Paraffin waxes and Hydrocarbon waxes, chloro |
| 53028594 | Paraffin waxes and Hydrocarbon waxes, chloro |
| 53028607 | Paraffin waxes and Hydrocarbon waxes, chloro |
| 53200354 | Paraffin waxes and Hydrocarbon waxes, chloro |
| 54577718 | Paraffin waxes and Hydrocarbon waxes, chloro |
| 55353509 | Paraffin waxes and Hydrocarbon waxes, chloro |
| 56509649 | Paraffin waxes and Hydrocarbon waxes, chloro |
| 56730951 | Paraffin waxes and Hydrocarbon waxes, chloro |
| 58516522 | Paraffin waxes and Hydrocarbon waxes, chloro |
| 60202644 | Paraffin waxes and Hydrocarbon waxes, chloro |
| 63449398 | Paraffin waxes and Hydrocarbon waxes, chloro |
| 66746358 | Paraffin waxes and Hydrocarbon waxes, chloro |
| 108171262 | Paraffin waxes and Hydrocarbon waxes, chloro |
| 108171273 | Paraffin waxes and Hydrocarbon waxes, chloro |
| 108688637 | Paraffin waxes and Hydrocarbon waxes, chloro |
| 1303975 | Pentaborane(9) |
| 19624227 | Pentaborane(9) |
| 24378367 | Pentaborane(9) |
| 24378378 | Pentaborane(9) |
| 24378389 | Pentaborane(9) |
| 52712659 | Pentaborane(9) |
| 64442815 | Pentaborane(9) |
| 71129914 | Pentaborane(9) |
| 629992 | Pentacosane |
| 629629 | Pentadecane |
| 110623 | Pentanal |
| 109660 | Pentane |
| 8031354 | Pentane |
| 111240 | Pentane, 1,5-dibromo- |
| 540841 | Pentane, 2,2,4-trimethyl- |
| 31921365 | Pentane, 2,2,4-trimethyl- |
| 565753 | Pentane, 2,3,4-trimethyl- |
| 565593 | Pentane, 2,3-dimethyl- |
| 108087 | Pentane, 2,4-dimethyl- |
| 625296 | Pentane, 2-chloro- |
| 125591313 | Pentane, 2-chloro- |
| 107835 | Pentane, 2-methyl- |
| 96140 | Pentane, 3-methyl- |
| 760214 | Pentane, 3-methylene- |
| 111308 | Pentanedial |
| 37245617 | Pentanedial |
| 79215579 | Pentanedial |
| 107950890 | Pentanedial |
| 1428979547 | Pentanedial |
| 35691657 | Pentanedinitrile, 2-bromo-2-(bromomethyl)- |
| 4553622 | Pentanedinitrile, 2-methyl- |
| 110598 | Pentanenitrile |
| 109524 | Pentanoic acid |
| 12124877 | Pentanoic acid |
| 14797730 | Perchlorate |
| 60349260 | Perchlorate |
| 181259574 | Perchlorate |
| 7616946 | Perchloryl fluoride ((ClO3)F) |
| 13862607 | Perchloryl fluoride ((ClO3)F) |
| 7722647 | Permanganic acid (HMnO4), potassium salt (1:1) |
| 13987014 | Permanganic acid (HMnO4), potassium salt (1:1) |
| 146104974 | Permanganic acid (HMnO4), potassium salt (1:1) |
| 23414724 | Permanganic acid (HMnO4), zinc salt |
| 78637 | Peroxide, 1,1'-(1,1,4,4-tetramethyl-1,4-butanediyl)bis[2-(1,1-dimethylethyl) |
| 64366729 | Peroxide, 1,1'-(1,1,4,4-tetramethyl-1,4-butanediyl)bis[2-(1,1-dimethylethyl) |
| 80237872 | Peroxide, 1,1'-(1,1,4,4-tetramethyl-1,4-butanediyl)bis[2-(1,1-dimethylethyl) |
| 105521593 | Peroxide, 1,1'-(1,1,4,4-tetramethyl-1,4-butanediyl)bis[2-(1,1-dimethylethyl) |
| 109603454 | Peroxide, 1,1'-(1,1,4,4-tetramethyl-1,4-butanediyl)bis[2-(1,1-dimethylethyl) |
| 118093188 | Peroxide, 1,1'-(1,1,4,4-tetramethyl-1,4-butanediyl)bis[2-(1,1-dimethylethyl) |
| 138427608 | Peroxide, 1,1'-(1,1,4,4-tetramethyl-1,4-butanediyl)bis[2-(1,1-dimethylethyl) |
| 139352388 | Peroxide, 1,1'-(1,1,4,4-tetramethyl-1,4-butanediyl)bis[2-(1,1-dimethylethyl) |
| 143637290 | Peroxide, 1,1'-(1,1,4,4-tetramethyl-1,4-butanediyl)bis[2-(1,1-dimethylethyl) |
| 158049628 | Peroxide, 1,1'-(1,1,4,4-tetramethyl-1,4-butanediyl)bis[2-(1,1-dimethylethyl) |
| 180513580 | Peroxide, 1,1'-(1,1,4,4-tetramethyl-1,4-butanediyl)bis[2-(1,1-dimethylethyl) |
| 184247210 | Peroxide, 1,1'-(1,1,4,4-tetramethyl-1,4-butanediyl)bis[2-(1,1-dimethylethyl) |
| 186467254 | Peroxide, 1,1'-(1,1,4,4-tetramethyl-1,4-butanediyl)bis[2-(1,1-dimethylethyl) |
| 860310583 | Peroxide, 1,1'-(1,1,4,4-tetramethyl-1,4-butanediyl)bis[2-(1,1-dimethylethyl) |
| 25155253 | Peroxide, 1,1'-[1,3(or 1,4)-phenylenebis(1-methylethylidene)]bis[2-(1,1-dimethylethyl) |
| 33296616 | Peroxide, 1,1'-[1,3(or 1,4)-phenylenebis(1-methylethylidene)]bis[2-(1,1-dimethylethyl) |
| 38783196 | Peroxide, 1,1'-[1,3(or 1,4)-phenylenebis(1-methylethylidene)]bis[2-(1,1-dimethylethyl) |
| 53801368 | Peroxide, 1,1'-[1,3(or 1,4)-phenylenebis(1-methylethylidene)]bis[2-(1,1-dimethylethyl) |
| 95974939 | Peroxide, 1,1'-[1,3(or 1,4)-phenylenebis(1-methylethylidene)]bis[2-(1,1-dimethylethyl) |
| 121535486 | Peroxide, 1,1'-[1,3(or 1,4)-phenylenebis(1-methylethylidene)]bis[2-(1,1-dimethylethyl) |
| 123203758 | Peroxide, 1,1'-[1,3(or 1,4)-phenylenebis(1-methylethylidene)]bis[2-(1,1-dimethylethyl) |
| 153859508 | Peroxide, 1,1'-[1,3(or 1,4)-phenylenebis(1-methylethylidene)]bis[2-(1,1-dimethylethyl) |
| 166090886 | Peroxide, 1,1'-[1,3(or 1,4)-phenylenebis(1-methylethylidene)]bis[2-(1,1-dimethylethyl) |
| 868236231 | Peroxide, 1,1'-[1,3(or 1,4)-phenylenebis(1-methylethylidene)]bis[2-(1,1-dimethylethyl) |
| 2278220 | Peroxide, acetyl nitro |
| 325458411 | Peroxide, acetyl nitro |
| 32368697 | Peroxide, benzoyl nitro |
| 110054 | Peroxide, bis(1,1-dimethylethyl) |
| 62534718 | Peroxide, bis(1,1-dimethylethyl) |
| 80433 | Peroxide, bis(1-methyl-1-phenylethyl) |
| 82322574 | Peroxide, bis(1-methyl-1-phenylethyl) |
| 88161120 | Peroxide, bis(1-methyl-1-phenylethyl) |
| 188070599 | Peroxide, bis(1-methyl-1-phenylethyl) |
| 209969799 | Peroxide, bis(1-methyl-1-phenylethyl) |
| 246180994 | Peroxide, bis(1-methyl-1-phenylethyl) |
| 478016943 | Peroxide, bis(1-methyl-1-phenylethyl) |
| 945614062 | Peroxide, bis(1-methyl-1-phenylethyl) |
| 94360 | Peroxide, dibenzoyl |
| 106934 | Peroxide, dibenzoyl |
| 37370299 | Peroxide, dibenzoyl |
| 117989716 | Peroxide, dibenzoyl |
| 132323445 | Peroxide, dibenzoyl |
| 143928589 | Peroxide, dibenzoyl |
| 7727540 | Peroxydisulfuric acid ([(HO)S(O)2]2O2), ammonium salt (1:2) |
| 7727541 | Peroxydisulfuric acid ([(HO)S(O)2]2O2), ammonium salt (1:2) |
| 398469959 | Peroxydisulfuric acid ([(HO)S(O)2]2O2), ammonium salt (1:2) |
| 7727211 | Peroxydisulfuric acid ([(HO)S(O)2]2O2), potassium salt (1:2) |
| 106015105 | Peroxydisulfuric acid ([(HO)S(O)2]2O2), potassium salt (1:2) |
| 1001387467 | Peroxydisulfuric acid ([(HO)S(O)2]2O2), potassium salt (1:2) |
| 7775271 | Peroxydisulfuric acid ([(HO)S(O)2]2O2), sodium salt (1:2) |
| 872981992 | Peroxydisulfuric acid ([(HO)S(O)2]2O2), sodium salt (1:2) |
| 8002059 | Petroleum |
| 61789955 | Petroleum |
| 8002059 | Petroleum distillates |
| 8030306 | Petroleum spirits |
| 8032324 | Petroleum spirits |
| 63394003 | Petroleum spirits |
| 64475850 | Petroleum spirits |
| 7329502 | Phen-2,4,6-d3-ol |
| 4165622 | Phen-d5-ol |
| 85018 | Phenanthrene |
| 483658 | Phenanthrene, 1-methyl-7-(1-methylethyl)- |
| 2531842 | Phenanthrene, 2-methyl- |
| 1517222 | Phenanthrene-d10 |
| 229878 | Phenanthridine |
| 71523 | Phenol |
| 108952 | Phenol |
| 8002071 | Phenol |
| 14534237 | Phenol |
| 50356257 | Phenol |
| 28777700 | Phenol, (1,1-dimethylethyl)-, phosphate |
| 1336318 | Phenol, (1,1-dimethylethyl)-4-methoxy- |
| 8003245 | Phenol, (1,1-dimethylethyl)-4-methoxy- |
| 8041814 | Phenol, (1,1-dimethylethyl)-4-methoxy- |
| 9009681 | Phenol, (1,1-dimethylethyl)-4-methoxy- |
| 25013165 | Phenol, (1,1-dimethylethyl)-4-methoxy- |
| 37349772 | Phenol, (1,1-dimethylethyl)-4-methoxy- |
| 56587667 | Phenol, (1,1-dimethylethyl)-4-methoxy- |
| 57534288 | Phenol, (1,1-dimethylethyl)-4-methoxy- |
| 26967760 | Phenol, (1-methylethyl)-, phosphate (3:1) |
| 70304 | Phenol, 2,2'-methylenebis[3,4,6-trichloro- |
| 8054986 | Phenol, 2,2'-methylenebis[3,4,6-trichloro- |
| 139411964 | Phenol, 2,2'-methylenebis[3,4,6-trichloro- |
| 1195388852 | Phenol, 2,2'-methylenebis[3,4,6-trichloro- |
| 97234 | Phenol, 2,2'-methylenebis[4-chloro- |
| 8017865 | Phenol, 2,2'-methylenebis[4-chloro- |
| 1135443661 | Phenol, 2,2'-methylenebis[4-chloro- |
| 97187 | Phenol, 2,2'-thiobis[4,6-dichloro- |
| 3294039 | Phenol, 2,2'-thiobis[4-(1,1,3,3-tetramethylbutyl)- |
| 33397238 | Phenol, 2,2'-thiobis[4-(1,1,3,3-tetramethylbutyl)- |
| 93487184 | Phenol, 2,2'-thiobis[4-(1,1,3,3-tetramethylbutyl)- |
| 97245 | Phenol, 2,2'-thiobis[4-chloro- |
| 74082965 | Phenol, 2,2'-thiobis[4-chloro- |
| 90664 | Phenol, 2,2'-thiobis[6-(1,1-dimethylethyl)-4-methyl- |
| 42612577 | Phenol, 2,2'-thiobis[6-(1,1-dimethylethyl)-4-methyl- |
| 209534214 | Phenol, 2,2'-thiobis[6-(1,1-dimethylethyl)-4-methyl- |
| 905570425 | Phenol, 2,2'-thiobis[6-(1,1-dimethylethyl)-4-methyl- |
| 608719 | Phenol, 2,3,4,5,6-pentabromo- |
| 87865 | Phenol, 2,3,4,5,6-pentachloro- |
| 39390777 | Phenol, 2,3,4,5,6-pentachloro- |
| 101802544 | Phenol, 2,3,4,5,6-pentachloro- |
| 1135443672 | Phenol, 2,3,4,5,6-pentachloro- |
| 131522 | Phenol, 2,3,4,5,6-pentachloro-, sodium salt (1:1) |
| 4901513 | Phenol, 2,3,4,5-tetrachloro- |
| 2539175 | Phenol, 2,3,4,5-tetrachloro-6-methoxy- |
| 58902 | Phenol, 2,3,4,6-tetrachloro- |
| 12698643 | Phenol, 2,3,4,6-tetrachloro- |
| 15950660 | Phenol, 2,3,4-trichloro- |
| 2668248 | Phenol, 2,3,4-trichloro-6-methoxy- |
| 12407862 | Phenol, 2,3,5(or 3,4,5)-trimethyl-, methylcarbamate |
| 37301454 | Phenol, 2,3,5(or 3,4,5)-trimethyl-, methylcarbamate |
| 58784137 | Phenol, 2,3,5(or 3,4,5)-trimethyl-, methylcarbamate |
| 935955 | Phenol, 2,3,5,6-tetrachloro- |
| 933788 | Phenol, 2,3,5-trichloro- |
| 2655154 | Phenol, 2,3,5-trimethyl-, methylcarbamate |
| 2686999 | Phenol, 2,3,5-trimethyl-, methylcarbamate |
| 933755 | Phenol, 2,3,6-trichloro- |
| 576249 | Phenol, 2,3-dichloro- |
| 526750 | Phenol, 2,3-dimethyl- |
| 95954 | Phenol, 2,4,5-trichloro- |
| 25167822 | Phenol, 2,4,5-trichloro- |
| 77001457 | Phenol, 2,4,5-trichloro- |
| 118796 | Phenol, 2,4,6-tribromo- |
| 88062 | Phenol, 2,4,6-trichloro- |
| 88891 | Phenol, 2,4,6-trinitro- |
| 29663114 | Phenol, 2,4,6-trinitro- |
| 189195399 | Phenol, 2,4,6-trinitro- |
| 190402109 | Phenol, 2,4,6-trinitro- |
| 856615639 | Phenol, 2,4,6-trinitro- |
| 856993130 | Phenol, 2,4,6-trinitro- |
| 857370424 | Phenol, 2,4,6-trinitro- |
| 131748 | Phenol, 2,4,6-trinitro-, ammonium salt (1:1) |
| 4041412 | Phenol, 2,4,6-trinitro-, ammonium salt (1:1) |
| 74893780 | Phenol, 2,4,6-trinitro-, ammonium salt (1:1) |
| 101671903 | Phenol, 2,4,6-trinitro-, ammonium salt (1:1) |
| 340127824 | Phenol, 2,4,6-trinitro-, ammonium salt (1:1) |
| 405108603 | Phenol, 2,4,6-trinitro-, ammonium salt (1:1) |
| 120956 | Phenol, 2,4-bis(1,1-dimethylpropyl)- |
| 137097 | Phenol, 2,4-diamino-, hydrochloride (1:2) |
| 64768349 | Phenol, 2,4-diamino-, hydrochloride (1:2) |
| 120832 | Phenol, 2,4-dichloro- |
| 105679 | Phenol, 2,4-dimethyl- |
| 130071 | Phenol, 2,4-dimethyl- |
| 51285 | Phenol, 2,4-dinitro- |
| 117271 | Phenol, 2,4-dinitro- |
| 583788 | Phenol, 2,5-dichloro- |
| 95874 | Phenol, 2,5-dimethyl- |
| 50356122 | Phenol, 2,5-dimethyl- |
| 145929313 | Phenol, 2,5-dimethyl- |
| 128370 | Phenol, 2,6-bis(1,1-dimethylethyl)-4-methyl- |
| 36631284 | Phenol, 2,6-bis(1,1-dimethylethyl)-4-methyl- |
| 42615305 | Phenol, 2,6-bis(1,1-dimethylethyl)-4-methyl- |
| 50356199 | Phenol, 2,6-bis(1,1-dimethylethyl)-4-methyl- |
| 50641991 | Phenol, 2,6-bis(1,1-dimethylethyl)-4-methyl- |
| 52683462 | Phenol, 2,6-bis(1,1-dimethylethyl)-4-methyl- |
| 53571703 | Phenol, 2,6-bis(1,1-dimethylethyl)-4-methyl- |
| 58500826 | Phenol, 2,6-bis(1,1-dimethylethyl)-4-methyl- |
| 83047169 | Phenol, 2,6-bis(1,1-dimethylethyl)-4-methyl- |
| 97123416 | Phenol, 2,6-bis(1,1-dimethylethyl)-4-methyl- |
| 102962458 | Phenol, 2,6-bis(1,1-dimethylethyl)-4-methyl- |
| 259752539 | Phenol, 2,6-bis(1,1-dimethylethyl)-4-methyl- |
| 290348231 | Phenol, 2,6-bis(1,1-dimethylethyl)-4-methyl- |
| 87650 | Phenol, 2,6-dichloro- |
| 305851 | Phenol, 2,6-diiodo-4-nitro- |
| 8026935 | Phenol, 2,6-diiodo-4-nitro- |
| 576261 | Phenol, 2,6-dimethyl- |
| 28449969 | Phenol, 2,6-dimethyl- |
| 50356224 | Phenol, 2,6-dimethyl- |
| 1363408621 | Phenol, 2,6-dimethyl- |
| 1420071 | Phenol, 2-(1,1-dimethylethyl)-4,6-dinitro- |
| 114261 | Phenol, 2-(1-methylethoxy)-, methylcarbamate |
| 3687227 | Phenol, 2-(1-methylheptyl)-4,6-dinitro- |
| 89725 | Phenol, 2-(1-methylpropyl)- |
| 28449958 | Phenol, 2-(1-methylpropyl)- |
| 96346155 | Phenol, 2-(1-methylpropyl)- |
| 88857 | Phenol, 2-(1-methylpropyl)-4,6-dinitro- |
| 2813958 | Phenol, 2-(1-methylpropyl)-4,6-dinitro- |
| 39403800 | Phenol, 2-(1-methylpropyl)-4,6-dinitro- |
| 152212209 | Phenol, 2-(1-methylpropyl)-4,6-dinitro- |
| 444304 | Phenol, 2-(trifluoromethyl)- |
| 6358232 | Phenol, 2-[(2,4-dinitrophenyl)amino]- |
| 4790710 | Phenol, 2-[(2-methyl-2-propen-1-yl)oxy]- |
| 52551674 | Phenol, 2-[bis(2-hydroxyethyl)amino]-5-nitro- |
| 95556 | Phenol, 2-amino- |
| 51194 | Phenol, 2-amino-, hydrochloride |
| 67845798 | Phenol, 2-amino-, sulfate (2:1) |
| 6358152 | Phenol, 2-amino-3,4,6-trichloro- |
| 527628 | Phenol, 2-amino-4,6-dichloro- |
| 96913 | Phenol, 2-amino-4,6-dinitro- |
| 98306 | Phenol, 2-amino-4-(methylsulfonyl)- |
| 95852 | Phenol, 2-amino-4-chloro- |
| 6358072 | Phenol, 2-amino-4-chloro-5-nitro- |
| 6358083 | Phenol, 2-amino-4-chloro-6-nitro- |
| 95841 | Phenol, 2-amino-4-methyl- |
| 99570 | Phenol, 2-amino-4-nitro- |
| 121880 | Phenol, 2-amino-5-nitro- |
| 95578 | Phenol, 2-chloro- |
| 5323659 | Phenol, 2-chloro-4-(1,1-dimethylpropyl)- |
| 131895 | Phenol, 2-cyclohexyl-4,6-dinitro- |
| 367124 | Phenol, 2-fluoro- |
| 811801340 | Phenol, 2-fluoro- |
| 90051 | Phenol, 2-methoxy- |
| 97541 | Phenol, 2-methoxy-4-(1-propen-1-yl)- |
| 97530 | Phenol, 2-methoxy-4-(2-propen-1-yl)- |
| 95487 | Phenol, 2-methyl- |
| 534521 | Phenol, 2-methyl-4,6-dinitro- |
| 8068733 | Phenol, 2-methyl-4,6-dinitro- |
| 8071510 | Phenol, 2-methyl-4,6-dinitro- |
| 37359436 | Phenol, 2-methyl-4,6-dinitro- |
| 53240952 | Phenol, 2-methyl-4,6-dinitro- |
| 534521 | Phenol, 2-methyl-4,6-dinitro- and salts |
| 1335859 | Phenol, 2-methyl-4,6-dinitro- and salts |
| 88755 | Phenol, 2-nitro- |
| 136834 | Phenol, 2-nonyl- |
| 609198 | Phenol, 3,4,5-trichloro- |
| 2539266 | Phenol, 3,4,5-trichloro-2,6-dimethoxy- |
| 57057837 | Phenol, 3,4,5-trichloro-2-methoxy- |
| 60712449 | Phenol, 3,4,6-trichloro-2-methoxy- |
| 82622 | Phenol, 3,4,6-trichloro-2-nitro- |
| 95772 | Phenol, 3,4-dichloro- |
| 95658 | Phenol, 3,4-dimethyl- |
| 591355 | Phenol, 3,5-dichloro- |
| 7379513 | Phenol, 3,5-dimethyl-4-(methylthio)- |
| 203657 | Phenol, 3,5-dimethyl-4-(methylthio)-, methylcarbamate |
| 716165 | Phenol, 3,5-dimethyl-4-(methylthio)-, methylcarbamate |
| 2032657 | Phenol, 3,5-dimethyl-4-(methylthio)-, methylcarbamate |
| 64006 | Phenol, 3-(1-methylethyl)-, methylcarbamate |
| 91689 | Phenol, 3-(diethylamino)- |
| 99070 | Phenol, 3-(dimethylamino)- |
| 119313 | Phenol, 3-(dimethylamino)-4-methyl- |
| 621318 | Phenol, 3-(ethylamino)- |
| 120376 | Phenol, 3-(ethylamino)-4-methyl- |
| 101188 | Phenol, 3-(phenylamino)- |
| 591275 | Phenol, 3-amino- |
| 2836002 | Phenol, 3-amino-4-methyl- |
| 108430 | Phenol, 3-chloro- |
| 108394 | Phenol, 3-methyl- |
| 3120749 | Phenol, 3-methyl-4-(methylthio)- |
| 2581342 | Phenol, 3-methyl-4-nitro- |
| 2631370 | Phenol, 3-methyl-5-(1-methylethyl)-, methylcarbamate |
| 4111891 | Phenol, 3-methyl-5-(1-methylethyl)-, methylcarbamate |
| 31677562 | Phenol, 3-methyl-5-(1-methylethyl)-, methylcarbamate |
| 554847 | Phenol, 3-nitro- |
| 84173 | Phenol, 4,4'-(1,2-diethylidene-1,2-ethanediyl)bis- |
| 39011864 | Phenol, 4,4'-(1-ethyl-2-ethylidene-1,2-ethanediyl)bis- |
| 80057 | Phenol, 4,4'-(1-methylethylidene)bis- |
| 27360890 | Phenol, 4,4'-(1-methylethylidene)bis- |
| 28106823 | Phenol, 4,4'-(1-methylethylidene)bis- |
| 37808085 | Phenol, 4,4'-(1-methylethylidene)bis- |
| 137885531 | Phenol, 4,4'-(1-methylethylidene)bis- |
| 146479756 | Phenol, 4,4'-(1-methylethylidene)bis- |
| 1429425262 | Phenol, 4,4'-(1-methylethylidene)bis- |
| 79947 | Phenol, 4,4'-(1-methylethylidene)bis[2,6-dibromo- |
| 7300234 | Phenol, 4,4'-(1-methylethylidene)bis[2,6-dibromo- |
| 30496130 | Phenol, 4,4'-(1-methylethylidene)bis[2,6-dibromo- |
| 51253317 | Phenol, 4,4'-(1-methylethylidene)bis[2,6-dibromo- |
| 76341269 | Phenol, 4,4'-(1-methylethylidene)bis[2,6-dibromo- |
| 107719551 | Phenol, 4,4'-(1-methylethylidene)bis[2,6-dibromo- |
| 108608602 | Phenol, 4,4'-(1-methylethylidene)bis[2,6-dibromo- |
| 110670650 | Phenol, 4,4'-(1-methylethylidene)bis[2,6-dibromo- |
| 124779540 | Phenol, 4,4'-(1-methylethylidene)bis[2,6-dibromo- |
| 131891388 | Phenol, 4,4'-(1-methylethylidene)bis[2,6-dibromo- |
| 186673392 | Phenol, 4,4'-(1-methylethylidene)bis[2,6-dibromo- |
| 224951262 | Phenol, 4,4'-(1-methylethylidene)bis[2,6-dibromo- |
| 56531 | Phenol, 4,4'-[(1E)-1,2-diethyl-1,2-ethenediyl]bis- |
| 8026457 | Phenol, 4,4'-[(1E)-1,2-diethyl-1,2-ethenediyl]bis- |
| 8028099 | Phenol, 4,4'-[(1E)-1,2-diethyl-1,2-ethenediyl]bis- |
| 8030340 | Phenol, 4,4'-[(1E)-1,2-diethyl-1,2-ethenediyl]bis- |
| 8049421 | Phenol, 4,4'-[(1E)-1,2-diethyl-1,2-ethenediyl]bis- |
| 8053007 | Phenol, 4,4'-[(1E)-1,2-diethyl-1,2-ethenediyl]bis- |
| 130803 | Phenol, 4,4'-[(1E)-1,2-diethyl-1,2-ethenediyl]bis-, dipropanoate |
| 85609 | Phenol, 4,4'-butylidenebis[2-(1,1-dimethylethyl)-5-methyl- |
| 60318196 | Phenol, 4,4'-butylidenebis[2-(1,1-dimethylethyl)-5-methyl- |
| 80693103 | Phenol, 4,4'-butylidenebis[2-(1,1-dimethylethyl)-5-methyl- |
| 87524309 | Phenol, 4,4'-butylidenebis[2-(1,1-dimethylethyl)-5-methyl- |
| 90651437 | Phenol, 4,4'-butylidenebis[2-(1,1-dimethylethyl)-5-methyl- |
| 99346891 | Phenol, 4,4'-butylidenebis[2-(1,1-dimethylethyl)-5-methyl- |
| 111214552 | Phenol, 4,4'-butylidenebis[2-(1,1-dimethylethyl)-5-methyl- |
| 153569643 | Phenol, 4,4'-butylidenebis[2-(1,1-dimethylethyl)-5-methyl- |
| 193362537 | Phenol, 4,4'-butylidenebis[2-(1,1-dimethylethyl)-5-methyl- |
| 210757736 | Phenol, 4,4'-butylidenebis[2-(1,1-dimethylethyl)-5-methyl- |
| 96695 | Phenol, 4,4'-thiobis[2-(1,1-dimethylethyl)-5-methyl- |
| 12671704 | Phenol, 4,4'-thiobis[2-(1,1-dimethylethyl)-5-methyl- |
| 52012530 | Phenol, 4,4'-thiobis[2-(1,1-dimethylethyl)-5-methyl- |
| 60318323 | Phenol, 4,4'-thiobis[2-(1,1-dimethylethyl)-5-methyl- |
| 76996606 | Phenol, 4,4'-thiobis[2-(1,1-dimethylethyl)-5-methyl- |
| 126340601 | Phenol, 4,4'-thiobis[2-(1,1-dimethylethyl)-5-methyl- |
| 188253476 | Phenol, 4,4'-thiobis[2-(1,1-dimethylethyl)-5-methyl- |
| 381726029 | Phenol, 4,4'-thiobis[2-(1,1-dimethylethyl)-5-methyl- |
| 3818540 | Phenol, 4,4'-thiobis[3-(1,1-dimethylethyl)-5-methyl- |
| 858831682 | Phenol, 4,4'-thiobis[3-(1,1-dimethylethyl)-5-methyl- |
| 98544 | Phenol, 4-(1,1-dimethylethyl)- |
| 1334243569 | Phenol, 4-(1,1-dimethylethyl)- |
| 80466 | Phenol, 4-(1,1-dimethylpropyl)- |
| 53404185 | Phenol, 4-(1,1-dimethylpropyl)-, potassium salt (1:1) |
| 93458 | Phenol, 4-(2-naphthalenylamino)- |
| 31584 | Phenol, 4-(dimethylamino)-3,5-dimethyl-, methylcarbamate (ester) |
| 315184 | Phenol, 4-(dimethylamino)-3,5-dimethyl-, methylcarbamate (ester) |
| 39373869 | Phenol, 4-(dimethylamino)-3,5-dimethyl-, methylcarbamate (ester) |
| 2032599 | Phenol, 4-(dimethylamino)-3-methyl-, methylcarbamate (ester) |
| 55550 | Phenol, 4-(methylamino)-, sulfate (2:1) |
| 160976136 | Phenol, 4-(methylamino)-, sulfate (2:1) |
| 119153 | Phenol, 4-[(2,4-dinitrophenyl)amino]- |
| 6219892 | Phenol, 4-[(4-amino-3-methylphenyl)amino]- |
| 123308 | Phenol, 4-amino- |
| 52985098 | Phenol, 4-amino- |
| 51785 | Phenol, 4-amino-, hydrochloride (1:1) |
| 63084980 | Phenol, 4-amino-, sulfate (2:1) |
| 119346 | Phenol, 4-amino-2-nitro- |
| 106489 | Phenol, 4-chloro- |
| 88879 | Phenol, 4-chloro-2,6-dinitro- |
| 120321 | Phenol, 4-chloro-2-(phenylmethyl)- |
| 8013498 | Phenol, 4-chloro-2-(phenylmethyl)- |
| 144246479 | Phenol, 4-chloro-2-(phenylmethyl)- |
| 35471499 | Phenol, 4-chloro-2-(phenylmethyl)-, potassium salt (1:1) |
| 6358185 | Phenol, 4-chloro-2-[(2,4-dinitrophenyl)amino]- |
| 1570645 | Phenol, 4-chloro-2-methyl- |
| 88040 | Phenol, 4-chloro-3,5-dimethyl- |
| 59507 | Phenol, 4-chloro-3-methyl- |
| 35421080 | Phenol, 4-chloro-3-methyl- |
| 54548504 | Phenol, 4-chloro-3-methyl- |
| 150765 | Phenol, 4-methoxy- |
| 106445 | Phenol, 4-methyl- |
| 41873749 | Phenol, 4-methyl- |
| 6265130 | Phenol, 4-methyl-3-(methylamino)- |
| 100027 | Phenol, 4-nitro- |
| 856824674 | Phenol, 4-nitro- |
| 856824710 | Phenol, 4-nitro- |
| 88302 | Phenol, 4-nitro-3-(trifluoromethyl)- |
| 104916 | Phenol, 4-nitroso- |
| 104405 | Phenol, 4-nonyl- |
| 29832119 | Phenol, 4-nonyl- |
| 84852153 | Phenol, 4-nonyl- |
| 6265094 | Phenol, 5-(diethylamino)-4-methyl-2-nitroso- |
| 6265118 | Phenol, 5-(dimethylamino)-4-methyl-2-nitroso- |
| 2835952 | Phenol, 5-amino-2-methyl- |
| 1336352 | Phenol, chloro derivs. |
| 1320816 | Phenol, chloro- |
| 25167800 | Phenol, chloro- |
| 25167811 | Phenol, dichloro- |
| 1300716 | Phenol, dimethyl- |
| 144700027 | Phenol, dimethyl- |
| 25155231 | Phenol, dimethyl-, 1,1',1''-phosphate |
| 95660610 | Phenol, dimethyl-, 1,1',1''-phosphate |
| 174956833 | Phenol, dimethyl-, 1,1',1''-phosphate |
| 68937406 | Phenol, isobutylenated, phosphate (3:1) |
| 68937417 | Phenol, isopropylated, phosphate (3:1) |
| 299865 | Phenol, methyl- |
| 1319773 | Phenol, methyl- |
| 8003336 | Phenol, methyl- |
| 8006620 | Phenol, methyl- |
| 8026946 | Phenol, methyl- |
| 8027165 | Phenol, methyl- |
| 52037475 | Phenol, methyl- |
| 116804252 | Phenol, methyl- |
| 1300169 | Phenol, nonyl- |
| 25154523 | Phenol, nonyl- |
| 84852153 | Phenol, nonyl- |
| 256459004 | Phenol, nonyl- |
| 67554501 | Phenol, octyl- |
| 25167822 | Phenol, trichloro- |
| 57057837 | Phenol, trichloro-2-methoxy- |
| 61966367 | Phenol, trichloro-2-methoxy- |
| 25953064 | Phenol,5-(diethylamino)-2-nitroso-, monohydrochloride |
| 13127883 | Phenol-d6 |
| 262204 | Phenoxathiin |
| 342950 | Phenylalanine, 2-[bis(2-chloroethyl)amino]- |
| 531760 | Phenylalanine, 4-[bis(2-chloroethyl)amino]- |
| 51650 | Phenylalanine, 4-fluoro- |
| 60173 | Phenylalanine, 4-fluoro- |
| 300641 | Phenylalanine, 4-fluoro- |
| 14265442 | Phosphate |
| 264888199 | Phosphate |
| 7803512 | Phosphine |
| 167076440 | Phosphine |
| 638211 | Phosphine, phenyl- |
| 603350 | Phosphine, triphenyl- |
| 112771478 | Phosphine, triphenyl- |
| 630403257 | Phosphine, triphenyl- |
| 1198579871 | Phosphine, triphenyl- |
| 52686 | Phosphonic acid, (2,2,2-trichloro-1-hydroxyethyl)-, dimethyl ester |
| 37333098 | Phosphonic acid, (2,2,2-trichloro-1-hydroxyethyl)-, dimethyl ester |
| 50924442 | Phosphonic acid, (2,2,2-trichloro-1-hydroxyethyl)-, dimethyl ester |
| 56042252 | Phosphonic acid, (2,2,2-trichloro-1-hydroxyethyl)-, dimethyl ester |
