Related Topics:
Pollutant Lookup
Use this table to lookup a "Common Pollutant Name" or "CAS Number" to be entered on the Search Form.
Click on the "Back" button to return to the Multisystem Search Form.
CAS Number | Common Pollutant Name |
---|---|
57501 | .alpha.-D-Glucopyranoside, .beta.-D-fructofuranosyl |
8027472 | .alpha.-D-Glucopyranoside, .beta.-D-fructofuranosyl |
8030204 | .alpha.-D-Glucopyranoside, .beta.-D-fructofuranosyl |
12040732 | .alpha.-D-Glucopyranoside, .beta.-D-fructofuranosyl |
29253789 | .alpha.-D-Glucopyranoside, .beta.-D-fructofuranosyl |
29764065 | .alpha.-D-Glucopyranoside, .beta.-D-fructofuranosyl |
30027726 | .alpha.-D-Glucopyranoside, .beta.-D-fructofuranosyl |
47167522 | .alpha.-D-Glucopyranoside, .beta.-D-fructofuranosyl |
47185091 | .alpha.-D-Glucopyranoside, .beta.-D-fructofuranosyl |
47257910 | .alpha.-D-Glucopyranoside, .beta.-D-fructofuranosyl |
50857686 | .alpha.-D-Glucopyranoside, .beta.-D-fructofuranosyl |
51909694 | .alpha.-D-Glucopyranoside, .beta.-D-fructofuranosyl |
64533660 | .alpha.-D-Glucopyranoside, .beta.-D-fructofuranosyl |
65545995 | .alpha.-D-Glucopyranoside, .beta.-D-fructofuranosyl |
75398844 | .alpha.-D-Glucopyranoside, .beta.-D-fructofuranosyl |
76056387 | .alpha.-D-Glucopyranoside, .beta.-D-fructofuranosyl |
78654770 | .alpha.-D-Glucopyranoside, .beta.-D-fructofuranosyl |
80165033 | .alpha.-D-Glucopyranoside, .beta.-D-fructofuranosyl |
85456515 | .alpha.-D-Glucopyranoside, .beta.-D-fructofuranosyl |
86101306 | .alpha.-D-Glucopyranoside, .beta.-D-fructofuranosyl |
87430668 | .alpha.-D-Glucopyranoside, .beta.-D-fructofuranosyl |
92004847 | .alpha.-D-Glucopyranoside, .beta.-D-fructofuranosyl |
100405081 | .alpha.-D-Glucopyranoside, .beta.-D-fructofuranosyl |
104242106 | .alpha.-D-Glucopyranoside, .beta.-D-fructofuranosyl |
131932122 | .alpha.-D-Glucopyranoside, .beta.-D-fructofuranosyl |
146054355 | .alpha.-D-Glucopyranoside, .beta.-D-fructofuranosyl |
146187044 | .alpha.-D-Glucopyranoside, .beta.-D-fructofuranosyl |
151756024 | .alpha.-D-Glucopyranoside, .beta.-D-fructofuranosyl |
220376227 | .alpha.-D-Glucopyranoside, .beta.-D-fructofuranosyl |
635681902 | .alpha.-D-Glucopyranoside, .beta.-D-fructofuranosyl |
786702634 | .alpha.-D-Glucopyranoside, .beta.-D-fructofuranosyl |
880257625 | .alpha.-D-Glucopyranoside, .beta.-D-fructofuranosyl |
1159795784 | .alpha.-D-Glucopyranoside, .beta.-D-fructofuranosyl |
1206156822 | .alpha.-D-Glucopyranoside, .beta.-D-fructofuranosyl |
35621 | .beta.-D-Galactopyranoside, (2.alpha.,3.beta.,5.alpha.,15.beta.,25R)-2,15-dihydroxyspirostan-3-yl O-.beta.-D-glucopyranosyl-(1.fwdarw.3)-O-.beta.-D-galactopyranosyl-(1.fwdarw.2)-O-[.beta.-D-xylopyranosyl-(1.fwdarw.3)]-O-.beta.-D-glucopyranosyl-(1.fwdarw.4)- |
11024241 | .beta.-D-Galactopyranoside, (2.alpha.,3.beta.,5.alpha.,15.beta.,25R)-2,15-dihydroxyspirostan-3-yl O-.beta.-D-glucopyranosyl-(1.fwdarw.3)-O-.beta.-D-galactopyranosyl-(1.fwdarw.2)-O-[.beta.-D-xylopyranosyl-(1.fwdarw.3)]-O-.beta.-D-glucopyranosyl-(1.fwdarw.4)- |
52781767 | .beta.-D-Galactopyranoside, (2.alpha.,3.beta.,5.alpha.,15.beta.,25R)-2,15-dihydroxyspirostan-3-yl O-.beta.-D-glucopyranosyl-(1.fwdarw.3)-O-.beta.-D-galactopyranosyl-(1.fwdarw.2)-O-[.beta.-D-xylopyranosyl-(1.fwdarw.3)]-O-.beta.-D-glucopyranosyl-(1.fwdarw.4)- |
14901087 | .beta.-D-Glucopyranoside, [(Z)-methyl-ONN-azoxy] methyl |
119391 | 1(2H)-Phthalazinone |
5418268 | 1(2H)-Phthalazinone |
86544 | 1(2H)-Phthalazinone, hydrazone |
77098 | 1(3H)-Isobenzofuranone, 3,3-bis(4-hydroxyphenyl)- |
467298 | 1(3H)-Isobenzofuranone, 3,3-bis(4-hydroxyphenyl)- |
5768876 | 1(3H)-Isobenzofuranone, 3,3-bis(4-hydroxyphenyl)- |
57214207 | 1(3H)-Isobenzofuranone, 3,3-bis(4-hydroxyphenyl)- |
390417240 | 1(3H)-Isobenzofuranone, 3,3-bis(4-hydroxyphenyl)- |
546094137 | 1(3H)-Isobenzofuranone, 3,3-bis(4-hydroxyphenyl)- |
17369594 | 1(3H)-Isobenzofuranone, 3-propylidene- |
92524 | 1,1'-Biphenyl |
56481937 | 1,1'-Biphenyl |
72931465 | 1,1'-Biphenyl |
1135443729 | 1,1'-Biphenyl |
25640782 | 1,1'-Biphenyl, (1-methylethyl)- |
26545631 | 1,1'-Biphenyl, (1-methylethyl)- |
68306774 | 1,1'-Biphenyl, (1-methylethyl)- |
2051243 | 1,1'-Biphenyl, 2,2',3,3',4,4',5,5',6,6'-decachloro- |
65510443 | 1,1'-Biphenyl, 2,3',4,4',5'-pentachloro- |
52663726 | 1,1'-Biphenyl, 2,3',4,4',5,5'-hexachloro- |
31508006 | 1,1'-Biphenyl, 2,3',4,4',5-pentachloro- |
69782907 | 1,1'-Biphenyl, 2,3,3',4,4',5'-hexachloro- |
39635319 | 1,1'-Biphenyl, 2,3,3',4,4',5,5'-heptachloro- |
38380084 | 1,1'-Biphenyl, 2,3,3',4,4',5-hexachloro- |
32598144 | 1,1'-Biphenyl, 2,3,3'4,4'-pentachloro- |
74472370 | 1,1'-Biphenyl, 2,3,4,4',5-pentachloro- |
2052075 | 1,1'-Biphenyl, 2-bromo- |
2051607 | 1,1'-Biphenyl, 2-chloro- |
321608 | 1,1'-Biphenyl, 2-fluoro- |
86000 | 1,1'-Biphenyl, 2-nitro- |
32774166 | 1,1'-Biphenyl, 3,3',4,4',5,5'-hexachloro- |
31508006 | 1,1'-Biphenyl, 3,3',4,4',5-pentachloro- |
57465288 | 1,1'-Biphenyl, 3,3',4,4',5-pentachloro- |
32598133 | 1,1'-Biphenyl, 3,3',4,4'-tetrachloro- |
70362504 | 1,1'-Biphenyl, 3,4,4',5-tetrachloro- |
2113577 | 1,1'-Biphenyl, 3-bromo- |
10386842 | 1,1'-Biphenyl, 4,4'-dibromo-2,2',3,3',5,5',6,6'-octafluoro- |
91930 | 1,1'-Biphenyl, 4,4'-diisocyanato-3,3'-dimethoxy- |
3012655 | 1,1'-Biphenyl, 4,4'-diisocyanato-3,3'-dimethoxy- |
92660 | 1,1'-Biphenyl, 4-bromo- |
92933 | 1,1'-Biphenyl, 4-nitro- |
59536651 | 1,1'-Biphenyl, bromo derivs. |
67774327 | 1,1'-Biphenyl, bromo derivs. |
1336363 | 1,1'-Biphenyl, chloro derivs. |
12767792 | 1,1'-Biphenyl, chloro derivs. |
16606023 | 1,1'-Biphenyl, chloro derivs. |
36355018 | 1,1'-Biphenyl, hexabromo- |
26601649 | 1,1'-Biphenyl, hexachloro- |
101848 | 1,1'-Biphenyl, mixt. with 1,1'-oxybis[benzene] |
8004135 | 1,1'-Biphenyl, mixt. with 1,1'-oxybis[benzene] |
26914330 | 1,1'-Biphenyl, tetrachloro- |
1486017 | 1,1'-Biphenyl-2,2',3,3',4,4',5,5',6,6'-d10 |
92944 | 1,1':4',1''-Terphenyl |
75831651 | 1,1':4',1''-Terphenyl |
94363130 | 1,1':4',1''-Terphenyl |
302170 | 1,1-Ethanediol, 2,2,2-trichloro- |
109128190 | 1,1-Ethanediol, 2,2,2-trichloro- |
541220 | 1,10-Decanediaminium, N1,N1,N1,N10,N10,N10-hexamethyl-, bromide (1:2) |
60869650 | 1,10-Decanediaminium, N1,N1,N1,N10,N10,N10-hexamethyl-, bromide (1:2) |
66717 | 1,10-Phenanthroline |
299752 | 1,2,3,4-Butanetetrol, 1,4-dimethanesulfonate, [S-(R*,R*)]- |
87661 | 1,2,3-Benzenetriol |
77929 | 1,2,3-Propanetricarboxylic acid, 2-hydroxy- |
12262736 | 1,2,3-Propanetricarboxylic acid, 2-hydroxy- |
43136352 | 1,2,3-Propanetricarboxylic acid, 2-hydroxy- |
136108935 | 1,2,3-Propanetricarboxylic acid, 2-hydroxy- |
245654346 | 1,2,3-Propanetricarboxylic acid, 2-hydroxy- |
623158963 | 1,2,3-Propanetricarboxylic acid, 2-hydroxy- |
856568155 | 1,2,3-Propanetricarboxylic acid, 2-hydroxy- |
878903721 | 1,2,3-Propanetricarboxylic acid, 2-hydroxy- |
890704548 | 1,2,3-Propanetricarboxylic acid, 2-hydroxy- |
896506460 | 1,2,3-Propanetricarboxylic acid, 2-hydroxy- |
906507377 | 1,2,3-Propanetricarboxylic acid, 2-hydroxy- |
1192555955 | 1,2,3-Propanetricarboxylic acid, 2-hydroxy- |
56815 | 1,2,3-Propanetriol |
8013250 | 1,2,3-Propanetriol |
29796427 | 1,2,3-Propanetriol |
30049526 | 1,2,3-Propanetriol |
37228549 | 1,2,3-Propanetriol |
75398786 | 1,2,3-Propanetriol |
78630167 | 1,2,3-Propanetriol |
1400594628 | 1,2,3-Propanetriol |
1422250438 | 1,2,3-Propanetriol |
55630 | 1,2,3-Propanetriol, 1,2,3-trinitrate |
8013238 | 1,2,3-Propanetriol, 1,2,3-trinitrate |
9010020 | 1,2,3-Propanetriol, 1,2,3-trinitrate |
80066484 | 1,2,3-Propanetriol, 1,2,3-trinitrate |
100292135 | 1,2,3-Propanetriol, 1,2,3-trinitrate |
105469316 | 1,2,3-Propanetriol, 1,2,3-trinitrate |
1335382 | 1,2,3-Propanetriol, monoacetate |
26446355 | 1,2,3-Propanetriol, monoacetate |
89054 | 1,2,4,5-Benzenetetracarboxylic acid |
3319311 | 1,2,4-Benzenetricarboxylic acid, 1,2,4-tris(2-ethylhexyl) ester |
59941467 | 1,2,4-Benzenetricarboxylic acid, 1,2,4-tris(2-ethylhexyl) ester |
75882007 | 1,2,4-Benzenetricarboxylic acid, 1,2,4-tris(2-ethylhexyl) ester |
82643263 | 1,2,4-Benzenetricarboxylic acid, 1,2,4-tris(2-ethylhexyl) ester |
113816970 | 1,2,4-Benzenetricarboxylic acid, 1,2,4-tris(2-ethylhexyl) ester |
131734059 | 1,2,4-Benzenetricarboxylic acid, 1,2,4-tris(2-ethylhexyl) ester |
144470655 | 1,2,4-Benzenetricarboxylic acid, 1,2,4-tris(2-ethylhexyl) ester |
1199184 | 1,2,4-Benzenetriol, 5-(2-aminoethyl)- |
28094157 | 1,2,4-Benzenetriol, 5-(2-aminoethyl)-, hydrochloride |
7221934 | 1,2,4-Methenocyclopenta[cd]pentalene-5-carboxaldehyde, 2,2a,3,3,4,7-hexachlorodecahydro-, (1.alpha.,2.beta.,2a.beta.,4.beta.,4a.beta.,5.beta.,6a.beta.,6b.beta.,7R*)- |
7421934 | 1,2,4-Methenocyclopenta[cd]pentalene-5-carboxaldehyde, 2,2a,3,3,4,7-hexachlorodecahydro-, (1.alpha.,2.beta.,2a.beta.,4.beta.,4a.beta.,5.beta.,6a.beta.,6b.beta.,7R*)- |
7621934 | 1,2,4-Methenocyclopenta[cd]pentalene-5-carboxaldehyde, 2,2a,3,3,4,7-hexachlorodecahydro-, (1.alpha.,2.beta.,2a.beta.,4.beta.,4a.beta.,5.beta.,6a.beta.,6b.beta.,7R*)- |
20354261 | 1,2,4-Oxadiazolidine-3,5-dione, 2-(3,4-dichlorophenyl)-4-methyl- |
2593159 | 1,2,4-Thiadiazole, 5-ethoxy-3-(trichloromethyl)- |
123312890 | 1,2,4-Triazin-3(2H)-one, 4,5-dihydro-6-methyl-4-[(3-pyridinylmethylene)amino]-, (E)- |
3131600 | 1,2,4-Triazin-3(2H)-one, 5-amino-2-.beta.-D-ribofuranosyl- |
21087649 | 1,2,4-Triazin-5(4H)-one, 4-amino-6-(1,1-dimethylethyl)-3-(methylthio)- |
41814782 | 1,2,4-Triazolo[3,4-b]benzothiazole, 5-methyl- |
1135442759 | 1,2,4-Triazolo[3,4-b]benzothiazole, 5-methyl- |
95545 | 1,2-Benzenediamine |
95830 | 1,2-Benzenediamine, 4-chloro- |
496720 | 1,2-Benzenediamine, 4-methyl- |
99569 | 1,2-Benzenediamine, 4-nitro- |
615281 | 1,2-Benzenediamine, hydrochloride (1:2) |
88960 | 1,2-Benzenedicarboxamide |
88993 | 1,2-Benzenedicarboxylic acid |
4401643 | 1,2-Benzenedicarboxylic acid |
131157 | 1,2-Benzenedicarboxylic acid, 1,2-bis(1-methylheptyl) ester |
117839 | 1,2-Benzenedicarboxylic acid, 1,2-bis(2-butoxyethyl) ester |
117817 | 1,2-Benzenedicarboxylic acid, 1,2-bis(2-ethylhexyl) ester |
8033532 | 1,2-Benzenedicarboxylic acid, 1,2-bis(2-ethylhexyl) ester |
40120692 | 1,2-Benzenedicarboxylic acid, 1,2-bis(2-ethylhexyl) ester |
50885875 | 1,2-Benzenedicarboxylic acid, 1,2-bis(2-ethylhexyl) ester |
109630526 | 1,2-Benzenedicarboxylic acid, 1,2-bis(2-ethylhexyl) ester |
126639290 | 1,2-Benzenedicarboxylic acid, 1,2-bis(2-ethylhexyl) ester |
137718377 | 1,2-Benzenedicarboxylic acid, 1,2-bis(2-ethylhexyl) ester |
205180592 | 1,2-Benzenedicarboxylic acid, 1,2-bis(2-ethylhexyl) ester |
275818898 | 1,2-Benzenedicarboxylic acid, 1,2-bis(2-ethylhexyl) ester |
607374505 | 1,2-Benzenedicarboxylic acid, 1,2-bis(2-ethylhexyl) ester |
117828 | 1,2-Benzenedicarboxylic acid, 1,2-bis(2-methoxyethyl) ester |
34006763 | 1,2-Benzenedicarboxylic acid, 1,2-bis(2-methoxyethyl) ester |
84695 | 1,2-Benzenedicarboxylic acid, 1,2-bis(2-methylpropyl) ester |
131179 | 1,2-Benzenedicarboxylic acid, 1,2-di-2-propen-1-yl ester |
124743277 | 1,2-Benzenedicarboxylic acid, 1,2-di-2-propen-1-yl ester |
143318734 | 1,2-Benzenedicarboxylic acid, 1,2-di-2-propen-1-yl ester |
84742 | 1,2-Benzenedicarboxylic acid, 1,2-dibutyl ester |
84617 | 1,2-Benzenedicarboxylic acid, 1,2-dicyclohexyl ester |
55819028 | 1,2-Benzenedicarboxylic acid, 1,2-dicyclohexyl ester |
169741166 | 1,2-Benzenedicarboxylic acid, 1,2-dicyclohexyl ester |
84662 | 1,2-Benzenedicarboxylic acid, 1,2-diethyl ester |
1431865870 | 1,2-Benzenedicarboxylic acid, 1,2-diethyl ester |
84753 | 1,2-Benzenedicarboxylic acid, 1,2-dihexyl ester |
1341395 | 1,2-Benzenedicarboxylic acid, 1,2-diisodecyl ester |
26761400 | 1,2-Benzenedicarboxylic acid, 1,2-diisodecyl ester |
105009981 | 1,2-Benzenedicarboxylic acid, 1,2-diisodecyl ester |
148384025 | 1,2-Benzenedicarboxylic acid, 1,2-diisodecyl ester |
28553120 | 1,2-Benzenedicarboxylic acid, 1,2-diisononyl ester |
41375911 | 1,2-Benzenedicarboxylic acid, 1,2-diisononyl ester |
58033902 | 1,2-Benzenedicarboxylic acid, 1,2-diisononyl ester |
105009970 | 1,2-Benzenedicarboxylic acid, 1,2-diisononyl ester |
1330912 | 1,2-Benzenedicarboxylic acid, 1,2-diisooctyl ester |
25103508 | 1,2-Benzenedicarboxylic acid, 1,2-diisooctyl ester |
27554263 | 1,2-Benzenedicarboxylic acid, 1,2-diisooctyl ester |
41375900 | 1,2-Benzenedicarboxylic acid, 1,2-diisooctyl ester |
131113 | 1,2-Benzenedicarboxylic acid, 1,2-dimethyl ester |
64441709 | 1,2-Benzenedicarboxylic acid, 1,2-dimethyl ester |
1352054353 | 1,2-Benzenedicarboxylic acid, 1,2-dimethyl ester |
84764 | 1,2-Benzenedicarboxylic acid, 1,2-dinonyl ester |
117640 | 1,2-Benzenedicarboxylic acid, 1,2-dioctyl ester |
117817 | 1,2-Benzenedicarboxylic acid, 1,2-dioctyl ester |
117840 | 1,2-Benzenedicarboxylic acid, 1,2-dioctyl ester |
8031296 | 1,2-Benzenedicarboxylic acid, 1,2-dioctyl ester |
131180 | 1,2-Benzenedicarboxylic acid, 1,2-dipentyl ester |
131168 | 1,2-Benzenedicarboxylic acid, 1,2-dipropyl ester |
119062 | 1,2-Benzenedicarboxylic acid, 1,2-ditridecyl ester |
3648202 | 1,2-Benzenedicarboxylic acid, 1,2-diundecyl ester |
154766253 | 1,2-Benzenedicarboxylic acid, 1,2-diundecyl ester |
85701 | 1,2-Benzenedicarboxylic acid, 1-(2-butoxy-2-oxoethyl) 2-butyl ester |
89134 | 1,2-Benzenedicarboxylic acid, 1-(2-ethylhexyl) 2-(8-methylnonyl) ester |
85698 | 1,2-Benzenedicarboxylic acid, 1-butyl 2-(2-ethylhexyl) ester |
85687 | 1,2-Benzenedicarboxylic acid, 1-butyl 2-(phenylmethyl) ester |
58128782 | 1,2-Benzenedicarboxylic acid, 1-butyl 2-(phenylmethyl) ester |
84640 | 1,2-Benzenedicarboxylic acid, 1-butyl 2-cyclohexyl ester |
84786 | 1,2-Benzenedicarboxylic acid, 1-butyl 2-octyl ester |
5334098 | 1,2-Benzenedicarboxylic acid, 1-cyclohexyl 2-(2-methylpropyl) ester |
25724587 | 1,2-Benzenedicarboxylic acid, 1-decyl 2-hexyl ester |
119073 | 1,2-Benzenedicarboxylic acid, 1-decyl 2-octyl ester |
1323735 | 1,2-Benzenedicarboxylic acid, 1-decyl 2-octyl ester |
61702816 | 1,2-Benzenedicarboxylic acid, 1-hexyl 2-isodecyl ester |
61886600 | 1,2-Benzenedicarboxylic acid, 1-isodecyl 2-tridecyl ester |
27215221 | 1,2-Benzenedicarboxylic acid, 1-isooctyl 2-(phenylmethyl) ester |
30138751 | 1,2-Benzenedicarboxylic acid, 1-isooctyl 2-(phenylmethyl) ester |
85712 | 1,2-Benzenedicarboxylic acid, 2-ethoxy-2-oxoethyl methyl ester |
84720 | 1,2-Benzenedicarboxylic acid, 2-ethoxy-2-oxoethyl-, ethyl ester |
80264499 | 1,2-Benzenedicarboxylic acid, 2-ethoxy-2-oxoethyl-, ethyl ester |
632586 | 1,2-Benzenedicarboxylic acid, 3,4,5,6-tetrachloro- |
89190 | 1,2-Benzenedicarboxylic acid, butyl decyl ester |
146509 | 1,2-Benzenedicarboxylic acid, diisohexyl ester |
4376209 | 1,2-Benzenedicarboxylic acid, mono(2-ethylhexyl) ester |
120809 | 1,2-Benzenediol |
16474898 | 1,2-Benzenediol |
16474901 | 1,2-Benzenediol |
37349329 | 1,2-Benzenediol |
1198556 | 1,2-Benzenediol, 3,4,5,6-tetrachloro- |
56961207 | 1,2-Benzenediol, 3,4,5-trichloro- |
32139723 | 1,2-Benzenediol, 3,4,6-trichloro- |
51434 | 1,2-Benzenediol, 4-[(1R)-1-hydroxy-2-(methylamino)ethyl]- |
51028730 | 1,2-Benzenediol, 4-[(1R)-1-hydroxy-2-(methylamino)ethyl]- |
55312 | 1,2-Benzenediol, 4-[(1R)-1-hydroxy-2-(methylamino)ethyl]-, hydrochloride |
329657 | 1,2-Benzenediol, 4-[1-hydroxy-2-(methylamino)ethyl]- |
51309 | 1,2-Benzenediol, 4-[1-hydroxy-2-[(1-methylethyl)amino]ethyl]-, hydrochloride |
949360 | 1,2-Benzenediol, 4-[1-hydroxy-2-[(1-methylethyl)amino]ethyl]-, hydrochloride |
1336896 | 1,2-Benzenediol, 4-[1-hydroxy-2-[(1-methylethyl)amino]ethyl]-, hydrochloride |
71249428 | 1,2-Benzenediol, 4-[1-hydroxy-2-[(1-methylethyl)amino]ethyl]-, hydrochloride |
81072 | 1,2-Benzisothiazol-3(2H)-one, 1,1- dioxide and salts |
81072 | 1,2-Benzisothiazol-3(2H)-one, 1,1-dioxide |
474919 | 1,2-Benzisothiazol-3(2H)-one, 1,1-dioxide |
61255274 | 1,2-Benzisothiazol-3(2H)-one, 1,1-dioxide |
126987835 | 1,2-Benzisothiazol-3(2H)-one, 1,1-dioxide |
890126348 | 1,2-Benzisothiazol-3(2H)-one, 1,1-dioxide |
128449 | 1,2-Benzisothiazol-3(2H)-one, 1,1-dioxide, sodium salt (1:1) |
38279264 | 1,2-Benzisothiazol-3(2H)-one, 1,1-dioxide, sodium salt (1:1) |
272162 | 1,2-Benzisothiazole |
40991386 | 1,2-Benzisothiazole, 3-methoxy- |
5493458 | 1,2-Cyclohexanedicarboxylic acid, 1,2-bis(2-oxiranylmethyl) ester |
123773 | 1,2-Diazenedicarboxamide |
52737710 | 1,2-Diazenedicarboxamide |
62494615 | 1,2-Diazenedicarboxamide |
62494626 | 1,2-Diazenedicarboxamide |
62494853 | 1,2-Diazenedicarboxamide |
65098864 | 1,2-Diazenedicarboxamide |
65098875 | 1,2-Diazenedicarboxamide |
72514455 | 1,2-Diazenedicarboxamide |
73247424 | 1,2-Diazenedicarboxamide |
73905778 | 1,2-Diazenedicarboxamide |
81774201 | 1,2-Diazenedicarboxamide |
89073358 | 1,2-Diazenedicarboxamide |
97707965 | 1,2-Diazenedicarboxamide |
131715269 | 1,2-Diazenedicarboxamide |
183256782 | 1,2-Diazenedicarboxamide |
218433148 | 1,2-Diazenedicarboxamide |
221272726 | 1,2-Diazenedicarboxamide |
882523855 | 1,2-Diazenedicarboxamide |
1006730148 | 1,2-Diazenedicarboxamide |
107153 | 1,2-Ethanediamine |
8030248 | 1,2-Ethanediamine |
85404188 | 1,2-Ethanediamine |
91816 | 1,2-Ethanediamine, N,N-dimethyl-N'-(phenylmethyl)-N'-2-pyridinyl- |
154698 | 1,2-Ethanediamine, N,N-dimethyl-N'-(phenylmethyl)-N'-2-pyridinyl-, monohydrochloride |
91805 | 1,2-Ethanediamine, N,N-dimethyl-N'-2-pyridinyl-N'-(2-thienylmethyl)- |
958930 | 1,2-Ethanediamine, N,N-dimethyl-N'-2-pyridinyl-N'-(3-thienylmethyl)-, monohydrochloride |
961717 | 1,2-Ethanediamine, N,N-dimethyl-N'-phenyl-N'-(phenylmethyl)- |
2045525 | 1,2-Ethanediamine, N,N-dimethyl-N'-phenyl-N'-(phenylmethyl)-, monohydrochloride |
91849 | 1,2-Ethanediamine, N-[(4-methoxyphenyl)methyl]-N',N'-dimethyl-N-2-pyridinyl- |
91850 | 1,2-Ethanediamine, N-[(4-methoxyphenyl)methyl]-N',N'-dimethyl-N-2-pyrimidinyl- |
63569 | 1,2-Ethanediamine, N-[(4-methoxyphenyl)methyl]-N',N'-dimethyl-N-2-pyrimidinyl-, monohydrochloride |
148652 | 1,2-Ethanediamine, N-[(5-chloro-2-thienyl)methyl]-N',N'-dimethyl-N-2-pyridinyl- |
110189 | 1,2-Ethanediamine, N1,N1,N2,N2-tetramethyl- |
1258795322 | 1,2-Ethanediamine, N1,N1,N2,N2-tetramethyl- |
135239 | 1,2-Ethanediamine, N1,N1-dimethyl-N2-2-pyridinyl-N2-(2-thienylmethyl)-, hydrochloride (1:1) |
8048019 | 1,2-Ethanediamine, N1,N1-dimethyl-N2-2-pyridinyl-N2-(2-thienylmethyl)-, hydrochloride (1:1) |
112243 | 1,2-Ethanediamine, N1,N2-bis(2-aminoethyl)- |
14175145 | 1,2-Ethanediamine, N1,N2-bis(2-aminoethyl)- |
39421777 | 1,2-Ethanediamine, N1,N2-bis(2-aminoethyl)- |
71124113 | 1,2-Ethanediamine, N1,N2-bis(2-aminoethyl)- |
105093207 | 1,2-Ethanediamine, N1,N2-bis(2-aminoethyl)- |
110670332 | 1,2-Ethanediamine, N1,N2-bis(2-aminoethyl)- |
150139029 | 1,2-Ethanediamine, N1,N2-bis(2-aminoethyl)- |
193487080 | 1,2-Ethanediamine, N1,N2-bis(2-aminoethyl)- |
801997182 | 1,2-Ethanediamine, N1,N2-bis(2-aminoethyl)- |
1309612461 | 1,2-Ethanediamine, N1,N2-bis(2-aminoethyl)- |
1404190346 | 1,2-Ethanediamine, N1,N2-bis(2-aminoethyl)- |
111400 | 1,2-Ethanediamine, N1-(2-aminoethyl)- |
8076559 | 1,2-Ethanediamine, N1-(2-aminoethyl)- |
26915786 | 1,2-Ethanediamine, N1-(2-aminoethyl)- |
53303767 | 1,2-Ethanediamine, N1-(2-aminoethyl)- |
54018927 | 1,2-Ethanediamine, N1-(2-aminoethyl)- |
59135909 | 1,2-Ethanediamine, N1-(2-aminoethyl)- |
73989307 | 1,2-Ethanediamine, N1-(2-aminoethyl)- |
94700171 | 1,2-Ethanediamine, N1-(2-aminoethyl)- |
98824352 | 1,2-Ethanediamine, N1-(2-aminoethyl)- |
203009170 | 1,2-Ethanediamine, N1-(2-aminoethyl)- |
419553449 | 1,2-Ethanediamine, N1-(2-aminoethyl)- |
859039002 | 1,2-Ethanediamine, N1-(2-aminoethyl)- |
1078151435 | 1,2-Ethanediamine, N1-(2-aminoethyl)- |
112572 | 1,2-Ethanediamine, N1-(2-aminoethyl)-N2-[2-[(2-aminoethyl)amino]ethyl]- |
107324823 | 1,2-Ethanediamine, N1-(2-aminoethyl)-N2-[2-[(2-aminoethyl)amino]ethyl]- |
115254449 | 1,2-Ethanediamine, N1-(2-aminoethyl)-N2-[2-[(2-aminoethyl)amino]ethyl]- |
675120384 | 1,2-Ethanediamine, N1-(2-aminoethyl)-N2-[2-[(2-aminoethyl)amino]ethyl]- |
778611862 | 1,2-Ethanediamine, N1-(2-aminoethyl)-N2-[2-[(2-aminoethyl)amino]ethyl]- |
916431340 | 1,2-Ethanediamine, N1-(2-aminoethyl)-N2-[2-[(2-aminoethyl)amino]ethyl]- |
951317923 | 1,2-Ethanediamine, N1-(2-aminoethyl)-N2-[2-[(2-aminoethyl)amino]ethyl]- |
1061621166 | 1,2-Ethanediamine, N1-(2-aminoethyl)-N2-[2-[(2-aminoethyl)amino]ethyl]- |
1151794169 | 1,2-Ethanediamine, N1-(2-aminoethyl)-N2-[2-[(2-aminoethyl)amino]ethyl]- |
1465254 | 1,2-Ethanediamine, N1-1-naphthalenyl-, hydrochloride (1:2) |
59336 | 1,2-Ethanediamine, N1-[(4-methoxyphenyl)methyl]-N2,N2-dimethyl-N1-2-pyridinyl-, (2Z)-2-butenedioate (1:1) |
5572065 | 1,2-Ethanediamine, N1-[(4-methoxyphenyl)methyl]-N2,N2-dimethyl-N1-2-pyridinyl-, (2Z)-2-butenedioate (1:1) |
107211 | 1,2-Ethanediol |
37221957 | 1,2-Ethanediol |
71767641 | 1,2-Ethanediol |
1371582330 | 1,2-Ethanediol |
111557 | 1,2-Ethanediol, 1,2-diacetate |
628966 | 1,2-Ethanediol, 1,2-dinitrate |
121749119 | 1,2-Ethanediol, 1,2-dinitrate |
542596 | 1,2-Ethanediol, 1-acetate |
142461 | 1,2-Hydrazinedicarbothioamide |
110214 | 1,2-Hydrazinedicarboxamide |
77107483 | 1,2-Hydrazinedicarboxamide |
524425 | 1,2-Naphthalenedione |
1120714 | 1,2-Oxathiolane, 2,2-dioxide |
463490 | 1,2-Propadiene |
6688911 | 1,2-Propadiene |
78900 | 1,2-Propanediamine |
10424381 | 1,2-Propanediamine |
68928994 | 1,2-Propanediamine |
57556 | 1,2-Propanediol |
114261 | 1,2-Propanediol |
4254164 | 1,2-Propanediol |
63625569 | 1,2-Propanediol |
190913758 | 1,2-Propanediol |
1194046202 | 1,2-Propanediol |
6423434 | 1,2-Propanediol, 1,2-dinitrate |
93141 | 1,2-Propanediol, 3-(2-methoxyphenoxy)- |
1336670 | 1,2-Propanediol, 3-(2-methoxyphenoxy)- |
12041735 | 1,2-Propanediol, 3-(2-methoxyphenoxy)- |
128707448 | 1,2-Propanediol, 3-(2-methoxyphenoxy)- |
532036 | 1,2-Propanediol, 3-(2-methoxyphenoxy)-, 1-carbamate |
145308038 | 1,2-Propanediol, 3-(2-methoxyphenoxy)-, 1-carbamate |
96242 | 1,2-Propanediol, 3-chloro- |
96662 | 1,2-Propanediol, 3-chloro- |
52340462 | 1,2-Propanediol, 3-chloro- |
69420220 | 1,2-Propanediol, 3-chloro- |
16091182 | 1,3,2-Dioxastannepin-4,7-dione, 2,2-dioctyl- |
24493514 | 1,3,2-Dioxastannepin-4,7-dione, 2,2-dioctyl- |
32296041 | 1,3,2-Dioxastannepin-4,7-dione, 2,2-dioctyl- |
52434421 | 1,3,2-Dioxastannepin-4,7-dione, 2,2-dioctyl- |
1034419 | 1,3,4-Metheno-1H-cyclobuta[cd]pentalen-2-ol, 1,1a,3,3a,4,5,5,5a,5b,6-decachlorooctahydro- |
2385855 | 1,3,4-Metheno-1H-cyclobuta[cd]pentalene, 1,1a,2,2,3,3a,4,5,5,5a,5b,6-dodecachlorooctahydro- |
12557889 | 1,3,4-Metheno-1H-cyclobuta[cd]pentalene, 1,1a,2,2,3,3a,4,5,5,5a,5b,6-dodecachlorooctahydro- |
12707436 | 1,3,4-Metheno-1H-cyclobuta[cd]pentalene, 1,1a,2,2,3,3a,4,5,5,5a,5b,6-dodecachlorooctahydro- |
12766040 | 1,3,4-Metheno-1H-cyclobuta[cd]pentalene, 1,1a,2,2,3,3a,4,5,5,5a,5b,6-dodecachlorooctahydro- |
20594494 | 1,3,4-Metheno-1H-cyclobuta[cd]pentalene, 1,1a,2,2,3,3a,4,5,5,5a,5b,6-dodecachlorooctahydro- |
56449786 | 1,3,4-Metheno-1H-cyclobuta[cd]pentalene, 1,1a,2,2,3,3a,4,5,5,5a,5b,6-dodecachlorooctahydro- |
4234791 | 1,3,4-Metheno-1H-cyclobuta[cd]pentalene-2-pentanoic acid, 1,1a,3,3a,4,5,5,5a,5b,6-decachlorooctahydro-2-hydroxy-.gamma.-oxo-, ethyl ester |
143500 | 1,3,4-Metheno-2H-cyclobuta[cd]pentalen-2-one, 1,1a,3,3a,4,5,5,5a,5b,6-decachlorooctahydro- |
19666309 | 1,3,4-Oxadiazol-2(3H)-one, 3-[2,4-dichloro-5-(1-methylethoxy)phenyl]-5-(1,1-dimethylethyl)- |
101257 | 1,3,5,7-Tetraazabicyclo[3.3.1]nonane, 3,7-dinitroso- |
42617174 | 1,3,5,7-Tetraazabicyclo[3.3.1]nonane, 3,7-dinitroso- |
42617185 | 1,3,5,7-Tetraazabicyclo[3.3.1]nonane, 3,7-dinitroso- |
50337901 | 1,3,5,7-Tetraazabicyclo[3.3.1]nonane, 3,7-dinitroso- |
52229988 | 1,3,5,7-Tetraazabicyclo[3.3.1]nonane, 3,7-dinitroso- |
85605181 | 1,3,5,7-Tetraazabicyclo[3.3.1]nonane, 3,7-dinitroso- |
100970 | 1,3,5,7-Tetraazatricyclo[3.3.1.13,7]decane |
11103676 | 1,3,5,7-Tetraazatricyclo[3.3.1.13,7]decane |
15978333 | 1,3,5,7-Tetraazatricyclo[3.3.1.13,7]decane |
56549349 | 1,3,5,7-Tetraazatricyclo[3.3.1.13,7]decane |
74734160 | 1,3,5,7-Tetraazatricyclo[3.3.1.13,7]decane |
91773487 | 1,3,5,7-Tetraazatricyclo[3.3.1.13,7]decane |
2691410 | 1,3,5,7-Tetrazocine, octahydro-1,3,5,7-tetranitro- |
5222468 | 1,3,5,7-Tetrazocine, octahydro-1,3,5,7-tetranitro- |
66038264 | 1,3,5,7-Tetrazocine, octahydro-1,3,5,7-tetranitro- |
66745902 | 1,3,5,7-Tetrazocine, octahydro-1,3,5,7-tetranitro- |
97956019 | 1,3,5,7-Tetrazocine, octahydro-1,3,5,7-tetranitro- |
121631138 | 1,3,5,7-Tetrazocine, octahydro-1,3,5,7-tetranitro- |
141615545 | 1,3,5,7-Tetrazocine, octahydro-1,3,5,7-tetranitro- |
2353335 | 1,3,5-Triazin-2(1H)-one, 4-amino-1-(2-deoxy-.beta.-D-erythro-pentofuranosyl)- |
320672 | 1,3,5-Triazin-2(1H)-one, 4-amino-1-.beta.-D-ribofuranosyl- |
101053 | 1,3,5-Triazin-2-amine, 4,6-dichloro-N-(2-chlorophenyl)- |
675149 | 1,3,5-Triazine, 2,4,6-trifluoro- |
51183 | 1,3,5-Triazine, 2,4,6-tris(1-aziridinyl)- |
121824 | 1,3,5-Triazine, hexahydro-1,3,5-trinitro- |
50579232 | 1,3,5-Triazine, hexahydro-1,3,5-trinitro- |
53800536 | 1,3,5-Triazine, hexahydro-1,3,5-trinitro- |
57608454 | 1,3,5-Triazine, hexahydro-1,3,5-trinitro- |
82030420 | 1,3,5-Triazine, hexahydro-1,3,5-trinitro- |
204655618 | 1,3,5-Triazine, hexahydro-1,3,5-trinitro- |
4719044 | 1,3,5-Triazine-1,3,5(2H,4H,6H)-triethanol |
63310098 | 1,3,5-Triazine-1,3,5(2H,4H,6H)-triethanol |
51235042 | 1,3,5-Triazine-2,4(1H,3H)-dione, 3-cyclohexyl-6-(dimethylamino)-1-methyl- |
108805 | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione |
504198 | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione |
134016527 | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione |
273203079 | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione |
1025156 | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3,5-tri-2-propen-1-yl- |
109521508 | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3,5-tri-2-propen-1-yl- |
123339468 | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3,5-tri-2-propen-1-yl- |
196519945 | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3,5-tri-2-propen-1-yl- |
1086264290 | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3,5-tri-2-propen-1-yl- |
87901 | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3,5-trichloro- |
499583312 | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3,5-trichloro- |
1062228505 | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3,5-trichloro- |
827167 | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3,5-trimethyl- |
839907 | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3,5-tris(2-hydroxyethyl)- |
63118423 | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3,5-tris(2-hydroxyethyl)- |
248590650 | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3,5-tris(2-hydroxyethyl)- |
2451629 | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3,5-tris(2-oxiranylmethyl)- |
414867600 | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3,5-tris(2-oxiranylmethyl)- |
61050973 | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3,5-tris(2-oxopropyl)- |
7423532 | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3,5-tris(3-chloro-2-hydroxypropyl)- |
606031 | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3,5-tris(phenylmethyl)- |
2782572 | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3-dichloro- |
76162351 | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3-dichloro- |
2244215 | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3-dichloro-, potassium salt (1:1) |
14426074 | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3-dichloro-, potassium salt (1:1) |
25727268 | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3-dichloro-, potassium salt (1:1) |
57073479 | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3-dichloro-, potassium salt (1:1) |
68462522 | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3-dichloro-, potassium salt (1:1) |
73694072 | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3-dichloro-, potassium salt (1:1) |
156620803 | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3-dichloro-, potassium salt (1:1) |
174016616 | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3-dichloro-, potassium salt (1:1) |
2893789 | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3-dichloro-, sodium salt (1:1) |
10119309 | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3-dichloro-, sodium salt (1:1) |
12676232 | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3-dichloro-, sodium salt (1:1) |
13023284 | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3-dichloro-, sodium salt (1:1) |
16499744 | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3-dichloro-, sodium salt (1:1) |
25717184 | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3-dichloro-, sodium salt (1:1) |
76560286 | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3-dichloro-, sodium salt (1:1) |
81918505 | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3-dichloro-, sodium salt (1:1) |
200401838 | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3-dichloro-, sodium salt (1:1) |
2624171 | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, sodium salt (1:1) |
15193450 | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, sodium salt (1:1) |
108781 | 1,3,5-Triazine-2,4,6-triamine |
504187 | 1,3,5-Triazine-2,4,6-triamine |
65544345 | 1,3,5-Triazine-2,4,6-triamine |
67757431 | 1,3,5-Triazine-2,4,6-triamine |
68379555 | 1,3,5-Triazine-2,4,6-triamine |
70371196 | 1,3,5-Triazine-2,4,6-triamine |
94977272 | 1,3,5-Triazine-2,4,6-triamine |
130392039 | 1,3,5-Triazine-2,4,6-triamine |
169314629 | 1,3,5-Triazine-2,4,6-triamine |
1228929278 | 1,3,5-Triazine-2,4,6-triamine |
1399841690 | 1,3,5-Triazine-2,4,6-triamine |
1399841714 | 1,3,5-Triazine-2,4,6-triamine |
1399841736 | 1,3,5-Triazine-2,4,6-triamine |
645056 | 1,3,5-Triazine-2,4,6-triamine, N,N,N',N',N'',N''-hexamethyl- |
7673098 | 1,3,5-Triazine-2,4,6-triamine, N2,N4,N6-trichloro- |
6190654 | 1,3,5-Triazine-2,4-diamine, 6-chloro-N-(1-methylethyl)- |
1007289 | 1,3,5-Triazine-2,4-diamine, 6-chloro-N-ethyl- |
139402 | 1,3,5-Triazine-2,4-diamine, 6-chloro-N2,N4-bis(1-methylethyl)- |
122349 | 1,3,5-Triazine-2,4-diamine, 6-chloro-N2,N4-diethyl- |
11141201 | 1,3,5-Triazine-2,4-diamine, 6-chloro-N2,N4-diethyl- |
12764715 | 1,3,5-Triazine-2,4-diamine, 6-chloro-N2,N4-diethyl- |
39291640 | 1,3,5-Triazine-2,4-diamine, 6-chloro-N2,N4-diethyl- |
119603940 | 1,3,5-Triazine-2,4-diamine, 6-chloro-N2,N4-diethyl- |
5915413 | 1,3,5-Triazine-2,4-diamine, 6-chloro-N2-(1,1-dimethylethyl)-N4-ethyl- |
63026573 | 1,3,5-Triazine-2,4-diamine, 6-chloro-N2-(1,1-dimethylethyl)-N4-ethyl- |
1912249 | 1,3,5-Triazine-2,4-diamine, 6-chloro-N2-ethyl-N4-(1-methylethyl)- |
11121316 | 1,3,5-Triazine-2,4-diamine, 6-chloro-N2-ethyl-N4-(1-methylethyl)- |
12040458 | 1,3,5-Triazine-2,4-diamine, 6-chloro-N2-ethyl-N4-(1-methylethyl)- |
12797727 | 1,3,5-Triazine-2,4-diamine, 6-chloro-N2-ethyl-N4-(1-methylethyl)- |
39400721 | 1,3,5-Triazine-2,4-diamine, 6-chloro-N2-ethyl-N4-(1-methylethyl)- |
69771319 | 1,3,5-Triazine-2,4-diamine, 6-chloro-N2-ethyl-N4-(1-methylethyl)- |
93616398 | 1,3,5-Triazine-2,4-diamine, 6-chloro-N2-ethyl-N4-(1-methylethyl)- |
1610180 | 1,3,5-Triazine-2,4-diamine, 6-methoxy-N2,N4-bis(1-methylethyl)- |
11126753 | 1,3,5-Triazine-2,4-diamine, 6-methoxy-N2,N4-bis(1-methylethyl)- |
7287196 | 1,3,5-Triazine-2,4-diamine, N,N'-bis(1-methylethyl)-6-(methylthio)- |
1014706 | 1,3,5-Triazine-2,4-diamine, N,N'-diethyl-6-(methylthio)- |
886500 | 1,3,5-Triazine-2,4-diamine, N-(1,1-dimethylethyl)-N'-ethyl-6-(methylthio)- |
1610179 | 1,3,5-Triazine-2,4-diamine, N-ethyl-6-methoxy-N'-(1-methylethyl)- |
834128 | 1,3,5-Triazine-2,4-diamine, N-ethyl-N'-(1-methylethyl)-6-(methylthio)- |
110883 | 1,3,5-Trioxane |
113783485 | 1,3,5-Trioxane |
123637 | 1,3,5-Trioxane, 2,4,6-trimethyl- |
51289715 | 1,3,5-Trioxane, 2,4,6-trimethyl- |
108452 | 1,3-Benzenediamine |
1274866895 | 1,3-Benzenediamine |
823405 | 1,3-Benzenediamine, 2-methyl- |
15481706 | 1,3-Benzenediamine, 2-methyl-, dihydrochloride |
495545 | 1,3-Benzenediamine, 4-(2-phenyldiazenyl)- |
89961160 | 1,3-Benzenediamine, 4-(2-phenyldiazenyl)- |
532821 | 1,3-Benzenediamine, 4-(2-phenyldiazenyl)-, hydrochloride (1:1) |
5131602 | 1,3-Benzenediamine, 4-chloro- |
615054 | 1,3-Benzenediamine, 4-methoxy- |
39156417 | 1,3-Benzenediamine, 4-methoxy-, sulfate (1:1) |
108066984 | 1,3-Benzenediamine, 4-methoxy-, sulfate (1:1) |
95807 | 1,3-Benzenediamine, 4-methyl- |
95877 | 1,3-Benzenediamine, 4-methyl- |
12236565 | 1,3-Benzenediamine, 4-methyl- |
25376458 | 1,3-Benzenediamine, 4-methyl- |
85898880 | 1,3-Benzenediamine, 4-methyl- |
5131588 | 1,3-Benzenediamine, 4-nitro- |
626175 | 1,3-Benzenedicarbonitrile |
1897456 | 1,3-Benzenedicarbonitrile, 2,4,5,6-tetrachloro- |
37223691 | 1,3-Benzenedicarbonitrile, 2,4,5,6-tetrachloro- |
101963739 | 1,3-Benzenedicarbonitrile, 2,4,5,6-tetrachloro- |
216082574 | 1,3-Benzenedicarbonitrile, 2,4,5,6-tetrachloro- |
342632513 | 1,3-Benzenedicarbonitrile, 2,4,5,6-tetrachloro- |
462093272 | 1,3-Benzenedicarbonitrile, 2,4,5,6-tetrachloro- |
137893 | 1,3-Benzenedicarboxylic acid, 1,3-bis(2-ethylhexyl) ester |
7195439 | 1,3-Benzenedicarboxylic acid, bis(oxiranylmethyl) ester |
1477550 | 1,3-Benzenedimethanamine |
153326455 | 1,3-Benzenedimethanamine |
554432836 | 1,3-Benzenedimethanamine |
108463 | 1,3-Benzenediol |
136776 | 1,3-Benzenediol, 4-hexyl- |
500663 | 1,3-Benzenediol, 5-pentyl- |
98486 | 1,3-Benzenedisulfonic acid |
22961826 | 1,3-Benzodioxol-4-ol, 2,2-dimethyl- |
22781233 | 1,3-Benzodioxol-4-ol, 2,2-dimethyl-, methylcarbamate |
120581 | 1,3-Benzodioxole, 5-(1-propen-1-yl)- |
191281035 | 1,3-Benzodioxole, 5-(1-propen-1-yl)- |
94597 | 1,3-Benzodioxole, 5-(2-propen-1-yl)- |
1406559 | 1,3-Benzodioxole, 5-(2-propen-1-yl)- |
8022922 | 1,3-Benzodioxole, 5-(2-propen-1-yl)- |
120627 | 1,3-Benzodioxole, 5-[2-(octylsulfinyl)propyl]- |
23715119 | 1,3-Benzodioxole, 5-[2-(octylsulfinyl)propyl]- |
51036 | 1,3-Benzodioxole, 5-[[2-(2-butoxyethoxy)ethoxy]methyl]-6-propyl- |
12750924 | 1,3-Benzodioxole, 5-[[2-(2-butoxyethoxy)ethoxy]methyl]-6-propyl- |
94586 | 1,3-Benzodioxole, 5-propyl- |
120570 | 1,3-Benzodioxole-5-carboxaldehyde |
30024749 | 1,3-Benzodioxole-5-carboxaldehyde |
659726326 | 1,3-Benzodioxole-5-carboxaldehyde |
326614 | 1,3-Benzodioxole-5-methanol, 5-acetate |
106990 | 1,3-Butadiene |
25339575 | 1,3-Butadiene |
130983709 | 1,3-Butadiene |
183592612 | 1,3-Butadiene |
1213224271 | 1,3-Butadiene |
87683 | 1,3-Butadiene, 1,1,2,3,4,4-hexachloro- |
1653196 | 1,3-Butadiene, 2,3-dichloro- |
126998 | 1,3-Butadiene, 2-chloro- |
184963095 | 1,3-Butadiene, 2-chloro- |
9010984 | 1,3-Butadiene, 2-chloro-, homopolymer |
28430719 | 1,3-Butadiene, 2-chloro-, homopolymer |
129541839 | 1,3-Butadiene, 2-chloro-, homopolymer |
78795 | 1,3-Butadiene, 2-methyl- |
78006925 | 1,3-Butadiene, 2-methyl- |
823271950 | 1,3-Butadiene, 2-methyl- |
97847 | 1,3-Butanediamine, N1,N1,N3,N3-tetramethyl- |
55637280 | 1,3-Butanediamine, N1,N1,N3,N3-tetramethyl- |
107880 | 1,3-Butanediol |
18826954 | 1,3-Butanediol |
817176753 | 1,3-Butanediol |
542927 | 1,3-Cyclopentadiene |
26912334 | 1,3-Cyclopentadiene |
77473 | 1,3-Cyclopentadiene, 1,2,3,4,5,5-hexachloro- |
77474 | 1,3-Cyclopentadiene, 1,2,3,4,5,5-hexachloro- |
828002 | 1,3-Dioxan-4-ol, 2,6-dimethyl-, 4-acetate |
37235599 | 1,3-Dioxan-4-ol, 2,6-dimethyl-, 4-acetate |
505226 | 1,3-Dioxane |
25683005 | 1,3-Dioxane, 2-butyl-2-methyl- |
126396 | 1,3-Dioxolane, 2-ethyl-2-methyl- |
90641568 | 1,3-Dioxolane, 2-ethyl-2-methyl- |
957464743 | 1,3-Dioxolane, 2-ethyl-2-methyl- |
497267 | 1,3-Dioxolane, 2-methyl- |
1331095 | 1,3-Dioxolane, 2-methyl- |
89579873 | 1,3-Dioxolane, 2-methyl- |
5634399 | 1,3-Dioxolane-4-methanol, 2-(1-iodoethyl)- |
26419738 | 1,3-Dithiolane-2-carboxaldehyde, 2,4-dimethyl-, O-[(methylamino)carbonyl]oxime |
2439012 | 1,3-Dithiolo[4,5-b]quinoxalin-2-one, 6-methyl- |
85449 | 1,3-Isobenzofurandione |
39363638 | 1,3-Isobenzofurandione |
632791 | 1,3-Isobenzofurandione, 4,5,6,7-tetrabromo- |
72625957 | 1,3-Isobenzofurandione, 4,5,6,7-tetrabromo- |
117088 | 1,3-Isobenzofurandione, 4,5,6,7-tetrachloro- |
204975246 | 1,3-Isobenzofurandione, 4,5,6,7-tetrachloro- |
858829104 | 1,3-Isobenzofurandione, 4,5,6,7-tetrachloro- |
5466842 | 1,3-Isobenzofurandione, 5-nitro- |
2610051 | 1,3-Naphthalenedisulfonic acid, 6,6'-[(3,3'-dimethoxy[1,1'-biphenyl]-4,4'-diyl)bis(2,1-diazenediyl)]bis[4-amino-5-hydroxy-, sodium salt (1:4) |
755040574 | 1,3-Naphthalenedisulfonic acid, 6,6'-[(3,3'-dimethoxy[1,1'-biphenyl]-4,4'-diyl)bis(2,1-diazenediyl)]bis[4-amino-5-hydroxy-, sodium salt (1:4) |
314136 | 1,3-Naphthalenedisulfonic acid, 6,6'-[(3,3'-dimethyl[1,1'-biphenyl]-4,4'-diyl)bis(2,1-diazenediyl)]bis[4-amino-5-hydroxy-, sodium salt (1:4) |
179472538 | 1,3-Naphthalenedisulfonic acid, 6,6'-[(3,3'-dimethyl[1,1'-biphenyl]-4,4'-diyl)bis(2,1-diazenediyl)]bis[4-amino-5-hydroxy-, sodium salt (1:4) |
1936158 | 1,3-Naphthalenedisulfonic acid, 7-hydroxy-8-(2-phenyldiazenyl)-, sodium salt (1:2) |
53988800 | 1,3-Naphthalenedisulfonic acid, 7-hydroxy-8-(2-phenyldiazenyl)-, sodium salt (1:2) |
6459945 | 1,3-Naphthalenedisulfonic acid, 8-[2-[3,3'-dimethyl-4'-[2-[4-[[(4-methylphenyl)sulfonyl]oxy]phenyl]diazenyl][1,1'-biphenyl]-4-yl]diazenyl]-7-hydroxy-, sodium salt (1:2) |
471258227 | 1,3-Naphthalenedisulfonic acid, 8-[2-[3,3'-dimethyl-4'-[2-[4-[[(4-methylphenyl)sulfonyl]oxy]phenyl]diazenyl][1,1'-biphenyl]-4-yl]diazenyl]-7-hydroxy-, sodium salt (1:2) |
6358298 | 1,3-Naphthalenedisulfonic acid, 8-[2-[4'-[2-(4-ethoxyphenyl)diazenyl]-3,3'-dimethyl[1,1'-biphenyl]-4-yl]diazenyl]-7-hydroxy-, sodium salt (1:2) |
504609 | 1,3-Pentadiene |
109762 | 1,3-Propanediamine |
54018949 | 1,3-Propanediamine |
17070450 | 1,3-Propanediamine, N-(2-chloroethyl)-N'-(6-chloro-2-methoxy-9-acridinyl)-, dihydrochloride |
109557 | 1,3-Propanediamine, N1,N1-dimethyl- |
68497585 | 1,3-Propanediamine, N1,N1-dimethyl- |
1190921642 | 1,3-Propanediamine, N1,N1-dimethyl- |
56188 | 1,3-Propanediamine, N1-(3-aminopropyl)- |
6291845 | 1,3-Propanediamine, N1-methyl- |
504632 | 1,3-Propanediol |
757125932 | 1,3-Propanediol |
3296900 | 1,3-Propanediol, 2,2-bis(bromomethyl)- |
115775 | 1,3-Propanediol, 2,2-bis(hydroxymethyl)- |
75398866 | 1,3-Propanediol, 2,2-bis(hydroxymethyl)- |
88201290 | 1,3-Propanediol, 2,2-bis(hydroxymethyl)- |
4196865 | 1,3-Propanediol, 2,2-bis[(benzoyloxy)methyl]-, 1,3-dibenzoate |
78115 | 1,3-Propanediol, 2,2-bis[(nitrooxy)methyl]-, 1,3-dinitrate |
53025846 | 1,3-Propanediol, 2,2-bis[(nitrooxy)methyl]-, 1,3-dinitrate |
103842906 | 1,3-Propanediol, 2,2-bis[(nitrooxy)methyl]-, 1,3-dinitrate |
108736716 | 1,3-Propanediol, 2,2-bis[(nitrooxy)methyl]-, 1,3-dinitrate |
4196876 | 1,3-Propanediol, 2-[(benzoyloxy)methyl]-2-methyl-, 1,3-dibenzoate |
77861 | 1,3-Propanediol, 2-amino-2-(hydroxymethyl)- |
10819586 | 1,3-Propanediol, 2-amino-2-(hydroxymethyl)- |
25149079 | 1,3-Propanediol, 2-amino-2-(hydroxymethyl)- |
68755453 | 1,3-Propanediol, 2-amino-2-(hydroxymethyl)- |
83147391 | 1,3-Propanediol, 2-amino-2-(hydroxymethyl)- |
108195864 | 1,3-Propanediol, 2-amino-2-(hydroxymethyl)- |
119320159 | 1,3-Propanediol, 2-amino-2-(hydroxymethyl)- |
857365232 | 1,3-Propanediol, 2-amino-2-(hydroxymethyl)- |
1158650646 | 1,3-Propanediol, 2-amino-2-(hydroxymethyl)- |
52517 | 1,3-Propanediol, 2-bromo-2-nitro- |
133248961 | 1,3-Propanediol, 2-bromo-2-nitro- |
179733609 | 1,3-Propanediol, 2-bromo-2-nitro- |
1135443730 | 1,3-Propanediol, 2-bromo-2-nitro- |
497041 | 1,3-Propanediol, 2-chloro- |
77996 | 1,3-Propanediol, 2-ethyl-2-(hydroxymethyl)- |
30774186 | 1,3-Propanediol, 2-ethyl-2-(hydroxymethyl)- |
51811735 | 1,3-Propanediol, 2-ethyl-2-(hydroxymethyl)- |
53632318 | 1,3-Propanediol, 2-ethyl-2-(hydroxymethyl)- |
59218552 | 1,3-Propanediol, 2-ethyl-2-(hydroxymethyl)- |
65581897 | 1,3-Propanediol, 2-ethyl-2-(hydroxymethyl)- |
69896099 | 1,3-Propanediol, 2-ethyl-2-(hydroxymethyl)- |
77974028 | 1,3-Propanediol, 2-ethyl-2-(hydroxymethyl)- |
97649495 | 1,3-Propanediol, 2-ethyl-2-(hydroxymethyl)- |
101164618 | 1,3-Propanediol, 2-ethyl-2-(hydroxymethyl)- |
102984189 | 1,3-Propanediol, 2-ethyl-2-(hydroxymethyl)- |
110368520 | 1,3-Propanediol, 2-ethyl-2-(hydroxymethyl)- |
853320124 | 1,3-Propanediol, 2-ethyl-2-(hydroxymethyl)- |
3032551 | 1,3-Propanediol, 2-methyl-2-[(nitrooxy)methyl]-, 1,3-dinitrate |
57534 | 1,3-Propanediol, 2-methyl-2-propyl-, 1,3-dicarbamate |
109808 | 1,3-Propanedithiol |
1893330 | 1,4'-Bipiperidine]-4'-carboxamide, 1'-[4-(4-fluorophenyl)-4-oxobutyl]- |
106503 | 1,4-Benzenediamine |
56481766 | 1,4-Benzenediamine |
82785555 | 1,4-Benzenediamine |
609201 | 1,4-Benzenediamine, 2,6-dichloro- |
61702441 | 1,4-Benzenediamine, 2-chloro-, sulfate (1:1) |
95705 | 1,4-Benzenediamine, 2-methyl- |
33379316 | 1,4-Benzenediamine, 2-methyl- |
62488191 | 1,4-Benzenediamine, 2-methyl- |
124688013 | 1,4-Benzenediamine, 2-methyl- |
156031300 | 1,4-Benzenediamine, 2-methyl- |
6369591 | 1,4-Benzenediamine, 2-methyl-, sulfate (1:?) |
81892731 | 1,4-Benzenediamine, 2-methyl-, sulfate (1:?) |
5307142 | 1,4-Benzenediamine, 2-nitro- |
29467014 | 1,4-Benzenediamine, 2-nitro- |
100221 | 1,4-Benzenediamine, N1,N1,N4,N4-tetramethyl- |
93050 | 1,4-Benzenediamine, N1,N1-diethyl- |
99989 | 1,4-Benzenediamine, N1,N1-dimethyl- |
3081149 | 1,4-Benzenediamine, N1,N4-bis(1,4-dimethylpentyl)- |
32588764 | 1,4-Benzenediamine, N1,N4-bis(1,4-dimethylpentyl)- |
583049461 | 1,4-Benzenediamine, N1,N4-bis(1,4-dimethylpentyl)- |
101962 | 1,4-Benzenediamine, N1,N4-bis(1-methylpropyl)- |
1042164420 | 1,4-Benzenediamine, N1,N4-bis(1-methylpropyl)- |
93469 | 1,4-Benzenediamine, N1,N4-di-2-naphthalenyl- |
60005698 | 1,4-Benzenediamine, N1,N4-di-2-naphthalenyl- |
112721025 | 1,4-Benzenediamine, N1,N4-di-2-naphthalenyl- |
866724574 | 1,4-Benzenediamine, N1,N4-di-2-naphthalenyl- |
74317 | 1,4-Benzenediamine, N1,N4-diphenyl- |
66746427 | 1,4-Benzenediamine, N1,N4-diphenyl- |
72711536 | 1,4-Benzenediamine, N1,N4-diphenyl- |
943443445 | 1,4-Benzenediamine, N1,N4-diphenyl- |
793248 | 1,4-Benzenediamine, N1-(1,3-dimethylbutyl)-N4-phenyl- |
50809580 | 1,4-Benzenediamine, N1-(1,3-dimethylbutyl)-N4-phenyl- |
76600845 | 1,4-Benzenediamine, N1-(1,3-dimethylbutyl)-N4-phenyl- |
101724 | 1,4-Benzenediamine, N1-(1-methylethyl)-N4-phenyl- |
12771903 | 1,4-Benzenediamine, N1-(1-methylethyl)-N4-phenyl- |
59792631 | 1,4-Benzenediamine, N1-(1-methylethyl)-N4-phenyl- |
87133560 | 1,4-Benzenediamine, N1-(1-methylethyl)-N4-phenyl- |
121889803 | 1,4-Benzenediamine, N1-(1-methylethyl)-N4-phenyl- |
101542 | 1,4-Benzenediamine, N1-phenyl- |
12227746 | 1,4-Benzenediamine, N1-phenyl- |
76600630 | 1,4-Benzenediamine, N1-phenyl- |
624180 | 1,4-Benzenediamine, hydrochloride (1:2) |
100210 | 1,4-Benzenedicarboxylic acid |
211863900 | 1,4-Benzenedicarboxylic acid |
211863922 | 1,4-Benzenedicarboxylic acid |
120616 | 1,4-Benzenedicarboxylic acid, 1,4-dimethyl ester |
63143146 | 1,4-Benzenedicarboxylic acid, 1,4-dimethyl ester |
202644540 | 1,4-Benzenedicarboxylic acid, 1,4-dimethyl ester |
2136790 | 1,4-Benzenedicarboxylic acid, 2,3,5,6-tetrachloro- |
709988 | 1,4-Benzenedicarboxylic acid, 2,3,5,6-tetrachloro-, dimethyl ester |
1861321 | 1,4-Benzenedicarboxylic acid, 2,3,5,6-tetrachloro-, dimethyl ester |
887547 | 1,4-Benzenedicarboxylic acid, 2,3,5,6-tetrachloro-, monomethyl ester |
1861321 | 1,4-Benzenedicarboxylic acid, 2,3,5,6-tetrachloro-, monomethyl ester |
123319 | 1,4-Benzenediol |
8027029 | 1,4-Benzenediol |
57534131 | 1,4-Benzenediol |
1948330 | 1,4-Benzenediol, 2-(1,1-dimethylethyl)- |
29863170 | 1,4-Benzenediol, 2-(1,1-dimethylethyl)- |
68816568 | 1,4-Benzenediol, 2-(1,1-dimethylethyl)- |
123477690 | 1,4-Benzenediol, 2-(1,1-dimethylethyl)- |
140627334 | 1,4-Benzenediol, 2-(1,1-dimethylethyl)- |
110634 | 1,4-Butanediol |
732189036 | 1,4-Butanediol |
1204746064 | 1,4-Butanediol |
1400594639 | 1,4-Butanediol |
55981 | 1,4-Butanediol, dimethanesulfonate |
280579 | 1,4-Diazabicyclo[2.2.2]octane |
23790332 | 1,4-Diazabicyclo[2.2.2]octane |
88935437 | 1,4-Diazabicyclo[2.2.2]octane |
101484199 | 1,4-Diazabicyclo[2.2.2]octane |
150605019 | 1,4-Diazabicyclo[2.2.2]octane |
165724470 | 1,4-Diazabicyclo[2.2.2]octane |
203072111 | 1,4-Diazabicyclo[2.2.2]octane |
309955097 | 1,4-Diazabicyclo[2.2.2]octane |
746642466 | 1,4-Diazabicyclo[2.2.2]octane |
903524958 | 1,4-Diazabicyclo[2.2.2]octane |
123911 | 1,4-Dioxane |
28347888 | 1,4-Dioxane |
28347913 | 1,4-Dioxane |
39449246 | 1,4-Dioxane |
54841746 | 1,4-Dioxane |
95590 | 1,4-Dioxane, 2,3-dichloro- |
3883430 | 1,4-Dioxane, 2,3-dichloro-, (2R,3R)-rel- |
55290647 | 1,4-Dithiin, 2,3-dihydro-5,6-dimethyl-, 1,1,4,4-tetraoxide |
2243610 | 1,4-Naphthalenediamine |
130154 | 1,4-Naphthalenedione |
117806 | 1,4-Naphthalenedione, 2,3-dichloro- |
83727 | 1,4-Naphthalenedione, 2-hydroxy- |
5234684 | 1,4-Oxathiin-3-carboxamide, 5,6-dihydro-2-methyl-N-phenyl- |
64046793 | 1,4-Pentanediamine, N1,N1-bis(2-chloroethyl)-N4-(6-chloro-2-methoxy-9-acridinyl)- |
69056 | 1,4-Pentanediamine, N4-(6-chloro-2-methoxy-9-acridinyl)-N1,N1-diethyl-, dihydrochloride |
3682197 | 1,4-Phthalazinedione, 2,3-dihydro-6-nitro- |
521313 | 1,4-Phthalazinedione, 5-amino-2,3-dihydro- |
309002 | 1,4:5,8-Dimethanonaphthalene, 1,2,3,4,10,10-hexachloro-1,4,4a,5,8,8a-hexahydro-, (1.alpha.,4.alpha.,4a.beta.,5.alpha.,8.alpha.,8a.beta.)- |
465736 | 1,4:5,8-Dimethanonaphthalene, 1,2,3,4,10,10-hexachloro-1,4,4a,5,8,8a-hexahydro-, (1R,4S,4aS,5R,8S,8aR)-rel- |
20389611 | 1,4:5,8-Dimethanonaphthalene, 1,2,3,4,10,10-hexachloro-1,4,4a,5,8,8a-hexahydro-, (1R,4S,4aS,5R,8S,8aR)-rel- |
26302409 | 1,4:5,8-Dimethanonaphthalene, 1,2,3,4,10,10-hexachloro-1,4,4a,5,8,8a-hexahydro-, (1R,4S,4aS,5R,8S,8aR)-rel- |
1195521131 | 1,4:5,8-Dimethanonaphthalene, 1,2,3,4,10,10-hexachloro-1,4,4a,5,8,8a-hexahydro-, (1R,4S,4aS,5R,8S,8aR)-rel- |
11114140 | 1,4:7,10-Dimethanodibenzo[a,e]cyclooctene, 1,2,3,4,7,8,9,10,13,13,14,14-dodecachloro-1,4,4a,5,6,6a,7,10,10a,11,12,12a-dodecahydro- |
13560899 | 1,4:7,10-Dimethanodibenzo[a,e]cyclooctene, 1,2,3,4,7,8,9,10,13,13,14,14-dodecachloro-1,4,4a,5,6,6a,7,10,10a,11,12,12a-dodecahydro- |
39386102 | 1,4:7,10-Dimethanodibenzo[a,e]cyclooctene, 1,2,3,4,7,8,9,10,13,13,14,14-dodecachloro-1,4,4a,5,6,6a,7,10,10a,11,12,12a-dodecahydro- |
40372585 | 1,4:7,10-Dimethanodibenzo[a,e]cyclooctene, 1,2,3,4,7,8,9,10,13,13,14,14-dodecachloro-1,4,4a,5,6,6a,7,10,10a,11,12,12a-dodecahydro- |
59459119 | 1,4:7,10-Dimethanodibenzo[a,e]cyclooctene, 1,2,3,4,7,8,9,10,13,13,14,14-dodecachloro-1,4,4a,5,6,6a,7,10,10a,11,12,12a-dodecahydro- |
60880742 | 1,4:7,10-Dimethanodibenzo[a,e]cyclooctene, 1,2,3,4,7,8,9,10,13,13,14,14-dodecachloro-1,4,4a,5,6,6a,7,10,10a,11,12,12a-dodecahydro- |
1195618746 | 1,4:7,10-Dimethanodibenzo[a,e]cyclooctene, 1,2,3,4,7,8,9,10,13,13,14,14-dodecachloro-1,4,4a,5,6,6a,7,10,10a,11,12,12a-dodecahydro- |
2243621 | 1,5-Naphthalenediamine |
458377 | 1,6-Heptadiene-3,5-dione, 1,7-bis(4-hydroxy-3-methoxyphenyl)-, (1E,6E)- |
15845473 | 1,6-Heptadiene-3,5-dione, 1,7-bis(4-hydroxy-3-methoxyphenyl)-, (1E,6E)- |
33171049 | 1,6-Heptadiene-3,5-dione, 1,7-bis(4-hydroxy-3-methoxyphenyl)-, (1E,6E)- |
73729234 | 1,6-Heptadiene-3,5-dione, 1,7-bis(4-hydroxy-3-methoxyphenyl)-, (1E,6E)- |