| 66758314 | Phosphonic acid, (2,2,2-trichloro-1-hydroxyethyl)-, dimethyl ester |
| 597251 | Phosphonic acid, 4-morpholinyl-, dimethyl ester |
| 1429501 | Phosphonic acid, P,P',P'',P'''-[1,2-ethanediylbis[nitrilobis(methylene)]]tetrakis- |
| 54579316 | Phosphonic acid, P,P',P'',P'''-[1,2-ethanediylbis[nitrilobis(methylene)]]tetrakis- |
| 66300263 | Phosphonic acid, P,P',P'',P'''-[1,2-ethanediylbis[nitrilobis(methylene)]]tetrakis- |
| 85497536 | Phosphonic acid, P,P',P'',P'''-[1,2-ethanediylbis[nitrilobis(methylene)]]tetrakis- |
| 103333762 | Phosphonic acid, P,P',P'',P'''-[1,2-ethanediylbis[nitrilobis(methylene)]]tetrakis- |
| 244775211 | Phosphonic acid, P,P',P'',P'''-[1,2-ethanediylbis[nitrilobis(methylene)]]tetrakis- |
| 68188965 | Phosphonic acid, P,P',P'',P'''-[1,2-ethanediylbis[nitrilobis(methylene)]]tetrakis-, potassium salt (1:4) |
| 15142968 | Phosphonic acid, P,P',P'',P'''-[1,2-ethanediylbis[nitrilobis(methylene)]]tetrakis-, sodium salt (1:6) |
| 15147969 | Phosphonic acid, P,P',P'',P'''-[1,2-ethanediylbis[nitrilobis(methylene)]]tetrakis-, sodium salt (1:6) |
| 2809214 | Phosphonic acid, P,P'-(1-hydroxyethylidene)bis- |
| 51888665 | Phosphonic acid, P,P'-(1-hydroxyethylidene)bis- |
| 66216986 | Phosphonic acid, P,P'-(1-hydroxyethylidene)bis- |
| 83047250 | Phosphonic acid, P,P'-(1-hydroxyethylidene)bis- |
| 85985268 | Phosphonic acid, P,P'-(1-hydroxyethylidene)bis- |
| 86159184 | Phosphonic acid, P,P'-(1-hydroxyethylidene)bis- |
| 100511442 | Phosphonic acid, P,P'-(1-hydroxyethylidene)bis- |
| 103736669 | Phosphonic acid, P,P'-(1-hydroxyethylidene)bis- |
| 106908763 | Phosphonic acid, P,P'-(1-hydroxyethylidene)bis- |
| 129130423 | Phosphonic acid, P,P'-(1-hydroxyethylidene)bis- |
| 138360846 | Phosphonic acid, P,P'-(1-hydroxyethylidene)bis- |
| 192526559 | Phosphonic acid, P,P'-(1-hydroxyethylidene)bis- |
| 303177335 | Phosphonic acid, P,P'-(1-hydroxyethylidene)bis- |
| 853028383 | Phosphonic acid, P,P'-(1-hydroxyethylidene)bis- |
| 78386 | Phosphonic acid, P-ethyl-, diethyl ester |
| 150103836 | Phosphonic acid, P-ethyl-, diethyl ester |
| 756796 | Phosphonic acid, P-methyl-, dimethyl ester |
| 351011433 | Phosphonic acid, P-methyl-, dimethyl ester |
| 880251707 | Phosphonic acid, P-methyl-, dimethyl ester |
| 1066519 | Phosphonic acid, aminomethyl- |
| 868859 | Phosphonic acid, dimethyl ester |
| 124641 | Phosphonium, tetrakis(hydroxymethyl)-, chloride (1:1) |
| 2245605 | Phosphonium, tetrakis(hydroxymethyl)-, chloride (1:1) |
| 55566308 | Phosphonium, tetrakis(hydroxymethyl)-, sulfate (2:1) |
| 58591110 | Phosphonium, tetrakis(hydroxymethyl)-, sulfate (2:1) |
| 65257047 | Phosphonium, tetrakis(hydroxymethyl)-, sulfate (2:1) |
| 944229 | Phosphonodithioic acid, ethyl-, O-ethyl S-phenyl ester |
| 107448 | Phosphonofluoridic acid, P-methyl-, 1-methylethyl ester |
| 50642234 | Phosphonofluoridic acid, P-methyl-, 1-methylethyl ester |
| 102490540 | Phosphonofluoridic acid, P-methyl-, 1-methylethyl ester |
| 50782699 | Phosphonothioic acid, P-methyl-, S-[2-[bis(1-methylethyl)amino]ethyl] O-ethyl ester |
| 51848476 | Phosphonothioic acid, P-methyl-, S-[2-[bis(1-methylethyl)amino]ethyl] O-ethyl ester |
| 53800401 | Phosphonothioic acid, P-methyl-, S-[2-[bis(1-methylethyl)amino]ethyl] O-ethyl ester |
| 65143057 | Phosphonothioic acid, P-methyl-, S-[2-[bis(1-methylethyl)amino]ethyl] O-ethyl ester |
| 70938840 | Phosphonothioic acid, P-methyl-, S-[2-[bis(1-methylethyl)amino]ethyl] O-ethyl ester |
| 327980 | Phosphonothioic acid, ethyl-, O-ethyl O-(2,4,5-trichlorophenyl) ester |
| 21609905 | Phosphonothioic acid, phenyl-, O-(4-bromo-2,5-dichlorophenyl) O-methyl ester |
| 73270492 | Phosphonothioic acid, phenyl-, O-(4-bromo-2,5-dichlorophenyl) O-methyl ester |
| 2104645 | Phosphonothioic acid, phenyl-, O-ethyl O-(4-nitrophenyl) ester |
| 22224926 | Phosphoramidic acid, (1-methylethyl)-, ethyl 3-methyl-4-(methylthio)phenyl ester |
| 947331 | Phosphoramidic acid, N-(4-methyl-1,3-dithiolan-2-ylidene)-, diethyl ester |
| 950107 | Phosphoramidic acid, N-(4-methyl-1,3-dithiolan-2-ylidene)-, diethyl ester |
| 12643220 | Phosphoramidic acid, N-(4-methyl-1,3-dithiolan-2-ylidene)-, diethyl ester |
| 21548323 | Phosphoramidic acid, N-1,3-dithietan-2-ylidene-, diethyl ester |
| 68335148 | Phosphoramidic acid, N-1,3-dithietan-2-ylidene-, diethyl ester |
| 947024 | Phosphoramidic acid, N-1,3-dithiolan-2-ylidene-, diethyl ester |
| 99910175 | Phosphoramidic acid, N-1,3-dithiolan-2-ylidene-, diethyl ester |
| 99910186 | Phosphoramidic acid, N-1,3-dithiolan-2-ylidene-, diethyl ester |
| 229865 | Phosphoramidic acid, methyl-, 2-chloro-4-(1,1-dimethylethyl)phenyl methyl ester |
| 299865 | Phosphoramidic acid, methyl-, 2-chloro-4-(1,1-dimethylethyl)phenyl methyl ester |
| 12676141 | Phosphoramidic acid, methyl-, 2-chloro-4-(1,1-dimethylethyl)phenyl methyl ester |
| 150402576 | Phosphoramidic acid, methyl-, 2-chloro-4-(1,1-dimethylethyl)phenyl methyl ester |
| 77816 | Phosphoramidocyanidic acid, N,N-dimethyl-, ethyl ester |
| 102490551 | Phosphoramidocyanidic acid, N,N-dimethyl-, ethyl ester |
| 299854 | Phosphoramidothioic acid, (1-methylethyl)-, O-(2,4-dichlorophenyl) O-methyl ester |
| 21248259 | Phosphoramidothioic acid, (1-methylethyl)-, O-(2,4-dichlorophenyl) O-methyl ester |
| 10265926 | Phosphoramidothioic acid, O,S-dimethyl ester |
| 115182359 | Phosphoramidothioic acid, O,S-dimethyl ester |
| 30560191 | Phosphoramidothioic acid, acetyl-, O,S-dimethyl ester |
| 115096112 | Phosphoramidothioic acid, acetyl-, O,S-dimethyl ester |
| 10026138 | Phosphorane, pentachloro- |
| 7647190 | Phosphorane, pentafluoro- |
| 137038303 | Phosphorane, pentafluoro- |
| 1314563 | Phosphoric acid |
| 7664382 | Phosphoric acid |
| 28602757 | Phosphoric acid |
| 178560731 | Phosphoric acid |
| 959699833 | Phosphoric acid |
| 1021417413 | Phosphoric acid |
| 1053657230 | Phosphoric acid |
| 1196963548 | Phosphoric acid |
| 126738 | Phosphoric acid tributyl ester |
| 15158857 | Phosphoric acid tributyl ester |
| 19824614 | Phosphoric acid tributyl ester |
| 80094399 | Phosphoric acid tributyl ester |
| 329184614 | Phosphoric acid tributyl ester |
| 1238174190 | Phosphoric acid tributyl ester |
| 56803373 | Phosphoric acid, (1,1-dimethylethyl)phenyl diphenyl ester |
| 28108998 | Phosphoric acid, (1-methylethyl)phenyl diphenyl ester |
| 359793445 | Phosphoric acid, (1-methylethyl)phenyl diphenyl ester |
| 141662 | Phosphoric acid, (1E)-3-(dimethylamino)-1-methyl-3-oxo-1-propenyl dimethyl ester |
| 22248799 | Phosphoric acid, (1Z)-2-chloro-1-(2,4,5-trichlorophenyl)ethenyl dimethyl ester |
| 300765 | Phosphoric acid, 1,2-dibromo-2,2-dichloroethyl dimethyl ester |
| 53095311 | Phosphoric acid, 1,2-dibromo-2,2-dichloroethyl dimethyl ester |
| 52686 | Phosphoric acid, 2,2-dichloroethenyl dimethyl ester |
| 62737 | Phosphoric acid, 2,2-dichloroethenyl dimethyl ester |
| 8023221 | Phosphoric acid, 2,2-dichloroethenyl dimethyl ester |
| 8072217 | Phosphoric acid, 2,2-dichloroethenyl dimethyl ester |
| 8072397 | Phosphoric acid, 2,2-dichloroethenyl dimethyl ester |
| 8076162 | Phosphoric acid, 2,2-dichloroethenyl dimethyl ester |
| 11095173 | Phosphoric acid, 2,2-dichloroethenyl dimethyl ester |
| 11096212 | Phosphoric acid, 2,2-dichloroethenyl dimethyl ester |
| 11111312 | Phosphoric acid, 2,2-dichloroethenyl dimethyl ester |
| 11126720 | Phosphoric acid, 2,2-dichloroethenyl dimethyl ester |
| 11678891 | Phosphoric acid, 2,2-dichloroethenyl dimethyl ester |
| 12772406 | Phosphoric acid, 2,2-dichloroethenyl dimethyl ester |
| 55819324 | Phosphoric acid, 2,2-dichloroethenyl dimethyl ester |
| 62139951 | Phosphoric acid, 2,2-dichloroethenyl dimethyl ester |
| 62655598 | Phosphoric acid, 2,2-dichloroethenyl dimethyl ester |
| 95828550 | Phosphoric acid, 2,2-dichloroethenyl dimethyl ester |
| 116788911 | Phosphoric acid, 2,2-dichloroethenyl dimethyl ester |
| 961115 | Phosphoric acid, 2-chloro-1-(2,4,5-trichlorophenyl)ethenyl dimethyl ester |
| 22248799 | Phosphoric acid, 2-chloro-1-(2,4,5-trichlorophenyl)ethenyl dimethyl ester |
| 22350761 | Phosphoric acid, 2-chloro-1-(2,4,5-trichlorophenyl)ethenyl dimethyl ester |
| 270906 | Phosphoric acid, 2-chloro-1-(2,4-dichlorophenyl)ethenyl diethyl ester |
| 470906 | Phosphoric acid, 2-chloro-1-(2,4-dichlorophenyl)ethenyl diethyl ester |
| 8018062 | Phosphoric acid, 2-chloro-1-(2,4-dichlorophenyl)ethenyl diethyl ester |
| 8067672 | Phosphoric acid, 2-chloro-1-(2,4-dichlorophenyl)ethenyl diethyl ester |
| 13171216 | Phosphoric acid, 2-chloro-3-(diethylamino)-1-methyl-3-oxo-1-propenyl dimethyl ester |
| 1241947 | Phosphoric acid, 2-ethylhexyl diphenyl ester |
| 64532974 | Phosphoric acid, 4-nonylphenyl diphenyl ester |
| 7784307 | Phosphoric acid, aluminum salt (1:1) |
| 8022591 | Phosphoric acid, aluminum salt (1:1) |
| 13765930 | Phosphoric acid, aluminum salt (1:1) |
| 36201726 | Phosphoric acid, aluminum salt (1:1) |
| 37324428 | Phosphoric acid, aluminum salt (1:1) |
| 51668554 | Phosphoric acid, aluminum salt (1:1) |
| 52350115 | Phosphoric acid, aluminum salt (1:1) |
| 89686544 | Phosphoric acid, aluminum salt (1:1) |
| 93237811 | Phosphoric acid, aluminum salt (1:1) |
| 135151778 | Phosphoric acid, aluminum salt (1:1) |
| 189303353 | Phosphoric acid, aluminum salt (1:1) |
| 7783280 | Phosphoric acid, ammonium salt (1:?) |
| 10124319 | Phosphoric acid, ammonium salt (1:?) |
| 124673865 | Phosphoric acid, ammonium salt (1:?) |
| 107664 | Phosphoric acid, dibutyl ester |
| 72283568 | Phosphoric acid, dibutyl ester |
| 2528361 | Phosphoric acid, dibutyl phenyl ester |
| 311455 | Phosphoric acid, diethyl 4-nitrophenyl ester |
| 962583 | Phosphoric acid, diethyl 6-methyl-2-(1-methylethyl)-4-pyrimidinyl ester |
| 919448 | Phosphoric acid, dimethyl (1E)-1-methyl-3-(methylamino)-3-oxo-1-propenyl ester |
| 6923224 | Phosphoric acid, dimethyl (1E)-1-methyl-3-(methylamino)-3-oxo-1-propenyl ester |
| 83857414 | Phosphoric acid, dimethyl (1E)-1-methyl-3-(methylamino)-3-oxo-1-propenyl ester |
| 950356 | Phosphoric acid, dimethyl-4-nitrophenyl ester |
| 29761215 | Phosphoric acid, isodecyl diphenyl ester |
| 59800463 | Phosphoric acid, isodecyl diphenyl ester |
| 146480140 | Phosphoric acid, isodecyl diphenyl ester |
| 7446277 | Phosphoric acid, lead(2+) salt (2:3) |
| 1314087563 | Phosphoric acid, lead(2+) salt (2:3) |
| 1323177 | Phosphoric acid, methylphenyl diphenyl ester |
| 25444495 | Phosphoric acid, methylphenyl diphenyl ester |
| 26444495 | Phosphoric acid, methylphenyl diphenyl ester |
| 627081247 | Phosphoric acid, methylphenyl diphenyl ester |
| 7558794 | Phosphoric acid, sodium salt (1:2) |
| 148560763 | Phosphoric acid, sodium salt (1:2) |
| 1374442713 | Phosphoric acid, sodium salt (1:2) |
| 7601549 | Phosphoric acid, sodium salt (1:3) |
| 96337983 | Phosphoric acid, sodium salt (1:3) |
| 1269628785 | Phosphoric acid, sodium salt (1:3) |
| 78400 | Phosphoric acid, triethyl ester |
| 512561 | Phosphoric acid, trimethyl ester |
| 91316448 | Phosphoric acid, trimethyl ester |
| 1806548 | Phosphoric acid, trioctyl ester |
| 115866 | Phosphoric acid, triphenyl ester |
| 402955026 | Phosphoric acid, triphenyl ester |
| 78422 | Phosphoric acid, tris(2-ethylhexyl) ester |
| 73308 | Phosphoric acid, tris(2-methylphenyl) ester |
| 78308 | Phosphoric acid, tris(2-methylphenyl) ester |
| 1336409 | Phosphoric acid, tris(2-methylphenyl) ester |
| 126716 | Phosphoric acid, tris(2-methylpropyl) ester |
| 856824629 | Phosphoric acid, tris(2-methylpropyl) ester |
| 563042 | Phosphoric acid, tris(3-methylphenyl) ester |
| 78320 | Phosphoric acid, tris(4-methylphenyl) ester |
| 1330785 | Phosphoric acid, tris(methylphenyl) ester |
| 25013176 | Phosphoric acid, tris(methylphenyl) ester |
| 34902620 | Phosphoric acid, tris(methylphenyl) ester |
| 56499457 | Phosphoric acid, tris(methylphenyl) ester |
| 56573105 | Phosphoric acid, tris(methylphenyl) ester |
| 69234044 | Phosphoric acid, tris(methylphenyl) ester |
| 1259372536 | Phosphoric acid, tris(methylphenyl) ester |
| 13847228 | Phosphoric acid, zinc salt (1:?) |
| 680319 | Phosphoric triamide, N,N,N',N',N'',N''-hexamethyl- |
| 24992550 | Phosphoric triamide, N,N,N',N',N'',N''-hexamethyl- |
| 51557018 | Phosphoric triamide, N,N,N',N',N'',N''-hexamethyl- |
| 10025873 | Phosphoric trichloride |
| 39380773 | Phosphoric trichloride |
| 1258871725 | Phosphoric trichloride |
| 814493 | Phosphorochloridic acid, diethyl ester |
| 1642542 | Phosphorochloridic acid, diethyl ester |
| 2524041 | Phosphorochloridothioic acid, O,O-diethyl ester |
| 1081841500 | Phosphorochloridothioic acid, O,O-diethyl ester |
| 2524030 | Phosphorochloridothioic acid, O,O-dimethyl ester |
| 4465945 | Phosphorodiamidic acid, N,N-bis(2-chloroethyl)-N'-(3-hydroxypropyl)-, compd. with cyclohexanamine (1:1) |
| 115264 | Phosphorodiamidic fluoride, tetramethyl- |
| 741582 | Phosphorodithioic acid, O,O-bis(1-methylethyl) S-[2-[(phenylsulfonyl)amino]ethyl] ester |
| 39291719 | Phosphorodithioic acid, O,O-bis(1-methylethyl) S-[2-[(phenylsulfonyl)amino]ethyl] ester |
| 2642719 | Phosphorodithioic acid, O,O-diethyl S-[(4-oxo-1,2,3-benzotriazin-3(4H)-yl)methyl] ester |
| 289022 | Phosphorodithioic acid, O,O-diethyl S-[(ethylthio)methyl] ester |
| 298022 | Phosphorodithioic acid, O,O-diethyl S-[(ethylthio)methyl] ester |
| 2497076 | Phosphorodithioic acid, O,O-diethyl S-[2-(ethylsulfinyl)ethyl] ester |
| 298044 | Phosphorodithioic acid, O,O-diethyl S-[2-(ethylthio)ethyl] ester |
| 3288582 | Phosphorodithioic acid, O,O-diethyl S-methyl ester |
| 86500 | Phosphorodithioic acid, O,O-dimethyl S-[(4-oxo-1,2,3-benzotriazin-3(4H)-yl)methyl] ester |
| 54182739 | Phosphorodithioic acid, O,O-dimethyl S-[(4-oxo-1,2,3-benzotriazin-3(4H)-yl)methyl] ester |
| 60515 | Phosphorodithioic acid, O,O-dimethyl S-[2-(methylamino)-2-oxoethyl] ester |
| 11003535 | Phosphorodithioic acid, O,O-dimethyl S-[2-(methylamino)-2-oxoethyl] ester |
| 11096201 | Phosphorodithioic acid, O,O-dimethyl S-[2-(methylamino)-2-oxoethyl] ester |
| 56833739 | Phosphorodithioic acid, O,O-dimethyl S-[2-(methylamino)-2-oxoethyl] ester |
| 79956186 | Phosphorodithioic acid, O,O-dimethyl S-[2-(methylamino)-2-oxoethyl] ester |
| 34643464 | Phosphorodithioic acid, O-(2,4-dichlorophenyl) O-ethyl S-propyl ester |
| 64772549 | Phosphorodithioic acid, O-(2,4-dichlorophenyl) O-ethyl S-propyl ester |
| 35400432 | Phosphorodithioic acid, O-ethyl O-[4-(methylthio)phenyl] S-propyl ester |
| 59299579 | Phosphorodithioic acid, O-ethyl O-[4-(methylthio)phenyl] S-propyl ester |
| 92642314 | Phosphorodithioic acid, O-ethyl O-[4-(methylthio)phenyl] S-propyl ester |
| 13194484 | Phosphorodithioic acid, O-ethyl S,S-dipropyl ester |
| 78342 | Phosphorodithioic acid, S,S'-1,4-dioxane-2,3-diyl O,O,O',O'-tetraethyl ester |
| 563122 | Phosphorodithioic acid, S,S'-methylene O,O,O',O'-tetraethyl ester |
| 12676936 | Phosphorodithioic acid, S,S'-methylene O,O,O',O'-tetraethyl ester |
| 12738475 | Phosphorodithioic acid, S,S'-methylene O,O,O',O'-tetraethyl ester |
| 24934916 | Phosphorodithioic acid, S-(chloromethyl) O,O-diethyl ester |
| 37209293 | Phosphorodithioic acid, S-(chloromethyl) O,O-diethyl ester |
| 732116 | Phosphorodithioic acid, S-[(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)methyl] O,O-dimethyl ester |
| 950378 | Phosphorodithioic acid, S-[(5-methoxy-2-oxo-1,3,4-thiadiazol-3(2H)-yl)methyl] O,O-dimethyl ester |
| 11114311 | Phosphorodithioic acid, S-[(5-methoxy-2-oxo-1,3,4-thiadiazol-3(2H)-yl)methyl] O,O-dimethyl ester |
| 80210099 | Phosphorodithioic acid, S-[(5-methoxy-2-oxo-1,3,4-thiadiazol-3(2H)-yl)methyl] O,O-dimethyl ester |
| 2310170 | Phosphorodithioic acid, S-[(6-chloro-2-oxo-3(2H)-benzoxazolyl)methyl] O,O-diethyl ester |
| 11129092 | Phosphorodithioic acid, S-[(6-chloro-2-oxo-3(2H)-benzoxazolyl)methyl] O,O-diethyl ester |
| 12650350 | Phosphorodithioic acid, S-[(6-chloro-2-oxo-3(2H)-benzoxazolyl)methyl] O,O-diethyl ester |
| 29562467 | Phosphorodithioic acid, S-[(6-chloro-2-oxo-3(2H)-benzoxazolyl)methyl] O,O-diethyl ester |
| 54182717 | Phosphorodithioic acid, S-[(6-chloro-2-oxo-3(2H)-benzoxazolyl)methyl] O,O-diethyl ester |
| 2540821 | Phosphorodithioic acid, S-[2-(formylmethylamino)-2-oxoethyl] O,O-dimethyl ester |
| 12767543 | Phosphorodithioic acid, S-[2-(formylmethylamino)-2-oxoethyl] O,O-dimethyl ester |
| 10311849 | Phosphorodithioic acid, S-[2-chloro-1-(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)ethyl] O,O-diethyl ester |
| 13071799 | Phosphorodithioic acid, S-[[(1,1-dimethylethyl)thio]methyl] O,O-diethyl ester |
| 3735237 | Phosphorodithioic acid, S-[[(2,5-dichlorophenyl)thio]methyl] O,O-dimethyl ester |
| 786196 | Phosphorodithioic acid, S-[[(4-chlorophenyl)thio]methyl] O,O-diethyl ester |
| 55914 | Phosphorofluoridic acid, bis(1-methylethyl) ester |
| 37209351 | Phosphorofluoridic acid, bis(1-methylethyl) ester |
| 126681 | Phosphorothioic acid, O,O,O-triethyl ester |
| 54593838 | Phosphorothioic acid, O,O-diethyl O-(1,2,2,2-tetrachloroethyl) ester |
| 104559355 | Phosphorothioic acid, O,O-diethyl O-(1,2,2,2-tetrachloroethyl) ester |
| 119791490 | Phosphorothioic acid, O,O-diethyl O-(1,2,2,2-tetrachloroethyl) ester |
| 2921882 | Phosphorothioic acid, O,O-diethyl O-(3,5,6-trichloro-2-pyridinyl) ester |
| 12768488 | Phosphorothioic acid, O,O-diethyl O-(3,5,6-trichloro-2-pyridinyl) ester |
| 39475553 | Phosphorothioic acid, O,O-diethyl O-(3,5,6-trichloro-2-pyridinyl) ester |
| 56382 | Phosphorothioic acid, O,O-diethyl O-(4-nitrophenyl) ester |
| 8057703 | Phosphorothioic acid, O,O-diethyl O-(4-nitrophenyl) ester |
| 11111914 | Phosphorothioic acid, O,O-diethyl O-(4-nitrophenyl) ester |
| 110616892 | Phosphorothioic acid, O,O-diethyl O-(4-nitrophenyl) ester |
| 297972 | Phosphorothioic acid, O,O-diethyl O-2-pyrazinyl ester |
| 30917363 | Phosphorothioic acid, O,O-diethyl O-2-pyrazinyl ester |
| 298033 | Phosphorothioic acid, O,O-diethyl O-[2-(ethylthio)ethyl] ester |
| 8000973 | Phosphorothioic acid, O,O-diethyl O-[2-(ethylthio)ethyl] ester, mixt. with O,O-diethyl S-[2-(ethylthio)ethyl] phosphorothioate |
| 8058739 | Phosphorothioic acid, O,O-diethyl O-[2-(ethylthio)ethyl] ester, mixt. with O,O-diethyl S-[2-(ethylthio)ethyl] phosphorothioate |
| 8065483 | Phosphorothioic acid, O,O-diethyl O-[2-(ethylthio)ethyl] ester, mixt. with O,O-diethyl S-[2-(ethylthio)ethyl] phosphorothioate |
| 34624538 | Phosphorothioic acid, O,O-diethyl O-[2-(ethylthio)ethyl] ester, mixt. with O,O-diethyl S-[2-(ethylthio)ethyl] phosphorothioate |
| 115902 | Phosphorothioic acid, O,O-diethyl O-[4-(methylsulfinyl)phenyl] ester |
| 115913 | Phosphorothioic acid, O,O-diethyl O-[4-(methylsulfinyl)phenyl] ester |
| 72435 | Phosphorothioic acid, O,O-diethyl O-[6-methyl-2-(1-methylethyl)-4-pyrimidinyl] ester |
| 333415 | Phosphorothioic acid, O,O-diethyl O-[6-methyl-2-(1-methylethyl)-4-pyrimidinyl] ester |
| 485472 | Phosphorothioic acid, O,O-diethyl O-[6-methyl-2-(1-methylethyl)-4-pyrimidinyl] ester |
| 27936409 | Phosphorothioic acid, O,O-diethyl O-[6-methyl-2-(1-methylethyl)-4-pyrimidinyl] ester |
| 30583381 | Phosphorothioic acid, O,O-diethyl O-[6-methyl-2-(1-methylethyl)-4-pyrimidinyl] ester |
| 65863038 | Phosphorothioic acid, O,O-diethyl O-[6-methyl-2-(1-methylethyl)-4-pyrimidinyl] ester |
| 299843 | Phosphorothioic acid, O,O-dimethyl O-(2,4,5-trichlorophenyl) ester |
| 8028282 | Phosphorothioic acid, O,O-dimethyl O-(2,4,5-trichlorophenyl) ester |
| 8050655 | Phosphorothioic acid, O,O-dimethyl O-(2,4,5-trichlorophenyl) ester |
| 54328120 | Phosphorothioic acid, O,O-dimethyl O-(2,4,5-trichlorophenyl) ester |
| 56172599 | Phosphorothioic acid, O,O-dimethyl O-(2,4,5-trichlorophenyl) ester |
| 5598130 | Phosphorothioic acid, O,O-dimethyl O-(3,5,6-trichloro-2-pyridinyl) ester |
| 122145 | Phosphorothioic acid, O,O-dimethyl O-(3-methyl-4-nitrophenyl) ester |
| 12764873 | Phosphorothioic acid, O,O-dimethyl O-(3-methyl-4-nitrophenyl) ester |
| 54182706 | Phosphorothioic acid, O,O-dimethyl O-(3-methyl-4-nitrophenyl) ester |
| 94650983 | Phosphorothioic acid, O,O-dimethyl O-(3-methyl-4-nitrophenyl) ester |
| 298000 | Phosphorothioic acid, O,O-dimethyl O-(4-nitrophenyl) ester |
| 37359356 | Phosphorothioic acid, O,O-dimethyl O-(4-nitrophenyl) ester |
| 63653667 | Phosphorothioic acid, O,O-dimethyl O-(4-nitrophenyl) ester |
| 55389 | Phosphorothioic acid, O,O-dimethyl O-[3-methyl-4-(methylthio)phenyl] ester |
| 97176 | Phosphorothioic acid, O-(2,4-dichlorophenyl) O,O-diethyl ester |
| 11137498 | Phosphorothioic acid, O-(2,4-dichlorophenyl) O,O-diethyl ester |
| 56724 | Phosphorothioic acid, O-(3-chloro-4-methyl-2-oxo-2H-1-benzopyran-7-yl) O,O-diethyl ester |
| 35400432 | Phosphorothioic acid, O-(4-bromo-2-chlorophenyl) O-ethyl S-propyl ester |
| 41198087 | Phosphorothioic acid, O-(4-bromo-2-chlorophenyl) O-ethyl S-propyl ester |
| 61230420 | Phosphorothioic acid, O-(4-bromo-2-chlorophenyl) O-ethyl S-propyl ester |
| 61287512 | Phosphorothioic acid, O-(4-bromo-2-chlorophenyl) O-ethyl S-propyl ester |
| 92760413 | Phosphorothioic acid, O-(4-bromo-2-chlorophenyl) O-ethyl S-propyl ester |
| 2636262 | Phosphorothioic acid, O-(4-cyanophenyl) O,O-dimethyl ester |
| 12692909 | Phosphorothioic acid, O-(4-cyanophenyl) O,O-dimethyl ester |
| 54578391 | Phosphorothioic acid, O-(4-cyanophenyl) O,O-dimethyl ester |
| 21923239 | Phosphorothioic acid, O-[2,5-dichloro-4-(methylthio)phenyl] O,O-diethyl ester |
| 51052596 | Phosphorothioic acid, O-[2,5-dichloro-4-(methylthio)phenyl] O,O-diethyl ester |
| 96182535 | Phosphorothioic acid, O-[2-(1,1-dimethylethyl)-5-pyrimidinyl] O-ethyl O-(1-methylethyl) ester |
| 12648521 | Phosphorothioic acid, O-[2-(diethylamino)-6-methyl-4-pyrimidinyl] O,O-diethyl ester |
| 23505411 | Phosphorothioic acid, O-[2-(diethylamino)-6-methyl-4-pyrimidinyl] O,O-diethyl ester |
| 11104271 | Phosphorothioic acid, O-[2-(diethylamino)-6-methyl-4-pyrimidinyl] O,O-dimethyl ester |
| 29232937 | Phosphorothioic acid, O-[2-(diethylamino)-6-methyl-4-pyrimidinyl] O,O-dimethyl ester |
| 8022002 | Phosphorothioic acid, O-[2-(ethylthio)ethyl] O,O-dimethyl ester, mixt. with S-[2-(ethylthio)ethyl] O,O-dimethyl phosphorothioate |
| 52857 | Phosphorothioic acid, O-[4-[(dimethylamino)sulfonyl]phenyl] O,O-dimethyl ester |