79257480 | 1,6-Heptadiene-3,5-dione, 1,7-bis(4-hydroxy-3-methoxyphenyl)-, (1E,6E)- |
91884865 | 1,6-Heptadiene-3,5-dione, 1,7-bis(4-hydroxy-3-methoxyphenyl)-, (1E,6E)- |
124094 | 1,6-Hexanediamine |
4835114 | 1,6-Hexanediamine, N1,N6-dibutyl- |
7149260 | 1,6-Octadien-3-ol, 3,7-dimethyl-, 3-(2-aminobenzoate) |
1206794173 | 1,6-Octadien-3-ol, 3,7-dimethyl-, 3-(2-aminobenzoate) |
389082 | 1,8-Naphthyridine-3-carboxylic acid, 1-ethyl-1,4-dihydro-7-methyl-4-oxo- |
21297723 | 1-Aza-2-silacyclopentane, 2,2-diethoxy-1-(trimethylsilyl)- |
1072522 | 1-Aziridineethanol |
109739 | 1-Butanamine |
42939720 | 1-Butanamine |
50929038 | 1-Butanamine |
85404213 | 1-Butanamine |
102829 | 1-Butanamine, N,N-dibutyl- |
168153193 | 1-Butanamine, N,N-dibutyl- |
4444682 | 1-Butanamine, N,N-diethyl- |
927628 | 1-Butanamine, N,N-dimethyl- |
111922 | 1-Butanamine, N-butyl- |
924163 | 1-Butanamine, N-butyl-N-nitroso- |
13360639 | 1-Butanamine, N-ethyl- |
109795 | 1-Butanethiol |
71363 | 1-Butanol |
42031196 | 1-Butanol |
107569517 | 1-Butanol |
220713257 | 1-Butanol |
1154866917 | 1-Butanol |
609314 | 1-Butanol, 2-nitro- |
123513 | 1-Butanol, 3-methyl- |
123912 | 1-Butanol, 3-methyl-, 1-acetate |
123922 | 1-Butanol, 3-methyl-, 1-acetate |
626380 | 1-Butanol, 3-methyl-, 1-acetate |
628637 | 1-Butanol, 3-methyl-, 1-acetate |
29732501 | 1-Butanol, 3-methyl-, 1-acetate |
3817116 | 1-Butanol, 4-(butylnitrosoamino)- |
1421632 | 1-Butanone, 1-(2,4,5-trihydroxyphenyl)- |
64091914 | 1-Butanone, 4-(methylnitrosoamino)-1-(3-pyridinyl)- |
689974 | 1-Buten-3-yne |
106989 | 1-Butene |
1735757 | 1-Butene |
25167673 | 1-Butene |
33004023 | 1-Butene |
54366073 | 1-Butene |
563462 | 1-Butene, 2-methyl- |
760236 | 1-Butene, 3,4-dichloro- |
64037543 | 1-Butene, 3,4-dichloro- |
563451 | 1-Butene, 3-methyl- |
107006 | 1-Butyne |
7173515 | 1-Decanaminium, N-decyl-N,N-dimethyl-, chloride (1:1) |
126851249 | 1-Decanaminium, N-decyl-N,N-dimethyl-, chloride (1:1) |
129186136 | 1-Decanaminium, N-decyl-N,N-dimethyl-, chloride (1:1) |
154765329 | 1-Decanaminium, N-decyl-N,N-dimethyl-, chloride (1:1) |
446279852 | 1-Decanaminium, N-decyl-N,N-dimethyl-, chloride (1:1) |
879292510 | 1-Decanaminium, N-decyl-N,N-dimethyl-, chloride (1:1) |
143102 | 1-Decanethiol |
112301 | 1-Decanol |
872059 | 1-Decene |
25339531 | 1-Decene |
112185 | 1-Dodecanamine, N,N-dimethyl- |
52622545 | 1-Dodecanamine, N,N-dimethyl- |
83855861 | 1-Dodecanamine, N,N-dimethyl- |
352546191 | 1-Dodecanamine, N,N-dimethyl- |
1643205 | 1-Dodecanamine, N,N-dimethyl-, N-oxide |
73502086 | 1-Dodecanamine, N,N-dimethyl-, N-oxide |
135526668 | 1-Dodecanamine, N,N-dimethyl-, N-oxide |
160714023 | 1-Dodecanamine, N,N-dimethyl-, N-oxide |
163221076 | 1-Dodecanamine, N,N-dimethyl-, N-oxide |
177162479 | 1-Dodecanamine, N,N-dimethyl-, N-oxide |
209122496 | 1-Dodecanamine, N,N-dimethyl-, N-oxide |
244235925 | 1-Dodecanamine, N,N-dimethyl-, N-oxide |
311814252 | 1-Dodecanamine, N,N-dimethyl-, N-oxide |
607690426 | 1-Dodecanamine, N,N-dimethyl-, N-oxide |
112550 | 1-Dodecanethiol |
112414 | 1-Dodecene |
25378227 | 1-Dodecene |
1639094 | 1-Heptanethiol |
592767 | 1-Heptene |
143271 | 1-Hexadecanamine |
28319202 | 1-Hexadecanamine |
146997924 | 1-Hexadecanamine |
104756 | 1-Hexanamine, 2-ethyl- |
114272354 | 1-Hexanamine, 2-ethyl- |
106207 | 1-Hexanamine, 2-ethyl-N-(2-ethylhexyl)- |
102095261 | 1-Hexanamine, 2-ethyl-N-(2-ethylhexyl)- |
143168 | 1-Hexanamine, N-hexyl- |
111319 | 1-Hexanethiol |
111273 | 1-Hexanol |
220713279 | 1-Hexanol |
104767 | 1-Hexanol, 2-ethyl- |
111675571 | 1-Hexanol, 2-ethyl- |
592416 | 1-Hexene |
33004045 | 1-Hexene |
153522124 | 1-Hexene |
36734197 | 1-Imidazolidinecarboxamide, 3-(3,5-dichlorophenyl)-N-(1-methylethyl)-2,4-dioxo- |
134327 | 1-Naphthalenamine |
12262098 | 1-Naphthalenamine |
90302 | 1-Naphthalenamine, N-phenyl- |
219315454 | 1-Naphthalenamine, N-phenyl- |
2429712 | 1-Naphthalenesulfonic acid, 3,3'-[(3,3'-dimethoxy[1,1'-biphenyl]-4,4'-diyl)bis(2,1-diazenediyl)]bis[4-hydroxy-, sodium salt (1:2) |
992596 | 1-Naphthalenesulfonic acid, 3,3'-[(3,3'-dimethyl[1,1'-biphenyl]-4,4'-diyl)bis(2,1-diazenediyl)]bis[4-amino-, sodium salt (1:2) |
70248714 | 1-Naphthalenesulfonic acid, 3,3'-[(3,3'-dimethyl[1,1'-biphenyl]-4,4'-diyl)bis(2,1-diazenediyl)]bis[4-amino-, sodium salt (1:2) |
179472458 | 1-Naphthalenesulfonic acid, 3,3'-[(3,3'-dimethyl[1,1'-biphenyl]-4,4'-diyl)bis(2,1-diazenediyl)]bis[4-amino-, sodium salt (1:2) |
6428940 | 1-Naphthalenesulfonic acid, 4-amino-3-((4'-((1-hydroxy-4-sulfo-2-naphthyl)azo)-3,3'-dimethoxy(1,1'-biphenyl)-4-yl)azo)-, disodium salt |
3567699 | 1-Naphthalenesulfonic acid, 4-hydroxy-3-[2-(4-sulfo-1-naphthalenyl)diazenyl]-, sodium salt (1:2) |
65721859 | 1-Naphthalenesulfonic acid, 4-hydroxy-3-[2-(4-sulfo-1-naphthalenyl)diazenyl]-, sodium salt (1:2) |
161628337 | 1-Naphthalenesulfonic acid, 4-hydroxy-3-[2-(4-sulfo-1-naphthalenyl)diazenyl]-, sodium salt (1:2) |
337505212 | 1-Naphthalenesulfonic acid, 4-hydroxy-3-[2-(4-sulfo-1-naphthalenyl)diazenyl]-, sodium salt (1:2) |
90153 | 1-Naphthalenol |
50356213 | 1-Naphthalenol |
63252 | 1-Naphthalenol, 1-(N-methylcarbamate) |
11095117 | 1-Naphthalenol, 1-(N-methylcarbamate) |
11130475 | 1-Naphthalenol, 1-(N-methylcarbamate) |
51274034 | 1-Naphthalenol, 1-(N-methylcarbamate) |
52001895 | 1-Naphthalenol, 1-(N-methylcarbamate) |
1392204771 | 1-Naphthalenol, 1-(N-methylcarbamate) |
1455216 | 1-Nonanethiol |
143088 | 1-Nonanol |
124118 | 1-Nonene |
27215958 | 1-Nonene |
124301 | 1-Octadecanamine |
1341475 | 1-Octadecanamine |
8038606 | 1-Octadecanamine |
258339978 | 1-Octadecanamine |
457883168 | 1-Octadecanamine |
1116763 | 1-Octanamine, N,N-dioctyl- |
11120277 | 1-Octanamine, N,N-dioctyl- |
12612156 | 1-Octanamine, N,N-dioctyl- |
51569029 | 1-Octanamine, N,N-dioctyl- |
57176406 | 1-Octanamine, N,N-dioctyl- |
111866 | 1-Octanethiol |
111886 | 1-Octanethiol |
111875 | 1-Octanol |
29063283 | 1-Octanol |
220713268 | 1-Octanol |
111660 | 1-Octene |
25377837 | 1-Octene |
110587 | 1-Pentanamine |
621772 | 1-Pentanamine, N,N-dipentyl- |
13256069 | 1-Pentanamine, N-nitroso-N-pentyl- |
2050922 | 1-Pentanamine, N-pentyl- |
110667 | 1-Pentanethiol |
71410 | 1-Pentanol |
109671 | 1-Pentene |
25377724 | 1-Pentene |
33004034 | 1-Pentene |
763291 | 1-Pentene, 2-methyl- |
691372 | 1-Pentene, 4-methyl- |
44390467 | 1-Pentene, 4-methyl- |
514103 | 1-Phenanthrenecarboxylic acid, 1,2,3,4,4a,4b,5,6,10,10a-decahydro-1,4a-dimethyl-7-(1-methylethyl)-, (1R,4aR,4bR,10aR)- |
72452621 | 1-Phenanthrenecarboxylic acid, 1,2,3,4,4a,4b,5,6,10,10a-decahydro-1,4a-dimethyl-7-(1-methylethyl)-, (1R,4aR,4bR,10aR)- |
1740198 | 1-Phenanthrenecarboxylic acid, 1,2,3,4,4a,9,10,10a-octahydro-1,4a-dimethyl-7-(1-methylethyl)-, (1R,4aS,10aR)- |
2501271 | 1-Phenanthrenecarboxylic acid, 1,2,3,4,4a,9,10,10a-octahydro-1,4a-dimethyl-7-(1-methylethyl)-, (1R,4aS,10aR)- |
35949247 | 1-Phenanthrenecarboxylic acid, 1,2,3,4,4a,9,10,10a-octahydro-1,4a-dimethyl-7-(1-methylethyl)-, (1R,4aS,10aR)- |
135577730 | 1-Phenanthrenecarboxylic acid, 1,2,3,4,4a,9,10,10a-octahydro-1,4a-dimethyl-7-(1-methylethyl)-, (1R,4aS,10aR)- |
5835267 | 1-Phenanthrenecarboxylic acid, 7-ethenyl-1,2,3,4,4a,4b,5,6,7,8,10,10a-dodecahydro-1,4a,7-trimethyl-, (1R,4aR,4bS,7S,10aR)- |
7201527 | 1-Phenanthrenecarboxylic acid, 7-ethenyl-1,2,3,4,4a,4b,5,6,7,8,10,10a-dodecahydro-1,4a,7-trimethyl-, (1R,4aR,4bS,7S,10aR)- |
107631594 | 1-Phenanthrenecarboxylic acid, 7-ethenyl-1,2,3,4,4a,4b,5,6,7,8,10,10a-dodecahydro-1,4a,7-trimethyl-, (1R,4aR,4bS,7S,10aR)- |
57055386 | 1-Phenanthrenecarboxylic acid, chloro-1,2,3,4,4a,9,10,10a-octahydro-1,4a-dimethyl-7-(1-methylethyl)-, (1R-(1.alpha.,4a.beta.,10a.alpha.))- |
57055397 | 1-Phenanthrenecarboxylic acid, dichloro-1,2,3,4,4a,9,10,10a-octahydro-1,4a-dimethyl-7-(1-methylethyl)-, (1R-(1.alpha.,4a.beta.,10a.alpha.))- |
1642542 | 1-Piperazinecarboxamide, N,N-diethyl-4-methyl-, 2-hydroxy-1,2,3-propanetricarboxylate (1:1) |
2591868 | 1-Piperidinecarboxaldehyde |
107108 | 1-Propanamine |
42939719 | 1-Propanamine |
78819 | 1-Propanamine, 2-methyl- |
1116401 | 1-Propanamine, 2-methyl-N,N-bis(2-methylpropyl)- |
110963 | 1-Propanamine, 2-methyl-N-(2-methylpropyl)- |
919302 | 1-Propanamine, 3-(triethoxysilyl)- |
919392 | 1-Propanamine, 3-(triethoxysilyl)- |
12738500 | 1-Propanamine, 3-(triethoxysilyl)- |
60000977 | 1-Propanamine, 3-(triethoxysilyl)- |
71618183 | 1-Propanamine, 3-(triethoxysilyl)- |
86836284 | 1-Propanamine, 3-(triethoxysilyl)- |
88527611 | 1-Propanamine, 3-(triethoxysilyl)- |
96726793 | 1-Propanamine, 3-(triethoxysilyl)- |
106096791 | 1-Propanamine, 3-(triethoxysilyl)- |
131641775 | 1-Propanamine, 3-(triethoxysilyl)- |
143178716 | 1-Propanamine, 3-(triethoxysilyl)- |
159778173 | 1-Propanamine, 3-(triethoxysilyl)- |
204987586 | 1-Propanamine, 3-(triethoxysilyl)- |
449753826 | 1-Propanamine, 3-(triethoxysilyl)- |
479401053 | 1-Propanamine, 3-(triethoxysilyl)- |
607502716 | 1-Propanamine, 3-(triethoxysilyl)- |
875121656 | 1-Propanamine, 3-(triethoxysilyl)- |
1020103347 | 1-Propanamine, 3-(triethoxysilyl)- |
1392103819 | 1-Propanamine, 3-(triethoxysilyl)- |
5397319 | 1-Propanamine, 3-[(2-ethylhexyl)oxy]- |
29714543 | 1-Propanamine, 3-[(2-ethylhexyl)oxy]- |
76461784 | 1-Propanamine, 3-[(2-ethylhexyl)oxy]- |
155634201 | 1-Propanamine, 3-[(2-ethylhexyl)oxy]- |
5332730 | 1-Propanamine, 3-methoxy- |
102692 | 1-Propanamine, N,N-dipropyl- |
112488514 | 1-Propanamine, N,N-dipropyl- |
621647 | 1-Propanamine, N-nitroso-N-propyl- |
142847 | 1-Propanamine, N-propyl- |
3327228 | 1-Propanaminium, 3-chloro-2-hydroxy-N,N,N-trimethyl-, chloride (1:1) |
58128362 | 1-Propanaminium, 3-chloro-2-hydroxy-N,N,N-trimethyl-, chloride (1:1) |
73935214 | 1-Propanaminium, 3-chloro-2-hydroxy-N,N,N-trimethyl-, chloride (1:1) |
101360398 | 1-Propanaminium, 3-chloro-2-hydroxy-N,N,N-trimethyl-, chloride (1:1) |
115993130 | 1-Propanaminium, 3-chloro-2-hydroxy-N,N,N-trimethyl-, chloride (1:1) |
126845690 | 1-Propanaminium, 3-chloro-2-hydroxy-N,N,N-trimethyl-, chloride (1:1) |
181939297 | 1-Propanaminium, 3-chloro-2-hydroxy-N,N,N-trimethyl-, chloride (1:1) |
1331834628 | 1-Propanaminium, 3-chloro-2-hydroxy-N,N,N-trimethyl-, chloride (1:1) |
107039 | 1-Propanethiol |
71238 | 1-Propanol |
96139 | 1-Propanol, 2,3-dibromo- |
116499753 | 1-Propanol, 2,3-dibromo- |
204570161 | 1-Propanol, 2,3-dibromo- |
126727 | 1-Propanol, 2,3-dibromo-, 1,1',1''-phosphate |
1867147 | 1-Propanol, 2,3-dibromo-, 1,1',1''-phosphate |
55962486 | 1-Propanol, 2,3-dibromo-, 1,1',1''-phosphate |
68112301 | 1-Propanol, 2,3-dibromo-, 1,1',1''-phosphate |
1228931665 | 1-Propanol, 2,3-dibromo-, 1,1',1''-phosphate |
616239 | 1-Propanol, 2,3-dichloro- |
82890220 | 1-Propanol, 2,3-dichloro- |
59529 | 1-Propanol, 2,3-dimercapto- |
31855411 | 1-Propanol, 2,3-dimercapto- |
81600568 | 1-Propanol, 2,3-dimercapto- |
98923194 | 1-Propanol, 2,3-dimercapto- |
78897 | 1-Propanol, 2-chloro- |
60828606 | 1-Propanol, 2-chloro- |
1253945515 | 1-Propanol, 2-chloro- |
78831 | 1-Propanol, 2-methyl- |
94519 | 1-Propanol, 3,3'-oxybis-, dibenzoate |
627189 | 1-Propanol, 3-bromo- |
1522925 | 1-Propanol, 3-bromo-2,2-bis(bromomethyl)- |
627305 | 1-Propanol, 3-chloro- |
1067987 | 1-Propanol, 3-chloro-, phosphate (3:1) |
111353 | 1-Propanol, 3-ethoxy- |
20702776 | 1-Propanone, 1-[4-[[2-O-(6-deoxy-.alpha.-L-mannopyranosyl)-.beta.-D-glucopyranosyl]oxy]-2,6-dihydroxyphenyl]-3-(3-hydroxy-4-methoxyphenyl)- |
115071 | 1-Propene |
676631 | 1-Propene |
33004012 | 1-Propene |
1888717 | 1-Propene, 1,1,2,3,3,3-hexachloro- |
10436392 | 1-Propene, 1,1,2,3-tetrachloro- |
563586 | 1-Propene, 1,1-dichloro- |
563542 | 1-Propene, 1,2-dichloro- |
7069387 | 1-Propene, 1,2-dichloro-, (1E)- |
78875 | 1-Propene, 1,3-dichloro- |
542756 | 1-Propene, 1,3-dichloro- |
8022762 | 1-Propene, 1,3-dichloro- |
68525586 | 1-Propene, 1,3-dichloro- |
10061026 | 1-Propene, 1,3-dichloro-, (1E)- |
542756 | 1-Propene, 1,3-dichloro-, (Z)- |
10061015 | 1-Propene, 1,3-dichloro-, (Z)- |
590216 | 1-Propene, 1-chloro- |
513371 | 1-Propene, 1-chloro-2-methyl- |
78886 | 1-Propene, 2,3-dichloro- |
557982 | 1-Propene, 2-chloro- |
115117 | 1-Propene, 2-methyl- |
382105 | 1-Propene, 3,3,3-trifluoro-2-(trifluoromethyl)- |
107051 | 1-Propene, 3-chloro- |
107186 | 1-Propene, 3-chloro- |
563473 | 1-Propene, 3-chloro-2-methyl- |
57067 | 1-Propene, 3-isothiocyanato- |
8007407 | 1-Propene, 3-isothiocyanato- |
50888647 | 1-Propene, 3-isothiocyanato- |
50978488 | 1-Propene, 3-isothiocyanato- |
58391870 | 1-Propene, 3-isothiocyanato- |
107231301 | 1-Propene, 3-isothiocyanato- |
9003070 | 1-Propene, homopolymer |
9044591 | 1-Propene, homopolymer |
37329036 | 1-Propene, homopolymer |
37370573 | 1-Propene, homopolymer |
52440183 | 1-Propene, homopolymer |
52622647 | 1-Propene, homopolymer |
53664327 | 1-Propene, homopolymer |
58318959 | 1-Propene, homopolymer |
60440688 | 1-Propene, homopolymer |
73989501 | 1-Propene, homopolymer |
76560786 | 1-Propene, homopolymer |
95751294 | 1-Propene, homopolymer |
104625254 | 1-Propene, homopolymer |
112024687 | 1-Propene, homopolymer |
112327421 | 1-Propene, homopolymer |
112821100 | 1-Propene, homopolymer |
122933373 | 1-Propene, homopolymer |
123243049 | 1-Propene, homopolymer |
131801188 | 1-Propene, homopolymer |
132823575 | 1-Propene, homopolymer |
133757661 | 1-Propene, homopolymer |
139465751 | 1-Propene, homopolymer |
143710365 | 1-Propene, homopolymer |
144855914 | 1-Propene, homopolymer |
148464771 | 1-Propene, homopolymer |
150261044 | 1-Propene, homopolymer |
156680705 | 1-Propene, homopolymer |
159074972 | 1-Propene, homopolymer |
162731353 | 1-Propene, homopolymer |
169741702 | 1-Propene, homopolymer |
170346993 | 1-Propene, homopolymer |
171903392 | 1-Propene, homopolymer |
178535676 | 1-Propene, homopolymer |
181232122 | 1-Propene, homopolymer |
186777480 | 1-Propene, homopolymer |
201873769 | 1-Propene, homopolymer |
215369918 | 1-Propene, homopolymer |
220286704 | 1-Propene, homopolymer |
221350750 | 1-Propene, homopolymer |
223461981 | 1-Propene, homopolymer |
262610593 | 1-Propene, homopolymer |
268745659 | 1-Propene, homopolymer |
286465972 | 1-Propene, homopolymer |
301161999 | 1-Propene, homopolymer |
313378448 | 1-Propene, homopolymer |
313471920 | 1-Propene, homopolymer |
343259030 | 1-Propene, homopolymer |
349655636 | 1-Propene, homopolymer |
368887790 | 1-Propene, homopolymer |
391599578 | 1-Propene, homopolymer |
399509343 | 1-Propene, homopolymer |
425369262 | 1-Propene, homopolymer |
439608932 | 1-Propene, homopolymer |
457057497 | 1-Propene, homopolymer |
582300707 | 1-Propene, homopolymer |
796853322 | 1-Propene, homopolymer |
848784134 | 1-Propene, homopolymer |
868670762 | 1-Propene, homopolymer |
875121178 | 1-Propene, homopolymer |
883306976 | 1-Propene, homopolymer |
890309258 | 1-Propene, homopolymer |
928298833 | 1-Propene, homopolymer |
929710907 | 1-Propene, homopolymer |
958447308 | 1-Propene, homopolymer |
1007233353 | 1-Propene, homopolymer |
1072914170 | 1-Propene, homopolymer |
1084698598 | 1-Propene, homopolymer |
1161009626 | 1-Propene, homopolymer |
1170942230 | 1-Propene, homopolymer |
1187015719 | 1-Propene, homopolymer |
1292821556 | 1-Propene, homopolymer |
1365635762 | 1-Propene, homopolymer |
1365657506 | 1-Propene, homopolymer |
1428902811 | 1-Propene, homopolymer |
1429741592 | 1-Propene, homopolymer |
1449076612 | 1-Propene, homopolymer |
74997 | 1-Propyne |
369597386 | 1-Propyne |
106967 | 1-Propyne, 3-bromo- |
1009031473 | 1-Propyne, 3-bromo- |
1187488614 | 1-Propyne, 3-bromo- |
1606673 | 1-Pyrenamine |
1087757036 | 1-Pyrenamine |
1120361 | 1-Tetradecene |
26952136 | 1-Tetradecene |
136356 | 1-Triazene, 1,3-diphenyl- |
7227910 | 1-Triazene, 3,3-dimethyl-1-phenyl- |
2437561 | 1-Tridecene |
25377826 | 1-Tridecene |
112425 | 1-Undecanol |
821954 | 1-Undecene |
28761275 | 1-Undecene |
34580137 | 10H-Benzo[4,5]cyclohepta[1,2-b]thiophen-10-one, 4,9-dihydro-4-(1-methyl-4-piperidinylidene)- |
92842 | 10H-Phenothiazine |
8023301 | 10H-Phenothiazine |
8048224 | 10H-Phenothiazine |
1982372 | 10H-Phenothiazine, 10-[(1-methyl-3-pyrrolidinyl)methyl]- |
1229352 | 10H-Phenothiazine, 10-[(1-methyl-3-pyrrolidinyl)methyl]-, monohydrochloride |
60877 | 10H-Phenothiazine-10-ethanamine, N,N,.alpha.-trimethyl- |
73745503 | 10H-Phenothiazine-10-ethanamine, N,N,.alpha.-trimethyl- |
58333 | 10H-Phenothiazine-10-ethanamine, N,N,.alpha.-trimethyl-, hydrochloride (1:1) |
16639386 | 10H-Phenothiazine-10-ethanamine, N,N,.alpha.-trimethyl-, hydrochloride (1:1) |
88208280 | 10H-Phenothiazine-10-ethanamine, N,N,.alpha.-trimethyl-, hydrochloride (1:1) |
69090 | 10H-Phenothiazine-10-propanamine, 2-chloro-N,N-dimethyl-, hydrochloride (1:1) |
58366 | 10H-Phenoxarsine, 10,10'-oxybis- |
53923276 | 10H-Phenoxarsine, 10,10'-oxybis- |
64684282 | 10H-Phenoxarsine, 10,10'-oxybis- |
64887101 | 10H-Phenoxarsine, 10,10'-oxybis- |
107391695 | 10H-Phenoxarsine, 10,10'-oxybis- |
115728295 | 10H-Phenoxarsine, 10,10'-oxybis- |
6533002 | 18,19-Dinorpregn-4-en-20-yn-3-one, 13-ethyl-17-hydroxy-, (17alpha)-(+-)- |
52766 | 19-Norpregn-4-en-20-yn-17-ol, (17.alpha.)- |
60416162 | 19-Norpregn-4-en-20-yn-17-ol, (17.alpha.)- |
68224 | 19-Norpregn-4-en-20-yn-3-one, 17-hydroxy-, (17.alpha.)- |
297767 | 19-Norpregn-4-en-20-yne-3,17-diol, diacetate, (3.beta.,17.alpha.)- |
68234 | 19-Norpregn-5(10)-en-20-yn-3-one, 17-hydroxy-, (17.alpha.)- |
68235 | 19-Norpregn-5(10)-en-20-yn-3-one, 17-hydroxy-, (17.alpha.)- |
72333 | 19-Norpregna-1,3,5(10)-trien-20-yn-17-ol, 3-methoxy-, (17.alpha.)- |
57636 | 19-Norpregna-1,3,5(10)-trien-20-yne-3,17-diol, (17.alpha.)- |
77538568 | 19-Norpregna-1,3,5(10)-trien-20-yne-3,17-diol, (17.alpha.)- |
406932932 | 19-Norpregna-1,3,5(10)-trien-20-yne-3,17-diol, (17.alpha.)- |
1050678653 | 19-Norpregna-1,3,5(10)-trien-20-yne-3,17-diol, (17.alpha.)- |
7241987 | 1H,12H-Furo[3',2':4,5]furo[2,3-h]pyrano[3,4-c][1]benzopyran-1,12-dione, 3,4,7a,9,10,10a-hexahydro-5-methoxy-, (7aR,10aS)- |
61825 | 1H-1,2,4-Triazol-5-amine |
155259 | 1H-1,2,4-Triazol-5-amine |
6051758 | 1H-1,2,4-Triazol-5-amine |
11121009 | 1H-1,2,4-Triazol-5-amine |
16681746 | 1H-1,2,4-Triazol-5-amine |
29212826 | 1H-1,2,4-Triazol-5-amine |
30922306 | 1H-1,2,4-Triazol-5-amine |
63598721 | 1H-1,2,4-Triazol-5-amine |
64598238 | 1H-1,2,4-Triazol-5-amine |
151517463 | 1H-1,2,4-Triazol-5-amine |
1057722436 | 1H-1,2,4-Triazol-5-amine |
60207901 | 1H-1,2,4-Triazole, 1-[[2-(2,4-dichlorophenyl)-4-propyl-1,3-dioxolan-2-yl]methyl]- |
75881822 | 1H-1,2,4-Triazole, 1-[[2-(2,4-dichlorophenyl)-4-propyl-1,3-dioxolan-2-yl]methyl]- |
125407525 | 1H-1,2,4-Triazole, 1-[[2-(2,4-dichlorophenyl)-4-propyl-1,3-dioxolan-2-yl]methyl]- |
181591673 | 1H-1,2,4-Triazole, 1-[[2-(2,4-dichlorophenyl)-4-propyl-1,3-dioxolan-2-yl]methyl]- |
85509199 | 1H-1,2,4-Triazole, 1-[[bis(4-fluorophenyl)methylsilyl]methyl]- |
96827348 | 1H-1,2,4-Triazole, 1-[[bis(4-fluorophenyl)methylsilyl]methyl]- |
80443410 | 1H-1,2,4-Triazole-1-ethanol, .alpha.-[2-(4-chlorophenyl)ethyl]-.alpha.-(1,1-dimethylethyl)- |
107534963 | 1H-1,2,4-Triazole-1-ethanol, .alpha.-[2-(4-chlorophenyl)ethyl]-.alpha.-(1,1-dimethylethyl)- |
88671890 | 1H-1,2,4-Triazole-1-propanenitrile, .alpha.-butyl-.alpha.-(4-chlorophenyl)- |
96281504 | 1H-1,2,4-Triazole-1-propanenitrile, .alpha.-butyl-.alpha.-(4-chlorophenyl)- |
154144931 | 1H-1,2,4-Triazole-1-propanenitrile, .alpha.-butyl-.alpha.-(4-chlorophenyl)- |
205862697 | 1H-1,2,4-Triazole-1-propanenitrile, .alpha.-butyl-.alpha.-(4-chlorophenyl)- |
503888 | 1H-1,2,4-Triazole-3,5-diamine |
1455772 | 1H-1,2,4-Triazole-3,5-diamine |
12705054 | 1H-2,1,3-Benzothiadiazin-4(3H)-one, 3-(1-methylethyl)-, 2,2-dioxide |
21723400 | 1H-2,1,3-Benzothiadiazin-4(3H)-one, 3-(1-methylethyl)-, 2,2-dioxide |
25057890 | 1H-2,1,3-Benzothiadiazin-4(3H)-one, 3-(1-methylethyl)-, 2,2-dioxide |
58856829 | 1H-2,1,3-Benzothiadiazin-4(3H)-one, 3-(1-methylethyl)-, 2,2-dioxide |
17924924 | 1H-2-Benzoxacyclotetradecin-1,7(8H)-dione, 3,4,5,6,9,10-hexahydro-14,16-dihydroxy-3-methyl-, (3S,11E)- |
18695288 | 1H-2-Benzoxacyclotetradecin-1,7(8H)-dione, 3,4,5,6,9,10-hexahydro-14,16-dihydroxy-3-methyl-, (3S,11E)- |
2212671 | 1H-Azepine-1-carbothioic acid, hexahydro-, S-ethyl ester |
934327 | 1H-Benzimidazol-2-amine |
144704994 | 1H-Benzimidazol-2-amine |
51172 | 1H-Benzimidazole |
25463256 | 1H-Benzimidazole |
79351716 | 1H-Benzimidazole |
116421273 | 1H-Benzimidazole |
3878191 | 1H-Benzimidazole, 2-(2-furanyl)- |
148798 | 1H-Benzimidazole, 2-(4-thiazolyl)- |
8018040 | 1H-Benzimidazole, 2-(4-thiazolyl)- |
8027109 | 1H-Benzimidazole, 2-(4-thiazolyl)- |
8028271 | 1H-Benzimidazole, 2-(4-thiazolyl)- |
94977067 | 1H-Benzimidazole, 2-(4-thiazolyl)- |
98002427 | 1H-Benzimidazole, 2-(4-thiazolyl)- |
123242331 | 1H-Benzimidazole, 2-(4-thiazolyl)- |
145316672 | 1H-Benzimidazole, 2-(4-thiazolyl)- |
1135441278 | 1H-Benzimidazole, 2-(4-thiazolyl)- |
94520 | 1H-Benzimidazole, 6-nitro- |
89843470 | 1H-Benzimidazole, 6-nitro- |
95147 | 1H-Benzotriazole |
25377815 | 1H-Benzotriazole |
27556510 | 1H-Benzotriazole |
28880015 | 1H-Benzotriazole |
70644745 | 1H-Benzotriazole |
83202919 | 1H-Benzotriazole |
94160697 | 1H-Benzotriazole |
115773983 | 1H-Benzotriazole |
116421319 | 1H-Benzotriazole |
152206503 | 1H-Benzotriazole |
197463084 | 1H-Benzotriazole |
1334724967 | 1H-Benzotriazole |
3663249 | 1H-Benzotriazole, 5-butyl- |
29385431 | 1H-Benzotriazole, 6(or 7)-methyl- |
39327112 | 1H-Benzotriazole, 6(or 7)-methyl- |
39410703 | 1H-Benzotriazole, 6(or 7)-methyl- |
42441656 | 1H-Benzotriazole, 6(or 7)-methyl- |
82467354 | 1H-Benzotriazole, 6(or 7)-methyl- |
197463095 | 1H-Benzotriazole, 6(or 7)-methyl- |
22144770 | 1H-Cycloundec[d]isoindole-1,11(2H)-dione, 15-(acetyloxy)-3,3a,4,5,6,6a,9,10,12,15-decahydro-6,12-dihydroxy-4,10,12-trimethyl-5-methylene-3-(phenylmethyl)-, (3S,3aR,4S,6S,6aR,7E,10S,12R,13E,15R,15aR)- |
35554440 | 1H-Imidazole, 1-[2-(2,4-dichlorophenyl)-2-(2-propenyloxy)ethyl]- |
51004467 | 1H-Imidazole, 1-[2-(2,4-dichlorophenyl)-2-(2-propenyloxy)ethyl]- |
73790280 | 1H-Imidazole, 1-[2-(2,4-dichlorophenyl)-2-(2-propenyloxy)ethyl]- |
24169026 | 1H-Imidazole, 1-[2-[(4-chlorophenyl)methoxy]-2-(2,4-dichlorophenyl)ethyl]-, mononitrate |
556229 | 1H-Imidazole, 2-heptadecyl-4,5-dihydro-, acetate (1:1) |
100016602 | 1H-Imidazole, 2-heptadecyl-4,5-dihydro-, acetate (1:1) |
137955727 | 1H-Imidazole, 2-heptadecyl-4,5-dihydro-, acetate (1:1) |
95192 | 1H-Imidazole-1-ethanol, 2-heptadecyl-4,5-dihydro- |
1330887 | 1H-Imidazole-1-ethanol, 2-heptadecyl-4,5-dihydro- |
37349067 | 1H-Imidazole-1-ethanol, 2-heptadecyl-4,5-dihydro- |
50957783 | 1H-Imidazole-1-ethanol, 2-heptadecyl-4,5-dihydro- |
53466914 | 1H-Imidazole-1-ethanol, 2-heptadecyl-4,5-dihydro- |
74551603 | 1H-Imidazole-1-ethanol, 2-heptadecyl-4,5-dihydro- |
443481 | 1H-Imidazole-1-ethanol, 2-methyl-5-nitro- |
133884001 | 1H-Imidazole-1-ethanol, 2-methyl-5-nitro- |
83857969 | 1H-Imidazole-4-carboxaldehyde, 2-butyl-5-chloro- |
4342034 | 1H-Imidazole-4-carboxamide, 5-(3,3-dimethyl-1-triazenyl)- |
95136 | 1H-Indene |
95316 | 1H-Indene |
485472 | 1H-Indene-1,3(2H)-dione, 2,2-dihydroxy- |
83261 | 1H-Indene-1,3(2H)-dione, 2-(2,2-dimethyl-1-oxopropyl)- |
82666 | 1H-Indene-1,3(2H)-dione, 2-(diphenylacetyl)- |
3691358 | 1H-Indene-1,3(2H)-dione, 2-[(4-chlorophenyl)phenylacetyl]- |
53861 | 1H-Indole-3-acetic acid, 1-(4-chlorobenzoyl)-5-methoxy-2-methyl- |
37242436 | 1H-Indole-3-acetic acid, 1-(4-chlorobenzoyl)-5-methoxy-2-methyl- |
91853746 | 1H-Indole-3-acetic acid, 1-(4-chlorobenzoyl)-5-methoxy-2-methyl- |
503560734 | 1H-Indole-3-acetic acid, 1-(4-chlorobenzoyl)-5-methoxy-2-methyl- |
80789748 | 1H-Indole-5-sulfonic acid, 2,3-dihydro-2,3-dioxo-, monosodium salt |
860220 | 1H-Indole-5-sulfonic acid, 2-(1,3-dihydro-3-oxo-5-sulfo-2H-indol-2-ylidene)-2,3-dihydro-3-oxo-, sodium salt (1:2) |
85416 | 1H-Isoindole-1,3(2H)-dione |
32588764 | 1H-Isoindole-1,3(2H)-dione, 2,2'-(1,2-ethanediyl)bis[4,5,6,7-tetrabromo- |
66797351 | 1H-Isoindole-1,3(2H)-dione, 2,2'-(1,2-ethanediyl)bis[4,5,6,7-tetrabromo- |
50351 | 1H-Isoindole-1,3(2H)-dione, 2-(2,6-dioxo-3-piperidinyl)- |
19246221 | 1H-Isoindole-1,3(2H)-dione, 2-(2,6-dioxo-3-pyridinyl)hexahydro- |
17796826 | 1H-Isoindole-1,3(2H)-dione, 2-(cyclohexylthio)- |
133073 | 1H-Isoindole-1,3(2H)-dione, 2-[(trichloromethyl)thio]- |
52306339 | 1H-Isoindole-1,3(2H)-dione, 2-[(trichloromethyl)thio]- |
1135442817 | 1H-Isoindole-1,3(2H)-dione, 2-[(trichloromethyl)thio]- |
41663847 | 1H-Isoindole-1,3(2H)-dione, 2-methyl-5-nitro- |
2425061 | 1H-Isoindole-1,3(2H)-dione, 3a,4,7,7a-tetrahydro-2-[(1,1,2,2-tetrachloroethyl)thio]- |
2939802 | 1H-Isoindole-1,3(2H)-dione, 3a,4,7,7a-tetrahydro-2-[(1,1,2,2-tetrachloroethyl)thio]- |
30017051 | 1H-Isoindole-1,3(2H)-dione, 3a,4,7,7a-tetrahydro-2-[(1,1,2,2-tetrachloroethyl)thio]- |
61913120 | 1H-Isoindole-1,3(2H)-dione, 3a,4,7,7a-tetrahydro-2-[(1,1,2,2-tetrachloroethyl)thio]- |
133062 | 1H-Isoindole-1,3(2H)-dione, 3a,4,7,7a-tetrahydro-2-[(trichloromethyl)thio]- |
1321422 | 1H-Isoindole-1,3(2H)-dione, 3a,4,7,7a-tetrahydro-2-[(trichloromethyl)thio]- |
37335152 | 1H-Isoindole-1,3(2H)-dione, 3a,4,7,7a-tetrahydro-2-[(trichloromethyl)thio]- |
120528258 | 1H-Isoindole-1,3(2H)-dione, 3a,4,7,7a-tetrahydro-2-[(trichloromethyl)thio]- |
89407 | 1H-Isoindole-1,3(2H)-dione, 5-nitro- |
27813214 | 1H-Isoindole-1,3(2H)-dione, tetrahydro- |
446866 | 1H-Purine, 6-[(1-methyl-4-nitro-1H-imidazol-5-yl)thio]- |
58082 | 1H-Purine-2,6-dione, 3,7-dihydro-1,3,7-trimethyl- |
71701025 | 1H-Purine-2,6-dione, 3,7-dihydro-1,3,7-trimethyl- |
95789132 | 1H-Purine-2,6-dione, 3,7-dihydro-1,3,7-trimethyl- |
83670 | 1H-Purine-2,6-dione, 3,7-dihydro-3,7-dimethyl- |
58559 | 1H-Purine-2,6-dione, 3,9-dihydro-1,3-dimethyl- |
46157000 | 1H-Purine-2,6-dione, 3,9-dihydro-1,3-dimethyl- |
56645320 | 1H-Purine-2,6-dione, 3,9-dihydro-1,3-dimethyl- |
75448532 | 1H-Purine-2,6-dione, 3,9-dihydro-1,3-dimethyl- |
111079493 | 1H-Purine-2,6-dione, 3,9-dihydro-1,3-dimethyl- |
479185 | 1H-Purine-2,6-dione, 7-(2,3-dihydroxypropyl)-3,7-dihydro-1,3-dimethyl- |
52756533 | 1H-Purine-2,6-dione, 7-(2,3-dihydroxypropyl)-3,7-dihydro-1,3-dimethyl- |
68350709 | 1H-Purine-2,6-dione, 7-(2,3-dihydroxypropyl)-3,7-dihydro-1,3-dimethyl- |
523875 | 1H-Purine-2,6-dione, 8-chloro-3,7-dihydro-1,3-dimethyl-, compd. with 2-(diphenylmethoxy)-N,N-dimethylethanamine (1:1) |
133294221 | 1H-Purine-2,6-dione, 8-chloro-3,7-dihydro-1,3-dimethyl-, compd. with 2-(diphenylmethoxy)-N,N-dimethylethanamine (1:1) |
147944 | 2(1H)-Pyrimidinone, 4-amino-1-.beta.-D-arabinofuranosyl- |
69749 | 2(1H)-Pyrimidinone, 4-amino-1-.beta.-D-arabinofuranosyl-, monohydrochloride |
67485294 | 2(1H)-Pyrimidinone, tetrahydro-5,5-dimethyl-, [3-[4-(trifluoromethyl)phenyl]-1-[2-[4-(trifluoromethyl)phenyl]ethenyl]-2-propenylidene]hydrazone |
70829128 | 2(1H)-Pyrimidinone, tetrahydro-5,5-dimethyl-, [3-[4-(trifluoromethyl)phenyl]-1-[2-[4-(trifluoromethyl)phenyl]ethenyl]-2-propenylidene]hydrazone |
149304 | 2(3H)-Benzothiazolethione |
1321080 | 2(3H)-Benzothiazolethione |
4464588 | 2(3H)-Benzothiazolethione |
12640903 | 2(3H)-Benzothiazolethione |
55199934 | 2(3H)-Benzothiazolethione |
81605654 | 2(3H)-Benzothiazolethione |
112242838 | 2(3H)-Benzothiazolethione |
119170411 | 2(3H)-Benzothiazolethione |
2492264 | 2(3H)-Benzothiazolethione, sodium salt (1:1) |
26249014 | 2(3H)-Benzothiazolethione, sodium salt (1:1) |
106691707 | 2(3H)-Benzothiazolethione, sodium salt (1:1) |
1208900177 | 2(3H)-Benzothiazolethione, sodium salt (1:1) |
95250 | 2(3H)-Benzoxazolone, 5-chloro- |
32850843 | 2(3H)-Benzoxazolone, 5-chloro- |
96480 | 2(3H)-Furanone, dihydro- |
187997166 | 2(3H)-Furanone, dihydro- |
1462535 | 2,2'-Bioxirane |
1464535 | 2,2'-Bioxirane |
298180 | 2,2'-Bioxirane, (2R,2'R)-rel- |
57716 | 2,3-Butanedione, 2-oxime |
66751 | 2,4(1H,3H)-Pyrimidinedione, 5-[bis(2-chloroethyl)amino]- |
314409 | 2,4(1H,3H)-Pyrimidinedione, 5-bromo-6-methyl-3-(1-methylpropyl)- |
154670129 | 2,4(1H,3H)-Pyrimidinedione, 5-bromo-6-methyl-3-(1-methylpropyl)- |
53404196 | 2,4(1H,3H)-Pyrimidinedione, 5-bromo-6-methyl-3-(1-methylpropyl)-, lithium salt (1:1) |
5902512 | 2,4(1H,3H)-Pyrimidinedione, 5-chloro-3-(1,1-dimethylethyl)-6-methyl- |
51218 | 2,4(1H,3H)-Pyrimidinedione, 5-fluoro- |
1004031 | 2,4(1H,3H)-Pyrimidinedione, 5-fluoro- |
4921975 | 2,4(1H,3H)-Pyrimidinedione, 5-fluoro- |
79108013 | 2,4(1H,3H)-Pyrimidinedione, 5-fluoro- |
2244113 | 2,4,5,6(1H,3H)-Pyrimidinetetrone, monohydrate |
3237501 | 2,4,5,6(1H,3H)-Pyrimidinetetrone, monohydrate |
309364 | 2,4,6(1H,3H,5H)-Pyrimidinetrione, 1-methyl-5-(1-methyl-2-pentynyl)-5-(2-propenyl)-, sodium salt |
50715 | 2,4,6(1H,3H,5H)-Pyrimidinetrione, 5,5-dihydroxy- |
2244113 | 2,4,6(1H,3H,5H)-Pyrimidinetrione, 5,5-dihydroxy- |
3237501 | 2,4,6(1H,3H,5H)-Pyrimidinetrione, 5,5-dihydroxy- |
57330 | 2,4,6(1H,3H,5H)-Pyrimidinetrione, 5-ethyl-5-(1-methylbutyl)-, monosodium salt |
8023118 | 2,4,6(1H,3H,5H)-Pyrimidinetrione, 5-ethyl-5-(1-methylbutyl)-, monosodium salt |
8050995 | 2,4,6(1H,3H,5H)-Pyrimidinetrione, 5-ethyl-5-(1-methylbutyl)-, monosodium salt |
10579814 | 2,4,6(1H,3H,5H)-Pyrimidinetrione, 5-ethyl-5-(1-methylbutyl)-, monosodium salt |
23714570 | 2,4,6(1H,3H,5H)-Pyrimidinetrione, 5-ethyl-5-(1-methylbutyl)-, monosodium salt |
57432 | 2,4,6(1H,3H,5H)-Pyrimidinetrione, 5-ethyl-5-(3-methylbutyl)- |
50066 | 2,4,6(1H,3H,5H)-Pyrimidinetrione, 5-ethyl-5-phenyl- |
13366739 | 2,4,6-Metheno-2H-cyclopenta[4,5]pentaleno[1,2-b]oxirene, 2a,3,3,4,5,5a-hexachlorodecahydro-, (1aR,1bR,2S,2aS,4R,5S,5aS,5bS,6S,6aS,7R)- |
396010 | 2,4,7-Pteridinetriamine, 6-phenyl- |
118525 | 2,4-Imidazolidinedione, 1,3-dichloro-5,5-dimethyl- |
67209 | 2,4-Imidazolidinedione, 1-[[(5-nitro-2-furanyl)methylene]amino]- |
7261974 | 2,4-Imidazolidinedione, 1-[[[5-(4-nitrophenyl)-2-furanyl]methylene]amino]- |
77714 | 2,4-Imidazolidinedione, 5,5-dimethyl- |
57410 | 2,4-Imidazolidinedione, 5,5-diphenyl- |
125597 | 2,4-Imidazolidinedione, 5,5-diphenyl- |
50124 | 2,4-Imidazolidinedione, 5-ethyl-3-methyl-5-phenyl- |
50471448 | 2,4-Oxazolidinedione, 3-(3,5-dichlorophenyl)-5-ethenyl-5-methyl- |
107378494 | 2,4-Oxazolidinedione, 3-(3,5-dichlorophenyl)-5-ethenyl-5-methyl- |
2608482 | 2,4-Pentadienal, 5-(4-nitrophenyl)- |
34807415 | 2,4-Pentadienoic acid, 5-phenyl-, (2S,3aR,3bS,3cS,4aR,5S,5aS,8aR,8bR,9R,10R,10aS)-3a,3b,3c,4a,5,5a,8a,9,10,10a-decahydro-5,5a-dihydroxy-4a-(hydroxymethyl)-7,9-dimethyl-10a-(1-methylethenyl)-6-oxo-2-phenyl-6H-2,8b-epoxyoxireno(6,7)azulene(5,4-e)-1,3-benzodioxol-10-yl ester, (2E,4E)- |
107415 | 2,4-Pentanediol, 2-methyl- |
99113754 | 2,4-Pentanediol, 2-methyl- |
123546 | 2,4-Pentanedione |
81235327 | 2,4-Pentanedione |
58140 | 2,4-Pyrimidinediamine, 5-(4-chlorophenyl)-6-ethyl- |
738705 | 2,4-Pyrimidinediamine, 5-[(3,4,5-trimethoxyphenyl)methyl]- |
53494705 | 2,5,7-Metheno-3H-cyclopenta[a]pentalen-3-one, 3b,4,5,6,6,6a-hexachlorodecahydro-, (2R,3aR,3bS,4R,5R,6aS,7S,7aR,8R)-rel- |
112492 | 2,5,8,11-Tetraoxadodecane |
70992857 | 2,5,8,11-Tetraoxadodecane |
106514 | 2,5-Cyclohexadiene-1,4-dione |
105113 | 2,5-Cyclohexadiene-1,4-dione, 1,4-dioxime |
68768 | 2,5-Cyclohexadiene-1,4-dione, 2,3,5-tris(1-aziridinyl)- |
8059323 | 2,5-Cyclohexadiene-1,4-dione, 2,3,5-tris(1-aziridinyl)- |
108316 | 2,5-Furandione |
24937722 | 2,5-Furandione |
184288311 | 2,5-Furandione |
1190407738 | 2,5-Furandione |
1229972046 | 2,5-Furandione |
1380217402 | 2,5-Furandione |
19780111 | 2,5-Furandione, 3-(2-dodecen-1-yl)dihydro- |
1338799033 | 2,5-Furandione, 3-(2-dodecen-1-yl)dihydro- |
108305 | 2,5-Furandione, dihydro- |
1123596586 | 2,5-Furandione, dihydro- |
1024573 | 2,5-Methano-2H-indeno[1,2-b]oxirene, 2,3,4,5,6,7,7-heptachloro-1a,1b,5,5a,6,6a-hexahydro-,(1aR,1bS,2R,5S,5aR,6S,6aR)-rel- |
4067305 | 2,5-Methano-2H-indeno[1,2-b]oxirene, 2,3,4,5,6,7,7-heptachloro-1a,1b,5,5a,6,6a-hexahydro-,(1aR,1bS,2R,5S,5aR,6S,6aR)-rel- |
24699421 | 2,5-Methano-2H-indeno[1,2-b]oxirene, 2,3,4,5,6,7,7-heptachloro-1a,1b,5,5a,6,6a-hexahydro-,(1aR,1bS,2R,5S,5aR,6S,6aR)-rel- |
24717724 | 2,5-Methano-2H-indeno[1,2-b]oxirene, 2,3,4,5,6,7,7-heptachloro-1a,1b,5,5a,6,6a-hexahydro-,(1aR,1bS,2R,5S,5aR,6S,6aR)-rel- |
28044828 | 2,5-Methano-2H-indeno[1,2-b]oxirene, 2,3,4,5,6,7,7-heptachloro-1a,1b,5,5a,6,6a-hexahydro-,(1aR,1bS,2R,5S,5aR,6S,6aR)-rel- |
66240719 | 2,5-Methano-2H-indeno[1,2-b]oxirene, 2,3,4,5,6,7,7-heptachloro-1a,1b,5,5a,6,6a-hexahydro-,(1aR,1bS,2R,5S,5aR,6S,6aR)-rel- |
66429354 | 2,5-Methano-2H-indeno[1,2-b]oxirene, 2,3,4,5,6,7,7-heptachloro-1a,1b,5,5a,6,6a-hexahydro-,(1aR,1bS,2R,5S,5aR,6S,6aR)-rel- |
113484 | 2,5-Pyridinedicarboxylic acid, dipropyl ester |
136458 | 2,5-Pyridinedicarboxylic acid, dipropyl ester |
114308724 | 2,5-Pyridinedicarboxylic acid, dipropyl ester |
4602840 | 2,6,10-Dodecatrien-1-ol, 3,7,11-trimethyl- |
106241 | 2,6-Octadien-1-ol, 3,7-dimethyl-, (2E)- |
8007134 | 2,6-Octadien-1-ol, 3,7-dimethyl-, (2E)- |
491611086 | 2,6-Octadien-1-ol, 3,7-dimethyl-, (2E)- |
105873 | 2,6-Octadien-1-ol, 3,7-dimethyl-, 1-acetate, (2E)- |
5579635 | 2,6-Octadien-1-ol, 3,7-dimethyl-, 1-acetate, (2E)- |
8022831 | 2,6-Octadien-1-ol, 3,7-dimethyl-, 1-acetate, (2E)- |
130396848 | 2,6-Octadien-1-ol, 3,7-dimethyl-, 1-acetate, (2E)- |
5392405 | 2,6-Octadienal, 3,7-dimethyl- |
8022944 | 2,6-Octadienal, 3,7-dimethyl- |
37350348 | 2,6-Octadienal, 3,7-dimethyl- |
96680158 | 2,6-Octadienal, 3,7-dimethyl- |
250599190 | 2,6-Octadienal, 3,7-dimethyl- |
433282338 | 2,6-Octadienal, 3,7-dimethyl- |
1392408160 | 2,6-Octadienal, 3,7-dimethyl- |
7492662 | 2,6-Octadiene, 1,1-diethoxy-3,7-dimethyl- |
26581817 | 2,6-Piperidinedione, 3-(1,3-dihydro-1-oxo-2H-isoindol-2-yl)- |
66819 | 2,6-Piperidinedione, 4-[(2R)-2-[(1S,3S,5S)-3,5-dimethyl-2-oxocyclohexyl]-2-hydroxyethyl]- |
4630766 | 2,6-Piperidinedione, 4-[(2R)-2-[(1S,3S,5S)-3,5-dimethyl-2-oxocyclohexyl]-2-hydroxyethyl]- |
6399673 | 2,6-Piperidinedione, 4-[(2R)-2-[(1S,3S,5S)-3,5-dimethyl-2-oxocyclohexyl]-2-hydroxyethyl]- |
17974048 | 2,6-Piperidinedione, 4-[(2R)-2-[(1S,3S,5S)-3,5-dimethyl-2-oxocyclohexyl]-2-hydroxyethyl]- |
21059096 | 2,6-Piperidinedione, 4-[(2R)-2-[(1S,3S,5S)-3,5-dimethyl-2-oxocyclohexyl]-2-hydroxyethyl]- |
64653 | 2,6-Piperidinedione, 4-ethyl-4-methyl- |
94780 | 2,6-Pyridinediamine, 3-(phenylazo)- |
136403 | 2,6-Pyridinediamine, 3-(phenylazo)-, monohydrochloride |
4198190 | 2,7-Naphthalenedisulfonic acid, 3,3'-[(3,3'-dimethoxy[1,1'-biphenyl]-4,4'-diyl)bis(2,1-diazenediyl)]bis[4,5-dihydroxy-, sodium salt (1:4) |
2429745 | 2,7-Naphthalenedisulfonic acid, 3,3'-[(3,3'-dimethoxy[1,1'-biphenyl]-4,4'-diyl)bis(2,1-diazenediyl)]bis[5-amino-4-hydroxy-, sodium salt (1:4) |
51568946 | 2,7-Naphthalenedisulfonic acid, 3,3'-[(3,3'-dimethoxy[1,1'-biphenyl]-4,4'-diyl)bis(2,1-diazenediyl)]bis[5-amino-4-hydroxy-, sodium salt (1:4) |
95032750 | 2,7-Naphthalenedisulfonic acid, 3,3'-[(3,3'-dimethoxy[1,1'-biphenyl]-4,4'-diyl)bis(2,1-diazenediyl)]bis[5-amino-4-hydroxy-, sodium salt (1:4) |
120146647 | 2,7-Naphthalenedisulfonic acid, 3,3'-[(3,3'-dimethoxy[1,1'-biphenyl]-4,4'-diyl)bis(2,1-diazenediyl)]bis[5-amino-4-hydroxy-, sodium salt (1:4) |
2150541 | 2,7-Naphthalenedisulfonic acid, 3,3'-[(3,3'-dimethyl[1,1'-biphenyl]-4,4'-diyl)bis(2,1-diazenediyl)]bis[4,5-dihydroxy-, sodium salt (1:4) |
72571 | 2,7-Naphthalenedisulfonic acid, 3,3'-[(3,3'-dimethyl[1,1'-biphenyl]-4,4'-diyl)bis(2,1-diazenediyl)]bis[5-amino-4-hydroxy-, sodium salt (1:4) |
179472550 | 2,7-Naphthalenedisulfonic acid, 3,3'-[(3,3'-dimethyl[1,1'-biphenyl]-4,4'-diyl)bis(2,1-diazenediyl)]bis[5-amino-4-hydroxy-, sodium salt (1:4) |
2602462 | 2,7-Naphthalenedisulfonic acid, 3,3'-[[1,1'-biphenyl]-4,4'-diylbis(2,1-diazenediyl)]bis[5-amino-4-hydroxy-, sodium salt (1:4) |
116675435 | 2,7-Naphthalenedisulfonic acid, 3,3'-[[1,1'-biphenyl]-4,4'-diylbis(2,1-diazenediyl)]bis[5-amino-4-hydroxy-, sodium salt (1:4) |
179472561 | 2,7-Naphthalenedisulfonic acid, 3,3'-[[1,1'-biphenyl]-4,4'-diylbis(2,1-diazenediyl)]bis[5-amino-4-hydroxy-, sodium salt (1:4) |
627097625 | 2,7-Naphthalenedisulfonic acid, 3,3'-[[1,1'-biphenyl]-4,4'-diylbis(2,1-diazenediyl)]bis[5-amino-4-hydroxy-, sodium salt (1:4) |
3564098 | 2,7-Naphthalenedisulfonic acid, 3-hydroxy-4-[(2,4,5-trimethylphenyl)azo]-, disodium salt |
915673 | 2,7-Naphthalenedisulfonic acid, 3-hydroxy-4-[2-(4-sulfo-1-naphthalenyl)diazenyl]-, sodium salt (1:3) |
11139847 | 2,7-Naphthalenedisulfonic acid, 3-hydroxy-4-[2-(4-sulfo-1-naphthalenyl)diazenyl]-, sodium salt (1:3) |
12000496 | 2,7-Naphthalenedisulfonic acid, 3-hydroxy-4-[2-(4-sulfo-1-naphthalenyl)diazenyl]-, sodium salt (1:3) |
23307893 | 2,7-Naphthalenedisulfonic acid, 3-hydroxy-4-[2-(4-sulfo-1-naphthalenyl)diazenyl]-, sodium salt (1:3) |
3761533 | 2,7-Naphthalenedisulfonic acid, 4-[2-(2,4-dimethylphenyl)diazenyl]-3-hydroxy-, sodium salt (1:2) |
64553715 | 2,7-Naphthalenedisulfonic acid, 4-[2-(2,4-dimethylphenyl)diazenyl]-3-hydroxy-, sodium salt (1:2) |
1937377 | 2,7-Naphthalenedisulfonic acid, 4-amino-3-[2-[4'-[2-(2,4-diaminophenyl)diazenyl][1,1'-biphenyl]-4-yl]diazenyl]-5-hydroxy-6-(2-phenyldiazenyl)-, sodium salt (1:2) |
61701153 | 2,7-Naphthalenedisulfonic acid, 4-amino-3-[2-[4'-[2-(2,4-diaminophenyl)diazenyl][1,1'-biphenyl]-4-yl]diazenyl]-5-hydroxy-6-(2-phenyldiazenyl)-, sodium salt (1:2) |
220970376 | 2,7-Naphthalenedisulfonic acid, 4-amino-3-[2-[4'-[2-(2,4-diaminophenyl)diazenyl][1,1'-biphenyl]-4-yl]diazenyl]-5-hydroxy-6-(2-phenyldiazenyl)-, sodium salt (1:2) |
3626286 | 2,7-Naphthalenedisulfonic acid, 4-amino-5-hydroxy-3-[2-[4'-[2-(4-hydroxyphenyl)diazenyl][1,1'-biphenyl]-4-yl]diazenyl]-6-(2-phenyldiazenyl)-, sodium salt (1:2) |
2429734 | 2,7-Naphthalenedisulfonic acid, 5-amino-3-[2-[4'-[2-(7-amino-1-hydroxy-3-sulfo-2-naphthalenyl)diazenyl][1,1'-biphenyl]-4-yl]diazenyl]-4-hydroxy-, sodium salt (1:3) |
52350228 | 2,7-Naphthalenedisulfonic acid, 5-amino-3-[2-[4'-[2-(7-amino-1-hydroxy-3-sulfo-2-naphthalenyl)diazenyl][1,1'-biphenyl]-4-yl]diazenyl]-4-hydroxy-, sodium salt (1:3) |
72208 | 2,7:3,6-Dimethanonaphth[2,3-b]oxirene, 3,4,5,6,9,9-hexachloro-1a,2,2a,3,6,6a,7,7a-octahydro-, (1aR,2R,2aR,3R,6S,6aS,7S,7aS)-rel- |
7421934 | 2,7:3,6-Dimethanonaphth[2,3-b]oxirene, 3,4,5,6,9,9-hexachloro-1a,2,2a,3,6,6a,7,7a-octahydro-, (1aR,2R,2aR,3R,6S,6aS,7S,7aS)-rel- |
72208 | 2,7:3,6-Dimethanonaphth[2,3-b]oxirene, 3,4,5,6,9,9-hexachloro-1a,2,2a,3,6,6a,7,7a-octahydro-, (1aR,2R,2aR,3R,6S,6aS,7S,7aS)-rel-, and metabolites |
60571 | 2,7:3,6-Dimethanonaphth[2,3-b]oxirene, 3,4,5,6,9,9-hexachloro-1a,2,2a,3,6,6a,7,7a-octahydro-, (1aR,2R,2aS,3S,6R,6aR,7S,7aS)-rel- |
3039007 | 2,7:3,6-Dimethanonaphth[2,3-b]oxirene, 3,4,5,6,9,9-hexachloro-1a,2,2a,3,6,6a,7,7a-octahydro-, (1aR,2R,2aS,3S,6R,6aR,7S,7aS)-rel- |
12622752 | 2,7:3,6-Dimethanonaphth[2,3-b]oxirene, 3,4,5,6,9,9-hexachloro-1a,2,2a,3,6,6a,7,7a-octahydro-, (1aR,2R,2aS,3S,6R,6aR,7S,7aS)-rel- |
17301109 | 2,7:3,6-Dimethanonaphth[2,3-b]oxirene, 3,4,5,6,9,9-hexachloro-1a,2,2a,3,6,6a,7,7a-octahydro-, (1aR,2R,2aS,3S,6R,6aR,7S,7aS)-rel- |
33648225 | 2,7:3,6-Dimethanonaphth[2,3-b]oxirene, 3,4,5,6,9,9-hexachloro-1a,2,2a,3,6,6a,7,7a-octahydro-, (1aR,2R,2aS,3S,6R,6aR,7S,7aS)-rel- |
59029571 | 2,7:3,6-Dimethanonaphth[2,3-b]oxirene, 3,4,5,6,9,9-hexachloro-1a,2,2a,3,6,6a,7,7a-octahydro-, (1aR,2R,2aS,3S,6R,6aR,7S,7aS)-rel- |
476391 | 2-Anthracenecarboxylic acid, 7-.beta.-D-glucopyranosyl-9,10-dihydro-3,5,6,8-tetrahydroxy-1-methyl-9,10-dioxo- |
632553 | 2-Anthracenecarboxylic acid, 7-.beta.-D-glucopyranosyl-9,10-dihydro-3,5,6,8-tetrahydroxy-1-methyl-9,10-dioxo- |
1260179 | 2-Anthracenecarboxylic acid, 7-.beta.-D-glucopyranosyl-9,10-dihydro-3,5,6,8-tetrahydroxy-1-methyl-9,10-dioxo- |
1389340 | 2-Anthracenecarboxylic acid, 7-.beta.-D-glucopyranosyl-9,10-dihydro-3,5,6,8-tetrahydroxy-1-methyl-9,10-dioxo- |
16667064 | 2-Anthracenecarboxylic acid, 7-.beta.-D-glucopyranosyl-9,10-dihydro-3,5,6,8-tetrahydroxy-1-methyl-9,10-dioxo- |
37349498 | 2-Anthracenecarboxylic acid, 7-.beta.-D-glucopyranosyl-9,10-dihydro-3,5,6,8-tetrahydroxy-1-methyl-9,10-dioxo- |
131802727 | 2-Anthracenecarboxylic acid, 7-.beta.-D-glucopyranosyl-9,10-dihydro-3,5,6,8-tetrahydroxy-1-methyl-9,10-dioxo- |
613138 | 2-Anthramine |
136958 | 2-Benzothiazolamine |
35858538 | 2-Benzothiazolamine |
120045467 | 2-Benzothiazolamine |
19952477 | 2-Benzothiazolamine, 4-chloro- |
5464799 | 2-Benzothiazolamine, 4-methoxy- |
1477425 | 2-Benzothiazolamine, 4-methyl- |
24072751 | 2-Benzothiazolamine, 5,6-dichloro- |
29927080 | 2-Benzothiazolamine, 5,6-dimethyl- |
94451 | 2-Benzothiazolamine, 6-ethoxy- |
1747600 | 2-Benzothiazolamine, 6-methoxy- |
6285570 | 2-Benzothiazolamine, 6-nitro- |
13952846 | 2-Butanamine |
33966506 | 2-Butanamine |
78922 | 2-Butanol |
15892236 | 2-Butanol |
2421025 | 2-Butanol, 1,1',1''-nitrilotris- |
13552211 | 2-Butanol, 1-amino- |
13552324 | 2-Butanol, 1-amino- |
78933 | 2-Butanone |
135311023 | 2-Butanone |
43121433 | 2-Butanone, 1-(4-chlorophenoxy)-3,3-dimethyl-1-(1H-1,2,4-triazol-1-yl)- |
43121434 | 2-Butanone, 1-(4-chlorophenoxy)-3,3-dimethyl-1-(1H-1,2,4-triazol-1-yl)- |
72650409 | 2-Butanone, 1-(4-chlorophenoxy)-3,3-dimethyl-1-(1H-1,2,4-triazol-1-yl)- |
93779512 | 2-Butanone, 1-(4-chlorophenoxy)-3,3-dimethyl-1-(1H-1,2,4-triazol-1-yl)- |
119143305 | 2-Butanone, 1-(4-chlorophenoxy)-3,3-dimethyl-1-(1H-1,2,4-triazol-1-yl)- |
148227321 | 2-Butanone, 1-(4-chlorophenoxy)-3,3-dimethyl-1-(1H-1,2,4-triazol-1-yl)- |
39196184 | 2-Butanone, 3,3-dimethyl-1-(methylthio)-, O-[(methylamino)carbonyl]oxime |
563804 | 2-Butanone, 3-methyl- |
52325527 | 2-Butanone, 3-methyl- |
96297 | 2-Butanone, oxime |
105287283 | 2-Butanone, oxime |
1338234 | 2-Butanone, peroxide |
9042653 | 2-Butanone, peroxide |
37228094 | 2-Butanone, peroxide |
37332211 | 2-Butanone, peroxide |
37364684 | 2-Butanone, peroxide |
39386168 | 2-Butanone, peroxide |
50927894 | 2-Butanone, peroxide |
99676025 | 2-Butanone, peroxide |
1175509655 | 2-Butanone, peroxide |
1403779894 | 2-Butanone, peroxide |
123739 | 2-Butenal |
4170300 | 2-Butenal |
4170303 | 2-Butenal |
123739 | 2-Butenal, (2E)- |
4170303 | 2-Butenal, (2Z)- |
15798648 | 2-Butenal, (2Z)- |
107017 | 2-Butene |
1735768 | 2-Butene |
624646 | 2-Butene, (2E)- |
590181 | 2-Butene, (2Z)- |
764410 | 2-Butene, 1,4-dichloro- |
7644410 | 2-Butene, 1,4-dichloro- |
110576 | 2-Butene, 1,4-dichloro-, (2E)- |
764410 | 2-Butene, 1,4-dichloro-, (2E)- |
1476115 | 2-Butene, 1,4-dichloro-, (2Z)- |
513359 | 2-Butene, 2-methyl- |
3234024 | 2-Butene-1,4-diol, 2,3-dibromo- |
764421 | 2-Butenedinitrile, (2E)- |
1187424 | 2-Butenedinitrile, 2,3-diamino-, (2Z)- |
54414889 | 2-Butenedinitrile, 2,3-diamino-, (2Z)- |
110178 | 2-Butenedioic acid (2E)- |
623158974 | 2-Butenedioic acid (2E)- |
999213 | 2-Butenedioic acid (2Z)-, 1,4-di-2-propen-1-yl ester |
70798720 | 2-Butenedioic acid (2Z)-, 1,4-di-2-propen-1-yl ester |
105323339 | 2-Butenedioic acid (2Z)-, 1,4-di-2-propen-1-yl ester |
4403616 | 2-Butenenitrile, 2-methyl- |
30574971 | 2-Butenenitrile, 2-methyl-, (2E)- |
20068024 | 2-Butenenitrile, 2-methyl-, (2Z)- |
393453 | 2-Butenoic acid, 2(or 4)-isooctyl-4,6(or 2,6)-dinitrophenyl ester |
12684105 | 2-Butenoic acid, 2(or 4)-isooctyl-4,6(or 2,6)-dinitrophenyl ester |
39300453 | 2-Butenoic acid, 2(or 4)-isooctyl-4,6(or 2,6)-dinitrophenyl ester |
57131132 | 2-Butenoic acid, 2(or 4)-isooctyl-4,6(or 2,6)-dinitrophenyl ester |
57526973 | 2-Butenoic acid, 2(or 4)-isooctyl-4,6(or 2,6)-dinitrophenyl ester |
7700176 | 2-Butenoic acid, 3-[(dimethoxyphosphinyl)oxy]-, 1-phenylethyl ester, (2E)- |
7786347 | 2-Butenoic acid, 3-[(dimethoxyphosphinyl)oxy]-, methyl ester |
243464315 | 2-Butenoic acid, 3-[(dimethoxyphosphinyl)oxy]-, methyl ester |
31218834 | 2-Butenoic acid, 3-[[(ethylamino)methoxyphosphinothioyl]oxy]-, 1-methylethyl ester, (2E)- |
58995372 | 2-Butenoic acid, 3-[[(ethylamino)methoxyphosphinothioyl]oxy]-, 1-methylethyl ester, (2E)- |
21739913 | 2-Butenoic acid, 3-bromo-4-(4-methoxyphenyl)-4-oxo-, sodium salt, (2E)- |
99489 | 2-Cyclohexen-1-ol, 2-methyl-5-(1-methylethenyl)- |
20307862 | 2-Cyclohexen-1-ol, 2-methyl-5-(1-methylethenyl)- |
22567186 | 2-Cyclohexen-1-ol, 2-methyl-5-(1-methylethenyl)- |
97427 | 2-Cyclohexen-1-ol, 2-methyl-5-(1-methylethenyl)-, 1-acetate |
22567131 | 2-Cyclohexen-1-ol, 2-methyl-5-(1-methylethenyl)-, 1-acetate |
73468196 | 2-Cyclohexen-1-one, 2-[1-(ethoxyimino)butyl]-5-[2-(ethylthio)propyl]-3-hydroxy- |
74051802 | 2-Cyclohexen-1-one, 2-[1-(ethoxyimino)butyl]-5-[2-(ethylthio)propyl]-3-hydroxy- |
74433800 | 2-Cyclohexen-1-one, 2-[1-(ethoxyimino)butyl]-5-[2-(ethylthio)propyl]-3-hydroxy- |
77107416 | 2-Cyclohexen-1-one, 2-[1-(ethoxyimino)butyl]-5-[2-(ethylthio)propyl]-3-hydroxy- |
2244168 | 2-Cyclohexen-1-one, 2-methyl-5-(1-methylethenyl)-, (5S)- |
53763738 | 2-Cyclohexen-1-one, 2-methyl-5-(1-methylethenyl)-, (5S)- |
78591 | 2-Cyclohexen-1-one, 3,5,5-trimethyl- |
3688537 | 2-Furanacetamide, .alpha.-[(5-nitro-2-furanyl)methylene]- |
98011 | 2-Furancarboxaldehyde |
98000 | 2-Furanmethanol |
623176 | 2-Furanmethanol, 2-acetate |
110430 | 2-Heptanone |
591786 | 2-Hexanone |
110123 | 2-Hexanone, 5-methyl- |
645625 | 2-Hexenal, 2-ethyl- |
128744218 | 2-Hexenal, 2-ethyl- |
1197009338 | 2-Hexenal, 2-ethyl- |
7688213 | 2-Hexene, (2Z)- |
96457 | 2-Imidazolidinethione |
96468 | 2-Imidazolidinethione |
12261948 | 2-Imidazolidinethione |
26856291 | 2-Imidazolidinethione |
71836049 | 2-Imidazolidinethione |
90613755 | 2-Imidazolidinethione |
875479382 | 2-Imidazolidinethione |
1854268 | 2-Imidazolidinone, 4,5-dihydroxy-1,3-bis(hydroxymethyl)- |
11114082 | 2-Imidazolidinone, 4,5-dihydroxy-1,3-bis(hydroxymethyl)- |
11121098 | 2-Imidazolidinone, 4,5-dihydroxy-1,3-bis(hydroxymethyl)- |
28085714 | 2-Imidazolidinone, 4,5-dihydroxy-1,3-bis(hydroxymethyl)- |
37220329 | 2-Imidazolidinone, 4,5-dihydroxy-1,3-bis(hydroxymethyl)- |
39421722 | 2-Imidazolidinone, 4,5-dihydroxy-1,3-bis(hydroxymethyl)- |
53789461 | 2-Imidazolidinone, 4,5-dihydroxy-1,3-bis(hydroxymethyl)- |
55963592 | 2-Imidazolidinone, 4,5-dihydroxy-1,3-bis(hydroxymethyl)- |
58391507 | 2-Imidazolidinone, 4,5-dihydroxy-1,3-bis(hydroxymethyl)- |
60704281 | 2-Imidazolidinone, 4,5-dihydroxy-1,3-bis(hydroxymethyl)- |
60918663 | 2-Imidazolidinone, 4,5-dihydroxy-1,3-bis(hydroxymethyl)- |
66565499 | 2-Imidazolidinone, 4,5-dihydroxy-1,3-bis(hydroxymethyl)- |
66797500 | 2-Imidazolidinone, 4,5-dihydroxy-1,3-bis(hydroxymethyl)- |
73767336 | 2-Imidazolidinone, 4,5-dihydroxy-1,3-bis(hydroxymethyl)- |
79394299 | 2-Imidazolidinone, 4,5-dihydroxy-1,3-bis(hydroxymethyl)- |
79749181 | 2-Imidazolidinone, 4,5-dihydroxy-1,3-bis(hydroxymethyl)- |
82905508 | 2-Imidazolidinone, 4,5-dihydroxy-1,3-bis(hydroxymethyl)- |
97123530 | 2-Imidazolidinone, 4,5-dihydroxy-1,3-bis(hydroxymethyl)- |
115803946 | 2-Imidazolidinone, 4,5-dihydroxy-1,3-bis(hydroxymethyl)- |
140161553 | 2-Imidazolidinone, 4,5-dihydroxy-1,3-bis(hydroxymethyl)- |
186359922 | 2-Imidazolidinone, 4,5-dihydroxy-1,3-bis(hydroxymethyl)- |
211866852 | 2-Imidazolidinone, 4,5-dihydroxy-1,3-bis(hydroxymethyl)- |
876564759 | 2-Imidazolidinone, 4,5-dihydroxy-1,3-bis(hydroxymethyl)- |
1384186122 | 2-Imidazolidinone, 4,5-dihydroxy-1,3-bis(hydroxymethyl)- |