| 3383968 | Phosphorothioic acid, Op,Op'-(thiodi-4,1-phenylene) Op,Op,Op',Op'-tetramethyl ester |
| 53320584 | Phosphorothioic acid, Op,Op'-(thiodi-4,1-phenylene) Op,Op,Op',Op'-tetramethyl ester |
| 3734972 | Phosphorothioic acid, S-(2-(diethylamino)ethyl) O,O-diethyl ester, ethanedioate (1:1) |
| 2778043 | Phosphorothioic acid, S-[(5-methoxy-4-oxo-4H-pyran-2-yl)methyl] O,O-dimethyl ester |
| 78535 | Phosphorothioic acid, S-[2-(diethylamino)ethyl] O,O-diethyl ester |
| 102388589 | Phosphorothioic acid, S-[2-(diethylamino)ethyl] O,O-diethyl ester |
| 301122 | Phosphorothioic acid, S-[2-(ethylsulfinyl)ethyl] O,O-dimethyl ester |
| 37320937 | Phosphorothioic acid, S-[2-(ethylsulfinyl)ethyl] O,O-dimethyl ester |
| 919868 | Phosphorothioic acid, S-[2-(ethylthio)ethyl] O,O-dimethyl ester |
| 1079803498 | Phosphorothioic acid, S-[2-(ethylthio)ethyl] O,O-dimethyl ester |
| 78488 | Phosphorotrithioic acid |
| 25758763 | Phosphorotrithioic acid |
| 78488 | Phosphorotrithioic acid, S,S,S-tributyl ester |
| 150505 | Phosphorotrithious acid, tributyl ester |
| 121459 | Phosphorous acid, trimethyl ester |
| 101020 | Phosphorous acid, triphenyl ester |
| 301133 | Phosphorous acid, tris(2-ethylhexyl) ester |
| 7719122 | Phosphorous trichloride |
| 11082954 | Phosphorous trichloride |
| 7723140 | Phosphorus |
| 29879376 | Phosphorus |
| 1314563 | Phosphorus oxide (P2O5) |
| 24377842 | Phosphorus oxide (P2O5) |
| 50811864 | Phosphorus oxide (P2O5) |
| 59778573 | Phosphorus oxide (P2O5) |
| 72906424 | Phosphorus oxide (P2O5) |
| 1314803 | Phosphorus sulfide (P2S5) |
| 12066625 | Phosphorus sulfide (P2S5) |
| 16857093 | Phosphorus sulfide (P2S5) |
| 129680279 | Phosphorus sulfide (P2S5) |
| 132620996 | Phosphorus sulfide (P2S5) |
| 337913538 | Phosphorus sulfide (P2S5) |
| 341007601 | Phosphorus sulfide (P2S5) |
| 342401472 | Phosphorus sulfide (P2S5) |
| 409325037 | Phosphorus sulfide (P2S5) |
| 952005457 | Phosphorus sulfide (P2S5) |
| 14596373 | Phosphorus, isotope of mass 32 |
| 24267558 | Phosphorus, isotope of mass 32 |
| 7723140 | Phosphorus, mol. (P4) |
| 12185103 | Phosphorus, mol. (P4) |
| 51273586 | Phosphorus, mol. (P4) |
| 110850 | Piperazine |
| 8017901 | Piperazine |
| 8027814 | Piperazine |
| 26644462 | Piperazine |
| 81546158 | Piperazine |
| 854880152 | Piperazine |
| 861800353 | Piperazine |
| 142643 | Piperazine, hydrochloride (1:2) |
| 8049001 | Piperazine, hydrochloride (1:2) |
| 110894 | Piperidine |
| 100754 | Piperidine, 1-nitroso- |
| 68374629 | Piperidine, 1-nitroso- |
| 7440064 | Platinum |
| 7440664 | Platinum |
| 21547637 | Platinum |
| 15663271 | Platinum, diamminedichloro-, (SP-4-2)- |
| 96081742 | Platinum, diamminedichloro-, (SP-4-2)- |
| 936542993 | Platinum, diamminedichloro-, (SP-4-2)- |
| 15706362 | Platinum, isotope of mass 191 |
| 15735703 | Platinum, isotope of mass 193 |
| 15735703 | Platinum, isotope of mass 193m(4.33 d) |
| 378783154 | Platinum, isotope of mass 193m(4.33 d) |
| 1067147 | Plumbane, chlorotriethyl- |
| 15710471 | Plumbane, chlorotriethyl- |
| 78002 | Plumbane, tetraethyl- |
| 75741 | Plumbane, tetramethyl- |
| 7440075 | Plutonium |
| 15117483 | Plutonium |
| 13981163 | Plutonium, isotope of mass 238 |
| 1517483 | Plutonium, isotope of mass 239 |
| 15117483 | Plutonium, isotope of mass 239 |
| 7440086 | Polonium |
| 13981527 | Polonium, isotope of mass 210 |
| 14809837 | Polonium, isotope of mass 210 |
| 9016459 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 9021038 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 9067509 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 11098161 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 11103609 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 11107930 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 12767689 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 12789127 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 12790679 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 25154523 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 26064028 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 28136109 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 29594363 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 30676836 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 32196524 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 37187238 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 37210949 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 37230992 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 37280801 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 37336520 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 39289571 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 39316455 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 39316739 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 39346855 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 39373712 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 39392831 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 39393367 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 39421493 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 39453059 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 39454983 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 39475462 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 42617038 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 50855293 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 50934844 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 51059973 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 51609199 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 51668510 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 51938591 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 51938604 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 52012438 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 52038467 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 52051497 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 52434078 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 52440036 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 52440785 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 52440945 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 52504184 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 52504195 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 52683075 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 53125170 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 53529490 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 53663551 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 53763352 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 53763363 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 54174366 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 54985545 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 55126802 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 55838692 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 56590966 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 57308028 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 57571694 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 59330697 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 60098671 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 60476279 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 61614071 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 61840559 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 62169442 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 62229214 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 62229247 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 62229292 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 63440039 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 63798889 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 64296146 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 64940972 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 65035407 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 65035418 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 65777142 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 66525846 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 67053581 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 72847440 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 72847451 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 74434416 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 74656636 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 74749716 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 75882096 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 76829055 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 77271604 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 80341599 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 80966321 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 81296824 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 83271481 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 90452816 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 93095762 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 95828594 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 96231617 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 96957641 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 96958177 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 96958280 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 99402832 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 99531825 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 102188454 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 103939373 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 105269883 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 106152981 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 107231629 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 111623622 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 112509361 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 114101892 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 116711785 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 123019341 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 123068213 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 124057609 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 137263060 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 139281677 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 141490144 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 142985895 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 143929071 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 167140069 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 172521163 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 188612239 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 190856872 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 202936229 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 205577033 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 226225587 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 226225598 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 286015245 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 376647335 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 441352552 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 441352563 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 441352574 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 441352585 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 441352596 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 509171191 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 623588932 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 874461435 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 933050998 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 942205983 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 1163687500 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 1202388202 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 1202388268 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
| 1336603 | Poly(oxy-1,2-ethanediyl), .alpha.-[(1,1,3,3-tetramethylbutyl)phenyl]-.omega.-hydroxy- |
| 9036195 | Poly(oxy-1,2-ethanediyl), .alpha.-[(1,1,3,3-tetramethylbutyl)phenyl]-.omega.-hydroxy- |
| 9081838 | Poly(oxy-1,2-ethanediyl), .alpha.-[(1,1,3,3-tetramethylbutyl)phenyl]-.omega.-hydroxy- |
| 11130431 | Poly(oxy-1,2-ethanediyl), .alpha.-[(1,1,3,3-tetramethylbutyl)phenyl]-.omega.-hydroxy- |
| 12679742 | Poly(oxy-1,2-ethanediyl), .alpha.-[(1,1,3,3-tetramethylbutyl)phenyl]-.omega.-hydroxy- |
| 39283493 | Poly(oxy-1,2-ethanediyl), .alpha.-[(1,1,3,3-tetramethylbutyl)phenyl]-.omega.-hydroxy- |
| 39316466 | Poly(oxy-1,2-ethanediyl), .alpha.-[(1,1,3,3-tetramethylbutyl)phenyl]-.omega.-hydroxy- |
| 39320655 | Poly(oxy-1,2-ethanediyl), .alpha.-[(1,1,3,3-tetramethylbutyl)phenyl]-.omega.-hydroxy- |
| 39341032 | Poly(oxy-1,2-ethanediyl), .alpha.-[(1,1,3,3-tetramethylbutyl)phenyl]-.omega.-hydroxy- |
| 50815480 | Poly(oxy-1,2-ethanediyl), .alpha.-[(1,1,3,3-tetramethylbutyl)phenyl]-.omega.-hydroxy- |
| 52628054 | Poly(oxy-1,2-ethanediyl), .alpha.-[(1,1,3,3-tetramethylbutyl)phenyl]-.omega.-hydroxy- |
| 53663540 | Poly(oxy-1,2-ethanediyl), .alpha.-[(1,1,3,3-tetramethylbutyl)phenyl]-.omega.-hydroxy- |
| 53858665 | Poly(oxy-1,2-ethanediyl), .alpha.-[(1,1,3,3-tetramethylbutyl)phenyl]-.omega.-hydroxy- |
| 54834978 | Poly(oxy-1,2-ethanediyl), .alpha.-[(1,1,3,3-tetramethylbutyl)phenyl]-.omega.-hydroxy- |
| 55068752 | Poly(oxy-1,2-ethanediyl), .alpha.-[(1,1,3,3-tetramethylbutyl)phenyl]-.omega.-hydroxy- |
| 55600469 | Poly(oxy-1,2-ethanediyl), .alpha.-[(1,1,3,3-tetramethylbutyl)phenyl]-.omega.-hydroxy- |
| 58056954 | Poly(oxy-1,2-ethanediyl), .alpha.-[(1,1,3,3-tetramethylbutyl)phenyl]-.omega.-hydroxy- |
| 59112844 | Poly(oxy-1,2-ethanediyl), .alpha.-[(1,1,3,3-tetramethylbutyl)phenyl]-.omega.-hydroxy- |
| 63172509 | Poly(oxy-1,2-ethanediyl), .alpha.-[(1,1,3,3-tetramethylbutyl)phenyl]-.omega.-hydroxy- |
| 71538517 | Poly(oxy-1,2-ethanediyl), .alpha.-[(1,1,3,3-tetramethylbutyl)phenyl]-.omega.-hydroxy- |
| 73904968 | Poly(oxy-1,2-ethanediyl), .alpha.-[(1,1,3,3-tetramethylbutyl)phenyl]-.omega.-hydroxy- |
| 77137667 | Poly(oxy-1,2-ethanediyl), .alpha.-[(1,1,3,3-tetramethylbutyl)phenyl]-.omega.-hydroxy- |
| 120026279 | Poly(oxy-1,2-ethanediyl), .alpha.-[(1,1,3,3-tetramethylbutyl)phenyl]-.omega.-hydroxy- |
| 141443665 | Poly(oxy-1,2-ethanediyl), .alpha.-[(1,1,3,3-tetramethylbutyl)phenyl]-.omega.-hydroxy- |
| 188612228 | Poly(oxy-1,2-ethanediyl), .alpha.-[(1,1,3,3-tetramethylbutyl)phenyl]-.omega.-hydroxy- |
| 881841969 | Poly(oxy-1,2-ethanediyl), .alpha.-[(1,1,3,3-tetramethylbutyl)phenyl]-.omega.-hydroxy- |
| 881842188 | Poly(oxy-1,2-ethanediyl), .alpha.-[(1,1,3,3-tetramethylbutyl)phenyl]-.omega.-hydroxy- |
| 1211504209 | Poly(oxy-1,2-ethanediyl), .alpha.-[(1,1,3,3-tetramethylbutyl)phenyl]-.omega.-hydroxy- |
| 9002931 | Poly(oxy-1,2-ethanediyl), .alpha.-[4-(1,1,3,3-tetramethylbutyl)phenyl]-.omega.-hydroxy- |
| 9010428 | Poly(oxy-1,2-ethanediyl), .alpha.-[4-(1,1,3,3-tetramethylbutyl)phenyl]-.omega.-hydroxy- |
| 9010439 | Poly(oxy-1,2-ethanediyl), .alpha.-[4-(1,1,3,3-tetramethylbutyl)phenyl]-.omega.-hydroxy- |
| 9077650 | Poly(oxy-1,2-ethanediyl), .alpha.-[4-(1,1,3,3-tetramethylbutyl)phenyl]-.omega.-hydroxy- |
| 13463075 | Poly(oxy-1,2-ethanediyl), .alpha.-[4-(1,1,3,3-tetramethylbutyl)phenyl]-.omega.-hydroxy- |
| 39409115 | Poly(oxy-1,2-ethanediyl), .alpha.-[4-(1,1,3,3-tetramethylbutyl)phenyl]-.omega.-hydroxy- |
| 66057689 | Poly(oxy-1,2-ethanediyl), .alpha.-[4-(1,1,3,3-tetramethylbutyl)phenyl]-.omega.-hydroxy- |
| 66057690 | Poly(oxy-1,2-ethanediyl), .alpha.-[4-(1,1,3,3-tetramethylbutyl)phenyl]-.omega.-hydroxy- |
| 66057827 | Poly(oxy-1,2-ethanediyl), .alpha.-[4-(1,1,3,3-tetramethylbutyl)phenyl]-.omega.-hydroxy- |
| 81398869 | Poly(oxy-1,2-ethanediyl), .alpha.-[4-(1,1,3,3-tetramethylbutyl)phenyl]-.omega.-hydroxy- |
| 111287037 | Poly(oxy-1,2-ethanediyl), .alpha.-[4-(1,1,3,3-tetramethylbutyl)phenyl]-.omega.-hydroxy- |
| 125692924 | Poly(oxy-1,2-ethanediyl), .alpha.-[4-(1,1,3,3-tetramethylbutyl)phenyl]-.omega.-hydroxy- |
| 172826823 | Poly(oxy-1,2-ethanediyl), .alpha.-[4-(1,1,3,3-tetramethylbutyl)phenyl]-.omega.-hydroxy- |
| 308104645 | Poly(oxy-1,2-ethanediyl), .alpha.-[4-(1,1,3,3-tetramethylbutyl)phenyl]-.omega.-hydroxy- |
| 935753041 | Poly(oxy-1,2-ethanediyl), .alpha.-[4-(1,1,3,3-tetramethylbutyl)phenyl]-.omega.-hydroxy- |
| 1017686871 | Poly(oxy-1,2-ethanediyl), .alpha.-[4-(1,1,3,3-tetramethylbutyl)phenyl]-.omega.-hydroxy- |
| 1334721 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 1341055 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 6540994 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 8027110 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 9002920 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 9015558 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 9079214 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 11106346 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 14675388 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 31798988 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 37231235 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 37343876 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 39316024 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 39316411 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 39363774 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 50815855 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 50815866 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 51426132 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 53026667 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 53241342 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 54351541 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 54398173 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 55599843 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 55892949 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 56093868 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 56590579 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 56939709 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 57244903 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 61373942 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 61710381 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 62229270 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 64772196 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 66048746 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 69344850 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 71636710 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 71932086 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 86547026 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 86727313 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 87296342 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 101008553 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 101840748 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 102329602 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 102342030 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 106254084 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 106254095 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 106856659 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 113716351 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 122779582 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 124401714 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 137736733 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 138100080 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 141875754 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 147398172 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 148093101 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 148498913 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 152206241 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 176235624 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 176596955 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 183117579 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 186762970 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 189388509 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 191546415 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 201746170 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 218607002 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 221642917 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 234761810 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 234761821 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 234761832 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 234764375 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 258278329 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 266678040 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 266678051 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 348616524 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 359786166 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 362661710 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 384842799 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 459409031 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 503027858 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 504414588 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 544481278 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 648426351 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 777931723 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 786657316 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 798544271 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 869893210 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 875119838 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 903524710 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 903524776 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 935753052 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 942439954 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 942929819 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 946527748 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 957761158 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 1010802240 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 1075258126 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 1075258137 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 1231209225 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 1235485650 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 1263057788 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 1338464848 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 1361543250 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 1437798985 | Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