79572 | 2-Naphthacenecarboxamide, 4-(dimethylamino)-1,4,4a,5,5a,6,11,12a-octahydro-3,5,6,10,12,12a-hexahydroxy-6-methyl-1,11-dioxo-, (4S,4aR,5S,5aR,6S,12aS)- |
1405954 | 2-Naphthacenecarboxamide, 4-(dimethylamino)-1,4,4a,5,5a,6,11,12a-octahydro-3,5,6,10,12,12a-hexahydroxy-6-methyl-1,11-dioxo-, (4S,4aR,5S,5aR,6S,12aS)- |
21645090 | 2-Naphthacenecarboxamide, 4-(dimethylamino)-1,4,4a,5,5a,6,11,12a-octahydro-3,5,6,10,12,12a-hexahydroxy-6-methyl-1,11-dioxo-, (4S,4aR,5S,5aR,6S,12aS)- |
52214467 | 2-Naphthacenecarboxamide, 4-(dimethylamino)-1,4,4a,5,5a,6,11,12a-octahydro-3,5,6,10,12,12a-hexahydroxy-6-methyl-1,11-dioxo-, (4S,4aR,5S,5aR,6S,12aS)- |
96310428 | 2-Naphthacenecarboxamide, 4-(dimethylamino)-1,4,4a,5,5a,6,11,12a-octahydro-3,5,6,10,12,12a-hexahydroxy-6-methyl-1,11-dioxo-, (4S,4aR,5S,5aR,6S,12aS)- |
102287296 | 2-Naphthacenecarboxamide, 4-(dimethylamino)-1,4,4a,5,5a,6,11,12a-octahydro-3,5,6,10,12,12a-hexahydroxy-6-methyl-1,11-dioxo-, (4S,4aR,5S,5aR,6S,12aS)- |
103351037 | 2-Naphthacenecarboxamide, 4-(dimethylamino)-1,4,4a,5,5a,6,11,12a-octahydro-3,5,6,10,12,12a-hexahydroxy-6-methyl-1,11-dioxo-, (4S,4aR,5S,5aR,6S,12aS)- |
105145106 | 2-Naphthacenecarboxamide, 4-(dimethylamino)-1,4,4a,5,5a,6,11,12a-octahydro-3,5,6,10,12,12a-hexahydroxy-6-methyl-1,11-dioxo-, (4S,4aR,5S,5aR,6S,12aS)- |
106216573 | 2-Naphthacenecarboxamide, 4-(dimethylamino)-1,4,4a,5,5a,6,11,12a-octahydro-3,5,6,10,12,12a-hexahydroxy-6-methyl-1,11-dioxo-, (4S,4aR,5S,5aR,6S,12aS)- |
856305696 | 2-Naphthacenecarboxamide, 4-(dimethylamino)-1,4,4a,5,5a,6,11,12a-octahydro-3,5,6,10,12,12a-hexahydroxy-6-methyl-1,11-dioxo-, (4S,4aR,5S,5aR,6S,12aS)- |
1135442000 | 2-Naphthacenecarboxamide, 4-(dimethylamino)-1,4,4a,5,5a,6,11,12a-octahydro-3,5,6,10,12,12a-hexahydroxy-6-methyl-1,11-dioxo-, (4S,4aR,5S,5aR,6S,12aS)- |
1256964223 | 2-Naphthacenecarboxamide, 4-(dimethylamino)-1,4,4a,5,5a,6,11,12a-octahydro-3,5,6,10,12,12a-hexahydroxy-6-methyl-1,11-dioxo-, (4S,4aR,5S,5aR,6S,12aS)- |
2058460 | 2-Naphthacenecarboxamide, 4-(dimethylamino)-1,4,4a,5,5a,6,11,12a-octahydro-3,5,6,10,12,12a-hexahydroxy-6-methyl-1,11-dioxo-, hydrochloride (1:1), (4S,4aR,5S,5aR,6S,12aS)- |
61794352 | 2-Naphthacenecarboxamide, 4-(dimethylamino)-1,4,4a,5,5a,6,11,12a-octahydro-3,5,6,10,12,12a-hexahydroxy-6-methyl-1,11-dioxo-, hydrochloride (1:1), (4S,4aR,5S,5aR,6S,12aS)- |
72034969 | 2-Naphthacenecarboxamide, 4-(dimethylamino)-1,4,4a,5,5a,6,11,12a-octahydro-3,5,6,10,12,12a-hexahydroxy-6-methyl-1,11-dioxo-, hydrochloride (1:1), (4S,4aR,5S,5aR,6S,12aS)- |
90438850 | 2-Naphthacenecarboxamide, 4-(dimethylamino)-1,4,4a,5,5a,6,11,12a-octahydro-3,5,6,10,12,12a-hexahydroxy-6-methyl-1,11-dioxo-, hydrochloride (1:1), (4S,4aR,5S,5aR,6S,12aS)- |
102323648 | 2-Naphthacenecarboxamide, 4-(dimethylamino)-1,4,4a,5,5a,6,11,12a-octahydro-3,5,6,10,12,12a-hexahydroxy-6-methyl-1,11-dioxo-, hydrochloride (1:1), (4S,4aR,5S,5aR,6S,12aS)- |
885678739 | 2-Naphthacenecarboxamide, 4-(dimethylamino)-1,4,4a,5,5a,6,11,12a-octahydro-3,5,6,10,12,12a-hexahydroxy-6-methyl-1,11-dioxo-, hydrochloride (1:1), (4S,4aR,5S,5aR,6S,12aS)- |
64755 | 2-Naphthacenecarboxamide, 4-(dimethylamino)-1,4,4a,5,5a,6,11,12a-octahydro-3,6,10,12,12a-pentahydroxy-6-methyl-1,11-dioxo-, hydrochloride (1:1), (4S,4aS,5aS,6S,12aS)- |
8017774 | 2-Naphthacenecarboxamide, 4-(dimethylamino)-1,4,4a,5,5a,6,11,12a-octahydro-3,6,10,12,12a-pentahydroxy-6-methyl-1,11-dioxo-, hydrochloride (1:1), (4S,4aS,5aS,6S,12aS)- |
8026720 | 2-Naphthacenecarboxamide, 4-(dimethylamino)-1,4,4a,5,5a,6,11,12a-octahydro-3,6,10,12,12a-pentahydroxy-6-methyl-1,11-dioxo-, hydrochloride (1:1), (4S,4aS,5aS,6S,12aS)- |
90438838 | 2-Naphthacenecarboxamide, 4-(dimethylamino)-1,4,4a,5,5a,6,11,12a-octahydro-3,6,10,12,12a-pentahydroxy-6-methyl-1,11-dioxo-, hydrochloride (1:1), (4S,4aS,5aS,6S,12aS)- |
102030193 | 2-Naphthacenecarboxamide, 4-(dimethylamino)-1,4,4a,5,5a,6,11,12a-octahydro-3,6,10,12,12a-pentahydroxy-6-methyl-1,11-dioxo-, hydrochloride (1:1), (4S,4aS,5aS,6S,12aS)- |
91598 | 2-Naphthalenamine |
3025772 | 2-Naphthalenamine, 1-[2-(4-nitrophenyl)diazenyl]- |
494031 | 2-Naphthalenamine, N,N-bis(2-chloroethyl)- |
135886 | 2-Naphthalenamine, N-phenyl- |
52907172 | 2-Naphthalenamine, N-phenyl- |
84420280 | 2-Naphthalenamine, N-phenyl- |
6471494 | 2-Naphthalenecarboxamide, 3-hydroxy-4-[2-(2-methoxy-5-nitrophenyl)diazenyl]-N-(3-nitrophenyl)- |
3267105 | 2-Naphthalenecarboxamide, 4-[2-(2,5-dichlorophenyl)diazenyl]-3-hydroxy-N-phenyl- |
6041947 | 2-Naphthalenecarboxamide, 4-[2-(2,5-dichlorophenyl)diazenyl]-3-hydroxy-N-phenyl- |
1342616 | 2-Naphthalenesulfonic acid, 6-hydroxy-5-[2-(4-sulfophenyl)diazenyl]-, sodium salt (1:2) |
2783940 | 2-Naphthalenesulfonic acid, 6-hydroxy-5-[2-(4-sulfophenyl)diazenyl]-, sodium salt (1:2) |
12707276 | 2-Naphthalenesulfonic acid, 6-hydroxy-5-[2-(4-sulfophenyl)diazenyl]-, sodium salt (1:2) |
842079 | 2-Naphthalenol, 1-(2-phenyldiazenyl)- |
104407036 | 2-Naphthalenol, 1-(2-phenyldiazenyl)- |
3118976 | 2-Naphthalenol, 1-[2-(2,4-dimethylphenyl)diazenyl]- |
6356538 | 2-Naphthalenol, 1-[2-(2,5-dimethoxyphenyl)diazenyl]- |
6358538 | 2-Naphthalenol, 1-[2-(2,5-dimethoxyphenyl)diazenyl]- |
2646175 | 2-Naphthalenol, 1-[2-(2-methylphenyl)diazenyl]- |
50926675 | 2-Naphthalenol, 1-[2-(2-methylphenyl)diazenyl]- |
2425856 | 2-Naphthalenol, 1-[2-(4-methyl-2-nitrophenyl)diazenyl]- |
12238481 | 2-Naphthalenol, 1-[2-(4-methyl-2-nitrophenyl)diazenyl]- |
12240016 | 2-Naphthalenol, 1-[2-(4-methyl-2-nitrophenyl)diazenyl]- |
12240027 | 2-Naphthalenol, 1-[2-(4-methyl-2-nitrophenyl)diazenyl]- |
39310300 | 2-Naphthalenol, 1-[2-(4-methyl-2-nitrophenyl)diazenyl]- |
78690694 | 2-Naphthalenol, 1-[2-(4-methyl-2-nitrophenyl)diazenyl]- |
470826 | 2-Oxabicyclo[2.2.2]octane, 1,3,3-trimethyl- |
8024520 | 2-Oxabicyclo[2.2.2]octane, 1,3,3-trimethyl- |
8024531 | 2-Oxabicyclo[2.2.2]octane, 1,3,3-trimethyl- |
10458114 | 2-Oxabicyclo[2.2.2]octane, 1,3,3-trimethyl- |
855347238 | 2-Oxabicyclo[2.2.2]octane, 1,3,3-trimethyl- |
57578 | 2-Oxetanone |
1955459 | 2-Oxetanone, 3,3-dimethyl- |
45432824 | 2-Oxetanone, 3,3-dimethyl- |
77838 | 2-Oxiranecarboxylic acid, 3-methyl-3-phenyl-, ethyl ester |
1322049 | 2-Oxiranecarboxylic acid, 3-methyl-3-phenyl-, ethyl ester |
121391 | 2-Oxiranecarboxylic acid, 3-phenyl-, ethyl ester |
3033770 | 2-Oxiranemethanaminium, N,N,N-trimethyl-, chloride (1:1) |
129829227 | 2-Oxiranemethanaminium, N,N,N-trimethyl-, chloride (1:1) |
556525 | 2-Oxiranemethanol |
61915273 | 2-Oxiranemethanol |
98913543 | 2-Oxiranemethanol |
141388 | 2-Oxiraneoctanoic acid, 3-octyl-, 2-ethylhexyl ester |
1025028390 | 2-Oxiraneoctanoic acid, 3-octyl-, 2-ethylhexyl ester |
108098 | 2-Pentanamine, 4-methyl- |
54548480 | 2-Pentanamine, 4-methyl- |
626380 | 2-Pentanol, 2-acetate |
116783176 | 2-Pentanol, 2-acetate |
105306 | 2-Pentanol, 4-methyl- |
108112 | 2-Pentanol, 4-methyl- |
20281883 | 2-Pentanol, 4-methyl- |
40747851 | 2-Pentanol, 4-methyl- |
54972973 | 2-Pentanol, 4-methyl- |
72847315 | 2-Pentanol, 4-methyl- |
108849 | 2-Pentanol, 4-methyl-, 2-acetate |
142927 | 2-Pentanol, 4-methyl-, 2-acetate |
155749227 | 2-Pentanol, 4-methyl-, 2-acetate |
107879 | 2-Pentanone |
123422 | 2-Pentanone, 4-hydroxy-4-methyl- |
107700 | 2-Pentanone, 4-methoxy-4-methyl- |
108101 | 2-Pentanone, 4-methyl- |
1338234915 | 2-Pentanone, 4-methyl- |
646048 | 2-Pentene, (2E)- |
25377724 | 2-Pentene, (2E)- |
32968642 | 2-Pentene, (2E)- |
627203 | 2-Pentene, (2Z)- |
33064878 | 2-Pentene, (2Z)- |
13284429 | 2-Pentenenitrile |
298599 | 2-Piperidineacetic acid, .alpha.-phenyl-, methyl ester, hydrochloride |
75310 | 2-Propanamine |
85404246 | 2-Propanamine |
75649 | 2-Propanamine, 2-methyl- |
94896772 | 2-Propanamine, 2-methyl- |
108189 | 2-Propanamine, N-(1-methylethyl)- |
1051915253 | 2-Propanamine, N-(1-methylethyl)- |
38836394 | 2-Propanamine, N-(1-methylpropylidene)- |
50340 | 2-Propanaminium, N-methyl-N-(1-methylethyl)-N-[2-[(9H-xanthen-9-ylcarbonyl)oxy]ethyl]-, bromide (1:1) |
75332 | 2-Propanethiol |
67630 | 2-Propanol |
8013705 | 2-Propanol |
122203 | 2-Propanol, 1,1',1''-nitrilotris- |
53609646 | 2-Propanol, 1,1'-(nitrosoimino)bis- |
110974 | 2-Propanol, 1,1'-iminobis- |
1335542 | 2-Propanol, 1,1'-iminobis- |
1141787009 | 2-Propanol, 1,1'-iminobis- |
920661 | 2-Propanol, 1,1,1,3,3,3-hexafluoro- |
96231 | 2-Propanol, 1,3-dichloro- |
26545733 | 2-Propanol, 1,3-dichloro- |
148584489 | 2-Propanol, 1,3-dichloro- |
13674878 | 2-Propanol, 1,3-dichloro-, phosphate (3:1) |
78966 | 2-Propanol, 1-amino- |
1674562 | 2-Propanol, 1-amino- |
19686738 | 2-Propanol, 1-bromo- |
19785843 | 2-Propanol, 1-bromo- |
5131668 | 2-Propanol, 1-butoxy- |
127004 | 2-Propanol, 1-chloro- |
20008075 | 2-Propanol, 1-chloro- |
13674845 | 2-Propanol, 1-chloro-, 2,2',2''-phosphate |
16839320 | 2-Propanol, 1-chloro-, 2,2',2''-phosphate |
98112324 | 2-Propanol, 1-chloro-, 2,2',2''-phosphate |
4769737 | 2-Propanol, 1-chloro-3-phenoxy- |
108648266 | 2-Propanol, 1-chloro-3-phenoxy- |
107982 | 2-Propanol, 1-methoxy- |
58769190 | 2-Propanol, 1-methoxy- |
108656 | 2-Propanol, 1-methoxy-, 2-acetate |
84540578 | 2-Propanol, 1-methoxy-, 2-acetate |
142300821 | 2-Propanol, 1-methoxy-, 2-acetate |
1569013 | 2-Propanol, 1-propoxy- |
75650 | 2-Propanol, 2-methyl- |
75651 | 2-Propanol, 2-methyl- |
555317 | 2-Propanol, aluminum salt (3:1) |
12343270 | 2-Propanol, aluminum salt (3:1) |
51796099 | 2-Propanol, aluminum salt (3:1) |
78423413 | 2-Propanol, aluminum salt (3:1) |
95797389 | 2-Propanol, aluminum salt (3:1) |
188398621 | 2-Propanol, aluminum salt (3:1) |
245654302 | 2-Propanol, aluminum salt (3:1) |
301192927 | 2-Propanol, aluminum salt (3:1) |
358732168 | 2-Propanol, aluminum salt (3:1) |
365494413 | 2-Propanol, aluminum salt (3:1) |
856761212 | 2-Propanol, aluminum salt (3:1) |
67641 | 2-Propanone |
684162 | 2-Propanone, 1,1,1,3,3,3-hexafluoro- |
13098390 | 2-Propanone, 1,1,1,3,3,3-hexafluoro-, hydrate (2:3) |
918003 | 2-Propanone, 1,1,1-trichloro- |
513882 | 2-Propanone, 1,1-dichloro- |
534076 | 2-Propanone, 1,3-dichloro- |
598312 | 2-Propanone, 1-bromo- |
116096 | 2-Propanone, 1-hydroxy- |
107119 | 2-Propen-1-amine |
102705 | 2-Propen-1-amine, N,N-di-2-propen-1-yl- |
44905308 | 2-Propen-1-amine, N,N-di-2-propen-1-yl- |
343314283 | 2-Propen-1-amine, N,N-di-2-propen-1-yl- |
124027 | 2-Propen-1-amine, N-2-propen-1-yl- |
1263263746 | 2-Propen-1-amine, N-2-propen-1-yl- |
107186 | 2-Propen-1-ol |
1071861 | 2-Propen-1-ol |
513428 | 2-Propen-1-ol, 2-methyl- |
87296 | 2-Propen-1-ol, 3-phenyl-, 1-(2-aminobenzoate) |
107028 | 2-Propenal |
25314618 | 2-Propenal |
78853 | 2-Propenal, 2-methyl- |
101393 | 2-Propenal, 2-methyl-3-phenyl- |
623303 | 2-Propenal, 3-(2-furanyl)- |
1504741 | 2-Propenal, 3-(2-methoxyphenyl)- |
104552 | 2-Propenal, 3-phenyl-, (2E)- |
14371109 | 2-Propenal, 3-phenyl-, (2E)- |
79061 | 2-Propenamide |
1198293683 | 2-Propenamide |
110269 | 2-Propenamide, N,N'-methylenebis- |
1227834367 | 2-Propenamide, N,N'-methylenebis- |
2873974 | 2-Propenamide, N-(1,1-dimethyl-3-oxobutyl)- |
19910599 | 2-Propenamide, N-(1,1-dimethyl-3-oxobutyl)- |
45002231 | 2-Propenamide, N-(1,1-dimethyl-3-oxobutyl)- |
56891282 | 2-Propenamide, N-(1,1-dimethyl-3-oxobutyl)- |
66251705 | 2-Propenamide, N-(1,1-dimethyl-3-oxobutyl)- |
924425 | 2-Propenamide, N-(hydroxymethyl)- |
90456670 | 2-Propenamide, N-(hydroxymethyl)- |
160278557 | 2-Propenamide, N-(hydroxymethyl)- |
176598188 | 2-Propenamide, N-(hydroxymethyl)- |
194091526 | 2-Propenamide, N-(hydroxymethyl)- |
9003058 | 2-Propenamide, homopolymer |
9082068 | 2-Propenamide, homopolymer |
12624247 | 2-Propenamide, homopolymer |
25038453 | 2-Propenamide, homopolymer |
27754570 | 2-Propenamide, homopolymer |
31566424 | 2-Propenamide, homopolymer |
33338033 | 2-Propenamide, homopolymer |
39355072 | 2-Propenamide, homopolymer |
39387774 | 2-Propenamide, homopolymer |
51312404 | 2-Propenamide, homopolymer |
57679115 | 2-Propenamide, homopolymer |
68247814 | 2-Propenamide, homopolymer |
72270861 | 2-Propenamide, homopolymer |
79079155 | 2-Propenamide, homopolymer |
104981897 | 2-Propenamide, homopolymer |
114265359 | 2-Propenamide, homopolymer |
122177633 | 2-Propenamide, homopolymer |
124262357 | 2-Propenamide, homopolymer |
129774192 | 2-Propenamide, homopolymer |
133522777 | 2-Propenamide, homopolymer |
143180090 | 2-Propenamide, homopolymer |
143180136 | 2-Propenamide, homopolymer |
143180227 | 2-Propenamide, homopolymer |
143749079 | 2-Propenamide, homopolymer |
200138950 | 2-Propenamide, homopolymer |
210353858 | 2-Propenamide, homopolymer |
223905393 | 2-Propenamide, homopolymer |
443682777 | 2-Propenamide, homopolymer |
449742465 | 2-Propenamide, homopolymer |
1226898287 | 2-Propenamide, homopolymer |
1229457128 | 2-Propenamide, homopolymer |
1400274089 | 2-Propenamide, homopolymer |
125304076 | 2-Propenamide, reaction products with formaldehyde-melamine polymer Bu Me pentyl ether and hydrogen peroxide |
107131 | 2-Propenenitrile |
1424482 | 2-Propenenitrile |
29754210 | 2-Propenenitrile |
63908521 | 2-Propenenitrile |
769126923 | 2-Propenenitrile |
769134669 | 2-Propenenitrile |
1006710560 | 2-Propenenitrile |
1197872062 | 2-Propenenitrile |
1221168600 | 2-Propenenitrile |
1309882903 | 2-Propenenitrile |
920376 | 2-Propenenitrile, 2-chloro- |
126987 | 2-Propenenitrile, 2-methyl- |
9003547 | 2-Propenenitrile, polymer with ethenylbenzene |
12751507 | 2-Propenenitrile, polymer with ethenylbenzene |
37345407 | 2-Propenenitrile, polymer with ethenylbenzene |
52434272 | 2-Propenenitrile, polymer with ethenylbenzene |
74238907 | 2-Propenenitrile, polymer with ethenylbenzene |
75977956 | 2-Propenenitrile, polymer with ethenylbenzene |
94362740 | 2-Propenenitrile, polymer with ethenylbenzene |
113007571 | 2-Propenenitrile, polymer with ethenylbenzene |
125805905 | 2-Propenenitrile, polymer with ethenylbenzene |
151165116 | 2-Propenenitrile, polymer with ethenylbenzene |
199128353 | 2-Propenenitrile, polymer with ethenylbenzene |
287390663 | 2-Propenenitrile, polymer with ethenylbenzene |
578006958 | 2-Propenenitrile, polymer with ethenylbenzene |
1201851684 | 2-Propenenitrile, polymer with ethenylbenzene |
79107 | 2-Propenoic acid |
55927872 | 2-Propenoic acid |
1265528537 | 2-Propenoic acid |
1453489990 | 2-Propenoic acid |
19900460 | 2-Propenoic acid, (2-methyloxiranyl)methyl ester |
13048334 | 2-Propenoic acid, 1,1'-(1,6-hexanediyl) ester |
74872030 | 2-Propenoic acid, 1,1'-(1,6-hexanediyl) ester |
88250322 | 2-Propenoic acid, 1,1'-(1,6-hexanediyl) ester |
106717060 | 2-Propenoic acid, 1,1'-(1,6-hexanediyl) ester |
126038899 | 2-Propenoic acid, 1,1'-(1,6-hexanediyl) ester |
174845659 | 2-Propenoic acid, 1,1'-(1,6-hexanediyl) ester |
181826084 | 2-Propenoic acid, 1,1'-(1,6-hexanediyl) ester |
198694767 | 2-Propenoic acid, 1,1'-(1,6-hexanediyl) ester |
671774757 | 2-Propenoic acid, 1,1'-(1,6-hexanediyl) ester |
1220287864 | 2-Propenoic acid, 1,1'-(1,6-hexanediyl) ester |
2223827 | 2-Propenoic acid, 1,1'-(2,2-dimethyl-1,3-propanediyl) ester |
95576402 | 2-Propenoic acid, 1,1'-(2,2-dimethyl-1,3-propanediyl) ester |
127194972 | 2-Propenoic acid, 1,1'-(2,2-dimethyl-1,3-propanediyl) ester |
3524683 | 2-Propenoic acid, 1,1'-[2-(hydroxymethyl)-2-[[(1-oxo-2-propen-1-yl)oxy]methyl]-1,3-propanediyl] ester |
85205487 | 2-Propenoic acid, 1,1'-[2-(hydroxymethyl)-2-[[(1-oxo-2-propen-1-yl)oxy]methyl]-1,3-propanediyl] ester |
89900196 | 2-Propenoic acid, 1,1'-[2-(hydroxymethyl)-2-[[(1-oxo-2-propen-1-yl)oxy]methyl]-1,3-propanediyl] ester |
98036341 | 2-Propenoic acid, 1,1'-[2-(hydroxymethyl)-2-[[(1-oxo-2-propen-1-yl)oxy]methyl]-1,3-propanediyl] ester |
98866069 | 2-Propenoic acid, 1,1'-[2-(hydroxymethyl)-2-[[(1-oxo-2-propen-1-yl)oxy]methyl]-1,3-propanediyl] ester |
162774836 | 2-Propenoic acid, 1,1'-[2-(hydroxymethyl)-2-[[(1-oxo-2-propen-1-yl)oxy]methyl]-1,3-propanediyl] ester |
204270199 | 2-Propenoic acid, 1,1'-[2-(hydroxymethyl)-2-[[(1-oxo-2-propen-1-yl)oxy]methyl]-1,3-propanediyl] ester |
364365311 | 2-Propenoic acid, 1,1'-[2-(hydroxymethyl)-2-[[(1-oxo-2-propen-1-yl)oxy]methyl]-1,3-propanediyl] ester |
406935453 | 2-Propenoic acid, 1,1'-[2-(hydroxymethyl)-2-[[(1-oxo-2-propen-1-yl)oxy]methyl]-1,3-propanediyl] ester |
912677420 | 2-Propenoic acid, 1,1'-[2-(hydroxymethyl)-2-[[(1-oxo-2-propen-1-yl)oxy]methyl]-1,3-propanediyl] ester |
1063995981 | 2-Propenoic acid, 1,1'-[2-(hydroxymethyl)-2-[[(1-oxo-2-propen-1-yl)oxy]methyl]-1,3-propanediyl] ester |
1174502545 | 2-Propenoic acid, 1,1'-[2-(hydroxymethyl)-2-[[(1-oxo-2-propen-1-yl)oxy]methyl]-1,3-propanediyl] ester |
17831719 | 2-Propenoic acid, 1,1'-[oxybis(2,1-ethanediyloxy-2,1-ethanediyl)] ester |
62181219 | 2-Propenoic acid, 1,1'-[oxybis(2,1-ethanediyloxy-2,1-ethanediyl)] ester |
108136501 | 2-Propenoic acid, 1,1'-[oxybis(2,1-ethanediyloxy-2,1-ethanediyl)] ester |
19660163 | 2-Propenoic acid, 2,3-dibromopropyl ester |
2439352 | 2-Propenoic acid, 2-(dimethylamino)ethyl ester |
202667605 | 2-Propenoic acid, 2-(dimethylamino)ethyl ester |
254887688 | 2-Propenoic acid, 2-(dimethylamino)ethyl ester |
4823476 | 2-Propenoic acid, 2-bromoethyl ester |
2206895 | 2-Propenoic acid, 2-chloroethyl ester |
137053 | 2-Propenoic acid, 2-cyano-, methyl ester |
12790657 | 2-Propenoic acid, 2-cyano-, methyl ester |
53028652 | 2-Propenoic acid, 2-cyano-, methyl ester |
118232590 | 2-Propenoic acid, 2-cyano-, methyl ester |
6197304 | 2-Propenoic acid, 2-cyano-3,3-diphenyl-, 2-ethylhexyl ester |
80135315 | 2-Propenoic acid, 2-cyano-3,3-diphenyl-, 2-ethylhexyl ester |
149984838 | 2-Propenoic acid, 2-cyano-3,3-diphenyl-, 2-ethylhexyl ester |
194304331 | 2-Propenoic acid, 2-cyano-3,3-diphenyl-, 2-ethylhexyl ester |
103117 | 2-Propenoic acid, 2-ethylhexyl ester |
78733321 | 2-Propenoic acid, 2-ethylhexyl ester |
84948572 | 2-Propenoic acid, 2-ethylhexyl ester |
93460776 | 2-Propenoic acid, 2-ethylhexyl ester |
126830022 | 2-Propenoic acid, 2-ethylhexyl ester |
1329996895 | 2-Propenoic acid, 2-ethylhexyl ester |
1453489978 | 2-Propenoic acid, 2-ethylhexyl ester |
999611 | 2-Propenoic acid, 2-hydroxypropyl ester |
91029980 | 2-Propenoic acid, 2-hydroxypropyl ester |
79414 | 2-Propenoic acid, 2-methyl- |
463311957 | 2-Propenoic acid, 2-methyl- |
562836844 | 2-Propenoic acid, 2-methyl- |
1338439169 | 2-Propenoic acid, 2-methyl- |
4655349 | 2-Propenoic acid, 2-methyl-, 1-methylethyl ester |
3066704 | 2-Propenoic acid, 2-methyl-, 2,3-dibromopropyl ester |
5001876 | 2-Propenoic acid, 2-methyl-, 2-isocyanatoethyl ester |
30674807 | 2-Propenoic acid, 2-methyl-, 2-isocyanatoethyl ester |
1426396975 | 2-Propenoic acid, 2-methyl-, 2-isocyanatoethyl ester |
97869 | 2-Propenoic acid, 2-methyl-, 2-methylpropyl ester |
266675132 | 2-Propenoic acid, 2-methyl-, 2-methylpropyl ester |
106912 | 2-Propenoic acid, 2-methyl-, 2-oxiranylmethyl ester |
55279884 | 2-Propenoic acid, 2-methyl-, 2-oxiranylmethyl ester |
89678751 | 2-Propenoic acid, 2-methyl-, 2-oxiranylmethyl ester |
96778028 | 2-Propenoic acid, 2-methyl-, 2-oxiranylmethyl ester |
98104939 | 2-Propenoic acid, 2-methyl-, 2-oxiranylmethyl ester |
117955245 | 2-Propenoic acid, 2-methyl-, 2-oxiranylmethyl ester |
122785802 | 2-Propenoic acid, 2-methyl-, 2-oxiranylmethyl ester |
126872193 | 2-Propenoic acid, 2-methyl-, 2-oxiranylmethyl ester |
169957953 | 2-Propenoic acid, 2-methyl-, 2-oxiranylmethyl ester |
201732550 | 2-Propenoic acid, 2-methyl-, 2-oxiranylmethyl ester |
202149120 | 2-Propenoic acid, 2-methyl-, 2-oxiranylmethyl ester |
203300269 | 2-Propenoic acid, 2-methyl-, 2-oxiranylmethyl ester |
210093724 | 2-Propenoic acid, 2-methyl-, 2-oxiranylmethyl ester |
865699838 | 2-Propenoic acid, 2-methyl-, 2-oxiranylmethyl ester |
1451188707 | 2-Propenoic acid, 2-methyl-, 2-oxiranylmethyl ester |
2530850 | 2-Propenoic acid, 2-methyl-, 3-(trimethoxysilyl)propyl ester |
65323946 | 2-Propenoic acid, 2-methyl-, 3-(trimethoxysilyl)propyl ester |
65323957 | 2-Propenoic acid, 2-methyl-, 3-(trimethoxysilyl)propyl ester |
65324723 | 2-Propenoic acid, 2-methyl-, 3-(trimethoxysilyl)propyl ester |
66796201 | 2-Propenoic acid, 2-methyl-, 3-(trimethoxysilyl)propyl ester |
72779681 | 2-Propenoic acid, 2-methyl-, 3-(trimethoxysilyl)propyl ester |
79642981 | 2-Propenoic acid, 2-methyl-, 3-(trimethoxysilyl)propyl ester |
82658671 | 2-Propenoic acid, 2-methyl-, 3-(trimethoxysilyl)propyl ester |
85256866 | 2-Propenoic acid, 2-methyl-, 3-(trimethoxysilyl)propyl ester |
96353412 | 2-Propenoic acid, 2-methyl-, 3-(trimethoxysilyl)propyl ester |
100662144 | 2-Propenoic acid, 2-methyl-, 3-(trimethoxysilyl)propyl ester |
114266329 | 2-Propenoic acid, 2-methyl-, 3-(trimethoxysilyl)propyl ester |
201732583 | 2-Propenoic acid, 2-methyl-, 3-(trimethoxysilyl)propyl ester |
834889155 | 2-Propenoic acid, 2-methyl-, 3-(trimethoxysilyl)propyl ester |
1246811880 | 2-Propenoic acid, 2-methyl-, 3-(trimethoxysilyl)propyl ester |
97881 | 2-Propenoic acid, 2-methyl-, butyl ester |
55922775 | 2-Propenoic acid, 2-methyl-, butyl ester |
159172357 | 2-Propenoic acid, 2-methyl-, butyl ester |
1151915977 | 2-Propenoic acid, 2-methyl-, butyl ester |
1310566972 | 2-Propenoic acid, 2-methyl-, butyl ester |
1343477791 | 2-Propenoic acid, 2-methyl-, butyl ester |
3179473 | 2-Propenoic acid, 2-methyl-, decyl ester |
97632 | 2-Propenoic acid, 2-methyl-, ethyl ester |
142096 | 2-Propenoic acid, 2-methyl-, hexyl ester |
25087267 | 2-Propenoic acid, 2-methyl-, homopolymer |
30679051 | 2-Propenoic acid, 2-methyl-, homopolymer |
115708684 | 2-Propenoic acid, 2-methyl-, homopolymer |
152834816 | 2-Propenoic acid, 2-methyl-, homopolymer |
152834827 | 2-Propenoic acid, 2-methyl-, homopolymer |
155686809 | 2-Propenoic acid, 2-methyl-, homopolymer |
155686810 | 2-Propenoic acid, 2-methyl-, homopolymer |
186901871 | 2-Propenoic acid, 2-methyl-, homopolymer |
336176024 | 2-Propenoic acid, 2-methyl-, homopolymer |
29964849 | 2-Propenoic acid, 2-methyl-, isodecyl ester |
32242107 | 2-Propenoic acid, 2-methyl-, isodecyl ester |
62649734 | 2-Propenoic acid, 2-methyl-, isodecyl ester |
78747496 | 2-Propenoic acid, 2-methyl-, isodecyl ester |
107314103 | 2-Propenoic acid, 2-methyl-, isodecyl ester |
884998065 | 2-Propenoic acid, 2-methyl-, isodecyl ester |
80626 | 2-Propenoic acid, 2-methyl-, methyl ester |
162221547 | 2-Propenoic acid, 2-methyl-, methyl ester |
220713326 | 2-Propenoic acid, 2-methyl-, methyl ester |
874217137 | 2-Propenoic acid, 2-methyl-, methyl ester |
1196968394 | 2-Propenoic acid, 2-methyl-, methyl ester |
1227277873 | 2-Propenoic acid, 2-methyl-, methyl ester |
9011147 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
9011738 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
9063483 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
37206272 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
37243531 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
37260201 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
37317207 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
37329990 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
37348713 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
37383747 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
39307023 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
39307034 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
39316502 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
39404541 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
41354829 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
41354830 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
41354841 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
42617050 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
51004990 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
52051986 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
52254098 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
53148928 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
53637324 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
53663631 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
53988855 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
54018507 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
54242523 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
55802921 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
55819460 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
57455955 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
57460147 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
57608329 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
57829160 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
57881751 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
58057151 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
58968506 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
58968517 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
59355827 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
59519936 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
61642691 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
61642704 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
63454831 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
67167424 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
69071176 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
70226469 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
70816476 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
72270101 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
72394219 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
72626030 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
73019882 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
74239455 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
74871037 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
75831684 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
76559665 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
77751167 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
78206732 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
78207235 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
78590859 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
80209570 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
80619687 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
83764378 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
86438940 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
87210320 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
88528614 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
88813803 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
90092823 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
90248990 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
94469086 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
95567241 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
95918302 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
96420950 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
98825300 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
99550364 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
103220639 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
105417821 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
106008780 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
106440599 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
110617099 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
110866518 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
113041331 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
113096369 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
114512639 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
114558188 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
115165769 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
115190040 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
115252352 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
116189914 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
122463541 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
122525411 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
123611483 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
123897621 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
124181993 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
126482573 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
128151871 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
128417834 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
130123998 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
130243037 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
131463020 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
131831566 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
132694623 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
134490645 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
137012636 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
138185305 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
138186024 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
141911571 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
143476919 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
144747159 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
146909333 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
148092404 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
155123403 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
155197469 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
155421399 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
157090385 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
158319041 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
160170945 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
161740994 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
161755868 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
161776438 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
170905972 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
170906204 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
171022074 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
171040509 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
171970802 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
176366033 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
179530268 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
183131104 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
183325793 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
189021270 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
191551107 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
192464918 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
195009315 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
196623673 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
198292761 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
201948336 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
202289621 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
203526743 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
203665525 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
205599742 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
210823975 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
212624685 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
220286919 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
225105964 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
245346809 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
281223345 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
288264324 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
292865408 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
292865419 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
296786066 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
302571626 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
303190694 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
304916254 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
304916265 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
304916287 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
308276893 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
331443380 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
416900033 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
429685096 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
444904476 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
446263190 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
478957914 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
483278406 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
487021454 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
487021476 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
487021487 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
501120974 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
501645983 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
627538969 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
682813361 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
864969700 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
865348932 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
869186754 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
871813568 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
887401038 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
888615563 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
890935361 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
890935372 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
948029821 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
948310790 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
952661379 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
1044505998 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
1045710277 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
1059626946 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
1093414482 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
1182269959 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
1204590237 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
1256366047 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
1292307415 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
1307225984 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
1337906009 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
1350742958 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
1354782141 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
1425464385 | 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer |
2157019 | 2-Propenoic acid, 2-methyl-, octyl ester |
2210288 | 2-Propenoic acid, 2-methyl-, propyl ester |
30110613 | 2-Propenoic acid, 2-methyl-, propyl ester |
2155706 | 2-Propenoic acid, 2-methyl-, tributylstannyl ester |
154194726 | 2-Propenoic acid, 2-methyl-, tributylstannyl ester |
106638 | 2-Propenoic acid, 2-methylpropyl ester |
1401517007 | 2-Propenoic acid, 2-methylpropyl ester |
106901 | 2-Propenoic acid, 2-oxiranylmethyl ester |
69960652 | 2-Propenoic acid, 2-oxiranylmethyl ester |
70404761 | 2-Propenoic acid, 2-oxiranylmethyl ester |
130232450 | 2-Propenoic acid, 2-oxiranylmethyl ester |
999553 | 2-Propenoic acid, 2-propen-1-yl ester |
104289 | 2-Propenoic acid, 3-(4-methoxyphenyl)-, 2-ethoxyethyl ester |
1322652 | 2-Propenoic acid, 3-(4-methoxyphenyl)-, 2-ethoxyethyl ester |
5466773 | 2-Propenoic acid, 3-(4-methoxyphenyl)-, 2-ethylhexyl ester |
155867042 | 2-Propenoic acid, 3-(4-methoxyphenyl)-, 2-ethylhexyl ester |
1202568704 | 2-Propenoic acid, 3-(4-methoxyphenyl)-, 2-ethylhexyl ester |
2863947 | 2-Propenoic acid, 3-[4-[(E)-[(4-ethoxyphenyl)methylene]amino]phenyl]-, ethyl ester, (2E)- |
24140305 | 2-Propenoic acid, 3-[4-[(E)-[(4-methoxyphenyl)methylene]amino]phenyl]-, (2S)-2-methylbutyl ester, (2E)- |
140322 | 2-Propenoic acid, butyl ester |
141322 | 2-Propenoic acid, butyl ester |
126492544 | 2-Propenoic acid, butyl ester |
220713315 | 2-Propenoic acid, butyl ester |
1453490099 | 2-Propenoic acid, butyl ester |
140885 | 2-Propenoic acid, ethyl ester |
1441020412 | 2-Propenoic acid, ethyl ester |
9003014 | 2-Propenoic acid, homopolymer |
11132697 | 2-Propenoic acid, homopolymer |
37241239 | 2-Propenoic acid, homopolymer |
39341225 | 2-Propenoic acid, homopolymer |
51142257 | 2-Propenoic acid, homopolymer |
54578448 | 2-Propenoic acid, homopolymer |
54990828 | 2-Propenoic acid, homopolymer |
56747650 | 2-Propenoic acid, homopolymer |
59233191 | 2-Propenoic acid, homopolymer |
65742167 | 2-Propenoic acid, homopolymer |
71767276 | 2-Propenoic acid, homopolymer |
71767287 | 2-Propenoic acid, homopolymer |
81031529 | 2-Propenoic acid, homopolymer |
82446455 | 2-Propenoic acid, homopolymer |
82446466 | 2-Propenoic acid, homopolymer |
87913028 | 2-Propenoic acid, homopolymer |
88650899 | 2-Propenoic acid, homopolymer |
101360150 | 2-Propenoic acid, homopolymer |
104625856 | 2-Propenoic acid, homopolymer |
104922396 | 2-Propenoic acid, homopolymer |
105913471 | 2-Propenoic acid, homopolymer |
118168846 | 2-Propenoic acid, homopolymer |
125857683 | 2-Propenoic acid, homopolymer |
125857694 | 2-Propenoic acid, homopolymer |
131094478 | 2-Propenoic acid, homopolymer |
165724083 | 2-Propenoic acid, homopolymer |
168564565 | 2-Propenoic acid, homopolymer |
169799284 | 2-Propenoic acid, homopolymer |
170473899 | 2-Propenoic acid, homopolymer |
174594093 | 2-Propenoic acid, homopolymer |
223508972 | 2-Propenoic acid, homopolymer |
230287431 | 2-Propenoic acid, homopolymer |
471251420 | 2-Propenoic acid, homopolymer |
597551810 | 2-Propenoic acid, homopolymer |
746620962 | 2-Propenoic acid, homopolymer |
746620984 | 2-Propenoic acid, homopolymer |
925683303 | 2-Propenoic acid, homopolymer |
1243262396 | 2-Propenoic acid, homopolymer |
1422717483 | 2-Propenoic acid, homopolymer |
8049783 | 2-Propenoic acid, homopolymer, sodium salt |
9003047 | 2-Propenoic acid, homopolymer, sodium salt |
9080357 | 2-Propenoic acid, homopolymer, sodium salt |
25052793 | 2-Propenoic acid, homopolymer, sodium salt |
39283051 | 2-Propenoic acid, homopolymer, sodium salt |
39301036 | 2-Propenoic acid, homopolymer, sodium salt |
56048090 | 2-Propenoic acid, homopolymer, sodium salt |
63993691 | 2-Propenoic acid, homopolymer, sodium salt |
64441469 | 2-Propenoic acid, homopolymer, sodium salt |
67017214 | 2-Propenoic acid, homopolymer, sodium salt |
67167128 | 2-Propenoic acid, homopolymer, sodium salt |
72870554 | 2-Propenoic acid, homopolymer, sodium salt |
75718671 | 2-Propenoic acid, homopolymer, sodium salt |
76559778 | 2-Propenoic acid, homopolymer, sodium salt |
77847768 | 2-Propenoic acid, homopolymer, sodium salt |
83856160 | 2-Propenoic acid, homopolymer, sodium salt |
84420202 | 2-Propenoic acid, homopolymer, sodium salt |
87210284 | 2-Propenoic acid, homopolymer, sodium salt |
87912581 | 2-Propenoic acid, homopolymer, sodium salt |
88402975 | 2-Propenoic acid, homopolymer, sodium salt |
88650719 | 2-Propenoic acid, homopolymer, sodium salt |
88895334 | 2-Propenoic acid, homopolymer, sodium salt |
95077682 | 2-Propenoic acid, homopolymer, sodium salt |
100359373 | 2-Propenoic acid, homopolymer, sodium salt |
111642661 | 2-Propenoic acid, homopolymer, sodium salt |
113536699 | 2-Propenoic acid, homopolymer, sodium salt |
114355167 | 2-Propenoic acid, homopolymer, sodium salt |
118215911 | 2-Propenoic acid, homopolymer, sodium salt |
123140089 | 2-Propenoic acid, homopolymer, sodium salt |
129979040 | 2-Propenoic acid, homopolymer, sodium salt |
135842818 | 2-Propenoic acid, homopolymer, sodium salt |
136303349 | 2-Propenoic acid, homopolymer, sodium salt |
136753349 | 2-Propenoic acid, homopolymer, sodium salt |
162122625 | 2-Propenoic acid, homopolymer, sodium salt |
162730952 | 2-Propenoic acid, homopolymer, sodium salt |
179045966 | 2-Propenoic acid, homopolymer, sodium salt |
183599077 | 2-Propenoic acid, homopolymer, sodium salt |
187758129 | 2-Propenoic acid, homopolymer, sodium salt |
188899798 | 2-Propenoic acid, homopolymer, sodium salt |
200444333 | 2-Propenoic acid, homopolymer, sodium salt |
202833485 | 2-Propenoic acid, homopolymer, sodium salt |
204720025 | 2-Propenoic acid, homopolymer, sodium salt |
208472202 | 2-Propenoic acid, homopolymer, sodium salt |
216973410 | 2-Propenoic acid, homopolymer, sodium salt |
218949134 | 2-Propenoic acid, homopolymer, sodium salt |
227796205 | 2-Propenoic acid, homopolymer, sodium salt |
302578069 | 2-Propenoic acid, homopolymer, sodium salt |
313991503 | 2-Propenoic acid, homopolymer, sodium salt |
318474247 | 2-Propenoic acid, homopolymer, sodium salt |
351210032 | 2-Propenoic acid, homopolymer, sodium salt |
441742581 | 2-Propenoic acid, homopolymer, sodium salt |
444573459 | 2-Propenoic acid, homopolymer, sodium salt |
551943147 | 2-Propenoic acid, homopolymer, sodium salt |
871118013 | 2-Propenoic acid, homopolymer, sodium salt |
1101133441 | 2-Propenoic acid, homopolymer, sodium salt |
1152316374 | 2-Propenoic acid, homopolymer, sodium salt |
1421768311 | 2-Propenoic acid, homopolymer, sodium salt |
96333 | 2-Propenoic acid, methyl ester |
102256291 | 2-Propenoic acid, methyl ester |
1254182698 | 2-Propenoic acid, methyl ester |
814686 | 2-Propenoyl chloride |
107197 | 2-Propyn-1-ol |
139402 | 2-Propyn-1-ol |
2216946 | 2-Propynoic acid, 3-phenyl-, ethyl ester |
98964 | 2-Pyrazinecarboxamide |
504290 | 2-Pyridinamine |
509290 | 2-Pyridinamine |
29212315 | 2-Pyridinamine |
45505677 | 2-Pyridinamine |
102769744 | 2-Pyridinamine |
17433317 | 2-Pyridinecarboxylic acid, 2-acetylhydrazide |
1918021 | 2-Pyridinecarboxylic acid, 4-amino-3,5,6-trichloro- |
132229 | 2-Pyridinepropanamine, .gamma.-(4-chlorophenyl)-N,N-dimethyl- |
42882962 | 2-Pyridinepropanamine, .gamma.-(4-chlorophenyl)-N,N-dimethyl- |
46970450 | 2-Pyridinepropanamine, .gamma.-(4-chlorophenyl)-N,N-dimethyl- |
113928 | 2-Pyridinepropanamine, .gamma.-(4-chlorophenyl)-N,N-dimethyl-, (2Z)-2-butenedioate (1:1) |
7054117 | 2-Pyridinepropanamine, .gamma.-(4-chlorophenyl)-N,N-dimethyl-, (2Z)-2-butenedioate (1:1) |
132207 | 2-Pyridinepropanamine, N,N-dimethyl-.gamma.-phenyl-, (2Z)-2-butenedioate (1:1) |
155683117 | 2-Pyridinepropanamine, N,N-dimethyl-.gamma.-phenyl-, (2Z)-2-butenedioate (1:1) |
9003398 | 2-Pyrrolidinone, 1-ethenyl-, homopolymer |
9015627 | 2-Pyrrolidinone, 1-ethenyl-, homopolymer |
9080595 | 2-Pyrrolidinone, 1-ethenyl-, homopolymer |
29386945 | 2-Pyrrolidinone, 1-ethenyl-, homopolymer |
41724418 | 2-Pyrrolidinone, 1-ethenyl-, homopolymer |
53026736 | 2-Pyrrolidinone, 1-ethenyl-, homopolymer |
53026747 | 2-Pyrrolidinone, 1-ethenyl-, homopolymer |
53200274 | 2-Pyrrolidinone, 1-ethenyl-, homopolymer |
61932727 | 2-Pyrrolidinone, 1-ethenyl-, homopolymer |
65931568 | 2-Pyrrolidinone, 1-ethenyl-, homopolymer |
111214461 | 2-Pyrrolidinone, 1-ethenyl-, homopolymer |
116404616 | 2-Pyrrolidinone, 1-ethenyl-, homopolymer |
121414753 | 2-Pyrrolidinone, 1-ethenyl-, homopolymer |
132778042 | 2-Pyrrolidinone, 1-ethenyl-, homopolymer |
132778053 | 2-Pyrrolidinone, 1-ethenyl-, homopolymer |
132834209 | 2-Pyrrolidinone, 1-ethenyl-, homopolymer |
153631619 | 2-Pyrrolidinone, 1-ethenyl-, homopolymer |
170473902 | 2-Pyrrolidinone, 1-ethenyl-, homopolymer |
496908066 | 2-Pyrrolidinone, 1-ethenyl-, homopolymer |
730985601 | 2-Pyrrolidinone, 1-ethenyl-, homopolymer |
862983742 | 2-Pyrrolidinone, 1-ethenyl-, homopolymer |
1173909539 | 2-Pyrrolidinone, 1-ethenyl-, homopolymer |
1229193796 | 2-Pyrrolidinone, 1-ethenyl-, homopolymer |
1234714829 | 2-Pyrrolidinone, 1-ethenyl-, homopolymer |
1310675912 | 2-Pyrrolidinone, 1-ethenyl-, homopolymer |
1337987719 | 2-Pyrrolidinone, 1-ethenyl-, homopolymer |
1394151520 | 2-Pyrrolidinone, 1-ethenyl-, homopolymer |
1431958267 | 2-Pyrrolidinone, 1-ethenyl-, homopolymer |
872504 | 2-Pyrrolidinone, 1-methyl- |
26138589 | 2-Pyrrolidinone, 1-methyl- |
53774359 | 2-Pyrrolidinone, 1-methyl- |
57762466 | 2-Pyrrolidinone, 1-methyl- |
15569854 | 2-Pyrrolidinone, 1-methyl-5-(3-pyridinyl)- |
96504 | 2-Thiazolamine |
5654013 | 2-Thiazolamine |
58473793 | 2-Thiazolamine |
3882982 | 2-Thiazolamine, 4,5-dihydro-, monohydrochloride |
52253697 | 2-Thiazolamine, 4-phenyl-, monohydrobromide, monohydrate |
121664 | 2-Thiazolamine, 5-nitro- |
8017934 | 2-Thiazolamine, 5-nitro- |
8023005 | 2-Thiazolamine, 5-nitro- |
574936 | 29H,31H-Phthalocyanine |
2612546 | 29H,31H-Phthalocyanine |
4466642 | 29H,31H-Phthalocyanine |
52440514 | 29H,31H-Phthalocyanine |
81612160 | 29H,31H-Phthalocyanine |
162831665 | 29H,31H-Phthalocyanine |
889688862 | 29H,31H-Phthalocyanine |
303341 | 2?Butenoic acid, 2-methy-, (1S,7aR)-7-[[(2R)-2,3-dihydroxy-2-[(1S)-1-methoxyethyl]-3-methyl-1-oxobutoxy]methyl]-2,3,5,7a-tetrahydro-1H-ester, (2Z)- |
303344 | 2?Butenoic acid, 2-methy-, (1S,7aR)-7-[[(2R)-2,3-dihydroxy-2-[(1S)-1-methoxyethyl]-3-methyl-1-oxobutoxy]methyl]-2,3,5,7a-tetrahydro-1H-ester, (2Z)- |
58946 | 2H-1,2,4-Benzothiadiazine-7-sulfonamide, 6-chloro-, 1,1-dioxide |
58935 | 2H-1,2,4-Benzothiadiazine-7-sulfonamide, 6-chloro-3,4-dihydro-, 1,1-dioxide |
8049498 | 2H-1,2,4-Benzothiadiazine-7-sulfonamide, 6-chloro-3,4-dihydro-, 1,1-dioxide |
125727506 | 2H-1,2,4-Benzothiadiazine-7-sulfonamide, 6-chloro-3,4-dihydro-, 1,1-dioxide |
346189 | 2H-1,2,4-Benzothiadiazine-7-sulfonamide, 6-chloro-3,4-dihydro-2-methyl-3-[[(2,2,2-trifluoroethyl)thio]methyl]-, 1,1-dioxide (8CI, 9CI) |
50180 | 2H-1,3,2-Oxazaphosphorin-2-amine, N,N-bis(2-chloroethyl)tetrahydro-, 2-oxide |
60007956 | 2H-1,3,2-Oxazaphosphorin-2-amine, N,N-bis(2-chloroethyl)tetrahydro-, 2-oxide |
75526908 | 2H-1,3,2-Oxazaphosphorin-2-amine, N,N-bis(2-chloroethyl)tetrahydro-, 2-oxide |
533744 | 2H-1,3,5-Thiadiazine-2-thione, tetrahydro-3,5-dimethyl- |
55146106 | 2H-1,3,5-Thiadiazine-2-thione, tetrahydro-3,5-dimethyl- |
1135442806 | 2H-1,3,5-Thiadiazine-2-thione, tetrahydro-3,5-dimethyl- |
53404607 | 2H-1,3,5-Thiadiazine-2-thione, tetrahydro-3,5-dimethyl-, ion(1-), sodium |
439145 | 2H-1,4-Benzodiazepin-2-one, 7-chloro-1,3-dihydro-1-methyl-5-phenyl- |
11100371 | 2H-1,4-Benzodiazepin-2-one, 7-chloro-1,3-dihydro-1-methyl-5-phenyl- |
53320846 | 2H-1,4-Benzodiazepin-2-one, 7-chloro-1,3-dihydro-1-methyl-5-phenyl- |
846491 | 2H-1,4-Benzodiazepin-2-one, 7-chloro-5-(2-chlorophenyl)-1,3-dihydro-3-hydroxy- |
91645 | 2H-1-Benzopyran-2-one |
119846 | 2H-1-Benzopyran-2-one, 3,4-dihydro- |
1341362 | 2H-1-Benzopyran-2-one, 3,4-dihydro- |
28772567 | 2H-1-Benzopyran-2-one, 3-[3-(4'-bromo[1,1'-biphenyl]-4-yl)-3-hydroxy-1-phenylpropyl]-4-hydroxy- |
5836293 | 2H-1-Benzopyran-2-one, 4-hydroxy-3-(1,2,3,4-tetrahydro-1-naphthalenyl)- |
81812 | 2H-1-Benzopyran-2-one, 4-hydroxy-3-(3-oxo-1-phenylbutyl)- |
5543566 | 2H-1-Benzopyran-2-one, 4-hydroxy-3-(3-oxo-1-phenylbutyl)- |
56573898 | 2H-1-Benzopyran-2-one, 4-hydroxy-3-(3-oxo-1-phenylbutyl)- |
81812 | 2H-1-Benzopyran-2-one, 4-hydroxy-3-(3-oxo-1-phenylbutyl)-, and salts |