| 8038377 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 9081952 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 9085023 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 9085034 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 12676743 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 12770933 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 25104589 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 25322683 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 25609818 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 34802421 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 37361152 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 50809046 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 50809591 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 54510951 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 54847642 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 59763405 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 60894124 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 61840140 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 64441685 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 64640284 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 67411647 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 70926577 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 75285028 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 75285039 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 77986380 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 79964264 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 80341533 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 85399220 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 85945295 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 88077809 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 88747222 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 90597709 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 99264616 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 99333898 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 101677865 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 106186247 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 107502636 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 107529964 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 109550278 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 112384379 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 112895213 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 113041648 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 114323932 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 116549907 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 119219066 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 125223689 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 133573316 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 134919430 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 150872825 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 154394384 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 156948195 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 169046531 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 174460083 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 174460094 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 188364774 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 188924030 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 189154629 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 191743712 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 196696841 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 201163431 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 206357860 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 221638717 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 225502443 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 270910264 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 307928070 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 356055704 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 391229984 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 402483265 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 497171832 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 615575047 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 857367465 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 859315723 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 863328363 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 876655844 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 886469289 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 952682621 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 956217699 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 959127492 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 1011711388 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 1035554643 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 1152430379 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 1204298974 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 1221382780 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 1221382837 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 1221889651 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 1246265644 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 1256377908 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 1267533367 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 1287768380 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 1293291016 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 1319730681 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 1330618784 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 1338951328 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 1373256893 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 1377964823 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 1422717427 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 1434253801 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 1435263276 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 1446681771 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 1474108092 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
| 9009283 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 9078562 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 25038599 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 37310819 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 50957874 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 53025164 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 53025175 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 54174219 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 54514657 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 59678670 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 61036906 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 61584278 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 61811516 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 65430855 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 66167611 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 67166794 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 68417765 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 70699751 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 71119534 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 71343174 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 72099333 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 73201873 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 73379712 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 76688716 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 81031654 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 82115477 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 82446875 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 85410986 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 85764494 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 87501813 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 87659516 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 88385733 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 88385744 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 89234242 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 89338487 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 89493301 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 92769056 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 97666676 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 104492253 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 108251894 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 109617018 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 109617154 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 110158435 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 112024927 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 114013637 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 116094816 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 116094838 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 116675424 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 117216929 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 118442185 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 118442196 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 118737976 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 119574639 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 122636526 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 122878948 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 122987740 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 123759988 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 124364610 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 126465007 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 126904118 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 128279823 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 129434408 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 132324835 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 132965709 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 134090554 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 134090565 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 134498741 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 135151676 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 135151687 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 137178439 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 137191389 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 137261984 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 137263399 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 137263979 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 138860841 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 141444328 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 141444362 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 141444419 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 143244364 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 145808204 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 154214172 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 156930379 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 157352062 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 157884543 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 159202796 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 159250450 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 162430093 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 162430106 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 166385097 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 168256346 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 168317020 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 169150203 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 169313411 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 183681665 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 184378798 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 184921708 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 185351773 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 185351795 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 185568609 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 185766272 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 186467323 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 187175684 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 189399073 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 194304319 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 194304386 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 197527789 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 198085755 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 203009238 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 222414064 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 223585351 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 226924523 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 227803749 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 256421166 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 264235372 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 281675261 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 334650598 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 334991194 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 360562476 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 362014048 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 364732616 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 365440308 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 370858665 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 374078236 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 390411775 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 400089487 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 400089647 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 403991015 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 404373133 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 406207521 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 438207444 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 450336160 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 474958231 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 475139185 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 500314761 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 521288653 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 528594776 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 534557238 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 564479954 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 586363679 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 599174728 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 600718363 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 617686563 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 664374907 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 681146996 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 681147035 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 831196453 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 831226698 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 835621379 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 857058492 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 857847393 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 863102152 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 863201847 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 863201858 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 867030873 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 870246858 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 870246869 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 870246916 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 871109705 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 873072072 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 873425151 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 873874761 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 876014221 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 876051239 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 877677571 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 882500596 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 886988983 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 887144710 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 892874985 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 892876287 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 904291152 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 914402430 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 917085008 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 936650065 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 942619218 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 945491032 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 946595693 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 946595795 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 958633482 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 1009594551 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 1055343753 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 1105511714 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 1158074544 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 1187548055 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 1206626290 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 1245283899 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 1253960314 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 1290053507 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 1334703466 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 1361954757 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 1369965887 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 1377830926 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 1395734174 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 1418006297 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 1421947785 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 1422269100 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 1430230082 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) |