129066 | 2H-1-Benzopyran-2-one, 4-hydroxy-3-(3-oxo-1-phenylbutyl)-, sodium salt (1:1) |
12795550 | 2H-1-Benzopyran-2-one, 4-hydroxy-3-(3-oxo-1-phenylbutyl)-, sodium salt (1:1) |
51821819 | 2H-1-Benzopyran-2-one, 4-hydroxy-3-(3-oxo-1-phenylbutyl)-, sodium salt (1:1) |
859043622 | 2H-1-Benzopyran-2-one, 4-hydroxy-3-(3-oxo-1-phenylbutyl)-, sodium salt (1:1) |
2107768 | 2H-1-Benzopyran-2-one, 5,7-dihydroxy-4-methyl- |
92488 | 2H-1-Benzopyran-2-one, 6-methyl- |
91441 | 2H-1-Benzopyran-2-one, 7-(diethylamino)-4-methyl- |
11118211 | 2H-1-Benzopyran-2-one, 7-(diethylamino)-4-methyl- |
12224032 | 2H-1-Benzopyran-2-one, 7-(diethylamino)-4-methyl- |
12651353 | 2H-1-Benzopyran-2-one, 7-(diethylamino)-4-methyl- |
52232209 | 2H-1-Benzopyran-2-one, 7-(diethylamino)-4-methyl- |
58694556 | 2H-1-Benzopyran-2-one, 7-(diethylamino)-4-methyl- |
61968716 | 2H-1-Benzopyran-2-one, 7-(diethylamino)-4-methyl- |
70726420 | 2H-1-Benzopyran-2-one, 7-(diethylamino)-4-methyl- |
71123712 | 2H-1-Benzopyran-2-one, 7-(diethylamino)-4-methyl- |
73201226 | 2H-1-Benzopyran-2-one, 7-(diethylamino)-4-methyl- |
74029280 | 2H-1-Benzopyran-2-one, 7-(diethylamino)-4-methyl- |
86090688 | 2H-1-Benzopyran-2-one, 7-(diethylamino)-4-methyl- |
96538191 | 2H-1-Benzopyran-2-one, 7-(diethylamino)-4-methyl- |
129038922 | 2H-1-Benzopyran-2-one, 7-(diethylamino)-4-methyl- |
1215069650 | 2H-1-Benzopyran-2-one, 7-(diethylamino)-4-methyl- |
90335 | 2H-1-Benzopyran-2-one, 7-hydroxy-4-methyl- |
56275297 | 2H-1-Benzopyran-2-one, 7-hydroxy-4-methyl- |
58957 | 2H-1-Benzopyran-6-ol, 3,4-dihydro-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-, 6-acetate, (2R)- |
1406708 | 2H-1-Benzopyran-6-ol, 3,4-dihydro-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-, 6-acetate, (2R)- |
12741003 | 2H-1-Benzopyran-6-ol, 3,4-dihydro-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-, 6-acetate, (2R)- |
26243958 | 2H-1-Benzopyran-6-ol, 3,4-dihydro-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-, 6-acetate, (2R)- |
105602 | 2H-Azepin-2-one, hexahydro- |
2953039 | 2H-Azepin-2-one, hexahydro- |
32838214 | 2H-Azepin-2-one, hexahydro- |
32838236 | 2H-Azepin-2-one, hexahydro- |
34876181 | 2H-Azepin-2-one, hexahydro- |
117955369 | 2H-Azepin-2-one, hexahydro- |
168214286 | 2H-Azepin-2-one, hexahydro- |
583391 | 2H-Benzimidazole-2-thione, 1,3-dihydro- |
2080593 | 2H-Benzimidazole-2-thione, 1,3-dihydro- |
2254593 | 2H-Benzimidazole-2-thione, 1,3-dihydro- |
12640356 | 2H-Benzimidazole-2-thione, 1,3-dihydro- |
49608675 | 2H-Benzimidazole-2-thione, 1,3-dihydro- |
98443733 | 2H-Benzimidazole-2-thione, 1,3-dihydro- |
124449021 | 2H-Benzimidazole-2-thione, 1,3-dihydro- |
134469071 | 2H-Benzimidazole-2-thione, 1,3-dihydro- |
138464558 | 2H-Benzimidazole-2-thione, 1,3-dihydro- |
316427 | 2H-Benzo[a]quinolizine, 3-ethyl-1,3,4,6,7,11b-hexahydro-9,10-dimethoxy-2-[[(1R)-1,2,3,4-tetrahydro-6,7-dimethoxy-1-isoquinolinyl]methyl]-, hydrochloride (1:2), (2S,3R,11bS)- |
73459037 | 2H-Furo[2,3-h]-1-benzopyran-2-one, 5-methyl- |
4418262 | 2H-Pyran-2,4(3H)-dione, 3-acetyl-6-methyl-, ion(1-), sodium (1:1) |
6381846 | 2H-Pyran-2,4(3H)-dione, 3-acetyl-6-methyl-, ion(1-), sodium (1:1) |
20330103 | 2H-Pyran-2,4(3H)-dione, 3-acetyl-6-methyl-, ion(1-), sodium (1:1) |
56172680 | 2H-Pyran-2,4(3H)-dione, 3-acetyl-6-methyl-, ion(1-), sodium (1:1) |
71756279 | 2H-Pyran-2,4(3H)-dione, 3-acetyl-6-methyl-, ion(1-), sodium (1:1) |
74240247 | 2H-Pyran-2,4(3H)-dione, 3-acetyl-6-methyl-, ion(1-), sodium (1:1) |
78891904 | 2H-Pyran-2,4(3H)-dione, 3-acetyl-6-methyl-, ion(1-), sodium (1:1) |
1003072 | 3(2H)-Isothiazolone |
12673722 | 3(2H)-Isothiazolone, 2-octyl- |
26530201 | 3(2H)-Isothiazolone, 2-octyl- |
53028823 | 3(2H)-Isothiazolone, 2-octyl- |
122667236 | 3(2H)-Isothiazolone, 2-octyl- |
245125706 | 3(2H)-Isothiazolone, 2-octyl- |
249757593 | 3(2H)-Isothiazolone, 2-octyl- |
1135442680 | 3(2H)-Isothiazolone, 2-octyl- |
2489103 | 3(2H)-Isoxazolone, 5-(aminomethyl)- |
2763964 | 3(2H)-Isoxazolone, 5-(aminomethyl)- |
12680385 | 3(2H)-Pyridazinone, 4-chloro-5-(methylamino)-2-[3-(trifluoromethyl)phenyl]- |
27314132 | 3(2H)-Pyridazinone, 4-chloro-5-(methylamino)-2-[3-(trifluoromethyl)phenyl]- |
4080313 | 3,5,7-Triaza-1-azoniatricyclo[3.3.1.13,7]decane, 1-(3-chloro-2-propen-1-yl)-, chloride (1:1) |
60789824 | 3,5,7-Triaza-1-azoniatricyclo[3.3.1.13,7]decane, 1-(3-chloro-2-propen-1-yl)-, chloride (1:1) |
103638295 | 3,5,7-Triaza-1-azoniatricyclo[3.3.1.13,7]decane, 1-(3-chloro-2-propen-1-yl)-, chloride (1:1) |
50339 | 3,5-Pyrazolidinedione, 4-butyl-1,2-diphenyl- |
4297921 | 3,5-Pyrazolidinedione, 4-butyl-1,2-diphenyl- |
21829254 | 3,5-Pyridinedicarboxylic acid, 1,4-dihydro-2,6-dimethyl-4-(2-nitrophenyl)-, dimethyl ester |
4067167 | 3,6,9,12-Tetraazatetradecane-1,14-diamine |
778592373 | 3,6,9,12-Tetraazatetradecane-1,14-diamine |
531737 | 3,6-Acridinediamine, dihydrochloride |
952238 | 3,6-Acridinediamine, monohydrochloride |
123331 | 3,6-Pyridazinedione, 1,2-dihydro- |
5425796 | 3,6-Pyridazinedione, 1,2-dihydro- |
10071133 | 3,6-Pyridazinedione, 1,2-dihydro- |
48100181 | 3,6-Pyridazinedione, 1,2-dihydro- |
66988327 | 3,6-Pyridazinedione, 1,2-dihydro- |
92335530 | 3,6-Pyridazinedione, 1,2-dihydro- |
220787042 | 3,6-Pyridazinedione, 1,2-dihydro- |
5716154 | 3,6-Pyridazinedione, 1,2-dihydro-, compd. with 2,2'-iminobis[ethanol] (1:1) |
17655220 | 3,6-Pyridazinedione, 1,2-dihydro-, compd. with 2,2'-iminobis[ethanol] (1:1) |
92335541 | 3,6-Pyridazinedione, 1,2-dihydro-, compd. with 2,2'-iminobis[ethanol] (1:1) |
128250102 | 3,6-Pyridazinedione, 1,2-dihydro-, compd. with 2,2'-iminobis[ethanol] (1:1) |
16655826 | 3,7-Benzofurandiol, 2,3-dihydro-2,2-dimethyl-, 7-(methylcarbamate) |
115184 | 3-Buten-2-ol, 2-methyl- |
78944 | 3-Buten-2-one |
3160370 | 3-Buten-2-one, 4-(1,3-benzodioxol-5-yl)- |
79776 | 3-Buten-2-one, 4-(2,6,6-trimethyl-1-cyclohexen-1-yl)-, (3E)- |
14901076 | 3-Buten-2-one, 4-(2,6,6-trimethyl-1-cyclohexen-1-yl)-, (3E)- |
1353674222 | 3-Buten-2-one, 4-(2,6,6-trimethyl-1-cyclohexen-1-yl)-, (3E)- |
623154 | 3-Buten-2-one, 4-(2-furanyl)- |
71496269 | 3-Buten-2-one, 4-(2-furanyl)- |
929900265 | 3-Buten-2-one, 4-(2-furanyl)- |
16529569 | 3-Butenenitrile, 2-methyl- |
98555 | 3-Cyclohexene-1-methanol, .alpha.,.alpha.,4-trimethyl- |
2438122 | 3-Cyclohexene-1-methanol, .alpha.,.alpha.,4-trimethyl- |
22347882 | 3-Cyclohexene-1-methanol, .alpha.,.alpha.,4-trimethyl- |
106354 | 3-Heptanone |
106683 | 3-Octanone |
541855 | 3-Octanone |
96220 | 3-Pentanone |
813445 | 3-Pentanone, 1,1,1,2,4,5,5,5-octafluoro-2,4-bis(trifluoromethyl)- |
141797 | 3-Penten-2-one, 4-methyl- |
4635874 | 3-Pentenenitrile |
603178 | 3-Phorbinepropanoic acid, 9-ethenyl-14-ethyl-21-(methoxycarbonyl)-4,8,13,18-tetramethyl-20-oxo-, (2E,7R,11R)-3,7,11,15-tetramethyl-2-hexadecen-1-yl ester, (3S,4S,21R)- |
15113356 | 3-Phorbinepropanoic acid, 9-ethenyl-14-ethyl-21-(methoxycarbonyl)-4,8,13,18-tetramethyl-20-oxo-, (2E,7R,11R)-3,7,11,15-tetramethyl-2-hexadecen-1-yl ester, (3S,4S,21R)- |
28553186 | 3-Phorbinepropanoic acid, 9-ethenyl-14-ethyl-21-(methoxycarbonyl)-4,8,13,18-tetramethyl-20-oxo-, (2E,7R,11R)-3,7,11,15-tetramethyl-2-hexadecen-1-yl ester, (3S,4S,21R)- |
37231519 | 3-Phorbinepropanoic acid, 9-ethenyl-14-ethyl-21-(methoxycarbonyl)-4,8,13,18-tetramethyl-20-oxo-, (2E,7R,11R)-3,7,11,15-tetramethyl-2-hexadecen-1-yl ester, (3S,4S,21R)- |
37281155 | 3-Phorbinepropanoic acid, 9-ethenyl-14-ethyl-21-(methoxycarbonyl)-4,8,13,18-tetramethyl-20-oxo-, (2E,7R,11R)-3,7,11,15-tetramethyl-2-hexadecen-1-yl ester, (3S,4S,21R)- |
37317898 | 3-Phorbinepropanoic acid, 9-ethenyl-14-ethyl-21-(methoxycarbonyl)-4,8,13,18-tetramethyl-20-oxo-, (2E,7R,11R)-3,7,11,15-tetramethyl-2-hexadecen-1-yl ester, (3S,4S,21R)- |
52118635 | 3-Phorbinepropanoic acid, 9-ethenyl-14-ethyl-21-(methoxycarbonyl)-4,8,13,18-tetramethyl-20-oxo-, (2E,7R,11R)-3,7,11,15-tetramethyl-2-hexadecen-1-yl ester, (3S,4S,21R)- |
100759862 | 3-Phorbinepropanoic acid, 9-ethenyl-14-ethyl-21-(methoxycarbonyl)-4,8,13,18-tetramethyl-20-oxo-, (2E,7R,11R)-3,7,11,15-tetramethyl-2-hexadecen-1-yl ester, (3S,4S,21R)- |
178157114 | 3-Phorbinepropanoic acid, 9-ethenyl-14-ethyl-21-(methoxycarbonyl)-4,8,13,18-tetramethyl-20-oxo-, (2E,7R,11R)-3,7,11,15-tetramethyl-2-hexadecen-1-yl ester, (3S,4S,21R)- |
98920 | 3-Pyridinecarboxamide |
37321145 | 3-Pyridinecarboxamide |
78731472 | 3-Pyridinecarboxamide |
123574630 | 3-Pyridinecarboxamide |
329895 | 3-Pyridinecarboxamide, 6-amino- |
59267 | 3-Pyridinecarboxamide, N,N-diethyl- |
438415 | 3H-1,4-Benzodiazepin-2-amine, 7-chloro-N-methyl-5-phenyl-, 4-oxide, monohydrochloride |
482893 | 3H-Indol-3-one, 2-(1,3-dihydro-3-oxo-2H-indol-2-ylidene)-1,2-dihydro- |
11129412 | 3H-Indol-3-one, 2-(1,3-dihydro-3-oxo-2H-indol-2-ylidene)-1,2-dihydro- |
12000747 | 3H-Indol-3-one, 2-(1,3-dihydro-3-oxo-2H-indol-2-ylidene)-1,2-dihydro- |
12626732 | 3H-Indol-3-one, 2-(1,3-dihydro-3-oxo-2H-indol-2-ylidene)-1,2-dihydro- |
93660981 | 3H-Indol-3-one, 2-(1,3-dihydro-3-oxo-2H-indol-2-ylidene)-1,2-dihydro- |
136797303 | 3H-Indol-3-one, 2-(1,3-dihydro-3-oxo-2H-indol-2-ylidene)-1,2-dihydro- |
210488463 | 3H-Indol-3-one, 2-(1,3-dihydro-3-oxo-2H-indol-2-ylidene)-1,2-dihydro- |
908005947 | 3H-Indol-3-one, 2-(1,3-dihydro-3-oxo-2H-indol-2-ylidene)-1,2-dihydro- |
1131642595 | 3H-Indol-3-one, 2-(1,3-dihydro-3-oxo-2H-indol-2-ylidene)-1,2-dihydro- |
89258 | 3H-Pyrazol-3-one, 2,4-dihydro-5-methyl-2-phenyl- |
12235584 | 3H-Pyrazol-3-one, 2,4-dihydro-5-methyl-2-phenyl- |
52224176 | 3H-Pyrazol-3-one, 2,4-dihydro-5-methyl-2-phenyl- |
62495970 | 3H-Pyrazol-3-one, 2,4-dihydro-5-methyl-2-phenyl- |
72134668 | 3H-Pyrazol-3-one, 2,4-dihydro-5-methyl-2-phenyl- |
115566831 | 3H-Pyrazol-3-one, 2,4-dihydro-5-methyl-2-phenyl- |
206195951 | 3H-Pyrazol-3-one, 2,4-dihydro-5-methyl-2-phenyl- |
58151 | 3H-Pyrazol-3-one, 4-(dimethylamino)-1,2-dihydro-1,5-dimethyl-2-phenyl- |
144574107 | 3H-Pyrazol-3-one, 4-(dimethylamino)-1,2-dihydro-1,5-dimethyl-2-phenyl- |
59756604 | 4(1H)-Pyridinone, 1-methyl-3-phenyl-5-[3-(trifluoromethyl)phenyl]- |
56042 | 4(1H)-Pyrimidinone, 2,3-dihydro-6-methyl-2-thioxo- |
1123100 | 4(1H)-Pyrimidinone, 2,3-dihydro-6-methyl-2-thioxo- |
31909189 | 4(1H)-Pyrimidinone, 2,3-dihydro-6-methyl-2-thioxo- |
91795776 | 4(1H)-Pyrimidinone, 2,3-dihydro-6-methyl-2-thioxo- |
51525 | 4(1H)-Pyrimidinone, 2,3-dihydro-6-propyl-2-thioxo- |
500505 | 4(1H)-Pyrimidinone, 2,3-dihydro-6-propyl-2-thioxo- |
1910425 | 4,4'-Bipyridinium, 1,1'-dimethyl- |
4685147 | 4,4'-Bipyridinium, 1,1'-dimethyl- |
116047100 | 4,4'-Bipyridinium, 1,1'-dimethyl- |
2074502 | 4,4'-Bipyridinium, 1,1'-dimethyl-, bis(methyl sulfate) |
1910425 | 4,4'-Bipyridinium, 1,1'-dimethyl-, dichloride |
3765784 | 4,4'-Bipyridinium, 1,1'-dimethyl-, dichloride |
57593745 | 4,4'-Bipyridinium, 1,1'-dimethyl-, dichloride |
65982505 | 4,4'-Bipyridinium, 1,1'-dimethyl-, dichloride |
136338653 | 4,4'-Bipyridinium, 1,1'-dimethyl-, dichloride |
205105686 | 4,4'-Bipyridinium, 1,1'-dimethyl-, dichloride |
247050573 | 4,4'-Bipyridinium, 1,1'-dimethyl-, dichloride |
947080 | 4,6(1H,5H)-Pyrimidinedione, 5-ethyldihydro-5-(1-methylpropyl)-2-thioxo-, monosodium salt |
125337 | 4,6(1H,5H)-Pyrimidinedione, 5-ethyldihydro-5-phenyl- |
24143699 | 4,7-Methano-1H-indene, 1,2,3,4,5,6,7,8,8-nonachloro-2,3,3a,4,7,7a-hexahydro-, (1.alpha.,2.beta.,3.alpha.,3a.alpha.,4.beta.,7.beta.,7a.alpha.)- |
29555440 | 4,7-Methano-1H-indene, 1,2,3,4,5,6,7,8,8-nonachloro-2,3,3a,4,7,7a-hexahydro-, (1.alpha.,2.beta.,3.alpha.,3a.alpha.,4.beta.,7.beta.,7a.alpha.)- |
39765805 | 4,7-Methano-1H-indene, 1,2,3,4,5,6,7,8,8-nonachloro-2,3,3a,4,7,7a-hexahydro-, (1.alpha.,2.beta.,3.alpha.,3a.alpha.,4.beta.,7.beta.,7a.alpha.)- |
57749 | 4,7-Methano-1H-indene, 1,2,4,5,6,7,8,8-octachloro-2,3,3a,4,7,7a-hexahydro- |
90437 | 4,7-Methano-1H-indene, 1,2,4,5,6,7,8,8-octachloro-2,3,3a,4,7,7a-hexahydro- |
115286 | 4,7-Methano-1H-indene, 1,2,4,5,6,7,8,8-octachloro-2,3,3a,4,7,7a-hexahydro- |
39400801 | 4,7-Methano-1H-indene, 1,2,4,5,6,7,8,8-octachloro-2,3,3a,4,7,7a-hexahydro- |
53637131 | 4,7-Methano-1H-indene, 1,2,4,5,6,7,8,8-octachloro-2,3,3a,4,7,7a-hexahydro- |
57749 | 4,7-Methano-1H-indene, 1,2,4,5,6,7,8,8-octachloro-2,3,3a,4,7,7a-hexahydro-, (1R,2S,3aS,4S,7R,7aS)-rel |
5103719 | 4,7-Methano-1H-indene, 1,2,4,5,6,7,8,8-octachloro-2,3,3a,4,7,7a-hexahydro-, (1R,2S,3aS,4S,7R,7aS)-rel |
22212528 | 4,7-Methano-1H-indene, 1,2,4,5,6,7,8,8-octachloro-2,3,3a,4,7,7a-hexahydro-, (1R,2S,3aS,4S,7R,7aS)-rel |
26703866 | 4,7-Methano-1H-indene, 1,2,4,5,6,7,8,8-octachloro-2,3,3a,4,7,7a-hexahydro-, (1R,2S,3aS,4S,7R,7aS)-rel |
28140467 | 4,7-Methano-1H-indene, 1,2,4,5,6,7,8,8-octachloro-2,3,3a,4,7,7a-hexahydro-, (1R,2S,3aS,4S,7R,7aS)-rel |
152322297 | 4,7-Methano-1H-indene, 1,2,4,5,6,7,8,8-octachloro-2,3,3a,4,7,7a-hexahydro-, (1R,2S,3aS,4S,7R,7aS)-rel |
76448 | 4,7-Methano-1H-indene, 1,4,5,6,7,8,8-heptachloro-3a,4,7,7a-tetrahydro- |
23720594 | 4,7-Methano-1H-indene, 1,4,5,6,7,8,8-heptachloro-3a,4,7,7a-tetrahydro- |
37229064 | 4,7-Methano-1H-indene, 1,4,5,6,7,8,8-heptachloro-3a,4,7,7a-tetrahydro- |
57749 | 4,7-Methano-1H-indene, 2,2,4,5,6,7,8,8-octachloro-2,3,3a,4,7,7a-hexahydro- |
5103742 | 4,7-Methano-1H-indene, 2,2,4,5,6,7,8,8-octachloro-2,3,3a,4,7,7a-hexahydro- |
5566347 | 4,7-Methano-1H-indene, 2,2,4,5,6,7,8,8-octachloro-2,3,3a,4,7,7a-hexahydro- |
77736 | 4,7-Methano-1H-indene, 3a,4,7,7a-tetrahydro- |
45737846 | 4,7-Methano-1H-indene, 3a,4,7,7a-tetrahydro- |
54335170 | 4,7-Methano-1H-indene, 3a,4,7,7a-tetrahydro- |
107760167 | 4,7-Methano-1H-indene, 3a,4,7,7a-tetrahydro- |
275363116 | 4,7-Methano-1H-indene, 3a,4,7,7a-tetrahydro- |
991424 | 4,7-Methano-1H-isoindole-1,3(2H)-dione, 3a,4,7,7a-tetrahydro-5-(hydroxyphenyl-2-pyridinylmethyl)-8-(phenyl-2-pyridinylmethylene)- |
297789 | 4,7-Methanoisobenzofuran, 1,3,4,5,6,7,8,8-octachloro-1,3,3a,4,7,7a-hexahydro- |
3212315 | 4,7-Methanoisobenzofuran, 1,3,4,5,6,7,8,8-octachloro-1,3,3a,4,7,7a-hexahydro- |
21152158 | 4,7-Methanoisobenzofuran, 1,3,4,5,6,7,8,8-octachloro-1,3,3a,4,7,7a-hexahydro- |
115275 | 4,7-Methanoisobenzofuran-1,3-dione, 4,5,6,7,8,8-hexachloro-3a,4,7,7a-tetrahydro- |
122485512 | 4,7-Methanoisobenzofuran-1,3-dione, 4,5,6,7,8,8-hexachloro-3a,4,7,7a-tetrahydro- |
123193 | 4-Heptanone |
128193 | 4-Heptanone |
103838 | 4-Heptanone, 2,6-dimethyl- |
108838 | 4-Heptanone, 2,6-dimethyl- |
958635422 | 4-Heptanone, 2,6-dimethyl- |
504245 | 4-Pyridinamine |
536334 | 4-Pyridinecarbothioamide, 2-ethyl- |
55221 | 4-Pyridinecarboxylic acid |
54853 | 4-Pyridinecarboxylic acid, hydrazide |
7640371 | 4-Pyridinecarboxylic acid, hydrazide |
37271106 | 4-Pyridinecarboxylic acid, hydrazide |
41466073 | 4-Pyridinecarboxylic acid, hydrazide |
62229510 | 4-Pyridinecarboxylic acid, hydrazide |
2971906 | 4-Pyridinol, 3,5-dichloro-2,6-dimethyl- |
535897 | 4-Pyrimidinamine, 2-chloro-N,N,6-trimethyl- |
4637563 | 4-Quinolinamine, N-hydroxy-, 1-oxide |
7177482 | 4-Thia-1-azabicyclo(3.2.0)heptane-2-carboxylic acid, 6-[[(2R)-aminophenylacetyl]amino]-3,3-dimethyl-7-oxo-, trihydrate, (2S,5R,6R)- |
132989 | 4-Thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid, 3,3-dimethyl-7-oxo-6-[(2-phenoxyacetyl)amino]-, potassium salt (1:1), (2S,5R,6R)- |
8059732 | 4-Thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid, 3,3-dimethyl-7-oxo-6-[(2-phenoxyacetyl)amino]-, potassium salt (1:1), (2S,5R,6R)- |
87081 | 4-Thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid, 3,3-dimethyl-7-oxo-6-[(phenoxyacetyl)amino]-, (2S,5R,6R)- |
69578 | 4-Thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid, 3,3-dimethyl-7-oxo-6-[(phenylacetyl)amino]-(2S,5R,6R)-, monosodium salt |
1406093 | 4-Thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid, 3,3-dimethyl-7-oxo-6-[(phenylacetyl)amino]-(2S,5R,6R)-, monosodium salt |
8049603 | 4-Thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid, 3,3-dimethyl-7-oxo-6-[(phenylacetyl)amino]-(2S,5R,6R)-, monosodium salt |
20880675 | 4-Thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid, 6-[[(4-hydroxyphenoxy)acetyl]amino]-3,3-dimethyl-7-oxo-, (2S,5R,6R)- |
29676719 | 4-Thiazoleacetic acid, 2-amino- |
2150552 | 4-Thiazolecarboxylic acid, 2-amino-4,5-dihydro- |
141844 | 4-Thiazolidinone, 2-thioxo- |
87274 | 4H-1,3,2-Benzodioxabismin-4-one, 2-hydroxy- |
8045189 | 4H-1,3,2-Benzodioxabismin-4-one, 2-hydroxy- |
14882189 | 4H-1,3,2-Benzodioxabismin-4-one, 2-hydroxy- |
55200425 | 4H-1,3,2-Benzodioxabismin-4-one, 2-hydroxy- |
56029891 | 4H-1,3,2-Benzodioxabismin-4-one, 2-hydroxy- |
61529495 | 4H-1,3,2-Benzodioxabismin-4-one, 2-hydroxy- |
16110513 | 4H-1-Benzopyran-2-carboxylic acid, 5,5'-[(2-hydroxy-1,3-propanediyl)bis(oxy)]bis[4-oxo- |
117395 | 4H-1-Benzopyran-4-one, 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy- |
73123101 | 4H-1-Benzopyran-4-one, 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy- |
74893815 | 4H-1-Benzopyran-4-one, 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy- |
203645 | 4H-Cyclopenta[def]phenanthrene |
118718 | 4H-Pyran-4-one, 3-hydroxy-2-methyl- |
23214928 | 5,12-Naphthacenedione, 10-[(3-amino-2,3,6-trideoxy-.alpha.-L-lyxo-hexopyranosyl)oxy]-7,8,9,10-tetrahydro-6,8,11-trihydroxy-8-(hydroxyacetyl)-1-methoxy-, hydrochloride, (8S,10S)- |
25316409 | 5,12-Naphthacenedione, 10-[(3-amino-2,3,6-trideoxy-.alpha.-L-lyxo-hexopyranosyl)oxy]-7,8,9,10-tetrahydro-6,8,11-trihydroxy-8-(hydroxyacetyl)-1-methoxy-, hydrochloride, (8S,10S)- |
1407154 | 5,12-Naphthacenedione, 8-acetyl-10-[(3-amino-2,3,6-trideoxy-.alpha.-L-lyxo-hexopyranosyl)oxy]-7,8,9,10-tetrahydro-6,8,11-trihydroxy-1-methoxy-, (8S,10S)- |
11006545 | 5,12-Naphthacenedione, 8-acetyl-10-[(3-amino-2,3,6-trideoxy-.alpha.-L-lyxo-hexopyranosyl)oxy]-7,8,9,10-tetrahydro-6,8,11-trihydroxy-1-methoxy-, (8S,10S)- |
11048296 | 5,12-Naphthacenedione, 8-acetyl-10-[(3-amino-2,3,6-trideoxy-.alpha.-L-lyxo-hexopyranosyl)oxy]-7,8,9,10-tetrahydro-6,8,11-trihydroxy-1-methoxy-, (8S,10S)- |
20830813 | 5,12-Naphthacenedione, 8-acetyl-10-[(3-amino-2,3,6-trideoxy-.alpha.-L-lyxo-hexopyranosyl)oxy]-7,8,9,10-tetrahydro-6,8,11-trihydroxy-1-methoxy-, (8S,10S)- |
23942769 | 5,12-Naphthacenedione, 8-acetyl-10-[(3-amino-2,3,6-trideoxy-.alpha.-L-lyxo-hexopyranosyl)oxy]-7,8,9,10-tetrahydro-6,8,11-trihydroxy-1-methoxy-, (8S,10S)- |
27576814 | 5,12-Naphthacenedione, 8-acetyl-10-[(3-amino-2,3,6-trideoxy-.alpha.-L-lyxo-hexopyranosyl)oxy]-7,8,9,10-tetrahydro-6,8,11-trihydroxy-1-methoxy-, (8S,10S)- |
28020806 | 5,12-Naphthacenedione, 8-acetyl-10-[(3-amino-2,3,6-trideoxy-.alpha.-L-lyxo-hexopyranosyl)oxy]-7,8,9,10-tetrahydro-6,8,11-trihydroxy-1-methoxy-, (8S,10S)- |
149541571 | 5,12-Naphthacenedione, 8-acetyl-10-[(3-amino-2,3,6-trideoxy-.alpha.-L-lyxo-hexopyranosyl)oxy]-7,8,9,10-tetrahydro-6,8,11-trihydroxy-1-methoxy-, (8S,10S)- |
23541506 | 5,12-Naphthacenedione, 8-acetyl-10-[(3-amino-2,3,6-trideoxy-.alpha.-L-lyxo-hexopyranosyl)oxy]-7,8,9,10-tetrahydro-6,8,11-trihydroxy-1-methoxy-, hydrochloride, (8S,10S)- |
126863 | 5-Decyne-4,7-diol, 2,4,7,9-tetramethyl- |
126864 | 5-Decyne-4,7-diol, 2,4,7,9-tetramethyl- |
8043354 | 5-Decyne-4,7-diol, 2,4,7,9-tetramethyl- |
37211431 | 5-Decyne-4,7-diol, 2,4,7,9-tetramethyl- |
61879194 | 5-Decyne-4,7-diol, 2,4,7,9-tetramethyl- |
149079550 | 5-Decyne-4,7-diol, 2,4,7,9-tetramethyl- |
166737173 | 5-Decyne-4,7-diol, 2,4,7,9-tetramethyl- |
170006538 | 5-Decyne-4,7-diol, 2,4,7,9-tetramethyl- |
171023044 | 5-Decyne-4,7-diol, 2,4,7,9-tetramethyl- |
504414599 | 5-Decyne-4,7-diol, 2,4,7,9-tetramethyl- |
845642797 | 5-Decyne-4,7-diol, 2,4,7,9-tetramethyl- |
867273130 | 5-Decyne-4,7-diol, 2,4,7,9-tetramethyl- |
872345614 | 5-Decyne-4,7-diol, 2,4,7,9-tetramethyl- |
552307 | 5-Isobenzofurancarboxylic acid, 1,3-dihydro-1,3-dioxo- |
28605643 | 5-Isobenzofurancarboxylic acid, 1,3-dihydro-1,3-dioxo- |
68864891 | 5-Isobenzofurancarboxylic acid, 1,3-dihydro-1,3-dioxo- |
70425466 | 5-Isobenzofurancarboxylic acid, 1,3-dihydro-1,3-dioxo- |
928770370 | 5-Isobenzofurancarboxylic acid, 1,3-dihydro-1,3-dioxo- |
60168889 | 5-Pyrimidinemethanol, .alpha.-(2-chlorophenyl)-.alpha.-(4-chlorophenyl)- |
162707166 | 5-Pyrimidinemethanol, .alpha.-(2-chlorophenyl)-.alpha.-(4-chlorophenyl)- |
1135442577 | 5-Pyrimidinemethanol, .alpha.-(2-chlorophenyl)-.alpha.-(4-chlorophenyl)- |
17673255 | 5H-Cyclopropa[3,4]benz[1,2-e]azulen-5-one, 1,1a,1b,4,4a,7a,7b,8,9,9a-decahydro-4a,7b,9,9a-tetrahydroxy-3-(hydroxymethyl)-1,1,6,8-tetramethyl-, (1aR,1bS,4aR,7aS,7bS,8R,9R,9aS)- |
54955 | 5H-Tetrazolo[1,5-a]azepine, 6,7,8,9-tetrahydro- |
1031078 | 6,9-Methano-2,4,3-benzodioxathiepin, 6,7,8,9,10,10-hexachloro-1,5,5a,6,9,9a-hexahydro-, 3,3-dioxide |
6749253 | 6,9-Methano-2,4,3-benzodioxathiepin, 6,7,8,9,10,10-hexachloro-1,5,5a,6,9,9a-hexahydro-, 3,3-dioxide |
87695430 | 6,9-Methano-2,4,3-benzodioxathiepin, 6,7,8,9,10,10-hexachloro-1,5,5a,6,9,9a-hexahydro-, 3,3-dioxide |
115297 | 6,9-Methano-2,4,3-benzodioxathiepin, 6,7,8,9,10,10-hexachloro-1,5,5a,6,9,9a-hexahydro-, 3-oxide |
6994043 | 6,9-Methano-2,4,3-benzodioxathiepin, 6,7,8,9,10,10-hexachloro-1,5,5a,6,9,9a-hexahydro-, 3-oxide |
8003450 | 6,9-Methano-2,4,3-benzodioxathiepin, 6,7,8,9,10,10-hexachloro-1,5,5a,6,9,9a-hexahydro-, 3-oxide |
426824513 | 6,9-Methano-2,4,3-benzodioxathiepin, 6,7,8,9,10,10-hexachloro-1,5,5a,6,9,9a-hexahydro-, 3-oxide |
891861 | 6,9-Methano-2,4,3-benzodioxathiepin, 6,7,8,9,10,10-hexachloro-1,5,5a,6,9,9a-hexahydro-, 3-oxide, (3.alpha.,5a.alpha.,6.beta.,9.beta.,9a.alpha.)- |
8003450 | 6,9-Methano-2,4,3-benzodioxathiepin, 6,7,8,9,10,10-hexachloro-1,5,5a,6,9,9a-hexahydro-, 3-oxide, (3.alpha.,5a.alpha.,6.beta.,9.beta.,9a.alpha.)- |
12640594 | 6,9-Methano-2,4,3-benzodioxathiepin, 6,7,8,9,10,10-hexachloro-1,5,5a,6,9,9a-hexahydro-, 3-oxide, (3.alpha.,5a.alpha.,6.beta.,9.beta.,9a.alpha.)- |
19670156 | 6,9-Methano-2,4,3-benzodioxathiepin, 6,7,8,9,10,10-hexachloro-1,5,5a,6,9,9a-hexahydro-, 3-oxide, (3.alpha.,5a.alpha.,6.beta.,9.beta.,9a.alpha.)- |
33213659 | 6,9-Methano-2,4,3-benzodioxathiepin, 6,7,8,9,10,10-hexachloro-1,5,5a,6,9,9a-hexahydro-, 3-oxide, (3.alpha.,5a.alpha.,6.beta.,9.beta.,9a.alpha.)- |
959988 | 6,9-Methano-2,4,3-benzodioxathiepin, 6,7,8,9,10,10-hexachloro-1,5,5a,6,9,9a-hexahydro-, 3-oxide, (3.alpha.,5a.beta.,6.alpha.,9.alpha.,9a.beta.)- |
8003450 | 6,9-Methano-2,4,3-benzodioxathiepin, 6,7,8,9,10,10-hexachloro-1,5,5a,6,9,9a-hexahydro-, 3-oxide, (3.alpha.,5a.beta.,6.alpha.,9.alpha.,9a.beta.)- |
12640583 | 6,9-Methano-2,4,3-benzodioxathiepin, 6,7,8,9,10,10-hexachloro-1,5,5a,6,9,9a-hexahydro-, 3-oxide, (3.alpha.,5a.beta.,6.alpha.,9.alpha.,9a.beta.)- |
19595596 | 6,9-Methano-2,4,3-benzodioxathiepin, 6,7,8,9,10,10-hexachloro-1,5,5a,6,9,9a-hexahydro-, 3-oxide, (3.alpha.,5a.beta.,6.alpha.,9.alpha.,9a.beta.)- |
29106318 | 6,9-Methano-2,4,3-benzodioxathiepin, 6,7,8,9,10,10-hexachloro-1,5,5a,6,9,9a-hexahydro-, 3-oxide, (3.alpha.,5a.beta.,6.alpha.,9.alpha.,9a.beta.)- |
33213660 | 6,9-Methano-2,4,3-benzodioxathiepin, 6,7,8,9,10,10-hexachloro-1,5,5a,6,9,9a-hexahydro-, 3-oxide, (3.alpha.,5a.beta.,6.alpha.,9.alpha.,9a.beta.)- |
150845 | 6-Octen-1-ol, 3,7-dimethyl-, 1-acetate |
67650822 | 6-Octen-1-ol, 3,7-dimethyl-, 1-acetate |
73494 | 6-Quinazolinesulfonamide, 7-chloro-2-ethyl-1,2,3,4-tetrahydro-4-oxo- |
521357 | 6H-Dibenzo(b,d)pyran-1-ol, 6,6,9-trimethyl-3-pentyl- |
1972083 | 6H-Dibenzo[b,d]pyran-1-ol, 6a,7,8,10a-tetrahydro-6,6,9-trimethyl-3-pentyl-, (6aR,10aR)- |
50442 | 6H-Purine-6-thione, 1,7-dihydro- |
6112761 | 6H-Purine-6-thione, 1,7-dihydro-, monohydrate |
154427 | 6H-Purine-6-thione, 2-amino-1,7-dihydro- |
1563388 | 7-Benzofuranol, 2,3-dihydro-2,2-dimethyl- |