| 9003150 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 9079225 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 9079236 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 9087303 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 25322694 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 27274277 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 27615867 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 28724278 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 29434035 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 34465526 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 37231688 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 39465435 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 51019308 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 51568924 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 51922497 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 52309418 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 53528828 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 53863415 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 54500366 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 56591765 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 57137061 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 61090286 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 63279072 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 64176870 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 64940803 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 66174274 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 66988349 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 68821818 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 69900454 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 70992517 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 74870001 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 75139150 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 80408022 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 80803403 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 81774530 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 81774610 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 82548172 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 84420393 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 84503253 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 84682962 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 85497310 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 87608886 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 87940781 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 88025949 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 89126794 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 91218847 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 92094605 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 94586808 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 97199672 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 98444521 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 98565981 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 98913225 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 99130491 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 100357606 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 105844846 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 109489487 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 111146168 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 115450630 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 116958464 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 117715078 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 117968931 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 118441488 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 119652856 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 120468964 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 122392885 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 123687989 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 124448744 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 124631705 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 125147719 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 126906045 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 130842363 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 131649304 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 133439620 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 134092403 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 134192237 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 135355021 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 138704468 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 143710194 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 145699747 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 146024615 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 150825722 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 152287826 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 161278031 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 174206361 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 174722180 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 176742373 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 187954990 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 205657267 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 250380451 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 252369714 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 310902911 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 372166284 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 380912663 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 380912823 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 660439521 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 777067784 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 824420000 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 865704127 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 907603467 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 913723554 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 956483220 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 1014983277 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 1049785161 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 1169934331 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 1205544871 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 1269983381 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 1381802761 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
| 130498292 | Polycyclic aromatic hydrocarbons |
| 7440097 | Potassium |
| 7693267 | Potassium |
| 31079137 | Potassium |
| 7447407 | Potassium chloride (KCl) |
| 12599007 | Potassium chloride (KCl) |
| 59217684 | Potassium chloride (KCl) |
| 79103767 | Potassium chloride (KCl) |
| 126415358 | Potassium chloride (KCl) |
| 1037073816 | Potassium chloride (KCl) |
| 151508 | Potassium cyanide (K(CN)) |
| 15745741 | Potassium cyanide (K(CN)) |
| 60195520 | Potassium cyanide (K(CN)) |
| 133708368 | Potassium cyanide (K(CN)) |
| 7789233 | Potassium fluoride (KF) |
| 59217742 | Potassium fluoride (KF) |
| 165892239 | Potassium fluoride (KF) |
| 1310583 | Potassium hydroxide (K(OH)) |
| 29857725 | Potassium hydroxide (K(OH)) |
| 71769534 | Potassium hydroxide (K(OH)) |
| 1343959 | Potassium oxide (K2O) |
| 12136457 | Potassium oxide (K2O) |
| 37382437 | Potassium oxide (K2O) |
| 121326457 | Potassium oxide (K2O) |
| 1242458872 | Potassium oxide (K2O) |
| 12030885 | Potassium superoxide (K(O2)) |
| 12433500 | Potassium zinc chromate oxide (K2Zn4(CrO4)4O) |
| 58319327 | Potassium zinc chromate oxide (K2Zn4(CrO4)4O) |
| 137904188 | Potassium zinc chromate oxide (K2Zn4(CrO4)4O) |
| 871483102 | Potassium zinc chromate oxide (K2Zn4(CrO4)4O) |
| 13966002 | Potassium, isotope of mass 40 |
| 14981794 | Praseodymium, isotope of mass 143 |
| 52016 | Pregn-4-ene-21-carboxylic acid, 7-(acetylthio)-17-hydroxy-3-oxo-, .gamma.-lactone, (7.alpha.,17.alpha.)- |
| 52017 | Pregn-4-ene-21-carboxylic acid, 7-(acetylthio)-17-hydroxy-3-oxo-, .gamma.-lactone, (7.alpha.,17.alpha.)- |
| 496916406 | Pregn-4-ene-21-carboxylic acid, 7-(acetylthio)-17-hydroxy-3-oxo-, .gamma.-lactone, (7.alpha.,17.alpha.)- |
| 1050678937 | Pregn-4-ene-21-carboxylic acid, 7-(acetylthio)-17-hydroxy-3-oxo-, .gamma.-lactone, (7.alpha.,17.alpha.)- |
| 57830 | Pregn-4-ene-3,20-dione |
| 8012326 | Pregn-4-ene-3,20-dione |
| 8023130 | Pregn-4-ene-3,20-dione |
| 257630505 | Pregn-4-ene-3,20-dione |
| 753497200 | Pregn-4-ene-3,20-dione |
| 71589 | Pregn-4-ene-3,20-dione, 17-(acetyloxy)-6-methyl-, (6.alpha.)- |
| 630568 | Pregn-4-ene-3,20-dione, 17-[(1-oxohexyl)oxy]- |
| 53032 | Pregna-1,4-diene-3,11,20-trione, 17,21-dihydroxy- |
| 68597 | Pregna-1,4-diene-3,11,20-trione, 17,21-dihydroxy- |
| 50022 | Pregna-1,4-diene-3,20-dione, 9-fluoro-11,17,21-trihydroxy-16-methyl-, (11.beta.,16.alpha.)- |
| 8054599 | Pregna-1,4-diene-3,20-dione, 9-fluoro-11,17,21-trihydroxy-16-methyl-, (11.beta.,16.alpha.)- |
| 137098192 | Pregna-1,4-diene-3,20-dione, 9-fluoro-11,17,21-trihydroxy-16-methyl-, (11.beta.,16.alpha.)- |
| 906362707 | Pregna-1,4-diene-3,20-dione, 9-fluoro-11,17,21-trihydroxy-16-methyl-, (11.beta.,16.alpha.)- |
| 906422842 | Pregna-1,4-diene-3,20-dione, 9-fluoro-11,17,21-trihydroxy-16-methyl-, (11.beta.,16.alpha.)- |
| 1050677478 | Pregna-1,4-diene-3,20-dione, 9-fluoro-11,17,21-trihydroxy-16-methyl-, (11.beta.,16.alpha.)- |
| 595335 | Pregna-4,6-diene-3,20-dione, 17-(acetyloxy)-6-methyl- |
| 14380757 | Promethium, isotope of mass 147 |
| 14683193 | Promethium, isotope of mass 148 |
| 14683193 | Promethium, isotope of mass 148m(41.3 d) |
| 378783405 | Promethium, isotope of mass 148m(41.3 d) |
| 15765318 | Promethium, isotope of mass 149 |
| 123386 | Propanal |
| 78842 | Propanal, 2-methyl- |
| 26140465 | Propanal, 2-methyl- |
| 1646873 | Propanal, 2-methyl-2-(methylsulfinyl)-, O-[(methylamino)carbonyl]oxime |
| 1646874 | Propanal, 2-methyl-2-(methylsulfonyl)-, O-[(methylamino)carbonyl]oxime |
| 1646884 | Propanal, 2-methyl-2-(methylsulfonyl)-, O-[(methylamino)carbonyl]oxime |
| 60005950 | Propanal, 2-methyl-2-(methylsulfonyl)-, O-[(methylamino)carbonyl]oxime |
| 116063 | Propanal, 2-methyl-2-(methylthio)-, O-[(methylamino)carbonyl]oxime |
| 1646759 | Propanal, 2-methyl-2-(methylthio)-, oxime |
| 78988 | Propanal, 2-oxo- |
| 15299997 | Propanamide, N,N-diethyl-2-(1-naphthalenyloxy)- |
| 154799641 | Propanamide, N,N-diethyl-2-(1-naphthalenyloxy)- |
| 709988 | Propanamide, N-(3,4-dichlorophenyl)- |
| 11096325 | Propanamide, N-(3,4-dichlorophenyl)- |
| 110343367 | Propanamide, N-(3,4-dichlorophenyl)- |
| 74986 | Propane |
| 621761 | Propane, 1,1',1''-[methylidynetris(oxy)]tris- |
| 422786 | Propane, 1,1,1,2,2,3,3-heptachloro-3-fluoro- |
| 4259432 | Propane, 1,1,1-trichloro-2,2,3,3,3-pentafluoro- |
| 13474889 | Propane, 1,1-dichloro-1,2,2,3,3-pentafluoro- |
| 111512562 | Propane, 1,1-dichloro-1,2,3,3,3-pentafluoro- |
| 96184 | Propane, 1,2,3-trichloro- |
| 78751 | Propane, 1,2-dibromo- |
| 120575453 | Propane, 1,2-dibromo- |
| 594343 | Propane, 1,2-dibromo-2-methyl- |
| 96128 | Propane, 1,2-dibromo-3-chloro- |
| 1163195 | Propane, 1,2-dibromo-3-chloro- |
| 10556786 | Propane, 1,2-dibromo-3-chloro- |
| 105567860 | Propane, 1,2-dibromo-3-chloro- |
| 78875 | Propane, 1,2-dichloro- |
| 26198630 | Propane, 1,2-dichloro- |
| 661972 | Propane, 1,2-dichloro-1,1,2,3,3,3-hexafluoro- |
| 422446 | Propane, 1,2-dichloro-1,1,2,3,3-pentafluoro- |
| 431867 | Propane, 1,2-dichloro-1,1,3,3,3-pentafluoro- |
| 142289 | Propane, 1,3-dichloro- |
| 507551 | Propane, 1,3-dichloro-1,1,2,2,3-pentafluoro- |
| 136013791 | Propane, 1,3-dichloro-1,1,2,3,3-pentafluoro- |
| 422866 | Propane, 1-chloro-1,1,2,2,3,3,3-heptafluoro- |
| 600259 | Propane, 1-chloro-1-nitro- |
| 627021 | Propane, 1-ethoxy-2-methyl- |
| 108032 | Propane, 1-nitro- |
| 104306527 | Propane, 1-nitro- |
| 108203 | Propane, 2,2'-oxybis- |
| 108601 | Propane, 2,2'-oxybis[1-chloro- |
| 39638329 | Propane, 2,2'-oxybis[1-chloro- |
| 52438912 | Propane, 2,2'-oxybis[1-chloro- |
| 108601 | Propane, 2,2'-oxybis[2-chloro- |
| 39638329 | Propane, 2,2'-oxybis[2-chloro- |
| 594207 | Propane, 2,2-dichloro- |
| 128903219 | Propane, 2,2-dichloro-1,1,1,3,3-pentafluoro- |
| 77769 | Propane, 2,2-dimethoxy- |
| 463821 | Propane, 2,2-dimethyl- |
| 422480 | Propane, 2,3-dichloro-1,1,1,2,3-pentafluoro- |
| 3017956 | Propane, 2-bromo-1-chloro- |
| 127054380 | Propane, 2-bromo-1-chloro- |
| 75296 | Propane, 2-chloro- |
| 594718 | Propane, 2-chloro-2-nitro- |
| 1634044 | Propane, 2-methoxy-2-methyl- |
| 75285 | Propane, 2-methyl- |
| 70357152 | Propane, 2-methyl- |
| 100494200 | Propane, 2-methyl- |
| 1326305810 | Propane, 2-methyl- |
| 76469 | Propane, 2-nitro- |
| 79469 | Propane, 2-nitro- |
| 104306469 | Propane, 2-nitro- |
| 422560 | Propane, 3,3-dichloro-1,1,1,2,2-pentafluoro- |
| 460355 | Propane, 3-chloro-1,1,1-trifluoro- |
| 127564925 | Propane, dichloropentafluoro- |
| 135151961 | Propane, dichloropentafluoro- |
| 25735299 | Propane, trichloro- |
| 83547971 | Propane-1,1,1,2,3,3-d6, 2-bromo-3-chloro- |
| 24382045 | Propanedial, ion(1-), sodium |
| 7206760 | Propanediamide, 2-ethyl-2-phenyl- |
| 80147406 | Propanediamide, 2-ethyl-2-phenyl- |
| 109773 | Propanedinitrile |
| 144804999 | Propanedinitrile |
| 2698411 | Propanedinitrile, 2-[(2-chlorophenyl)methylene]- |
| 63843890 | Propanedioic acid, 2-[[3,5-bis(1,1-dimethylethyl)-4-hydroxyphenyl]methyl]-2-butyl-, 1,3-bis(1,2,2,6,6-pentamethyl-4-piperidinyl) ester |
| 71714471 | Propanedioic acid, 2-[[3,5-bis(1,1-dimethylethyl)-4-hydroxyphenyl]methyl]-2-butyl-, 1,3-bis(1,2,2,6,6-pentamethyl-4-piperidinyl) ester |
| 116797832 | Propanedioic acid, 2-[[3,5-bis(1,1-dimethylethyl)-4-hydroxyphenyl]methyl]-2-butyl-, 1,3-bis(1,2,2,6,6-pentamethyl-4-piperidinyl) ester |
| 2757188 | Propanedioic acid, thallium(1+) salt (1:2) |
| 26264142 | Propanediol |
| 107120 | Propanenitrile |
| 11096881 | Propanenitrile, 2-[[4-chloro-6-(ethylamino)-1,3,5-triazin-2-yl]amino]-2-methyl- |
| 12679537 | Propanenitrile, 2-[[4-chloro-6-(ethylamino)-1,3,5-triazin-2-yl]amino]-2-methyl- |
| 21725462 | Propanenitrile, 2-[[4-chloro-6-(ethylamino)-1,3,5-triazin-2-yl]amino]-2-methyl- |
| 78977 | Propanenitrile, 2-hydroxy- |
| 42492955 | Propanenitrile, 2-hydroxy- |
| 75865 | Propanenitrile, 2-hydroxy-2-methyl- |
| 59182864 | Propanenitrile, 2-hydroxy-2-methyl- |
| 78820 | Propanenitrile, 2-methyl- |
| 60153493 | Propanenitrile, 3-(methylnitrosoamino)- |
| 10213759 | Propanenitrile, 3-[(2-ethylhexyl)oxy]- |
| 542767 | Propanenitrile, 3-chloro- |
| 109784 | Propanenitrile, 3-hydroxy- |
| 2567013 | Propanenitrile, 3-hydroxy-2-methyl- |
| 79094 | Propanoic acid |
| 784139726 | Propanoic acid |
| 1032826440 | Propanoic acid |
| 123626 | Propanoic acid, 1,1'-anhydride |
| 75990 | Propanoic acid, 2,2-dichloro- |
| 127208 | Propanoic acid, 2,2-dichloro- |
| 39721 | Propanoic acid, 2-(2,4,5-trichlorophenoxy)- |
| 93721 | Propanoic acid, 2-(2,4,5-trichlorophenoxy)- |
| 7361377 | Propanoic acid, 2-(2,4,5-trichlorophenoxy)- |
| 15067524 | Propanoic acid, 2-(2,4,5-trichlorophenoxy)- |
| 29990394 | Propanoic acid, 2-(2,4,5-trichlorophenoxy)- |
| 32795974 | Propanoic acid, 2-(2,4,5-trichlorophenoxy)- |
| 32534955 | Propanoic acid, 2-(2,4,5-trichlorophenoxy)-, isooctyl ester |
| 120365 | Propanoic acid, 2-(2,4-dichlorophenoxy)- |
| 7547662 | Propanoic acid, 2-(2,4-dichlorophenoxy)- |
| 93652 | Propanoic acid, 2-(4-chloro-2-methylphenoxy)- |
| 7085190 | Propanoic acid, 2-(4-chloro-2-methylphenoxy)- |
| 637070 | Propanoic acid, 2-(4-chlorophenoxy)-2-methyl-, ethyl ester |
| 51338273 | Propanoic acid, 2-[4-(2,4-dichlorophenoxy)phenoxy]-, methyl ester |
| 66441234 | Propanoic acid, 2-[4-[(6-chloro-2-benzoxazolyl)oxy]phenoxy]-, ethyl ester |
| 82110723 | Propanoic acid, 2-[4-[(6-chloro-2-benzoxazolyl)oxy]phenoxy]-, ethyl ester |
| 87714452 | Propanoic acid, 2-[4-[(6-chloro-2-benzoxazolyl)oxy]phenoxy]-, ethyl ester |
| 116573183 | Propanoic acid, 2-[4-[(6-chloro-2-benzoxazolyl)oxy]phenoxy]-, ethyl ester |
| 76578148 | Propanoic acid, 2-[4-[(6-chloro-2-quinoxalinyl)oxy]phenoxy]-, ethyl ester |
| 89468495 | Propanoic acid, 2-[4-[(6-chloro-2-quinoxalinyl)oxy]phenoxy]-, ethyl ester |
| 100760109 | Propanoic acid, 2-[4-[(6-chloro-2-quinoxalinyl)oxy]phenoxy]-, ethyl ester |
| 69806504 | Propanoic acid, 2-[4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]-, butyl ester |
| 86334147 | Propanoic acid, 2-[4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]-, butyl ester |
| 93436 | Propanoic acid, 2-hydroxy-, 2-naphthalenyl ester |
| 138227 | Propanoic acid, 2-hydroxy-, butyl ester |
| 126872217 | Propanoic acid, 2-hydroxy-, butyl ester |
| 97858 | Propanoic acid, 2-methyl-, 2-methylpropyl ester |
| 297858 | Propanoic acid, 2-methyl-, 2-methylpropyl ester |
| 25134274 | Propanoic acid, 2-methyl-, monoester with 2,2,4-trimethyl-1,3-pentanediol |
| 25265774 | Propanoic acid, 2-methyl-, monoester with 2,2,4-trimethyl-1,3-pentanediol |
| 129383057 | Propanoic acid, 2-methyl-, monoester with 2,2,4-trimethyl-1,3-pentanediol |
| 141136234 | Propanoic acid, 2-methyl-, monoester with 2,2,4-trimethyl-1,3-pentanediol |
| 855004421 | Propanoic acid, 2-methyl-, monoester with 2,2,4-trimethyl-1,3-pentanediol |
| 3771195 | Propanoic acid, 2-methyl-2-[4-(1,2,3,4-tetrahydro-1-naphthalenyl)phenoxy]- |
| 763699 | Propanoic acid, 3-ethoxy-, ethyl ester |
| 1391911673 | Propanoic acid, 3-ethoxy-, ethyl ester |
| 504881 | Propanoic acid, 3-nitro- |
| 137406 | Propanoic acid, sodium salt (1:1) |
| 686679 | Propanoic acid, sodium salt (1:1) |
| 8027085 | Propanoic acid, sodium salt (1:1) |
| 11238878 | Propanol, 1(or 2)-(2-methoxymethylethoxy)- |
| 12002254 | Propanol, 1(or 2)-(2-methoxymethylethoxy)- |
| 12002356 | Propanol, 1(or 2)-(2-methoxymethylethoxy)- |
| 34590948 | Propanol, 1(or 2)-(2-methoxymethylethoxy)- |
| 83730603 | Propanol, 1(or 2)-(2-methoxymethylethoxy)- |
| 104512574 | Propanol, 1(or 2)-(2-methoxymethylethoxy)- |
| 112388780 | Propanol, 1(or 2)-(2-methoxymethylethoxy)- |
| 197632432 | Propanol, 1(or 2)-(2-methoxymethylethoxy)- |
| 110965 | Propanol, oxybis- |
| 110985 | Propanol, oxybis- |
| 25265718 | Propanol, oxybis- |
| 25322230 | Propanol, oxybis- |
| 27941908 | Propanol, oxybis- |
| 27941919 | Propanol, oxybis- |
| 28678264 | Propanol, oxybis- |
| 30370617 | Propanol, oxybis- |
| 75047142 | Propanol, oxybis- |
| 78644492 | Propanol, oxybis- |
| 13981141 | Protactinium, isotope of mass 233 |
| 68602937 | Pseudomonas |
| 66594318 | Pydraul 50E |
| 2016888 | Pyrazinecarboxamide, 3,5-diamino-N-(aminoiminomethyl)-6-chloro-, monohydrochloride |
| 129000 | Pyrene |
| 76165236 | Pyrene |
| 5522430 | Pyrene, 1-nitro- |
| 121299 | Pyrethrins and Pyrethroids |
| 8003347 | Pyrethrins and Pyrethroids |
| 8003737 | Pyrethrins and Pyrethroids |
| 12768739 | Pyrethrins and Pyrethroids |
| 110861 | Pyridine |
| 6999004 | Pyridine |
| 45410397 | Pyridine |
| 62301320 | Pyridine |
| 82005069 | Pyridine |
| 85404199 | Pyridine |
| 85404202 | Pyridine |
| 152758957 | Pyridine |
| 163392209 | Pyridine |
| 733733476 | Pyridine |
| 857961069 | Pyridine |
| 1462846 | Pyridine, 2,3,6-trimethyl- |
| 6959473 | Pyridine, 2-(chloromethyl)-, hydrochloride |
| 1929824 | Pyridine, 2-chloro-6-(trichloromethyl)- |
| 1135442919 | Pyridine, 2-chloro-6-(trichloromethyl)- |
| 109068 | Pyridine, 2-methyl- |
| 45505348 | Pyridine, 2-methyl- |
| 82005070 | Pyridine, 2-methyl- |
| 54115 | Pyridine, 3-(1-methyl-2-pyrrolidinyl)-, (S)-, and salts |
| 6912852 | Pyridine, 3-(1-methyl-2-pyrrolidinyl)-, (S)-, and salts |
| 16703675 | Pyridine, 3-(1-methyl-2-pyrrolidinyl)-, (S)-, and salts |
| 16760375 | Pyridine, 3-(1-methyl-2-pyrrolidinyl)-, (S)-, and salts |
| 6959484 | Pyridine, 3-(chloromethyl)-, hydrochloride |
| 54115 | Pyridine, 3-[(2S)-1-methyl-2-pyrrolidinyl]- |
| 551133 | Pyridine, 3-[(2S)-1-methyl-2-pyrrolidinyl]- |
| 6912852 | Pyridine, 3-[(2S)-1-methyl-2-pyrrolidinyl]- |
| 13890818 | Pyridine, 3-[(2S)-1-methyl-2-pyrrolidinyl]- |
| 13890829 | Pyridine, 3-[(2S)-1-methyl-2-pyrrolidinyl]- |
| 16760375 | Pyridine, 3-[(2S)-1-methyl-2-pyrrolidinyl]- |
| 65305 | Pyridine, 3-[(2S)-1-methyl-2-pyrrolidinyl]-, sulfate (2:1) |
| 16543558 | Pyridine, 3-[(2S)-1-nitroso-2-pyrrolidinyl]- |
| 53759221 | Pyridine, 3-[(2S)-1-nitroso-2-pyrrolidinyl]- |
| 64162578 | Pyridine, 3-[(2S)-1-nitroso-2-pyrrolidinyl]- |
| 64162589 | Pyridine, 3-[(2S)-1-nitroso-2-pyrrolidinyl]- |
| 108996 | Pyridine, 3-methyl- |
| 82005081 | Pyridine, 3-methyl- |
| 108894 | Pyridine, 4-methyl- |
| 82005092 | Pyridine, 4-methyl- |
| 92075359 | Pyridine, 4-methyl- |
| 140761 | Pyridine, 5-ethenyl-2-methyl- |
| 20260768 | Pyridine, 5-ethenyl-2-methyl- |
| 7291227 | Pyridine-d5 |
| 68909193 | Pyridinium, 1-methyl-, Et Me derivs., chlorides |
| 34913070 | Pyrimidine, 5-[4-(pentyloxy)phenyl]-2-(4-pentylphenyl)- |
| 930552 | Pyrrolidine, 1-nitroso- |
| 68374630 | Pyrrolidine, 1-nitroso- |
| 57476 | Pyrrolo[2,3-b]indol-5-ol, 1,2,3,3a,8,8a-hexahydro-1,3a,8-trimethyl-, 5-(N-methylcarbamate), (3aS,8aR)- |
| 57647 | Pyrrolo[2,3-b]indol-5-ol, 1,2,3,3a,8,8a-hexahydro-1,3a,8-trimethyl-, 5-(N-methylcarbamate), (3aS,8aR)- |
| 64471 | Pyrrolo[2,3-b]indol-5-ol, 1,2,3,3a,8,8a-hexahydro-1,3a,8-trimethyl-, 5-(N-methylcarbamate), (3aS,8aR)- |
| 511499 | Pyrrolo[2,3-b]indol-5-ol, 1,2,3,3a,8,8a-hexahydro-1,3a,8-trimethyl-, 5-(N-methylcarbamate), (3aS,8aR)- |
| 50975376 | Pyrrolo[2,3-b]indol-5-ol, 1,2,3,3a,8,8a-hexahydro-1,3a,8-trimethyl-, 5-(N-methylcarbamate), (3aS,8aR)- |
| 1317799 | Quartz (SiO2) |
| 12425262 | Quartz (SiO2) |
| 14808607 | Quartz (SiO2) |
| 70594955 | Quartz (SiO2) |
| 87347840 | Quartz (SiO2) |
| 122304487 | Quartz (SiO2) |
| 122304498 | Quartz (SiO2) |
| 8001545 | Quaternary ammonium compounds, alkylbenzyldimethyl, chlorides |
| 8011914 | Quaternary ammonium compounds, alkylbenzyldimethyl, chlorides |
| 8036906 | Quaternary ammonium compounds, alkylbenzyldimethyl, chlorides |
| 8039632 | Quaternary ammonium compounds, alkylbenzyldimethyl, chlorides |
| 8045214 | Quaternary ammonium compounds, alkylbenzyldimethyl, chlorides |
| 8045225 | Quaternary ammonium compounds, alkylbenzyldimethyl, chlorides |
| 12741069 | Quaternary ammonium compounds, alkylbenzyldimethyl, chlorides |
| 39434189 | Quaternary ammonium compounds, alkylbenzyldimethyl, chlorides |
| 59890141 | Quaternary ammonium compounds, alkylbenzyldimethyl, chlorides |
| 75635120 | Quaternary ammonium compounds, alkylbenzyldimethyl, chlorides |
| 50957625 | Quaternary ammonium compounds, benzyl-C8-18-alkyldimethyl, chlorides |
| 51004718 | Quaternary ammonium compounds, benzyl-C8-18-alkyldimethyl, chlorides |
| 51668623 | Quaternary ammonium compounds, benzyl-C8-18-alkyldimethyl, chlorides |
| 63449412 | Quaternary ammonium compounds, benzyl-C8-18-alkyldimethyl, chlorides |
| 69344714 | Quaternary ammonium compounds, benzyl-C8-18-alkyldimethyl, chlorides |
| 7128929 | Quaternary ammonium compounds, dimethylditallow alkyl, chlorides |
| 68783788 | Quaternary ammonium compounds, dimethylditallow alkyl, chlorides |
| 74967898 | Quaternary ammonium compounds, dimethylditallow alkyl, chlorides |
| 91225 | Quinoline |
| 20214077 | Quinoline |
| 147477 | Quinoline, 1,2-dihydro-2,2,4-trimethyl- |
| 389806193 | Quinoline, 1,2-dihydro-2,2,4-trimethyl- |
| 91634 | Quinoline, 2-methyl- |
| 56575 | Quinoline, 4-nitro-, 1-oxide |
| 91532 | Quinoline, 6-ethoxy-1,2-dihydro-2,2,4-trimethyl- |
| 8047049 | Quinoline, 6-ethoxy-1,2-dihydro-2,2,4-trimethyl- |
| 8047141 | Quinoline, 6-ethoxy-1,2-dihydro-2,2,4-trimethyl- |
| 124448335 | Quinoline, 6-ethoxy-1,2-dihydro-2,2,4-trimethyl- |
| 91623 | Quinoline, 6-methyl- |
| 612602 | Quinoline, 7-methyl- |
| 611325 | Quinoline, 8-methyl- |
| 530665 | Quinoline, sulfate (1:1) |
| 2213630 | Quinoxaline, 2,3-dichloro- |
| 7440144 | Radium |
| 15623457 | Radium, isotope of mass 223 |
| 13233324 | Radium, isotope of mass 224 |
| 7440144 | Radium, isotope of mass 226 |
| 13982633 | Radium, isotope of mass 226 |
| 7440144 | Radium, isotope of mass 226 and/or radium, isotope of mass 228 |
| 15262201 | Radium, isotope of mass 228 |
| 10043922 | Radon |
| 14859677 | Radon, isotope of mass 222 |
| 20076011 | Radon, isotope of mass 222 |
| 63848942 | Reofos 50 |
| 73299282 | Reofos 65 |
| 87495305 | Resorcine Blue |
| 302794 | Retinoic acid |
| 7005789 | Retinoic acid |
| 56573650 | Retinoic acid |
| 187175639 | Retinoic acid |
| 4759482 | Retinoic acid, 13-cis- |
| 7440155 | Rhenium |
| 14484130 | Rhenium, isotope of mass 183 |
| 14998631 | Rhenium, isotope of mass 186 |
| 14391298 | Rhenium, isotope of mass 187 |
| 7440166 | Rhodium |
| 24546245 | Rhodium |
| 100041370 | Rhodium |
| 10049077 | Rhodium chloride (RhCl3) |
| 14913894 | Rhodium, isotope of mass 105 |
| 139497044 | Rubber, reclaimed |
| 7440177 | Rubidium |
| 14932537 | Rubidium, isotope of mass 86 |
| 13982133 | Rubidium, isotope of mass 87 |
| 7440188 | Ruthenium |
| 57572017 | Ruthenium |
| 100041483 | Ruthenium |
| 13968531 | Ruthenium, isotope of mass 103 |
| 13967481 | Ruthenium, isotope of mass 106 |
| 15758357 | Ruthenium, isotope of mass 97 |
| 7440199 | Samarium |
| 110123529 | Samarium |
| 1232308676 | Samarium |
| 15715943 | Samarium, isotope of mass 151 |
| 15766004 | Samarium, isotope of mass 153 |
| 14808607 | Sand |
| 308075072 | Sand |
| 39393378 | Santicizer 711 |
| 13967630 | Scandium, isotope of mass 46 |
| 14391969 | Scandium, isotope of mass 47 |
| 14391867 | Scandium, isotope of mass 48 |
| 13410010 | Selenic acid, sodium salt (1:2) |
| 7791233 | Seleninyl chloride |
| 7783008 | Selenious acid |
| 11140606 | Selenious acid |
| 1408288834 | Selenious acid |
| 12039520 | Selenious acid, dithallium(1+) salt |
| 15123929 | Selenious acid, dithallium(1+) salt |
| 10102188 | Selenious acid, sodium salt (1:2) |
| 29528970 | Selenious acid, sodium salt (1:2) |
| 50647148 | Selenious acid, sodium salt (1:2) |
| 13597461 | Selenious acid, zinc salt (1:1) |
| 7782492 | Selenium |
| 11125238 | Selenium |
| 11133883 | Selenium |
| 12640298 | Selenium |
| 12640301 | Selenium |
| 12641962 | Selenium |
| 12733652 | Selenium |
| 37256192 | Selenium |
| 37258858 | Selenium |
| 37276156 | Selenium |
| 37368028 | Selenium |
| 50954171 | Selenium |
| 51882601 | Selenium |
| 95788457 | Selenium |
| 7782492 | Selenium compounds |
| 7783791 | Selenium fluoride (SeF6), (OC-6-11)- |
| 7446346 | Selenium sulfide (SeS) |
| 12039213 | Selenium sulfide (SeS) |
| 12299353 | Selenium sulfide (SeS) |
| 12299422 | Selenium sulfide (SeS) |
| 7488564 | Selenium sulfide (SeS2) |
| 7788564 | Selenium sulfide (SeS2) |
| 12299466 | Selenium sulfide (SeS2) |
| 14265715 | Selenium, isotope of mass 75 |
| 15758459 | Selenium, isotope of mass 79 |
| 630104 | Selenourea |
| 1309644 | Senarmontite |
| 12412521 | Senarmontite |
| 1319217 | Sepiolite (Mg4(OH)2(Si2O5)3.6H2O) |
| 12639439 | Sepiolite (Mg4(OH)2(Si2O5)3.6H2O) |
| 15501743 | Sepiolite (Mg4(OH)2(Si2O5)3.6H2O) |
| 18307238 | Sepiolite (Mg4(OH)2(Si2O5)3.6H2O) |
| 53664612 | Sepiolite (Mg4(OH)2(Si2O5)3.6H2O) |
| 61045543 | Sepiolite (Mg4(OH)2(Si2O5)3.6H2O) |
| 61180583 | Sepiolite (Mg4(OH)2(Si2O5)3.6H2O) |
| 63800373 | Sepiolite (Mg4(OH)2(Si2O5)3.6H2O) |
| 64418106 | Sepiolite (Mg4(OH)2(Si2O5)3.6H2O) |
| 69423694 | Sepiolite (Mg4(OH)2(Si2O5)3.6H2O) |
| 83271152 | Sepiolite (Mg4(OH)2(Si2O5)3.6H2O) |
| 479683528 | Sepiolite (Mg4(OH)2(Si2O5)3.6H2O) |
| 7803625 | Silane |
| 75774 | Silane, chlorotrimethyl- |
| 36642338 | Silane, chlorotrimethyl- |
| 127290362 | Silane, chlorotrimethyl- |
| 4109960 | Silane, dichloro- |
| 438546179 | Silane, dichloro- |
| 1719535 | Silane, dichlorodiethyl- |
| 75785 | Silane, dichlorodimethyl- |
| 5356832 | Silane, ethenylethoxydimethyl- |
| 597671 | Silane, ethoxytriethyl- |
| 1825623 | Silane, ethoxytrimethyl- |
| 871937416 | Silane, ethoxytrimethyl- |
| 75763 | Silane, tetramethyl- |
| 10025782 | Silane, trichloro- |
| 75796 | Silane, trichloromethyl- |
| 175446716 | Silane, trichloromethyl- |
| 617867 | Silane, triethyl- |
| 2487903 | Silane, trimethoxy- |
| 1185553 | Silane, trimethoxymethyl- |
| 106153304 | Silane, trimethoxymethyl- |
| 120250604 | Silane, trimethoxymethyl- |
| 947422 | Silanediol, 1,1-diphenyl- |
| 15112897 | Silanetriamine, N,N,N',N',N'',N''-hexamethyl- |
| 4130089 | Silanetriol, 1-ethenyl-, 1,1,1-triacetate |
| 63242626 | Silanetriol, 1-ethenyl-, 1,1,1-triacetate |
| 253778959 | Silanetriol, 1-ethenyl-, 1,1,1-triacetate |
| 1340096 | Silica |
| 7631869 | Silica |
| 9049778 | Silica |
| 11139723 | Silica |
| 11139734 | Silica |
| 12125132 | Silica |
| 12737369 | Silica |
| 12753638 | Silica |
| 12765741 | Silica |
| 12774286 | Silica |
| 37220249 | Silica |
| 37241251 | Silica |
| 37334659 | Silica |
| 37340457 | Silica |
| 37380931 | Silica |
| 39336668 | Silica |
| 39372582 | Silica |
| 39409251 | Silica |
| 39443408 | Silica |
| 39456810 | Silica |
| 50813133 | Silica |
| 50926937 | Silica |
| 50935836 | Silica |
| 51542575 | Silica |
| 51542586 | Silica |
| 52350433 | Silica |
| 53468647 | Silica |
| 55599332 | Silica |
| 56645273 | Silica |
| 56731067 | Silica |
| 60572114 | Silica |
| 61673469 | Silica |
| 61790532 | Silica |
| 62655736 | Silica |
| 67167162 | Silica |
| 70536231 | Silica |
| 70536617 | Silica |
| 70563358 | Silica |
| 78207177 | Silica |
| 83589564 | Silica |
| 83652920 | Silica |
| 87501595 | Silica |
| 89493210 | Silica |
| 97343629 | Silica |
| 97709143 | Silica |
| 98226405 | Silica |
| 98253259 | Silica |
| 102381588 | Silica |
| 107497596 | Silica |
| 108727715 | Silica |
| 113384411 | Silica |
| 122985482 | Silica |
| 125623178 | Silica |
| 126879149 | Silica |
| 126879309 | Silica |
| 126879490 | Silica |
| 127689161 | Silica |
| 127831270 | Silica |
| 136303134 | Silica |
| 136881806 | Silica |
| 137263037 | Silica |
| 138860829 | Silica |
| 139074730 | Silica |
| 145537548 | Silica |
| 145686915 | Silica |
| 145808771 | Silica |
| 146585720 | Silica |
| 149779022 | Silica |
| 150633208 | Silica |
| 152206354 | Silica |
| 152787332 | Silica |
| 155552253 | Silica |
| 155575056 | Silica |
| 171264189 | Silica |
| 172306091 | Silica |
| 173299417 | Silica |
| 179046038 | Silica |
| 184654533 | Silica |
| 185461909 | Silica |
| 188357779 | Silica |
| 191289299 | Silica |
| 203526867 | Silica |
| 206770312 | Silica |
| 207868971 | Silica |
| 217643588 | Silica |
| 231629155 | Silica |
| 247900772 | Silica |
| 250579705 | Silica |
| 250579783 | Silica |
| 264907280 | Silica |
| 330152642 | Silica |
| 341028715 | Silica |
| 368432400 | Silica |
| 402735493 | Silica |
| 402828379 | Silica |
| 402828391 | Silica |
| 402828404 | Silica |
| 573986273 | Silica |
| 574743923 | Silica |
| 636575183 | Silica |
| 761458291 | Silica |
| 781662699 | Silica |
| 865611445 | Silica |
| 871110019 | Silica |
| 895163776 | Silica |
| 900794709 | Silica |
| 910556604 | Silica |
| 916674469 | Silica |
| 942129911 | Silica |
| 1004994799 | Silica |
| 1006727269 | Silica |
| 1007355410 | Silica |
| 1151767348 | Silica |
| 1354383622 | Silica |
| 1365618912 | Silica |
| 1373553980 | Silica |
| 1377807276 | Silica |
| 1396528087 | Silica |
| 37224343 | Silica, vitreous |
| 37224354 | Silica, vitreous |
| 55126051 | Silica, vitreous |
| 60676860 | Silica, vitreous |
| 119573976 | Silica, vitreous |
| 221007063 | Silica, vitreous |
| 942229176 | Silica, vitreous |
| 1355213181 | Silica, vitreous |
| 78104 | Silicic acid (H4SiO4), tetraethyl ester |
| 827300061 | Silicic acid (H4SiO4), tetraethyl ester |
| 1239977991 | Silicic acid (H4SiO4), tetraethyl ester |
| 1421840085 | Silicic acid (H4SiO4), tetraethyl ester |
| 2157451 | Silicic acid (H4SiO4), tetrakis(2-methoxyethyl) ester |
| 681845 | Silicic acid (H4SiO4), tetramethyl ester |
| 12547318 | Silicic acid (H4SiO4), tetramethyl ester |
| 1337753 | Silicic acid, aluminum sodium salt |
| 1344009 | Silicic acid, aluminum sodium salt |
| 11140628 | Silicic acid, aluminum sodium salt |
| 12619577 | Silicic acid, aluminum sodium salt |
| 37349465 | Silicic acid, aluminum sodium salt |
| 39429873 | Silicic acid, aluminum sodium salt |
| 53320755 | Silicic acid, aluminum sodium salt |
| 119537745 | Silicic acid, aluminum sodium salt |
| 241166018 | Silicic acid, aluminum sodium salt |
| 422280748 | Silicic acid, aluminum sodium salt |
| 422280759 | Silicic acid, aluminum sodium salt |
| 446020935 | Silicic acid, aluminum sodium salt |
| 884739746 | Silicic acid, aluminum sodium salt |
| 1033037512 | Silicic acid, aluminum sodium salt |
| 10102246 | Silicic acid, lithium salt (1:2) |
| 1189978775 | Silicic acid, lithium salt (1:2) |
| 1343904 | Silicic acid, magnesium salt, hydrate |
| 7440213 | Silicon |
| 17375030 | Silicon |
| 71536237 | Silicon |
| 72516019 | Silicon |
| 72516020 | Silicon |
| 72516031 | Silicon |
| 90337932 | Silicon |
| 152284214 | Silicon |
| 157383374 | Silicon |
| 160371186 | Silicon |
| 409212 | Silicon carbide (SiC) |
| 12504675 | Silicon carbide (SiC) |
| 37231859 | Silicon carbide (SiC) |
| 54500139 | Silicon carbide (SiC) |
| 63686942 | Silicon carbide (SiC) |
| 66039278 | Silicon carbide (SiC) |
| 76647557 | Silicon carbide (SiC) |
| 78544497 | Silicon carbide (SiC) |
| 84149553 | Silicon carbide (SiC) |
| 86755240 | Silicon carbide (SiC) |
| 92843124 | Silicon carbide (SiC) |
| 95918006 | Silicon carbide (SiC) |
| 145583773 | Silicon carbide (SiC) |
| 146915551 | Silicon carbide (SiC) |
| 148031021 | Silicon carbide (SiC) |
| 152024732 | Silicon carbide (SiC) |
| 154643502 | Silicon carbide (SiC) |
| 156131383 | Silicon carbide (SiC) |
| 160073052 | Silicon carbide (SiC) |
| 167972089 | Silicon carbide (SiC) |
| 215780011 | Silicon carbide (SiC) |
| 259092530 | Silicon carbide (SiC) |
| 288149699 | Silicon carbide (SiC) |
| 1192824228 | Silicon carbide (SiC) |
| 1356922638 | Silicon carbide (SiC) |
| 1402835260 | Silicon carbide (SiC) |
| 1454308156 | Silicon carbide (SiC) |
| 67762929 | Siloxanes and Silicones, di-Me, (dimethylamino)-terminated |
| 7440224 | Silver |
| 12553683 | Silver |
| 87354458 | Silver |
| 87370841 | Silver |
| 97328411 | Silver |
| 172826345 | Silver |
| 204594092 | Silver |
| 745795748 | Silver |
| 858524728 | Silver |
| 930796091 | Silver |
| 1022160640 | Silver |
| 1082224483 | Silver |
| 1187830154 | Silver |
| 1293966069 | Silver |
| 1293966274 | Silver |
| 1337956098 | Silver |
| 7440224 | Silver compounds |
| 506649 | Silver cyanide (Ag(CN)) |
| 12351983 | Silver cyanide (Ag(CN)) |
| 29829514 | Silver cyanide (Ag(CN)) |
| 1302041 | Silver oxide (Ag2O) |
| 20667123 | Silver oxide (Ag2O) |
| 1301968 | Silver oxide (AgO) |
| 14701214 | Silver, ion (Ag1+) |
| 14928144 | Silver, isotope of mass 105m(7.23 min) |
| 454467211 | Silver, isotope of mass 105m(7.23 min) |
| 14391765 | Silver, isotope of mass 110 |
| 14391765 | Silver, isotope of mass 110m(249 d) |
| 378784248 | Silver, isotope of mass 110m(249 d) |
| 15760040 | Silver, isotope of mass 111 |
| 22501117 | Silver, isotope of mass 111 |
| 50815844 | Skydrol 500B |
| 55962271 | Skydrol LD |
| 7440235 | Sodium |
| 184637885 | Sodium |
| 213530359 | Sodium |
| 351903269 | Sodium |
| 1061193245 | Sodium |
| 12136899 | Sodium azide (Na(N3)) |
| 20828186 | Sodium azide (Na(N3)) |
| 26628228 | Sodium azide (Na(N3)) |
| 108592003 | Sodium azide (Na(N3)) |
| 157302084 | Sodium azide (Na(N3)) |
| 503002548 | Sodium azide (Na(N3)) |
| 575502022 | Sodium azide (Na(N3)) |
| 7647145 | Sodium chloride (NaCl) |
| 8028771 | Sodium chloride (NaCl) |
| 11062321 | Sodium chloride (NaCl) |
| 11062434 | Sodium chloride (NaCl) |
| 418758904 | Sodium chloride (NaCl) |
| 143339 | Sodium cyanide (Na(CN)) |
| 13998033 | Sodium cyanide (Na(CN)) |
| 25596525 | Sodium cyanide (Na(CN)) |
| 1333831 | Sodium fluoride (Na(HF2)) |
| 7783371 | Sodium fluoride (Na(HF2)) |
| 17097131 | Sodium fluoride (Na(HF2)) |
| 70876641 | Sodium fluoride (Na(HF2)) |
| 7681494 | Sodium fluoride (NaF) |
| 39287699 | Sodium fluoride (NaF) |
| 59217753 | Sodium fluoride (NaF) |
| 67112292 | Sodium fluoride (NaF) |
| 1310732 | Sodium hydroxide (Na(OH)) |
| 8012019 | Sodium hydroxide (Na(OH)) |
| 23340321 | Sodium hydroxide (Na(OH)), tetrahydrate |
| 11084858 | Sodium hypochlorite phosphate (Na13(ClO)(PO4)4) |
| 32680254 | Sodium hypochlorite phosphate (Na13(ClO)(PO4)4) |
| 56802994 | Sodium hypochlorite phosphate (Na13(ClO)(PO4)4) |
| 1313606 | Sodium peroxide (Na2(O2)) |
| 55248049 | Sodium peroxide (Na2(O2)) |
| 13966320 | Sodium, isotope of mass 22 |
| 14931261 | Sodium, isotope of mass 22 |
| 64742945 | Solvent naphtha (petroleum), heavy arom. |
| 64742956 | Solvent naphtha (petroleum), light arom. |
| 64742887 | Solvent naphtha (petroleum), medium aliph. |
| 1340858 | Sorbitan, mono-(9Z)-9-octadecenoate, poly(oxy-1,2-ethanediyl) derivs. |
| 8050837 | Sorbitan, mono-(9Z)-9-octadecenoate, poly(oxy-1,2-ethanediyl) derivs. |
| 9005656 | Sorbitan, mono-(9Z)-9-octadecenoate, poly(oxy-1,2-ethanediyl) derivs. |
| 9005678 | Sorbitan, mono-(9Z)-9-octadecenoate, poly(oxy-1,2-ethanediyl) derivs. |
| 9015070 | Sorbitan, mono-(9Z)-9-octadecenoate, poly(oxy-1,2-ethanediyl) derivs. |
| 9050491 | Sorbitan, mono-(9Z)-9-octadecenoate, poly(oxy-1,2-ethanediyl) derivs. |
| 9050571 | Sorbitan, mono-(9Z)-9-octadecenoate, poly(oxy-1,2-ethanediyl) derivs. |
| 37199238 | Sorbitan, mono-(9Z)-9-octadecenoate, poly(oxy-1,2-ethanediyl) derivs. |
| 37280845 | Sorbitan, mono-(9Z)-9-octadecenoate, poly(oxy-1,2-ethanediyl) derivs. |
| 51377276 | Sorbitan, mono-(9Z)-9-octadecenoate, poly(oxy-1,2-ethanediyl) derivs. |
| 61723759 | Sorbitan, mono-(9Z)-9-octadecenoate, poly(oxy-1,2-ethanediyl) derivs. |
| 141927233 | Sorbitan, mono-(9Z)-9-octadecenoate, poly(oxy-1,2-ethanediyl) derivs. |
| 178631964 | Sorbitan, mono-(9Z)-9-octadecenoate, poly(oxy-1,2-ethanediyl) derivs. |
| 209796634 | Sorbitan, mono-(9Z)-9-octadecenoate, poly(oxy-1,2-ethanediyl) derivs. |
| 253447346 | Sorbitan, mono-(9Z)-9-octadecenoate, poly(oxy-1,2-ethanediyl) derivs. |
| 361534352 | Sorbitan, mono-(9Z)-9-octadecenoate, poly(oxy-1,2-ethanediyl) derivs. |
| 541509664 | Sorbitan, mono-(9Z)-9-octadecenoate, poly(oxy-1,2-ethanediyl) derivs. |
| 900143897 | Sorbitan, mono-(9Z)-9-octadecenoate, poly(oxy-1,2-ethanediyl) derivs. |
| 1286269724 | Sorbitan, mono-(9Z)-9-octadecenoate, poly(oxy-1,2-ethanediyl) derivs. |
| 1341066 | Sorbitan, monododecanoate, poly(oxy-1,2-ethanediyl) derivs. |
| 8036826 | Sorbitan, monododecanoate, poly(oxy-1,2-ethanediyl) derivs. |
| 9005645 | Sorbitan, monododecanoate, poly(oxy-1,2-ethanediyl) derivs. |
| 9011307 | Sorbitan, monododecanoate, poly(oxy-1,2-ethanediyl) derivs. |
| 9015570 | Sorbitan, monododecanoate, poly(oxy-1,2-ethanediyl) derivs. |
| 37310966 | Sorbitan, monododecanoate, poly(oxy-1,2-ethanediyl) derivs. |
| 54174548 | Sorbitan, monododecanoate, poly(oxy-1,2-ethanediyl) derivs. |
| 60318549 | Sorbitan, monododecanoate, poly(oxy-1,2-ethanediyl) derivs. |
| 62229281 | Sorbitan, monododecanoate, poly(oxy-1,2-ethanediyl) derivs. |
| 93037366 | Sorbitan, monododecanoate, poly(oxy-1,2-ethanediyl) derivs. |
| 118955398 | Sorbitan, monododecanoate, poly(oxy-1,2-ethanediyl) derivs. |
| 122304318 | Sorbitan, monododecanoate, poly(oxy-1,2-ethanediyl) derivs. |
| 129428644 | Sorbitan, monododecanoate, poly(oxy-1,2-ethanediyl) derivs. |
| 194879920 | Sorbitan, monododecanoate, poly(oxy-1,2-ethanediyl) derivs. |
| 851015037 | Sorbitan, monododecanoate, poly(oxy-1,2-ethanediyl) derivs. |
| 861842355 | Sorbitan, monododecanoate, poly(oxy-1,2-ethanediyl) derivs. |
| 1242241457 | Sorbitan, monododecanoate, poly(oxy-1,2-ethanediyl) derivs. |
| 1302676 | Spinel (Mg(AlO2)2) |
| 93924744 | Spinel (Mg(AlO2)2) |
| 168316958 | Spinosad |
| 187473569 | Spinosad |
| 126078 | Spiro[benzofuran-2(3H),1'-[2]cyclohexene]-3,4'-dione, 7-chloro-2',4,6-trimethoxy-6'-methyl-, (1'S,6'R)- |
| 548265 | Spiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-one, 2',4',5',7'-tetrabromo-3',6'-dihydroxy-, sodium salt (1:2) |
| 1340154 | Spiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-one, 2',4',5',7'-tetrabromo-3',6'-dihydroxy-, sodium salt (1:2) |
| 12777832 | Spiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-one, 2',4',5',7'-tetrabromo-3',6'-dihydroxy-, sodium salt (1:2) |
| 17372871 | Spiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-one, 2',4',5',7'-tetrabromo-3',6'-dihydroxy-, sodium salt (1:2) |
| 37361243 | Spiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-one, 2',4',5',7'-tetrabromo-3',6'-dihydroxy-, sodium salt (1:2) |
| 56588875 | Spiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-one, 2',4',5',7'-tetrabromo-3',6'-dihydroxy-, sodium salt (1:2) |
| 84932332 | Spiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-one, 2',4',5',7'-tetrabromo-3',6'-dihydroxy-, sodium salt (1:2) |
| 95917832 | Spiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-one, 2',4',5',7'-tetrabromo-3',6'-dihydroxy-, sodium salt (1:2) |
| 122199148 | Spiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-one, 2',4',5',7'-tetrabromo-3',6'-dihydroxy-, sodium salt (1:2) |
| 198831980 | Spiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-one, 2',4',5',7'-tetrabromo-3',6'-dihydroxy-, sodium salt (1:2) |
| 528838893 | Spiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-one, 2',4',5',7'-tetrabromo-3',6'-dihydroxy-, sodium salt (1:2) |
| 658700915 | Spiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-one, 2',4',5',7'-tetrabromo-3',6'-dihydroxy-, sodium salt (1:2) |
| 518467 | Spiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-one, 3',6'-dihydroxy- |
| 2321075 | Spiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-one, 3',6'-dihydroxy- |
| 126605730 | Spiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-one, 3',6'-dihydroxy- |
| 213880865 | Spiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-one, 3',6'-dihydroxy- |
| 770677617 | Spiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-one, 3',6'-dihydroxy- |
| 518478 | Spiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-one, 3',6'-dihydroxy-, sodium salt (1:2) |
| 3266997 | Spiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-one, 3',6'-dihydroxy-, sodium salt (1:2) |
| 31949378 | Spiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-one, 3',6'-dihydroxy-, sodium salt (1:2) |
| 34517889 | Spiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-one, 3',6'-dihydroxy-, sodium salt (1:2) |
| 41935482 | Spiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-one, 3',6'-dihydroxy-, sodium salt (1:2) |
| 121511055 | Spiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-one, 3',6'-dihydroxy-, sodium salt (1:2) |
| 135354404 | Spiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-one, 3',6'-dihydroxy-, sodium salt (1:2) |
| 208117764 | Spiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-one, 3',6'-dihydroxy-, sodium salt (1:2) |
| 574737692 | Spiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-one, 3',6'-dihydroxy-, sodium salt (1:2) |
| 893427140 | Spiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-one, 3',6'-dihydroxy-, sodium salt (1:2) |
| 1279055252 | Spiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-one, 3',6'-dihydroxy-, sodium salt (1:2) |
| 1118463 | Stannane, butyltrichloro- |
| 639587 | Stannane, chlorotriphenyl- |
| 1185815 | Stannane, dibutylbis(dodecylthio)- |
| 39403640 | Stannane, dibutylbis(dodecylthio)- |
| 52434363 | Stannane, dibutylbis(dodecylthio)- |
| 74913294 | Stannane, dibutylbis(dodecylthio)- |
| 76879 | Stannane, hydroxytriphenyl- |
| 597648 | Stannane, tetraethyl- |
| 688733 | Stannane, tributyl- |
| 30115447 | Stannane, tributyl- |
| 1983104 | Stannane, tributylfluoro- |
| 13121705 | Stannane, tricyclohexylhydroxy- |
| 9005258 | Starch |
| 9057050 | Starch |
| 42616762 | Starch |
| 53112520 | Starch |
| 53262796 | Starch |
| 60496959 | Starch |
| 67674800 | Starch |
| 75138759 | Starch |
| 75398822 | Starch |
| 85746254 | Starch |
| 118550611 | Starch |
| 131800970 | Starch |
| 152987558 | Starch |
| 154636778 | Starch |
| 730985554 | Starch |
| 730985565 | Starch |
| 730985576 | Starch |
| 955949618 | Starch |
| 1374255250 | Starch |
| 7803523 | Stibine |
| 8030306 | Stoddard solvent |
| 8032324 | Stoddard solvent |
| 8052413 | Stoddard solvent |
| 1030262124 | Stoddard solvent |
| 8001501 | Strobane |
| 61789482 | Strobane |
| 7440246 | Strontium |
| 1314961 | Strontium sulfide (SrS) |
| 13967732 | Strontium, isotope of mass 85 |
| 14158271 | Strontium, isotope of mass 89 |
| 10098972 | Strontium, isotope of mass 90 |
| 37380964 | Strontium, isotope of mass 90 |
| 57249 | Strychnidin-10-one |
| 6899112 | Strychnidin-10-one |
| 101324338 | Strychnidin-10-one |
| 525584401 | Strychnidin-10-one |
| 854644965 | Strychnidin-10-one |
| 875538264 | Strychnidin-10-one |
| 900786574 | Strychnidin-10-one |
| 936009288 | Strychnidin-10-one |
| 1194719362 | Strychnidin-10-one |
| 357573 | Strychnidin-10-one, 2,3-dimethoxy- |
| 54193327 | Strychnidin-10-one, 2,3-dimethoxy- |
| 70206610 | Strychnidin-10-one, 2,3-dimethoxy- |
| 101324327 | Strychnidin-10-one, 2,3-dimethoxy- |
| 193198037 | Strychnidin-10-one, 2,3-dimethoxy- |
| 462651430 | Strychnidin-10-one, 2,3-dimethoxy- |
| 1087723678 | Strychnidin-10-one, 2,3-dimethoxy- |
| 1195340330 | Strychnidin-10-one, 2,3-dimethoxy- |
| 1195623198 | Strychnidin-10-one, 2,3-dimethoxy- |
| 57249 | Strychnidin-10-one, and salts |
| 60413 | Strychnidin-10-one, sulfate (2:1) |
| 125177 | Strychnidin-10-one, sulfate (2:1) |
| 1395217 | Subtilisin |
| 2392429 | Subtilisin |
| 9014011 | Subtilisin |
| 9028051 | Subtilisin |
| 9031736 | Subtilisin |
| 9045367 | Subtilisin |
| 9063472 | Subtilisin |
| 9067418 | Subtilisin |
| 12626209 | Subtilisin |
| 12770875 | Subtilisin |
| 104645854 | Subtilisin |
| 148093327 | Subtilisin |
| 179530315 | Subtilisin |
| 196414343 | Subtilisin |
| 213972066 | Subtilisin |
| 1349805215 | Subtilisin |
| 100889 | Sulfamic acid, N-cyclohexyl- |
| 45951459 | Sulfamic acid, N-cyclohexyl- |
| 139059 | Sulfamic acid, N-cyclohexyl-, sodium salt (1:1) |
| 53170915 | Sulfamic acid, N-cyclohexyl-, sodium salt (1:1) |
| 61373782 | Sulfamic acid, N-cyclohexyl-, sodium salt (1:1) |
| 7773060 | Sulfamic acid, ammonium salt (1:1) |
| 14808798 | Sulfate |
| 18496258 | Sulfide |
| 14265453 | Sulfite |
| 7704349 | Sulfur |
| 7782458 | Sulfur |
| 8050826 | Sulfur |
| 12673824 | Sulfur |
| 12684310 | Sulfur |
| 12767247 | Sulfur |
| 56449526 | Sulfur |
| 56591094 | Sulfur |
| 56645308 | Sulfur |
| 57035139 | Sulfur |
| 63705055 | Sulfur |
| 81032328 | Sulfur |
| 97124077 | Sulfur |
| 10025679 | Sulfur chloride (S2Cl2) |
| 12771083 | Sulfur chloride (S2Cl2) |
| 7446095 | Sulfur dioxide |
| 8014946 | Sulfur dioxide |
| 12396995 | Sulfur dioxide |
| 83008564 | Sulfur dioxide |
| 89125893 | Sulfur dioxide |
| 1239882826 | Sulfur dioxide |
| 5714227 | Sulfur fluoride (S2F10) |
| 7783600 | Sulfur fluoride (SF4), (T-4)- |
| 2551624 | Sulfur fluoride (SF6), (OC-6-11)- |
| 29267821 | Sulfur fluoride (SF6), (OC-6-11)- |
| 36575038 | Sulfur fluoride (SF6), (OC-6-11)- |
| 59109692 | Sulfur fluoride (SF6), (OC-6-11)- |
| 12624327 | Sulfur oxide |
| 7446119 | Sulfur trioxide |
| 856577623 | Sulfur trioxide |
| 15117530 | Sulfur, isotope of mass 35 |
| 7664935 | Sulfuric acid |
| 7664939 | Sulfuric acid |
| 8014957 | Sulfuric acid |
| 119540511 | Sulfuric acid |
| 127529015 | Sulfuric acid |
| 140623707 | Sulfuric acid |
| 7783202 | Sulfuric acid ammonium salt (1:2) |
| 44071934 | Sulfuric acid ammonium salt (1:2) |
| 57973736 | Sulfuric acid ammonium salt (1:2) |
| 64006537 | Sulfuric acid ammonium salt (1:2) |
| 82168614 | Sulfuric acid ammonium salt (1:2) |
| 122364221 | Sulfuric acid ammonium salt (1:2) |
| 122393139 | Sulfuric acid ammonium salt (1:2) |
| 428816324 | Sulfuric acid ammonium salt (1:2) |
| 7758987 | Sulfuric acid copper(2+) salt (1:1) |
| 139939698 | Sulfuric acid copper(2+) salt (1:1) |
| 151213 | Sulfuric acid monododecyl ester sodium salt (1:1) |
| 1334674 | Sulfuric acid monododecyl ester sodium salt (1:1) |
| 1335724 | Sulfuric acid monododecyl ester sodium salt (1:1) |
| 8012564 | Sulfuric acid monododecyl ester sodium salt (1:1) |
| 8048564 | Sulfuric acid monododecyl ester sodium salt (1:1) |
| 12738533 | Sulfuric acid monododecyl ester sodium salt (1:1) |
| 12765218 | Sulfuric acid monododecyl ester sodium salt (1:1) |
| 39384366 | Sulfuric acid monododecyl ester sodium salt (1:1) |
| 51222390 | Sulfuric acid monododecyl ester sodium salt (1:1) |
| 57176542 | Sulfuric acid monododecyl ester sodium salt (1:1) |
| 58640350 | Sulfuric acid monododecyl ester sodium salt (1:1) |
| 61711395 | Sulfuric acid monododecyl ester sodium salt (1:1) |
| 64441334 | Sulfuric acid monododecyl ester sodium salt (1:1) |
| 74433775 | Sulfuric acid monododecyl ester sodium salt (1:1) |
| 111726875 | Sulfuric acid monododecyl ester sodium salt (1:1) |
| 121481649 | Sulfuric acid monododecyl ester sodium salt (1:1) |
| 129203378 | Sulfuric acid monododecyl ester sodium salt (1:1) |
| 145269449 | Sulfuric acid monododecyl ester sodium salt (1:1) |
| 152155527 | Sulfuric acid monododecyl ester sodium salt (1:1) |
| 156108019 | Sulfuric acid monododecyl ester sodium salt (1:1) |
| 172826721 | Sulfuric acid monododecyl ester sodium salt (1:1) |
| 191490401 | Sulfuric acid monododecyl ester sodium salt (1:1) |
| 210297215 | Sulfuric acid monododecyl ester sodium salt (1:1) |
| 237743452 | Sulfuric acid monododecyl ester sodium salt (1:1) |
| 303179499 | Sulfuric acid monododecyl ester sodium salt (1:1) |
| 877454245 | Sulfuric acid monododecyl ester sodium salt (1:1) |
| 952055377 | Sulfuric acid monododecyl ester sodium salt (1:1) |
| 952092909 | Sulfuric acid monododecyl ester sodium salt (1:1) |
| 1000201728 | Sulfuric acid monododecyl ester sodium salt (1:1) |
| 1000201739 | Sulfuric acid monododecyl ester sodium salt (1:1) |
| 7778805 | Sulfuric acid potassium salt (1:2) |
| 1337286 | Sulfuric acid sodium salt (1:2) |
| 7757826 | Sulfuric acid sodium salt (1:2) |
| 856314017 | Sulfuric acid sodium salt (1:2) |
| 1079994549 | Sulfuric acid sodium salt (1:2) |
| 7784250 | Sulfuric acid, aluminum ammonium salt (2:1:1) |
| 7784261 | Sulfuric acid, aluminum ammonium salt (2:1:1), dodecahydrate |
| 10043671 | Sulfuric acid, aluminum potassium salt (2:1:1) |
| 131315496 | Sulfuric acid, aluminum potassium salt (2:1:1) |
| 10043013 | Sulfuric acid, aluminum salt (3:2) |
| 19239715 | Sulfuric acid, aluminum salt (3:2) |
| 22515373 | Sulfuric acid, aluminum salt (3:2) |
| 66578721 | Sulfuric acid, aluminum salt (3:2) |
| 121739795 | Sulfuric acid, aluminum salt (3:2) |
| 124027276 | Sulfuric acid, aluminum salt (3:2) |
| 139939734 | Sulfuric acid, aluminum salt (3:2) |
| 10102713 | Sulfuric acid, aluminum sodium salt (2:1:1) |
| 7727437 | Sulfuric acid, barium salt (1:1) |
| 8054351 | Sulfuric acid, barium salt (1:1) |
| 12751325 | Sulfuric acid, barium salt (1:1) |
| 1314087223 | Sulfuric acid, barium salt (1:1) |
| 1352053725 | Sulfuric acid, barium salt (1:1) |
| 1400694372 | Sulfuric acid, barium salt (1:1) |
| 13510491 | Sulfuric acid, beryllium salt (1:1) |
| 7787566 | Sulfuric acid, beryllium salt (1:1), tetrahydrate |
| 2973106 | Sulfuric acid, bis(1-methylethyl) ester |
| 10124364 | Sulfuric acid, cadmium salt (1:1) |
| 62642073 | Sulfuric acid, cadmium salt (1:1) |
| 7778189 | Sulfuric acid, calcium salt (1:1) |
| 23296153 | Sulfuric acid, calcium salt (1:1) |
| 99400018 | Sulfuric acid, calcium salt (1:1) |
| 146522670 | Sulfuric acid, calcium salt (1:1) |
| 151621691 | Sulfuric acid, calcium salt (1:1) |
| 326855678 | Sulfuric acid, calcium salt (1:1) |
| 871982240 | Sulfuric acid, calcium salt (1:1) |
| 1314087187 | Sulfuric acid, calcium salt (1:1) |
| 1428662161 | Sulfuric acid, calcium salt (1:1) |
| 10026241 | Sulfuric acid, cobalt(2+) salt (1:1), heptahydrate |
| 17599814 | Sulfuric acid, copper(1+) salt (1:2) |
| 31207097 | Sulfuric acid, copper(1+) salt (1:2) |
| 64675 | Sulfuric acid, diethyl ester |
| 98503298 | Sulfuric acid, diethyl ester |
| 182115044 | Sulfuric acid, diethyl ester |
| 77781 | Sulfuric acid, dimethyl ester |
| 62086979 | Sulfuric acid, dimethyl ester |
| 98478672 | Sulfuric acid, dimethyl ester |
| 139443724 | Sulfuric acid, dimethyl ester |
| 7720787 | Sulfuric acid, iron(2+) salt (1:1) |
| 8060182 | Sulfuric acid, iron(2+) salt (1:1) |
| 8063794 | Sulfuric acid, iron(2+) salt (1:1) |
| 56172588 | Sulfuric acid, iron(2+) salt (1:1) |
| 139939632 | Sulfuric acid, iron(2+) salt (1:1) |
| 10028225 | Sulfuric acid, iron(3+) salt (3:2) |
| 497092383 | Sulfuric acid, iron(3+) salt (3:2) |
| 1299332629 | Sulfuric acid, iron(3+) salt (3:2) |
| 15739807 | Sulfuric acid, lead salt (1:?) |
| 7446142 | Sulfuric acid, lead(2+) salt (1:1) |
| 12673937 | Sulfuric acid, lead(2+) salt (1:1) |
| 37223839 | Sulfuric acid, lead(2+) salt (1:1) |
| 37224423 | Sulfuric acid, lead(2+) salt (1:1) |
| 37251288 | Sulfuric acid, lead(2+) salt (1:1) |
| 13826567 | Sulfuric acid, magnesium potassium salt (3:2:2) |
| 99332497 | Sulfuric acid, magnesium potassium salt (3:2:2) |
| 10034965 | Sulfuric acid, manganese(2+) salt (1:1) monohydrate |
| 8014957 | Sulfuric acid, mixt. with sulfur trioxide |
| 17107618 | Sulfuric acid, mixt. with sulfur trioxide |
| 126921 | Sulfuric acid, mono(2-ethylhexyl) ester, sodium salt (1:1) |
| 11099084 | Sulfuric acid, mono(2-ethylhexyl) ester, sodium salt (1:1) |
| 75037319 | Sulfuric acid, mono(2-ethylhexyl) ester, sodium salt (1:1) |
| 778614 | Sulfuric acid, nickel(2+) salt (1:1) |
| 7786814 | Sulfuric acid, nickel(2+) salt (1:1) |
| 139939676 | Sulfuric acid, nickel(2+) salt (1:1) |
| 10101970 | Sulfuric acid, nickel(2+) salt (1:1), hexahydrate |
| 7631905 | Sulfuric acid, sodium salt (1:1) |
| 7681381 | Sulfuric acid, sodium salt (1:1) |
| 12262565 | Sulfuric acid, sodium salt (1:1) |
| 7446186 | Sulfuric acid, thallium(1+) salt (1:2) |
| 14012921 | Sulfuric acid, thallium(1+) salt (1:2) |
| 37333305 | Sulfuric acid, thallium(1+) salt (1:2) |
| 87993826 | Sulfuric acid, thallium(1+) salt (1:2) |
| 7733020 | Sulfuric acid, zinc salt (1:1) |
| 131315463 | Sulfuric acid, zinc salt (1:1) |
| 139939712 | Sulfuric acid, zinc salt (1:1) |
| 873788002 | Sulfuric acid, zinc salt (1:1) |
| 1942718 | Sulfurous acid, 2-[4-(1,1-dimethylethyl)phenoxy]cyclohexyl 2-propynyl ester |
| 2312358 | Sulfurous acid, 2-[4-(1,1-dimethylethyl)phenoxy]cyclohexyl 2-propynyl ester |
| 60098535 | Sulfurous acid, 2-[4-(1,1-dimethylethyl)phenoxy]cyclohexyl 2-propynyl ester |
| 140578 | Sulfurous acid, 2-chloroethyl 2-[4-(1,1-dimethylethyl)phenoxy]-1-methylethyl ester |
| 7631905 | Sulfurous acid, sodium salt (1:1) |
| 57414014 | Sulfurous acid, sodium salt (1:1) |
| 69098868 | Sulfurous acid, sodium salt (1:1) |
| 89830273 | Sulfurous acid, sodium salt (1:1) |
| 91829639 | Sulfurous acid, sodium salt (1:1) |
| 855427075 | Sulfurous acid, sodium salt (1:1) |
| 855924731 | Sulfurous acid, sodium salt (1:1) |
| 7791255 | Sulfuryl chloride |
| 2699798 | Sulfuryl fluoride |
| 8043569 | Talc (Mg3H2(SiO3)4) |
| 11119418 | Talc (Mg3H2(SiO3)4) |
| 12420121 | Talc (Mg3H2(SiO3)4) |
| 14807966 | Talc (Mg3H2(SiO3)4) |
| 37232125 | Talc (Mg3H2(SiO3)4) |
| 99638638 | Talc (Mg3H2(SiO3)4) |
| 110540415 | Talc (Mg3H2(SiO3)4) |
| 184973420 | Talc (Mg3H2(SiO3)4) |
| 1170673661 | Talc (Mg3H2(SiO3)4) |
| 7440257 | Tantalum |
| 13982008 | Tantalum, isotope of mass 182 |
| 68952352 | Tar acids, cresylic, Ph phosphates |
| 8001589 | Tar, coal |
| 8007452 | Tar, coal |
| 8050417 | Tar, coal |
| 8050439 | Tar, coal |
| 8055923 | Tar, coal |
| 65996909 | Tar, coal, low-temp. |
| 39300884 | Tara gum |
| 14808447 | Technetium, isotope of mass 96 |
| 15759350 | Technetium, isotope of mass 97 |
| 15759350 | Technetium, isotope of mass 97m(90.1 d) |
| 378784442 | Technetium, isotope of mass 97m(90.1 d) |
| 7440268 | Technetium, isotope of mass 99 |
| 14133767 | Technetium, isotope of mass 99 |
| 14133767 | Technetium, isotope of mass 99m(6.01 h) |
| 378784453 | Technetium, isotope of mass 99m(6.01 h) |
| 10102202 | Telluric acid (H2TeO3), sodium salt (1:2) |
| 13494809 | Tellurium |
| 137322204 | Tellurium |
| 7783804 | Tellurium fluoride (TeF6), (OC-6-11)- |
| 14390739 | Tellurium, isotope of mass 125m(57.4 d) |
| 378784500 | Tellurium, isotope of mass 125m(57.4 d) |
| 13981492 | Tellurium, isotope of mass 127 |
| 13981492 | Tellurium, isotope of mass 127m(109 d) |
| 378784511 | Tellurium, isotope of mass 127m(109 d) |
| 14269717 | Tellurium, isotope of mass 129 |
| 14269717 | Tellurium, isotope of mass 129m(33.6 d) |
| 378784522 | Tellurium, isotope of mass 129m(33.6 d) |
| 14234287 | Tellurium, isotope of mass 132 |
| 12367496 | Tellurium, tetrakis(N,N-diethylcarbamodithioato-.kappa.S,.kappa.S')-, (DD-8-111''1''1'1'1'''1''')- |
| 20941655 | Tellurium, tetrakis(N,N-diethylcarbamodithioato-.kappa.S,.kappa.S')-, (DD-8-111''1''1'1'1'''1''')- |
| 30145381 | Tellurium, tetrakis(N,N-diethylcarbamodithioato-.kappa.S,.kappa.S')-, (DD-8-111''1''1'1'1'''1''')- |
| 35745756 | Tellurium, tetrakis(N,N-diethylcarbamodithioato-.kappa.S,.kappa.S')-, (DD-8-111''1''1'1'1'''1''')- |
| 84135966 | Tellurium, tetrakis(N,N-diethylcarbamodithioato-.kappa.S,.kappa.S')-, (DD-8-111''1''1'1'1'''1''')- |
| 105425534 | Tellurium, tetrakis(N,N-diethylcarbamodithioato-.kappa.S,.kappa.S')-, (DD-8-111''1''1'1'1'''1''')- |
| 107129431 | Tellurium, tetrakis(N,N-diethylcarbamodithioato-.kappa.S,.kappa.S')-, (DD-8-111''1''1'1'1'''1''')- |
| 109973855 | Tellurium, tetrakis(N,N-diethylcarbamodithioato-.kappa.S,.kappa.S')-, (DD-8-111''1''1'1'1'''1''')- |
| 116836045 | Tellurium, tetrakis(N,N-diethylcarbamodithioato-.kappa.S,.kappa.S')-, (DD-8-111''1''1'1'1'''1''')- |
| 13981298 | Terbium, isotope of mass 160 |
| 1323042 | Terphenyl |
| 26140603 | Terphenyl |
| 61788338 | Terphenyl, chlorinated |
| 92944 | Terphenyl, hydrogenated |
| 95944 | Terphenyl, hydrogenated |
| 61788327 | Terphenyl, hydrogenated |
| 8000417 | Terpineol |
| 8006391 | Terpineol |
| 8031321 | Terpineol |
| 11103961 | Terpineol |
| 37195010 | Terpineol |
| 646311 | Tetracosane |
| 629594 | Tetradecane |
| 544638 | Tetradecanoic acid |
| 45184052 | Tetradecanoic acid |
| 57716899 | Tetradecanoic acid, (1aR,1bS,4aR,7aS,7bS,8R,9R,9aS)-9a-(acetyloxy)-1a,1b,4,4a,5,7a,7b,8,9,9a-decahydro-7b-hydroxy-3-(hydroxymethyl)-4a-methoxy-1,1,6,8-tetramethyl-5-oxo-1H-cyclopropa[3,4]benz[1,2-e]azulen-9-yl ester |
| 16561298 | Tetradecanoic acid, 9a-(acetyloxy)-1a,1b,4,4a,5,7a,7b,8,9, 9a-decahydro-4a,7b-dihydroxy-3-(hydroxymethyl)-1,1,6,8-tetramethyl-5-oxo-1H-cyclopropa(3,4)benz(1,2-e)azulen-9-yl ester, (1aR-(1aa,1bb,4ab,7aa,7ba, 8a,9b,9aa))- |
| 757584 | Tetraphosphoric acid, hexaethyl ester |
| 69155426 | Tetrasiloxane, 1,1,1,3,5,7,7,7-octamethyl-3,5-bis[3-(2-oxiranylmethoxy)propyl]- |
| 7440280 | Thallium |
| 82870813 | Thallium |
| 113835497 | Thallium |
| 623903275 | Thallium |
| 7791120 | Thallium chloride (TlCl) |
| 1314325 | Thallium oxide (Tl2O3) |
| 13968519 | Thallium, isotope of mass 204 |
| 14913509 | Thallium, isotope of mass 208 |
| 288471 | Thiazole |
| 857224454 | Thiazole |
| 302045 | Thiocyanate |
| 1111688 | Thiocyanate |
| 37223055 | Thiocyanate |
| 60168458 | Thiocyanate |
| 60773559 | Thiocyanate |
| 62476953 | Thiocyanate |
| 69924385 | Thiocyanate |
| 70874952 | Thiocyanate |
| 81210017 | Thiocyanate |
| 21564170 | Thiocyanic acid, (2-benzothiazolylthio)methyl ester |
| 24689892 | Thiocyanic acid, 1-chloro-1,2-ethanediyl ester |
| 112561 | Thiocyanic acid, 2-(2-butoxyethoxy)ethyl ester |
| 301111 | Thiocyanic acid, 2-(2-butoxyethoxy)ethyl ester |
| 6317186 | Thiocyanic acid, C,C'-methylene ester |
| 542905 | Thiocyanic acid, ethyl ester |
| 556649 | Thiocyanic acid, methyl ester |
| 540727 | Thiocyanic acid, sodium salt (1:1) |
| 13249871 | Thiocyanic acid, sodium salt (1:1) |
| 104345122 | Thiocyanic acid, sodium salt (1:1) |
| 885623983 | Thiocyanic acid, sodium salt (1:1) |
| 3689245 | Thiodiphosphoric acid ([(HO)2P(S)]2O), tetraethyl ester |
| 8054282 | Thiodiphosphoric acid ([(HO)2P(S)]2O), tetraethyl ester |
| 3244904 | Thiodiphosphoric acid ([(HO)2P(S)]2O), tetrapropyl ester |
| 541537 | Thioimidodicarbonic diamide ([(H2N)C(S)]2NH) |
| 26641952 | Thioimidodicarbonic diamide ([(H2N)C(S)]2NH) |
| 2125597 | Thionyl chloride |
| 7719097 | Thionyl chloride |
| 97778 | Thioperoxydicarbonic diamide ([(H2N)C(S)]2S2), N,N,N',N'-tetraethyl- |
| 155011 | Thioperoxydicarbonic diamide ([(H2N)C(S)]2S2), N,N,N',N'-tetraethyl- |
| 11078221 | Thioperoxydicarbonic diamide ([(H2N)C(S)]2S2), N,N,N',N'-tetraethyl- |
| 137268 | Thioperoxydicarbonic diamide ([(H2N)C(S)]2S2), N,N,N',N'-tetramethyl- |
| 12680078 | Thioperoxydicarbonic diamide ([(H2N)C(S)]2S2), N,N,N',N'-tetramethyl- |
| 12680625 | Thioperoxydicarbonic diamide ([(H2N)C(S)]2S2), N,N,N',N'-tetramethyl- |
| 39456809 | Thioperoxydicarbonic diamide ([(H2N)C(S)]2S2), N,N,N',N'-tetramethyl- |
| 56645319 | Thioperoxydicarbonic diamide ([(H2N)C(S)]2S2), N,N,N',N'-tetramethyl- |
| 66173726 | Thioperoxydicarbonic diamide ([(H2N)C(S)]2S2), N,N,N',N'-tetramethyl- |
| 92481099 | Thioperoxydicarbonic diamide ([(H2N)C(S)]2S2), N,N,N',N'-tetramethyl- |
| 93196737 | Thioperoxydicarbonic diamide ([(H2N)C(S)]2S2), N,N,N',N'-tetramethyl- |
| 200889050 | Thioperoxydicarbonic diamide ([(H2N)C(S)]2S2), N,N,N',N'-tetramethyl- |
| 1135443081 | Thioperoxydicarbonic diamide ([(H2N)C(S)]2S2), N,N,N',N'-tetramethyl- |
| 110021 | Thiophene |
| 8014231 | Thiophene |
| 77792 | Thiophene, 2,5-dihydro-, 1,1-dioxide |
| 126330 | Thiophene, tetrahydro-, 1,1-dioxide |
| 208252544 | Thiophene, tetrahydro-, 1,1-dioxide |
| 14383507 | Thiosulfate (S2O32-) |
| 15566479 | Thiosulfate (S2O32-) |
| 77387725 | Thiosulfate (S2O32-) |
| 7783188 | Thiosulfuric acid (H2S2O3), ammonium salt (1:2) |
| 15824314 | Thiosulfuric acid (H2S2O3), ammonium salt (1:2) |
| 62566 | Thiourea |
| 1032826451 | Thiourea |
| 1212299 | Thiourea, N,N'-dicyclohexyl- |
| 105555 | Thiourea, N,N'-diethyl- |
| 27598954 | Thiourea, N,N'-diethyl- |
| 534134 | Thiourea, N,N'-dimethyl- |
| 88001916 | Thiourea, N,N'-dimethyl- |
| 102089 | Thiourea, N,N'-diphenyl- |
| 3898086 | Thiourea, N,N'-diphenyl- |
| 2782914 | Thiourea, N,N,N',N'-tetramethyl- |
| 2489772 | Thiourea, N,N,N'-trimethyl- |
| 5344821 | Thiourea, N-(2-chlorophenyl)- |
| 86884 | Thiourea, N-1-naphthalenyl- |
| 109579 | Thiourea, N-2-propen-1-yl- |
| 103855 | Thiourea, N-phenyl- |
| 4189440 | Thiourea, S,S-dioxide |
| 7440291 | Thorium |
| 15117563 | Thorium |
| 24738305 | Thorium |
| 1314201 | Thorium oxide (ThO2) |
| 8006335 | Thorium oxide (ThO2) |
| 34321998 | Thorium oxide (ThO2) |
| 15623479 | Thorium, isotope of mass 227 |
| 14274829 | Thorium, isotope of mass 228 |
| 14269637 | Thorium, isotope of mass 230 |
| 15065108 | Thorium, isotope of mass 234 |
| 13981301 | Thulium, isotope of mass 170 |
| 14333450 | Thulium, isotope of mass 171 |
| 7440315 | Tin |
| 7772998 | Tin chloride (SnCl2) |
| 12306284 | Tin chloride (SnCl2) |
| 752749 | Tin, (2,4,6-trioxo-s-triazine-1,3,5(2H,4H,6H)-triyl)tris[triphenyl- |
| 13966068 | Tin, isotope of mass 113 |
| 14683079 | Tin, isotope of mass 123 |
| 14683080 | Tin, isotope of mass 125 |
| 7440326 | Titanium |
| 7550450 | Titanium |
| 53549909 | Titanium |
| 54319516 | Titanium |
| 57854372 | Titanium |
| 62650708 | Titanium |
| 67796945 | Titanium |
| 182260486 | Titanium |
| 195161810 | Titanium |
| 7550450 | Titanium chloride (TiCl4) (T-4)- |
| 7750450 | Titanium chloride (TiCl4) (T-4)- |
| 15612712 | Titanium chloride (TiCl4) (T-4)- |
| 44246222 | Titanium chloride (TiCl4) (T-4)- |
| 1309633 | Titanium oxide (TiO2) |
| 1344292 | Titanium oxide (TiO2) |
| 12000598 | Titanium oxide (TiO2) |
| 12701767 | Titanium oxide (TiO2) |
| 12767656 | Titanium oxide (TiO2) |
| 12789638 | Titanium oxide (TiO2) |
| 13463677 | Titanium oxide (TiO2) |
| 37230925 | Titanium oxide (TiO2) |
| 37230947 | Titanium oxide (TiO2) |
| 37230958 | Titanium oxide (TiO2) |
| 37230969 | Titanium oxide (TiO2) |
| 39320586 | Titanium oxide (TiO2) |
| 39360640 | Titanium oxide (TiO2) |
| 39379027 | Titanium oxide (TiO2) |
| 52624132 | Titanium oxide (TiO2) |
| 55068843 | Titanium oxide (TiO2) |
| 55068854 | Titanium oxide (TiO2) |
| 62338641 | Titanium oxide (TiO2) |
| 97929505 | Titanium oxide (TiO2) |
| 98084969 | Titanium oxide (TiO2) |
| 100292328 | Titanium oxide (TiO2) |
| 101239536 | Titanium oxide (TiO2) |
| 116788853 | Titanium oxide (TiO2) |
| 158518866 | Titanium oxide (TiO2) |
| 185323711 | Titanium oxide (TiO2) |
| 185828915 | Titanium oxide (TiO2) |
| 188357768 | Titanium oxide (TiO2) |
| 188357791 | Titanium oxide (TiO2) |
| 195740115 | Titanium oxide (TiO2) |
| 221548987 | Titanium oxide (TiO2) |
| 224963002 | Titanium oxide (TiO2) |
| 246178325 | Titanium oxide (TiO2) |
| 252962417 | Titanium oxide (TiO2) |
| 416845437 | Titanium oxide (TiO2) |
| 494848076 | Titanium oxide (TiO2) |
| 494848236 | Titanium oxide (TiO2) |
| 494851773 | Titanium oxide (TiO2) |
| 494851988 | Titanium oxide (TiO2) |
| 552316515 | Titanium oxide (TiO2) |
| 767341004 | Titanium oxide (TiO2) |
| 859528124 | Titanium oxide (TiO2) |
| 861455289 | Titanium oxide (TiO2) |
| 861455303 | Titanium oxide (TiO2) |
| 866531400 | Titanium oxide (TiO2) |
| 946525059 | Titanium oxide (TiO2) |
| 1025343796 | Titanium oxide (TiO2) |
| 1205638498 | Titanium oxide (TiO2) |
| 1236143411 | Titanium oxide (TiO2) |
| 1377807265 | Titanium oxide (TiO2) |
| 1393678131 | Titanium oxide (TiO2) |
| 1400974175 | Titanium oxide (TiO2) |
| 1415904107 | Titanium oxide (TiO2) |
| 1456717159 | Titanium oxide (TiO2) |
| 1271198 | Titanium, dichlorobis(.eta.5-2,4-cyclopentadien-1-yl)- |
| 30311536 | Titanium, dichlorobis(.eta.5-2,4-cyclopentadien-1-yl)- |
| 1406662 | Tocopherols |
| 8001352 | Toxaphene |
| 8022046 | Toxaphene |
| 12687422 | Toxaphene |
| 12698985 | Toxaphene |
| 12770206 | Toxaphene |
| 37226112 | Toxaphene |
| 56645284 | Toxaphene |
| 638686 | Triacontane |
| 638675 | Tricosane |
| 629505 | Tridecane |
| 1317948 | Tridymite (SiO2) |
| 12414709 | Tridymite (SiO2) |
| 15468323 | Tridymite (SiO2) |
| 7758294 | Triphosphoric acid, sodium salt (1:5) |
| 9010086 | Triphosphoric acid, sodium salt (1:5) |
| 187620231 | Triphosphoric acid, sodium salt (1:5) |
| 860389180 | Triphosphoric acid, sodium salt (1:5) |
| 1350716072 | Triphosphoric acid, sodium salt (1:5) |
| 10028178 | Tritium |
| 7440337 | Tungsten |
| 37374906 | Tungsten |
| 7440337 | Tungsten and compounds |
| 11130737 | Tungsten carbide (WC) |
| 12070121 | Tungsten carbide (WC) |
| 52555870 | Tungsten carbide (WC) |
| 182169080 | Tungsten carbide (WC) |
| 182169115 | Tungsten carbide (WC) |
| 188300427 | Tungsten carbide (WC) |
| 188300438 | Tungsten carbide (WC) |
| 188300449 | Tungsten carbide (WC) |
| 188300450 | Tungsten carbide (WC) |
| 1314358 | Tungsten oxide (WO3) |
| 1328661 | Tungsten oxide (WO3) |
| 12165161 | Tungsten oxide (WO3) |
| 12165376 | Tungsten oxide (WO3) |
| 12165456 | Tungsten oxide (WO3) |
| 12737756 | Tungsten oxide (WO3) |
| 30445728 | Tungsten oxide (WO3) |
| 160637489 | Tungsten oxide (WO3) |
| 530099640 | Tungsten oxide (WO3) |
| 611206703 | Tungsten oxide (WO3) |
| 627811636 | Tungsten oxide (WO3) |
| 1344994393 | Tungsten oxide (WO3) |
| 15749469 | Tungsten, isotope of mass 181 |
| 14932413 | Tungsten, isotope of mass 185 |
| 14983483 | Tungsten, isotope of mass 187 |
| 806642 | Turpentine |
| 8006642 | Turpentine |
| 9000548 | Turpentine |
| 9005907 | Turpentine |
| 64827152 | Turpentine |
| 1120214 | Undecane |
| 2432997 | Undecanoic acid, 11-amino- |
| 84029947 | Undecanoic acid, 11-amino- |
| 7440611 | Uranium |
| 24678828 | Uranium |
| 1240656487 | Uranium |
| 10049146 | Uranium fluoride (UF4), (T-4)- |
| 13966295 | Uranium, isotope of mass 234 |
| 15117961 | Uranium, isotope of mass 235 |
| 13982702 | Uranium, isotope of mass 236 |
| 220861621 | Uranyl ion(3+) |
| 57136 | Urea |
| 30535503 | Urea |
| 118548064 | Urea |
| 860639561 | Urea |
| 1202865460 | Urea |
| 1228376382 | Urea |
| 150696 | Urea, (4-ethoxyphenyl)- |
| 622515 | Urea, (4-methylphenyl)- |
| 139946 | Urea, 1-ethyl-3-(5-nitro-2-thiazolyl)- |
| 24370250 | Urea, 1H-benzimidazol-2-yl- |
| 330541 | Urea, N'-(3,4-dichlorophenyl)-N,N-dimethyl- |
| 330552 | Urea, N'-(3,4-dichlorophenyl)-N,N-dimethyl- |
| 56449184 | Urea, N'-(3,4-dichlorophenyl)-N,N-dimethyl- |
| 102962298 | Urea, N'-(3,4-dichlorophenyl)-N,N-dimethyl- |
| 127641752 | Urea, N'-(3,4-dichlorophenyl)-N,N-dimethyl- |
| 150825448 | Urea, N'-(3,4-dichlorophenyl)-N,N-dimethyl- |
| 201749624 | Urea, N'-(3,4-dichlorophenyl)-N,N-dimethyl- |
| 330552 | Urea, N'-(3,4-dichlorophenyl)-N-methoxy-N-methyl- |
| 56645875 | Urea, N'-(3,4-dichlorophenyl)-N-methoxy-N-methyl- |
| 150685 | Urea, N'-(4-chlorophenyl)-N,N-dimethyl- |
| 1982474 | Urea, N'-[4-(4-chlorophenoxy)phenyl]-N,N-dimethyl- |
| 18168019 | Urea, N'-ethyl-N,N-diphenyl- |
| 13114722 | Urea, N'-methyl-N,N-diphenyl- |
| 64216202 | Urea, N,N'-bis(2-benzothiazolylmercaptomethyl)- |
| 154938 | Urea, N,N'-bis(2-chloroethyl)-N-nitroso- |
| 85983 | Urea, N,N'-diethyl-N,N'-diphenyl- |
| 686680 | Urea, N,N'-dihydroxy- |
| 96311 | Urea, N,N'-dimethyl- |
| 475470598 | Urea, N,N'-dimethyl- |
| 102078 | Urea, N,N'-diphenyl- |
| 632224 | Urea, N,N,N',N'-tetramethyl- |
| 2164172 | Urea, N,N-dimethyl-N'-[3-(trifluoromethyl)phenyl]- |
| 101428 | Urea, N,N-dimethyl-N'-phenyl- |
| 603543 | Urea, N,N-diphenyl- |
| 13909096 | Urea, N-(2-chloroethyl)-N'-(4-methylcyclohexyl)-N-nitroso- |
| 1982496 | Urea, N-(2-methylcyclohexyl)-N'-phenyl- |
| 101202 | Urea, N-(4-chlorophenyl)-N'-(3,4-dichlorophenyl)- |
| 6406282 | Urea, N-(4-nitrophenyl)-N'-(3-pyridinylmethyl)- |
| 53558251 | Urea, N-(4-nitrophenyl)-N'-(3-pyridinylmethyl)- |
| 64060282 | Urea, N-(4-nitrophenyl)-N'-(3-pyridinylmethyl)- |
| 557119 | Urea, N-2-propen-1-yl- |
| 34014181 | Urea, N-[5-(1,1-dimethylethyl)-1,3,4-thiadiazol-2-yl]-N,N'-dimethyl- |
| 592314 | Urea, N-butyl- |
| 555373 | Urea, N-butyl-N'-(3,4-dichlorophenyl)-N-methyl- |
| 759739 | Urea, N-ethyl-N-nitroso- |
| 2151055 | Urea, N-ethyl-N-nitroso- |
| 684935 | Urea, N-methyl-N-nitroso- |
| 820600 | Urea, N-methyl-N-nitroso- |
| 126742505 | Urea, N-methyl-N-nitroso- |
| 330541 | Urea, N-phenyl-N'-1,2,3-thiadiazol-5-yl- |
| 51707552 | Urea, N-phenyl-N'-1,2,3-thiadiazol-5-yl- |
| 127071 | Urea, hydroxy- |
| 50919 | Uridine, 2'-deoxy-5-fluoro |
| 69409945 | Valine, N-[2-chloro-4-(trifluoromethyl)phenyl]-, cyano(3-phenoxyphenyl)methyl ester |
| 79472916 | Valine, N-[2-chloro-4-(trifluoromethyl)phenyl]-, cyano(3-phenoxyphenyl)methyl ester |
| 134167 | Valinomycin |
| 2001958 | Valinomycin |
| 11005804 | Valinomycin |
| 32398053 | Valinomycin |
| 7803556 | Vanadate (VO31-), ammonium (1:1) |
| 72901372 | Vanadate (VO31-), ammonium (1:1) |
| 72901383 | Vanadate (VO31-), ammonium (1:1) |
| 72901407 | Vanadate (VO31-), ammonium (1:1) |
| 72901418 | Vanadate (VO31-), ammonium (1:1) |
| 72901429 | Vanadate (VO31-), ammonium (1:1) |
| 105659356 | Vanadate (VO31-), ammonium (1:1) |
| 1032826406 | Vanadate (VO31-), ammonium (1:1) |
| 1270047647 | Vanadate (VO31-), ammonium (1:1) |
| 1314012571 | Vanadate (VO31-), ammonium (1:1) |
| 1353941384 | Vanadate (VO31-), ammonium (1:1) |
| 12436258 | Vanadate (VO31-), sodium (1:1) |
| 13718268 | Vanadate (VO31-), sodium (1:1) |
| 188478128 | Vanadate (VO31-), sodium (1:1) |
| 7440622 | Vanadium |
| 24763584 | Vanadium |
| 195161774 | Vanadium |
| 12604589 | Vanadium alloy, base, V,C,Fe (Ferrovanadium) |
| 1314021 | Vanadium oxide (V2O5) |
| 1314621 | Vanadium oxide (V2O5) |
| 12503989 | Vanadium oxide (V2O5) |
| 56870076 | Vanadium oxide (V2O5) |
| 87854555 | Vanadium oxide (V2O5) |
| 87854566 | Vanadium oxide (V2O5) |
| 166165373 | Vanadium oxide (V2O5) |
| 172928471 | Vanadium oxide (V2O5) |
| 184892226 | Vanadium oxide (V2O5) |
| 200577851 | Vanadium oxide (V2O5) |
| 203812344 | Vanadium oxide (V2O5) |
| 251927125 | Vanadium oxide (V2O5) |
| 410546906 | Vanadium oxide (V2O5) |
| 581075334 | Vanadium oxide (V2O5) |
| 828264648 | Vanadium oxide (V2O5) |
| 854372977 | Vanadium oxide (V2O5) |
| 857777389 | Vanadium oxide (V2O5) |
| 863639263 | Vanadium oxide (V2O5) |
| 934750466 | Vanadium oxide (V2O5) |
| 1408062281 | Vanadium oxide (V2O5) |
| 12701790 | Vanadium, chlorobis(.eta.5-2,4-cyclopentadien-1-yl)- |
| 12083486 | Vanadium, dichlorobis(.eta.5-2,4-cyclopentadien-1-yl)- |
| 14331976 | Vanadium, isotope of mass 48 |
| 1318009 | Vermiculite (Mg0.33[Mg2-3(Al0-1Fe0-1)0-1](Si2.33-3.33Al0.67-1.67)(OH)2O10.4H2O) |
| 865214 | Vincaleukoblastine |
| 57227 | Vincaleukoblastine, 22-oxo- |
| 2068782 | Vincaleukoblastine, 22-oxo-, sulfate (1:1) (salt) |
| 143679 | Vincaleukoblastine, sulfate (1:1) (salt) |
| 1406162 | Vitamin D |
| 7732185 | Water |
| 558440225 | Water |
| 558440532 | Water |
| 1202864490 | Water |
| 1371582341 | Water |
| 8042475 | White mineral oil (petroleum) |
| 9056308 | Wollastonite (Ca(SiO3)) |
| 13983170 | Wollastonite (Ca(SiO3)) |
| 57657075 | Wollastonite (Ca(SiO3)) |
| 9046086 | XC Polymer |
| 37299868 | Xanthylium, 9-(2,4-dicarboxyphenyl)-3,6-bis(diethylamino)-, chloride, disodium salt |
| 81889 | Xanthylium, 9-(2-carboxyphenyl)-3,6-bis(diethylamino)-, chloride (1:1) |
| 3521797 | Xanthylium, 9-(2-carboxyphenyl)-3,6-bis(diethylamino)-, chloride (1:1) |
| 11111298 | Xanthylium, 9-(2-carboxyphenyl)-3,6-bis(diethylamino)-, chloride (1:1) |
| 53664598 | Xanthylium, 9-(2-carboxyphenyl)-3,6-bis(diethylamino)-, chloride (1:1) |
| 69319239 | Xanthylium, 9-(2-carboxyphenyl)-3,6-bis(diethylamino)-, chloride (1:1) |
| 86513497 | Xanthylium, 9-(2-carboxyphenyl)-3,6-bis(diethylamino)-, chloride (1:1) |
| 86893154 | Xanthylium, 9-(2-carboxyphenyl)-3,6-bis(diethylamino)-, chloride (1:1) |
| 105480599 | Xanthylium, 9-(2-carboxyphenyl)-3,6-bis(diethylamino)-, chloride (1:1) |
| 248928565 | Xanthylium, 9-(2-carboxyphenyl)-3,6-bis(diethylamino)-, chloride (1:1) |
| 408346587 | Xanthylium, 9-(2-carboxyphenyl)-3,6-bis(diethylamino)-, chloride (1:1) |
| 412909172 | Xanthylium, 9-(2-carboxyphenyl)-3,6-bis(diethylamino)-, chloride (1:1) |
| 433215260 | Xanthylium, 9-(2-carboxyphenyl)-3,6-bis(diethylamino)-, chloride (1:1) |
| 539821357 | Xanthylium, 9-(2-carboxyphenyl)-3,6-bis(diethylamino)-, chloride (1:1) |
| 850856472 | Xanthylium, 9-(2-carboxyphenyl)-3,6-bis(diethylamino)-, chloride (1:1) |
| 859039477 | Xanthylium, 9-(2-carboxyphenyl)-3,6-bis(diethylamino)-, chloride (1:1) |
| 875572568 | Xanthylium, 9-(2-carboxyphenyl)-3,6-bis(diethylamino)-, chloride (1:1) |
| 918962660 | Xanthylium, 9-(2-carboxyphenyl)-3,6-bis(diethylamino)-, chloride (1:1) |
| 925914347 | Xanthylium, 9-(2-carboxyphenyl)-3,6-bis(diethylamino)-, chloride (1:1) |
| 956491273 | Xanthylium, 9-(2-carboxyphenyl)-3,6-bis(diethylamino)-, chloride (1:1) |
| 1023342655 | Xanthylium, 9-(2-carboxyphenyl)-3,6-bis(diethylamino)-, chloride (1:1) |
| 1051370490 | Xanthylium, 9-(2-carboxyphenyl)-3,6-bis(diethylamino)-, chloride (1:1) |
| 1236042797 | Xanthylium, 9-(2-carboxyphenyl)-3,6-bis(diethylamino)-, chloride (1:1) |
| 1394971119 | Xanthylium, 9-(2-carboxyphenyl)-3,6-bis(diethylamino)-, chloride (1:1) |
| 1326030 | Xanthylium, 9-(2-carboxyphenyl)-3,6-bis(diethylamino)-, molybdatetungstatephosphate |
| 39379505 | Xanthylium, 9-(2-carboxyphenyl)-3,6-bis(diethylamino)-, molybdatetungstatephosphate |
| 989388 | Xanthylium, 9-[2-(ethoxycarbonyl)phenyl]-3,6-bis(ethylamino)-2,7-dimethyl-, chloride (1:1) |
| 23479085 | Xanthylium, 9-[2-(ethoxycarbonyl)phenyl]-3,6-bis(ethylamino)-2,7-dimethyl-, chloride (1:1) |
| 37317741 | Xanthylium, 9-[2-(ethoxycarbonyl)phenyl]-3,6-bis(ethylamino)-2,7-dimethyl-, chloride (1:1) |
| 66796552 | Xanthylium, 9-[2-(ethoxycarbonyl)phenyl]-3,6-bis(ethylamino)-2,7-dimethyl-, chloride (1:1) |
| 79818965 | Xanthylium, 9-[2-(ethoxycarbonyl)phenyl]-3,6-bis(ethylamino)-2,7-dimethyl-, chloride (1:1) |
| 82853325 | Xanthylium, 9-[2-(ethoxycarbonyl)phenyl]-3,6-bis(ethylamino)-2,7-dimethyl-, chloride (1:1) |
| 88491150 | Xanthylium, 9-[2-(ethoxycarbonyl)phenyl]-3,6-bis(ethylamino)-2,7-dimethyl-, chloride (1:1) |
| 102395119 | Xanthylium, 9-[2-(ethoxycarbonyl)phenyl]-3,6-bis(ethylamino)-2,7-dimethyl-, chloride (1:1) |
| 126371140 | Xanthylium, 9-[2-(ethoxycarbonyl)phenyl]-3,6-bis(ethylamino)-2,7-dimethyl-, chloride (1:1) |
| 136590255 | Xanthylium, 9-[2-(ethoxycarbonyl)phenyl]-3,6-bis(ethylamino)-2,7-dimethyl-, chloride (1:1) |
| 160336356 | Xanthylium, 9-[2-(ethoxycarbonyl)phenyl]-3,6-bis(ethylamino)-2,7-dimethyl-, chloride (1:1) |
| 162887538 | Xanthylium, 9-[2-(ethoxycarbonyl)phenyl]-3,6-bis(ethylamino)-2,7-dimethyl-, chloride (1:1) |
| 201799715 | Xanthylium, 9-[2-(ethoxycarbonyl)phenyl]-3,6-bis(ethylamino)-2,7-dimethyl-, chloride (1:1) |
| 226555164 | Xanthylium, 9-[2-(ethoxycarbonyl)phenyl]-3,6-bis(ethylamino)-2,7-dimethyl-, chloride (1:1) |
| 232598902 | Xanthylium, 9-[2-(ethoxycarbonyl)phenyl]-3,6-bis(ethylamino)-2,7-dimethyl-, chloride (1:1) |
| 539820310 | Xanthylium, 9-[2-(ethoxycarbonyl)phenyl]-3,6-bis(ethylamino)-2,7-dimethyl-, chloride (1:1) |
| 1021498985 | Xanthylium, 9-[2-(ethoxycarbonyl)phenyl]-3,6-bis(ethylamino)-2,7-dimethyl-, chloride (1:1) |
| 1173373142 | Xanthylium, 9-[2-(ethoxycarbonyl)phenyl]-3,6-bis(ethylamino)-2,7-dimethyl-, chloride (1:1) |
| 1228661695 | Xanthylium, 9-[2-(ethoxycarbonyl)phenyl]-3,6-bis(ethylamino)-2,7-dimethyl-, chloride (1:1) |
| 1326018 | Xanthylium, 9-[2-(ethoxycarbonyl)phenyl]-3,6-bis(ethylamino)-2,7-dimethyl-, molybdatetungstatephosphate |
| 12224985 | Xanthylium, 9-[2-(ethoxycarbonyl)phenyl]-3,6-bis(ethylamino)-2,7-dimethyl-, molybdatetungstatephosphate |
| 12238185 | Xanthylium, 9-[2-(ethoxycarbonyl)phenyl]-3,6-bis(ethylamino)-2,7-dimethyl-, molybdatetungstatephosphate |
| 12657226 | Xanthylium, 9-[2-(ethoxycarbonyl)phenyl]-3,6-bis(ethylamino)-2,7-dimethyl-, molybdatetungstatephosphate |
| 57449566 | Xanthylium, 9-[2-(ethoxycarbonyl)phenyl]-3,6-bis(ethylamino)-2,7-dimethyl-, molybdatetungstatephosphate |
| 95917901 | Xanthylium, 9-[2-(ethoxycarbonyl)phenyl]-3,6-bis(ethylamino)-2,7-dimethyl-, molybdatetungstatephosphate |
| 1025784966 | Xanthylium, 9-[2-(ethoxycarbonyl)phenyl]-3,6-bis(ethylamino)-2,7-dimethyl-, molybdatetungstatephosphate |
| 50555 | Yohimban-16-carboxylic acid, 11,17-dimethoxy-18-[(3,4,5-trimethoxybenzoyl)oxy]-, methyl ester, (3.beta.,16.beta.,17.alpha.,18.beta.,20.alpha.)- |
| 1407381 | Yohimban-16-carboxylic acid, 11,17-dimethoxy-18-[(3,4,5-trimethoxybenzoyl)oxy]-, methyl ester, (3.beta.,16.beta.,17.alpha.,18.beta.,20.alpha.)- |
| 8048257 | Yohimban-16-carboxylic acid, 11,17-dimethoxy-18-[(3,4,5-trimethoxybenzoyl)oxy]-, methyl ester, (3.beta.,16.beta.,17.alpha.,18.beta.,20.alpha.)- |
| 141099492 | Yohimban-16-carboxylic acid, 11,17-dimethoxy-18-[(3,4,5-trimethoxybenzoyl)oxy]-, methyl ester, (3.beta.,16.beta.,17.alpha.,18.beta.,20.alpha.)- |
| 873409804 | Yohimban-16-carboxylic acid, 11,17-dimethoxy-18-[(3,4,5-trimethoxybenzoyl)oxy]-, methyl ester, (3.beta.,16.beta.,17.alpha.,18.beta.,20.alpha.)- |
| 24815245 | Yohimban-16-carboxylic acid, 11,17-dimethoxy-18-[[(2E)-1-oxo-3-(3,4,5-trimethoxyphenyl)-2-propenyl]oxy]-, methyl ester, (3.beta.,16.beta.,17.alpha.,18.beta.,20.alpha.)- |
| 14041442 | Ytterbium, isotope of mass 175 |
| 7440655 | Yttrium |
| 27151366 | Yttrium |
| 110123450 | Yttrium |
| 10098916 | Yttrium, isotope of mass 90 |
| 14234243 | Yttrium, isotope of mass 91 |
| 14234243 | Yttrium, isotope of mass 91m(49.7 min) |
| 378784986 | Yttrium, isotope of mass 91m(49.7 min) |
| 7440666 | Zinc |
| 12793532 | Zinc |
| 195161854 | Zinc |
| 199281215 | Zinc |
| 298688490 | Zinc |
| 7699458 | Zinc bromide (ZnBr2) |
| 76487 | Zinc chloride (ZnCl2) |
| 764687 | Zinc chloride (ZnCl2) |
| 7646857 | Zinc chloride (ZnCl2) |
| 53917990 | Zinc chloride (ZnCl2) |
| 1162648932 | Zinc chloride (ZnCl2) |
| 557211 | Zinc cyanide (Zn(CN)2) |
| 1314132 | Zinc oxide (ZnO) |
| 8011845 | Zinc oxide (ZnO) |
| 8047367 | Zinc oxide (ZnO) |
| 8047696 | Zinc oxide (ZnO) |
| 8050428 | Zinc oxide (ZnO) |
| 8051034 | Zinc oxide (ZnO) |
| 56592008 | Zinc oxide (ZnO) |
| 57206867 | Zinc oxide (ZnO) |
| 143477343 | Zinc oxide (ZnO) |
| 185461954 | Zinc oxide (ZnO) |
| 768390325 | Zinc oxide (ZnO) |
| 1035159717 | Zinc oxide (ZnO) |
| 1079737055 | Zinc oxide (ZnO) |
| 1158650408 | Zinc oxide (ZnO) |
| 1328870150 | Zinc oxide (ZnO) |
| 1352121288 | Zinc oxide (ZnO) |
| 1404365156 | Zinc oxide (ZnO) |
| 1434578694 | Zinc oxide (ZnO) |
| 1314847 | Zinc phosphide (Zn3P2) |
| 39342499 | Zinc phosphide (Zn3P2) |
| 67181742 | Zinc phosphide (Zn3P2) |
| 74191187 | Zinc phosphide (Zn3P2) |
| 1314983 | Zinc sulfide (ZnS) |
| 37187670 | Zinc sulfide (ZnS) |
| 64334345 | Zinc sulfide (ZnS) |
| 209065883 | Zinc sulfide (ZnS) |
| 714217013 | Zinc sulfide (ZnS) |
| 142143 | Zinc, [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']- |
| 1360390 | Zinc, [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']- |
| 12122677 | Zinc, [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']- |
| 12673653 | Zinc, [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']- |
| 14039259 | Zinc, [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']- |
| 14242127 | Zinc, [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']- |
| 14460174 | Zinc, [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']- |
| 20316443 | Zinc, [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']- |
| 21512958 | Zinc, [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']- |
| 39357090 | Zinc, [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']- |
| 70066352 | Zinc, [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']- |
| 84653189 | Zinc, [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']- |
| 136947 | Zinc, bis(N,N-diethylcarbamodithioato-.kappa.S,.kappa.S')-, (T-4)- |
| 14324551 | Zinc, bis(N,N-diethylcarbamodithioato-.kappa.S,.kappa.S')-, (T-4)- |
| 14460210 | Zinc, bis(N,N-diethylcarbamodithioato-.kappa.S,.kappa.S')-, (T-4)- |
| 15465131 | Zinc, bis(N,N-diethylcarbamodithioato-.kappa.S,.kappa.S')-, (T-4)- |
| 18445584 | Zinc, bis(N,N-diethylcarbamodithioato-.kappa.S,.kappa.S')-, (T-4)- |
| 32733021 | Zinc, bis(N,N-diethylcarbamodithioato-.kappa.S,.kappa.S')-, (T-4)- |
| 39456865 | Zinc, bis(N,N-diethylcarbamodithioato-.kappa.S,.kappa.S')-, (T-4)- |
| 92481102 | Zinc, bis(N,N-diethylcarbamodithioato-.kappa.S,.kappa.S')-, (T-4)- |
| 115028552 | Zinc, bis(N,N-diethylcarbamodithioato-.kappa.S,.kappa.S')-, (T-4)- |
| 120092571 | Zinc, bis(N,N-diethylcarbamodithioato-.kappa.S,.kappa.S')-, (T-4)- |
| 880359159 | Zinc, bis(N,N-diethylcarbamodithioato-.kappa.S,.kappa.S')-, (T-4)- |
| 905572852 | Zinc, bis(N,N-diethylcarbamodithioato-.kappa.S,.kappa.S')-, (T-4)- |
| 137304 | Zinc, bis(N,N-dimethylcarbamodithioato-.kappa.S,.kappa.S')-, (T-4)- |
| 8059743 | Zinc, bis(N,N-dimethylcarbamodithioato-.kappa.S,.kappa.S')-, (T-4)- |
| 8070073 | Zinc, bis(N,N-dimethylcarbamodithioato-.kappa.S,.kappa.S')-, (T-4)- |
| 12768615 | Zinc, bis(N,N-dimethylcarbamodithioato-.kappa.S,.kappa.S')-, (T-4)- |
| 12773045 | Zinc, bis(N,N-dimethylcarbamodithioato-.kappa.S,.kappa.S')-, (T-4)- |
| 14459917 | Zinc, bis(N,N-dimethylcarbamodithioato-.kappa.S,.kappa.S')-, (T-4)- |
| 17125916 | Zinc, bis(N,N-dimethylcarbamodithioato-.kappa.S,.kappa.S')-, (T-4)- |
| 19488814 | Zinc, bis(N,N-dimethylcarbamodithioato-.kappa.S,.kappa.S')-, (T-4)- |
| 31300717 | Zinc, bis(N,N-dimethylcarbamodithioato-.kappa.S,.kappa.S')-, (T-4)- |
| 50933807 | Zinc, bis(N,N-dimethylcarbamodithioato-.kappa.S,.kappa.S')-, (T-4)- |
| 55870887 | Zinc, bis(N,N-dimethylcarbamodithioato-.kappa.S,.kappa.S')-, (T-4)- |
| 98391072 | Zinc, bis(N,N-dimethylcarbamodithioato-.kappa.S,.kappa.S')-, (T-4)- |
| 111922613 | Zinc, bis(N,N-dimethylcarbamodithioato-.kappa.S,.kappa.S')-, (T-4)- |
| 1079126296 | Zinc, bis(N,N-dimethylcarbamodithioato-.kappa.S,.kappa.S')-, (T-4)- |
| 1135443105 | Zinc, bis(N,N-dimethylcarbamodithioato-.kappa.S,.kappa.S')-, (T-4)- |
| 1192707 | Zinc, bis[1-(hydroxy-.kappa.O)-2(1H)-pyridinethionato-.kappa.S2]-, (T-4)- |
| 1320689 | Zinc, bis[1-(hydroxy-.kappa.O)-2(1H)-pyridinethionato-.kappa.S2]-, (T-4)- |
| 3138010 | Zinc, bis[1-(hydroxy-.kappa.O)-2(1H)-pyridinethionato-.kappa.S2]-, (T-4)- |
| 3590236 | Zinc, bis[1-(hydroxy-.kappa.O)-2(1H)-pyridinethionato-.kappa.S2]-, (T-4)- |
| 3865778 | Zinc, bis[1-(hydroxy-.kappa.O)-2(1H)-pyridinethionato-.kappa.S2]-, (T-4)- |
| 13463417 | Zinc, bis[1-(hydroxy-.kappa.O)-2(1H)-pyridinethionato-.kappa.S2]-, (T-4)- |
| 14376320 | Zinc, bis[1-(hydroxy-.kappa.O)-2(1H)-pyridinethionato-.kappa.S2]-, (T-4)- |
| 15686643 | Zinc, bis[1-(hydroxy-.kappa.O)-2(1H)-pyridinethionato-.kappa.S2]-, (T-4)- |
| 16782006 | Zinc, bis[1-(hydroxy-.kappa.O)-2(1H)-pyridinethionato-.kappa.S2]-, (T-4)- |
| 17652470 | Zinc, bis[1-(hydroxy-.kappa.O)-2(1H)-pyridinethionato-.kappa.S2]-, (T-4)- |
| 31089482 | Zinc, bis[1-(hydroxy-.kappa.O)-2(1H)-pyridinethionato-.kappa.S2]-, (T-4)- |
| 35430207 | Zinc, bis[1-(hydroxy-.kappa.O)-2(1H)-pyridinethionato-.kappa.S2]-, (T-4)- |
| 39412618 | Zinc, bis[1-(hydroxy-.kappa.O)-2(1H)-pyridinethionato-.kappa.S2]-, (T-4)- |
| 51148108 | Zinc, bis[1-(hydroxy-.kappa.O)-2(1H)-pyridinethionato-.kappa.S2]-, (T-4)- |
| 51406576 | Zinc, bis[1-(hydroxy-.kappa.O)-2(1H)-pyridinethionato-.kappa.S2]-, (T-4)- |
| 55172617 | Zinc, bis[1-(hydroxy-.kappa.O)-2(1H)-pyridinethionato-.kappa.S2]-, (T-4)- |
| 74261715 | Zinc, bis[1-(hydroxy-.kappa.O)-2(1H)-pyridinethionato-.kappa.S2]-, (T-4)- |
| 109702194 | Zinc, bis[1-(hydroxy-.kappa.O)-2(1H)-pyridinethionato-.kappa.S2]-, (T-4)- |
| 118480787 | Zinc, bis[1-(hydroxy-.kappa.O)-2(1H)-pyridinethionato-.kappa.S2]-, (T-4)- |
| 162400433 | Zinc, bis[1-(hydroxy-.kappa.O)-2(1H)-pyridinethionato-.kappa.S2]-, (T-4)- |
| 186322747 | Zinc, bis[1-(hydroxy-.kappa.O)-2(1H)-pyridinethionato-.kappa.S2]-, (T-4)- |
| 192458892 | Zinc, bis[1-(hydroxy-.kappa.O)-2(1H)-pyridinethionato-.kappa.S2]-, (T-4)- |
| 208398703 | Zinc, bis[1-(hydroxy-.kappa.O)-2(1H)-pyridinethionato-.kappa.S2]-, (T-4)- |
| 226883654 | Zinc, bis[1-(hydroxy-.kappa.O)-2(1H)-pyridinethionato-.kappa.S2]-, (T-4)- |
| 244778798 | Zinc, bis[1-(hydroxy-.kappa.O)-2(1H)-pyridinethionato-.kappa.S2]-, (T-4)- |
| 266692380 | Zinc, bis[1-(hydroxy-.kappa.O)-2(1H)-pyridinethionato-.kappa.S2]-, (T-4)- |
| 318995787 | Zinc, bis[1-(hydroxy-.kappa.O)-2(1H)-pyridinethionato-.kappa.S2]-, (T-4)- |
| 943428715 | Zinc, bis[1-(hydroxy-.kappa.O)-2(1H)-pyridinethionato-.kappa.S2]-, (T-4)- |
| 1021487499 | Zinc, bis[1-(hydroxy-.kappa.O)-2(1H)-pyridinethionato-.kappa.S2]-, (T-4)- |
| 1199553622 | Zinc, bis[1-(hydroxy-.kappa.O)-2(1H)-pyridinethionato-.kappa.S2]-, (T-4)- |
| 1323439048 | Zinc, bis[1-(hydroxy-.kappa.O)-2(1H)-pyridinethionato-.kappa.S2]-, (T-4)- |
| 13982393 | Zinc, isotope of mass 65 |
| 7440672 | Zirconium |
| 7440677 | Zirconium |
| 141631745 | Zirconium |
| 141631756 | Zirconium |
| 141631778 | Zirconium |
| 182260464 | Zirconium |
| 1314234 | Zirconium oxide (ZrO2) |
| 10377998 | Zirconium oxide (ZrO2) |
| 12627768 | Zirconium oxide (ZrO2) |
| 73649215 | Zirconium oxide (ZrO2) |
| 112414854 | Zirconium oxide (ZrO2) |
| 129774170 | Zirconium oxide (ZrO2) |
| 869287832 | Zirconium oxide (ZrO2) |
| 943230044 | Zirconium oxide (ZrO2) |
| 943895941 | Zirconium oxide (ZrO2) |
| 949569088 | Zirconium oxide (ZrO2) |
| 1134791551 | Zirconium oxide (ZrO2) |
| 1255709693 | Zirconium oxide (ZrO2) |
| 1349696929 | Zirconium oxide (ZrO2) |
| 1381839913 | Zirconium oxide (ZrO2) |
| 1403239995 | Zirconium oxide (ZrO2) |
| 25399819 | Zirconium oxychloride, hexahydrate |
| 1291323 | Zirconium, dichlorobis(.eta.5-2,4-cyclopentadien-1-yl)- |
| 23845558 | Zirconium, dichlorobis(.eta.5-2,4-cyclopentadien-1-yl)- |
| 15751776 | Zirconium, isotope of mass 93 |
| 13967710 | Zirconium, isotope of mass 95 |
| 90415 | [1,1'-Biphenyl]-2-amine |
| 2185924 | [1,1'-Biphenyl]-2-amine, hydrochloride |
| 90431 | [1,1'-Biphenyl]-2-ol |
| 90437 | [1,1'-Biphenyl]-2-ol |
| 39387785 | [1,1'-Biphenyl]-2-ol |
| 192076929 | [1,1'-Biphenyl]-2-ol |
| 132274 | [1,1'-Biphenyl]-2-ol, sodium salt (1:1) |
| 6152336 | [1,1'-Biphenyl]-2-ol, sodium salt, tetrahydrate |
| 2373980 | [1,1'-Biphenyl]-3,3'-diol, 4,4'-diamino- |
| 92842 | [1,1'-Biphenyl]-4,4'-diamine |
| 92875 | [1,1'-Biphenyl]-4,4'-diamine |
| 46310070 | [1,1'-Biphenyl]-4,4'-diamine |
| 56481948 | [1,1'-Biphenyl]-4,4'-diamine |
| 54827177 | [1,1'-Biphenyl]-4,4'-diamine, 3,3',5,5'-tetramethyl- |
| 91941 | [1,1'-Biphenyl]-4,4'-diamine, 3,3'-dichloro- |
| 612839 | [1,1'-Biphenyl]-4,4'-diamine, 3,3'-dichloro-, hydrochloride (1:2) |
| 64969342 | [1,1'-Biphenyl]-4,4'-diamine, 3,3'-dichloro-, sulfate (1:2) |
| 119904 | [1,1'-Biphenyl]-4,4'-diamine, 3,3'-dimethoxy- |
| 59777105 | [1,1'-Biphenyl]-4,4'-diamine, 3,3'-dimethoxy- |
| 20325400 | [1,1'-Biphenyl]-4,4'-diamine, 3,3'-dimethoxy-, hydrochloride (1:2) |
| 111984099 | [1,1'-Biphenyl]-4,4'-diamine, 3,3'-dimethoxy-, monohydrochloride |
| 92875 | [1,1'-Biphenyl]-4,4'-diamine, 3,3'-dimethyl- |
| 119937 | [1,1'-Biphenyl]-4,4'-diamine, 3,3'-dimethyl- |
| 41766750 | [1,1'-Biphenyl]-4,4'-diamine, 3,3'-dimethyl-, dihydrofluoride |
| 612828 | [1,1'-Biphenyl]-4,4'-diamine, 3,3'-dimethyl-, hydrochloride (1:2) |
| 1331539 | [1,1'-Biphenyl]-4,4'-diamine, ar,ar'-dimethoxy- |
| 531851 | [1,1'-Biphenyl]-4,4'-diamine, hydrochloride (1:2) |
| 4301502 | [1,1'-Biphenyl]-4-acetic acid, 2-fluoroethyl ester |
| 11096734 | [1,1'-Biphenyl]-4-acetic acid, 2-fluoroethyl ester |
| 92671 | [1,1'-Biphenyl]-4-amine |
| 41122707 | [1,1'-Biphenyl]-4-carbonitrile, 4'-hexyl- |
| 69866382 | [1,1'-Biphenyl]-4-carbonitrile, 4'-hexyl- |
| 21351713 | [1,1'-Biphenyl]-4-carboxylic acid, 3'-nitro-4'-(octadecyloxy)- |
| 92693 | [1,1'-Biphenyl]-4-ol |
| 61840560 | [1,1'-Biphenyl]-4-ol |
| 110617599 | [1,1'-Biphenyl]-4-ol |
| 215723232 | [1,1'-Biphenyl]-4-ol |
| 37527563 | [1,1':4',1''-Terphenyl]-4,4''-dicarboxylic acid, diethyl ester |
| 23246960 | [1,6]Dioxacyclododecino[2,3,4-gh]pyrrolizine-2,7-dione, 3-ethylidene-3,4,5,6,9,11,13,14,14a,14b-decahydro-6-hydroxy-6-(hydroxymethyl)-5-methylene-, (3Z,6S,14aR,14bR)- |
| 480819 | [1,6]Dioxacyclododecino[2,3,4-gh]pyrrolizine-2,7-dione, 3-ethylidene-3,4,5,6,9,11,13,14,14a,14b-decahydro-6-hydroxy-6-methyl-5-methylene-, (3Z,6R,14aR,14bR)- |
| 83794 | [1]Benzopyrano[3,4-b]furo[2,3-h][1]benzopyran-6(6aH)-one, 1,2,12,12a-tetrahydro-8,9-dimethoxy-2-(1-methylethenyl)-, (2R,6aS,12aS)- |
| 12679582 | [1]Benzopyrano[3,4-b]furo[2,3-h][1]benzopyran-6(6aH)-one, 1,2,12,12a-tetrahydro-8,9-dimethoxy-2-(1-methylethenyl)-, (2R,6aS,12aS)- |
| 476664 | [1]Benzopyrano[5,4,3-cde][1]benzopyran-5,10-dione, 2,3,7,8-tetrahydroxy- |
| 6537684 | [2,2'-Bi-1H-indole]-3,3'-diol |
| 58139596 | [4,4'-Bithiazole]-2,2'-diamine |
| 31091142 | o-Xylene, tetrabromo- |
| 36059219 | o-Xylene, tetrabromo- |
| 1843487 | s-Triazine-1,3,5(2H,4H,6H)-triacetamide, 2,4,6-trioxo- |
| 25103586 | tert-Dodecanethiol |
| 90501341 | tert-Dodecanethiol |
| 119147910 | tert-Dodecanethiol |