1563662 | 7-Benzofuranol, 2,3-dihydro-2,2-dimethyl-, 7-(N-methylcarbamate) |
130176 | 7-Benzothiazolesulfonic acid, 2-(4-aminophenyl)-6-methyl- |
129679 | 7-Oxabicyclo[2.2.1]heptane-2,3-dicarboxylic acid |
145733 | 7-Oxabicyclo[2.2.1]heptane-2,3-dicarboxylic acid |
349466393 | 7-Oxabicyclo[2.2.1]heptane-2,3-dicarboxylic acid |
857020725 | 7-Oxabicyclo[2.2.1]heptane-2,3-dicarboxylic acid |
2164070 | 7-Oxabicyclo[2.2.1]heptane-2,3-dicarboxylic acid, potassium salt (1:2) |
106876 | 7-Oxabicyclo[4.1.0]heptane, 3-(2-oxiranyl)- |
108876 | 7-Oxabicyclo[4.1.0]heptane, 3-(2-oxiranyl)- |
25550496 | 7-Oxabicyclo[4.1.0]heptane, 3-(2-oxiranyl)- |
3388043 | 7-Oxabicyclo[4.1.0]heptane, 3-[2-(trimethoxysilyl)ethyl]- |
52682889 | 7-Oxabicyclo[4.1.0]heptane, 3-[2-(trimethoxysilyl)ethyl]- |
155684303 | 7-Oxabicyclo[4.1.0]heptane, 3-[2-(trimethoxysilyl)ethyl]- |
1203548495 | 7-Oxabicyclo[4.1.0]heptane, 3-[2-(trimethoxysilyl)ethyl]- |
194592 | 7H-Dibenzo[c,g]carbazole |
20073249 | 7H-Furo[3,2-g][1]benzopyran-6-carboxylic acid, 7-oxo-, ethyl ester |
484208 | 7H-Furo[3,2-g][1]benzopyran-7-one, 4-methoxy- |
298817 | 7H-Furo[3,2-g][1]benzopyran-7-one, 9-methoxy- |
12692943 | 7H-Furo[3,2-g][1]benzopyran-7-one, 9-methoxy- |
7008426 | 7H-Pyrano[2,3-c]acridin-7-one, 3,12-dihydro-6-methoxy-3,3,12-trimethyl- |
148243 | 8-Quinolinol |
24804146 | 8-Quinolinol |
123574674 | 8-Quinolinol |
130267 | 8-Quinolinol, 5-chloro-7-iodo- |
22112034 | 8-Quinolinol, 5-chloro-7-iodo- |
736176413 | 8-Quinolinol, 5-chloro-7-iodo- |
134316 | 8-Quinolinol, sulfate (2:1) |
480228 | 9(10H)-Anthracenone, 1,8-dihydroxy- |
1143380 | 9(10H)-Anthracenone, 1,8-dihydroxy- |
84651 | 9,10-Anthracenedione |
17418585 | 9,10-Anthracenedione |
790240527 | 9,10-Anthracenedione |
2475458 | 9,10-Anthracenedione, 1,4,5,8-tetraamino- |
117102 | 9,10-Anthracenedione, 1,8-dihydroxy- |
32073077 | 9,10-Anthracenedione, 1,8-dihydroxy- |
343235405 | 9,10-Anthracenedione, 1,8-dihydroxy- |
8150 | 9,10-Anthracenedione, 1,8-dihydroxy-4,5-dinitro- |
81550 | 9,10-Anthracenedione, 1,8-dihydroxy-4,5-dinitro- |
12227826 | 9,10-Anthracenedione, 1,8-dihydroxy-4-[[4-(2-hydroxyethyl)phenyl]amino]-5-nitro- |
15791783 | 9,10-Anthracenedione, 1,8-dihydroxy-4-[[4-(2-hydroxyethyl)phenyl]amino]-5-nitro- |
51281084 | 9,10-Anthracenedione, 1,8-dihydroxy-4-[[4-(2-hydroxyethyl)phenyl]amino]-5-nitro- |
58253308 | 9,10-Anthracenedione, 1,8-dihydroxy-4-[[4-(2-hydroxyethyl)phenyl]amino]-5-nitro- |
69993119 | 9,10-Anthracenedione, 1,8-dihydroxy-4-[[4-(2-hydroxyethyl)phenyl]amino]-5-nitro- |
81492 | 9,10-Anthracenedione, 1-amino-2,4-dibromo- |
82280 | 9,10-Anthracenedione, 1-amino-2-methyl- |
117793 | 9,10-Anthracenedione, 2-amino- |
129157 | 9,10-Anthracenedione, 2-methyl-1-nitro- |
463401 | 9,12,15-Octadecatrienoic acid, (9Z,12Z,15Z)- |
60333 | 9,12-Octadecadienoic acid (9Z,12Z)- |
949900189 | 9,12-Octadecadienoic acid (9Z,12Z)- |
90459 | 9-Acridinamine |
134509 | 9-Acridinamine, hydrochloride (1:1) |
52417228 | 9-Acridinamine, monohydrochloride, monohydrate |
112801 | 9-Octadecenoic acid (9Z)- |
8046013 | 9-Octadecenoic acid (9Z)- |
17156842 | 9-Octadecenoic acid (9Z)- |
56833513 | 9-Octadecenoic acid (9Z)- |
949900167 | 9-Octadecenoic acid (9Z)- |
1190712118 | 9-Octadecenoic acid (9Z)- |
1190965719 | 9-Octadecenoic acid (9Z)- |
1380514022 | 9-Octadecenoic acid (9Z)- |
688379 | 9-Octadecenoic acid (9Z)-, aluminum salt |
13961869 | 9-Octadecenoic acid (9Z)-, compd. with 2,2'-iminobis[ethanol] (1:1) |
112629 | 9-Octadecenoic acid (9Z)-, methyl ester |
139152822 | 9-Octadecenoic acid (9Z)-, methyl ester |
228858364 | 9-Octadecenoic acid (9Z)-, methyl ester |
5323955 | 9-Octadecenoic acid, 12-hydroxy-, sodium salt (1:1), (9Z,12R)- |
8043456 | 9-Octadecenoic acid, 12-hydroxy-, sodium salt (1:1), (9Z,12R)- |
23647441 | 9-Octadecenoic acid, 12-hydroxy-, sodium salt (1:1), (9Z,12R)- |
132321 | 9H-Carbazol-3-amine, 9-ethyl- |
6109973 | 9H-Carbazol-3-amine, 9-ethyl-, monohydrochloride (1:1) |
86737 | 9H-Carbazole |
86748 | 9H-Carbazole |
153786 | 9H-Fluoren-2-amine |
6633405 | 9H-Fluoren-2-ol, 7-nitro- |
129793 | 9H-Fluoren-9-one, 2,4,7-trinitro- |
31551458 | 9H-Fluoren-9-one, 2,7-dinitro- |
86730 | 9H-Fluorene |
86737 | 9H-Fluorene |
84987804 | 9H-Fluorene |
15110744 | 9H-Fluorene, 2,5-dinitro- |
607578 | 9H-Fluorene, 2-nitro- |
3105973 | 9H-Thioxanthen-9-one, 1-[[2-(diethylamino)ethyl]amino]-4-(hydroxymethyl)- |
23255938 | 9H-Thioxanthen-9-one, 1-[[2-(diethylamino)ethyl]amino]-4-(hydroxymethyl)-, monomethanesulfonate (salt) |
208968 | Acenaphthylene |
83329 | Acenaphthylene, 1,2-dihydro- |
83399 | Acenaphthylene, 1,2-dihydro- |
602879 | Acenaphthylene, 1,2-dihydro-5-nitro- |
15067262 | Acenaphthylene-d8, 1,2-dihydro-d2- |
75070 | Acetaldehyde |
75876 | Acetaldehyde, 2,2,2-trichloro- |
79027 | Acetaldehyde, 2,2-dichloro- |
107200 | Acetaldehyde, 2-chloro- |
60355 | Acetamide |
126272 | Acetamide, 2,2'-[(2-hydroxyethyl)imino]bis[N-(1,1-dimethyl-2-phenylethyl)-N-methyl- |
10222012 | Acetamide, 2,2-dibromo-2-cyano- |
63619090 | Acetamide, 2,2-dibromo-2-cyano- |
56757 | Acetamide, 2,2-dichloro-N-[(1R,2R)-2-hydroxy-1-(hydroxymethyl)-2-(4-nitrophenyl)ethyl]- |
15313323 | Acetamide, 2,2-dichloro-N-[(1R,2R)-2-hydroxy-1-(hydroxymethyl)-2-(4-nitrophenyl)ethyl]- |
55172720 | Acetamide, 2,2-dichloro-N-[(1R,2R)-2-hydroxy-1-(hydroxymethyl)-2-(4-nitrophenyl)ethyl]- |
59112593 | Acetamide, 2,2-dichloro-N-[(1R,2R)-2-hydroxy-1-(hydroxymethyl)-2-(4-nitrophenyl)ethyl]- |
85666848 | Acetamide, 2,2-dichloro-N-[(1R,2R)-2-hydroxy-1-(hydroxymethyl)-2-(4-nitrophenyl)ethyl]- |
137731909 | Acetamide, 2,2-dichloro-N-[(1R,2R)-2-hydroxy-1-(hydroxymethyl)-2-(4-nitrophenyl)ethyl]- |
555486 | Acetamide, 2-amino-N-phenyl- |
403652197 | Acetamide, 2-amino-N-phenyl- |
4801392 | Acetamide, 2-amino-N-phenyl-, monohydrochloride |
93710 | Acetamide, 2-chloro-N,N-di-2-propen-1-yl- |
1912249 | Acetamide, 2-chloro-N-(1-methylethyl)-N-phenyl- |
1918167 | Acetamide, 2-chloro-N-(1-methylethyl)-N-phenyl- |
63704814 | Acetamide, 2-chloro-N-(1-methylethyl)-N-phenyl- |
15972608 | Acetamide, 2-chloro-N-(2,6-diethylphenyl)-N-(methoxymethyl)- |
37924133 | Acetamide, 2-chloro-N-(2-ethyl-6-methylphenyl)-N-(2-methoxy-1-methylethyl)- |
51218452 | Acetamide, 2-chloro-N-(2-ethyl-6-methylphenyl)-N-(2-methoxy-1-methylethyl)- |
55762760 | Acetamide, 2-chloro-N-(2-ethyl-6-methylphenyl)-N-(2-methoxy-1-methylethyl)- |
63150685 | Acetamide, 2-chloro-N-(2-ethyl-6-methylphenyl)-N-(2-methoxy-1-methylethyl)- |
94449588 | Acetamide, 2-chloro-N-(2-ethyl-6-methylphenyl)-N-(2-methoxy-1-methylethyl)- |
34256821 | Acetamide, 2-chloro-N-(ethoxymethyl)-N-(2-ethyl-6-methylphenyl)- |
73412881 | Acetamide, 2-chloro-N-(ethoxymethyl)-N-(2-ethyl-6-methylphenyl)- |
123113746 | Acetamide, 2-chloro-N-(ethoxymethyl)-N-(2-ethyl-6-methylphenyl)- |
107915 | Acetamide, 2-cyano- |
30587805 | Acetamide, 2-cyano- |
640197 | Acetamide, 2-fluoro- |
127195 | Acetamide, N,N-dimethyl- |
6375173 | Acetamide, N-(2-hydroxy-5-methylphenyl)- |
120661 | Acetamide, N-(2-methylphenyl)- |
17026812 | Acetamide, N-(3-amino-4-ethoxyphenyl)- |
53461759 | Acetamide, N-(3-amino-4-ethoxyphenyl)- |
102283 | Acetamide, N-(3-aminophenyl)- |
591333 | Acetamide, N-(3-ethoxyphenyl)- |
621421 | Acetamide, N-(3-hydroxyphenyl)- |
537928 | Acetamide, N-(3-methylphenyl)- |
122805 | Acetamide, N-(4-aminophenyl)- |
1777840 | Acetamide, N-(4-ethoxy-3-nitrophenyl)- |
62442 | Acetamide, N-(4-ethoxyphenyl)- |
103902 | Acetamide, N-(4-hydroxyphenyl)- |
8055081 | Acetamide, N-(4-hydroxyphenyl)- |
719293046 | Acetamide, N-(4-hydroxyphenyl)- |
1430221003 | Acetamide, N-(4-hydroxyphenyl)- |
103899 | Acetamide, N-(4-methylphenyl)- |
42135353 | Acetamide, N-(9-oxo-9H-fluoren-4-yl)- |
591082 | Acetamide, N-(aminothioxomethyl)- |
23184669 | Acetamide, N-(butoxymethyl)-2-chloro-N-(2,6-diethylphenyl)- |
53963 | Acetamide, N-9H-fluoren-2-yl- |
2508216 | Acetamide, N-9H-fluoren-2-yl- |
53952 | Acetamide, N-9H-fluoren-2-yl-N-hydroxy- |
28322023 | Acetamide, N-9H-fluoren-4-yl- |
144809 | Acetamide, N-[(4-aminophenyl)sulfonyl]- |
64868 | Acetamide, N-[(7S)-5,6,7,9-tetrahydro-1,2,3,10-tetramethoxy-9-oxobenzo[a]heptalen-7-yl]- |
5843867 | Acetamide, N-[(7S)-5,6,7,9-tetrahydro-1,2,3,10-tetramethoxy-9-oxobenzo[a]heptalen-7-yl]- |
30512313 | Acetamide, N-[(7S)-5,6,7,9-tetrahydro-1,2,3,10-tetramethoxy-9-oxobenzo[a]heptalen-7-yl]- |
140498 | Acetamide, N-[4-(2-chloroacetyl)phenyl]- |
2832408 | Acetamide, N-[4-[2-(2-hydroxy-5-methylphenyl)diazenyl]phenyl]- |
12227019 | Acetamide, N-[4-[2-(2-hydroxy-5-methylphenyl)diazenyl]phenyl]- |
12238709 | Acetamide, N-[4-[2-(2-hydroxy-5-methylphenyl)diazenyl]phenyl]- |
66057656 | Acetamide, N-[4-[2-(2-hydroxy-5-methylphenyl)diazenyl]phenyl]- |
59665 | Acetamide, N-[5-(aminosulfonyl)-1,3,4-thiadiazol-2-yl]- |
5661256 | Acetamide, N-[5-(aminosulfonyl)-1,3,4-thiadiazol-2-yl]- |
8017694 | Acetamide, N-[5-(aminosulfonyl)-1,3,4-thiadiazol-2-yl]- |
79152 | Acetamide, N-bromo- |
103844 | Acetamide, N-phenyl- |
64197 | Acetic acid |
69197 | Acetic acid |
71501 | Acetic acid |
77671228 | Acetic acid |
1053656975 | Acetic acid |
108054 | Acetic acid ethenyl ester |
61891427 | Acetic acid ethenyl ester |
82041234 | Acetic acid ethenyl ester |
85306269 | Acetic acid ethenyl ester |
172702771 | Acetic acid ethenyl ester |
220713360 | Acetic acid ethenyl ester |
114786 | Acetic acid ethyl ester |
141786 | Acetic acid ethyl ester |
4938721 | Acetic acid, (2,4,5-trichlorophenoxy)-, 2-methylpropyl ester |
93798 | Acetic acid, (2,4,5-trichlorophenoxy)-, butyl ester |
53851799 | Acetic acid, (2,4,5-trichlorophenoxy)-, butyl ester |
25168154 | Acetic acid, (2,4,5-trichlorophenoxy)-, isooctyl ester |
94111 | Acetic acid, (2,4-dichlorophenoxy)-, 1-methylethyl ester |
1929733 | Acetic acid, (2,4-dichlorophenoxy)-, 2-butoxyethyl ester |
1320189 | Acetic acid, (2,4-dichlorophenoxy)-, 2-butoxymethylethyl ester |
29592992 | Acetic acid, (2,4-dichlorophenoxy)-, 2-butoxymethylethyl ester |
30286205 | Acetic acid, (2,4-dichlorophenoxy)-, 2-butoxymethylethyl ester |
118821775 | Acetic acid, (2,4-dichlorophenoxy)-, 2-butoxymethylethyl ester |
53404378 | Acetic acid, (2,4-dichlorophenoxy)-, 2-ethyl-4-methylpentyl ester |
1928434 | Acetic acid, (2,4-dichlorophenoxy)-, 2-ethylhexyl ester |
1713151 | Acetic acid, (2,4-dichlorophenoxy)-, 2-methylpropyl ester |
2971382 | Acetic acid, (2,4-dichlorophenoxy)-, 4-chloro-2-butenyl ester |
94804 | Acetic acid, (2,4-dichlorophenoxy)-, butyl ester |
2008391 | Acetic acid, (2,4-dichlorophenoxy)-, compd. with N-methylmethanamine (1:1) |
59644621 | Acetic acid, (2,4-dichlorophenoxy)-, compd. with N-methylmethanamine (1:1) |
64296191 | Acetic acid, (2,4-dichlorophenoxy)-, compd. with N-methylmethanamine (1:1) |
123950903 | Acetic acid, (2,4-dichlorophenoxy)-, compd. with N-methylmethanamine (1:1) |
1280202 | Acetic acid, (2,4-dichlorophenoxy)-, isooctyl ester |
25168267 | Acetic acid, (2,4-dichlorophenoxy)-, isooctyl ester |
56645342 | Acetic acid, (2,4-dichlorophenoxy)-, isooctyl ester |
94757 | Acetic acid, (2,4-dichlorophenoxy)-, salts and esters |
2702729 | Acetic acid, (2,4-dichlorophenoxy)-, salts and esters |
1067330 | Acetic acid, 1,1'-(dibutylstannylene) ester |
64197 | Acetic acid, 1,1'-anhydride |
108247 | Acetic acid, 1,1'-anhydride |
540885 | Acetic acid, 1,1-dimethylethyl ester |
108214 | Acetic acid, 1-methylethyl ester |
105464 | Acetic acid, 1-methylpropyl ester |
116698487 | Acetic acid, 1-methylpropyl ester |
16284541 | Acetic acid, 2,2',2''-[(butylstannylidyne)tris(thio)]tris-, 1,1',1''-triisooctyl ester |
25852704 | Acetic acid, 2,2',2''-[(butylstannylidyne)tris(thio)]tris-, 1,1',1''-triisooctyl ester |
54849386 | Acetic acid, 2,2',2''-[(methylstannylidyne)tris(thio)]tris-, 1,1',1''-triisooctyl ester |
56225491 | Acetic acid, 2,2',2''-[(methylstannylidyne)tris(thio)]tris-, 1,1',1''-triisooctyl ester |
11097635 | Acetic acid, 2,2'-[(dioctylstannylene)bis(thio)]bis-, 1,1'-diisooctyl ester |
26401978 | Acetic acid, 2,2'-[(dioctylstannylene)bis(thio)]bis-, 1,1'-diisooctyl ester |
31228827 | Acetic acid, 2,2'-[(dioctylstannylene)bis(thio)]bis-, 1,1'-diisooctyl ester |
52434432 | Acetic acid, 2,2'-[(dioctylstannylene)bis(thio)]bis-, 1,1'-diisooctyl ester |
55353598 | Acetic acid, 2,2'-[(dioctylstannylene)bis(thio)]bis-, 1,1'-diisooctyl ester |
67053649 | Acetic acid, 2,2'-[(dioctylstannylene)bis(thio)]bis-, 1,1'-diisooctyl ester |
72253679 | Acetic acid, 2,2'-[(dioctylstannylene)bis(thio)]bis-, 1,1'-diisooctyl ester |
80497898 | Acetic acid, 2,2'-[(dioctylstannylene)bis(thio)]bis-, 1,1'-diisooctyl ester |
103289301 | Acetic acid, 2,2'-[(dioctylstannylene)bis(thio)]bis-, 1,1'-diisooctyl ester |
75967 | Acetic acid, 2,2,2-tribromo- |
76039 | Acetic acid, 2,2,2-trichloro- |
631641 | Acetic acid, 2,2-dibromo- |
79436 | Acetic acid, 2,2-dichloro- |
42428477 | Acetic acid, 2,2-dichloro- |
39765 | Acetic acid, 2-(2,4,5-trichlorophenoxy)- |
93765 | Acetic acid, 2-(2,4,5-trichlorophenoxy)- |
4834495 | Acetic acid, 2-(2,4,5-trichlorophenoxy)- |
94757 | Acetic acid, 2-(2,4-dichlorophenoxy)- |
15183398 | Acetic acid, 2-(2,4-dichlorophenoxy)- |
2702729 | Acetic acid, 2-(2,4-dichlorophenoxy)-, sodium salt (1:1) |
37353585 | Acetic acid, 2-(2,4-dichlorophenoxy)-, sodium salt (1:1) |
58318528 | Acetic acid, 2-(2,4-dichlorophenoxy)-, sodium salt (1:1) |
67924781 | Acetic acid, 2-(2,4-dichlorophenoxy)-, sodium salt (1:1) |
94746 | Acetic acid, 2-(4-chloro-2-methylphenoxy)- |
11111130 | Acetic acid, 2-(4-chloro-2-methylphenoxy)- |
11111141 | Acetic acid, 2-(4-chloro-2-methylphenoxy)- |
50926551 | Acetic acid, 2-(4-chloro-2-methylphenoxy)- |
127289401 | Acetic acid, 2-(4-chloro-2-methylphenoxy)- |
3653483 | Acetic acid, 2-(4-chloro-2-methylphenoxy)-, sodium salt (1:1) |
11100019 | Acetic acid, 2-(4-chloro-2-methylphenoxy)-, sodium salt (1:1) |
11114060 | Acetic acid, 2-(4-chloro-2-methylphenoxy)-, sodium salt (1:1) |
55335063 | Acetic acid, 2-[(3,5,6-trichloro-2-pyridinyl)oxy]- |
69653721 | Acetic acid, 2-[(3,5,6-trichloro-2-pyridinyl)oxy]- |
79083 | Acetic acid, 2-bromo- |
418768497 | Acetic acid, 2-bromo- |
418768500 | Acetic acid, 2-bromo- |
79118 | Acetic acid, 2-chloro- |
627032 | Acetic acid, 2-ethoxy- |
144490 | Acetic acid, 2-fluoro- |
9074775 | Acetic acid, 2-fluoro- |
62748 | Acetic acid, 2-fluoro-, sodium salt (1:1) |
64697 | Acetic acid, 2-iodo- |
33089611 | Acetic acid, 2-iodo- |
68111 | Acetic acid, 2-mercapto- |
7283423 | Acetic acid, 2-mercapto- |
57755201 | Acetic acid, 2-mercapto- |
367511 | Acetic acid, 2-mercapto-, sodium salt (1:1) |
12773250 | Acetic acid, 2-mercapto-, sodium salt (1:1) |
28381988 | Acetic acid, 2-mercapto-, sodium salt (1:1) |
625456 | Acetic acid, 2-methoxy- |
110190 | Acetic acid, 2-methylpropyl ester |
723864 | Acetic acid, 2-methylpropyl ester |
122598 | Acetic acid, 2-phenoxy- |
103457 | Acetic acid, 2-phenylethyl ester |
114830 | Acetic acid, 2-phenylhydrazide |
57213691 | Acetic acid, [(3,5,6-trichloro-2-pyridinyl)oxy]-, compd. with N,N-diethylethanamine (1:1) |
69653732 | Acetic acid, [(3,5,6-trichloro-2-pyridinyl)oxy]-, compd. with N,N-diethylethanamine (1:1) |
58548 | Acetic acid, [2,3-dichloro-4-(2-methylene-1-oxobutyl)phenoxy]- |
139128 | Acetic acid, aluminum salt (3:1) |
8006131 | Acetic acid, aluminum salt (3:1) |
631618 | Acetic acid, ammonium salt (1:1) |
1066326 | Acetic acid, ammonium salt (1:1) |
92206387 | Acetic acid, ammonium salt (1:1) |
856326799 | Acetic acid, ammonium salt (1:1) |
858824314 | Acetic acid, ammonium salt (1:1) |
5589968 | Acetic acid, bromochloro- |
123864 | Acetic acid, butyl ester |
543908 | Acetic acid, cadmium salt (2:1) |
24558494 | Acetic acid, cadmium salt (2:1) |
29398763 | Acetic acid, cadmium salt (2:1) |
245727622 | Acetic acid, cadmium salt (2:1) |
5278955 | Acetic acid, dibromochloro- |
71501 | Acetic acid, ion(1-) |
301042 | Acetic acid, lead(2+) salt (2:1) |
6080564 | Acetic acid, lead(2+) salt, trihydrate |
546894 | Acetic acid, lithium salt (1:1) |
1600277 | Acetic acid, mercury(2+) salt (2:1) |
6129233 | Acetic acid, mercury(2+) salt (2:1) |
7619627 | Acetic acid, mercury(2+) salt (2:1) |
19701156 | Acetic acid, mercury(2+) salt (2:1) |
148333066 | Acetic acid, mercury(2+) salt (2:1) |
79209 | Acetic acid, methyl ester |
373024 | Acetic acid, nickel(2+) salt (2:1) |
17593690 | Acetic acid, nickel(2+) salt (2:1) |
219782271 | Acetic acid, nickel(2+) salt (2:1) |
628637 | Acetic acid, pentyl ester |
140114 | Acetic acid, phenylmethyl ester |
127082 | Acetic acid, potassium salt (1:1) |
134092629 | Acetic acid, potassium salt (1:1) |
325477950 | Acetic acid, potassium salt (1:1) |
662141299 | Acetic acid, potassium salt (1:1) |
109604 | Acetic acid, propyl ester |
127093 | Acetic acid, sodium salt (1:1) |
325477994 | Acetic acid, sodium salt (1:1) |
883902292 | Acetic acid, sodium salt (1:1) |
563688 | Acetic acid, thallium(1+) salt (1:1) |
75058 | Acetonitrile |
54841724 | Acetonitrile |
545062 | Acetonitrile, 2,2,2-trichloro- |
3252435 | Acetonitrile, 2,2-dibromo- |
107142 | Acetonitrile, 2-chloro- |
1867103 | Acetonitrile, 2-chloro- |
107164 | Acetonitrile, 2-hydroxy- |
590170 | Acetonitrile, bromo- |
83463621 | Acetonitrile, bromochloro- |
3018120 | Acetonitrile, dichloro- |
75519196 | Acetonitrile, tribromo- |
75365 | Acetyl chloride |
76028 | Acetyl chloride, 2,2,2-trichloro- |
79367 | Acetyl chloride, 2,2-dichloro- |
79040 | Acetyl chloride, 2-chloro- |
79049 | Acetyl chloride, 2-chloro- |
1256778774 | Acetyl chloride, 2-chloro- |
359068 | Acetyl chloride, 2-fluoro- |
260946 | Acridine |
14952400 | Actinium, isotope of mass 227 |
14331830 | Actinium, isotope of mass 228 |
50760 | Actinomycin D |
1402513 | Actinomycin D |
1402580 | Actinomycin D |
13473499 | Actinomycin D |
59473040 | Adsorbable organic halides |
83219458 | Aflatoxin G1S |
1402682 | Aflatoxins |
9002180 | Agar |
63241816 | Agar |
57837191 | Alanine, N-(2,6-dimethylphenyl)-N-(methoxyacetyl)-, methyl ester |
102256633 | Alanine, N-(2,6-dimethylphenyl)-N-(methoxyacetyl)-, methyl ester |
39288669 | Alfol |
108171262 | Alkanes, C10-12, chloro |
85535848 | Alkanes, C10-13, chloro |
12587461 | Alpha particle |
16941109 | Aluminate(1-), tetrahydro-, calcium (2:1), (T-4)- |
1302303 | Aluminate(1-), tetrahydro-, lithium (1:1), (T-4)- |
16853853 | Aluminate(1-), tetrahydro-, lithium (1:1), (T-4)- |
1035696446 | Aluminate(1-), tetrahydro-, lithium (1:1), (T-4)- |
1097640737 | Aluminate(1-), tetrahydro-, lithium (1:1), (T-4)- |
1097640760 | Aluminate(1-), tetrahydro-, lithium (1:1), (T-4)- |
1327362 | Aluminatesilicate |
37316704 | Aluminatesilicate |
39457313 | Aluminatesilicate |
7429905 | Aluminum |
12766459 | Aluminum |
37202645 | Aluminum |
39302711 | Aluminum |
39332622 | Aluminum |
80341191 | Aluminum |
91728142 | Aluminum |
113962666 | Aluminum |
121630486 | Aluminum |
182260453 | Aluminum |
185464373 | Aluminum |
257888996 | Aluminum |
298688478 | Aluminum |
349608511 | Aluminum |
477951227 | Aluminum |
934749469 | Aluminum |
1107614027 | Aluminum |
1374563195 | Aluminum |
1374563220 | Aluminum |
12656438 | Aluminum carbide |
7446700 | Aluminum chloride (AlCl3) |
41630017 | Aluminum chloride (AlCl3) |
125690940 | Aluminum chloride (AlCl3) |
195436385 | Aluminum chloride (AlCl3) |
255839011 | Aluminum chloride (AlCl3) |
1161430814 | Aluminum chloride (AlCl3) |
1332483609 | Aluminum chloride (AlCl3) |
1327419 | Aluminum chloride, basic |
8012666 | Aluminum chloride, basic |
11097680 | Aluminum chloride, basic |
32056158 | Aluminum chloride, basic |
37226463 | Aluminum chloride, basic |
39380808 | Aluminum chloride, basic |
56803011 | Aluminum chloride, basic |
56831664 | Aluminum chloride, basic |
64441776 | Aluminum chloride, basic |
79586020 | Aluminum chloride, basic |
84861983 | Aluminum chloride, basic |
101707179 | Aluminum chloride, basic |
114442103 | Aluminum chloride, basic |
135864709 | Aluminum chloride, basic |
143230540 | Aluminum chloride, basic |
144388283 | Aluminum chloride, basic |
162535151 | Aluminum chloride, basic |
167140058 | Aluminum chloride, basic |
245064408 | Aluminum chloride, basic |
672263853 | Aluminum chloride, basic |
745062582 | Aluminum chloride, basic |
808739255 | Aluminum chloride, basic |
851541974 | Aluminum chloride, basic |
929897916 | Aluminum chloride, basic |
929897938 | Aluminum chloride, basic |
929898033 | Aluminum chloride, basic |
929898044 | Aluminum chloride, basic |
1123762300 | Aluminum chloride, basic |
7784181 | Aluminum fluoride (AlF3) |
856859795 | Aluminum fluoride (AlF3) |
1202643057 | Aluminum fluoride (AlF3) |
1328946662 | Aluminum fluoride (AlF3) |
7784216 | Aluminum hydride (AlH3) |
957143316 | Aluminum hydride (AlH3) |
1302290 | Aluminum hydroxide (Al(OH)3) |
8012633 | Aluminum hydroxide (Al(OH)3) |
8064004 | Aluminum hydroxide (Al(OH)3) |
12040594 | Aluminum hydroxide (Al(OH)3) |
12252709 | Aluminum hydroxide (Al(OH)3) |
13783169 | Aluminum hydroxide (Al(OH)3) |
16657479 | Aluminum hydroxide (Al(OH)3) |
21645512 | Aluminum hydroxide (Al(OH)3) |
51330224 | Aluminum hydroxide (Al(OH)3) |
106152094 | Aluminum hydroxide (Al(OH)3) |
128083272 | Aluminum hydroxide (Al(OH)3) |
151393941 | Aluminum hydroxide (Al(OH)3) |
159704775 | Aluminum hydroxide (Al(OH)3) |
227961515 | Aluminum hydroxide (Al(OH)3) |
546141622 | Aluminum hydroxide (Al(OH)3) |
546141688 | Aluminum hydroxide (Al(OH)3) |
1071843349 | Aluminum hydroxide (Al(OH)3) |
1344281 | Aluminum oxide (Al2O3) |
12522882 | Aluminum oxide (Al2O3) |
12737165 | Aluminum oxide (Al2O3) |
39354499 | Aluminum oxide (Al2O3) |
53809964 | Aluminum oxide (Al2O3) |
54352044 | Aluminum oxide (Al2O3) |
67853354 | Aluminum oxide (Al2O3) |
67894148 | Aluminum oxide (Al2O3) |
67894422 | Aluminum oxide (Al2O3) |
68189684 | Aluminum oxide (Al2O3) |
68389424 | Aluminum oxide (Al2O3) |
68389435 | Aluminum oxide (Al2O3) |
74871106 | Aluminum oxide (Al2O3) |
76363810 | Aluminum oxide (Al2O3) |
84149213 | Aluminum oxide (Al2O3) |
90669628 | Aluminum oxide (Al2O3) |
107462077 | Aluminum oxide (Al2O3) |
107874146 | Aluminum oxide (Al2O3) |
117314008 | Aluminum oxide (Al2O3) |
122784354 | Aluminum oxide (Al2O3) |
127361040 | Aluminum oxide (Al2O3) |
131689140 | Aluminum oxide (Al2O3) |
135152657 | Aluminum oxide (Al2O3) |
135667708 | Aluminum oxide (Al2O3) |
138361587 | Aluminum oxide (Al2O3) |
148619390 | Aluminum oxide (Al2O3) |
152743265 | Aluminum oxide (Al2O3) |
153858981 | Aluminum oxide (Al2O3) |
157516295 | Aluminum oxide (Al2O3) |
163581508 | Aluminum oxide (Al2O3) |
165390910 | Aluminum oxide (Al2O3) |
170448814 | Aluminum oxide (Al2O3) |
190401786 | Aluminum oxide (Al2O3) |
200295994 | Aluminum oxide (Al2O3) |
205316365 | Aluminum oxide (Al2O3) |
209552432 | Aluminum oxide (Al2O3) |
230616054 | Aluminum oxide (Al2O3) |
252756357 | Aluminum oxide (Al2O3) |
253606450 | Aluminum oxide (Al2O3) |
253606461 | Aluminum oxide (Al2O3) |
253606472 | Aluminum oxide (Al2O3) |
268724089 | Aluminum oxide (Al2O3) |
334869464 | Aluminum oxide (Al2O3) |
457654465 | Aluminum oxide (Al2O3) |
488831465 | Aluminum oxide (Al2O3) |
521982718 | Aluminum oxide (Al2O3) |
546141611 | Aluminum oxide (Al2O3) |
663170523 | Aluminum oxide (Al2O3) |
916225600 | Aluminum oxide (Al2O3) |
960377086 | Aluminum oxide (Al2O3) |
1011245207 | Aluminum oxide (Al2O3) |
1022097819 | Aluminum oxide (Al2O3) |
1097999444 | Aluminum oxide (Al2O3) |
1197416355 | Aluminum oxide (Al2O3) |
1234495705 | Aluminum oxide (Al2O3) |
1239586425 | Aluminum oxide (Al2O3) |
1346644152 | Aluminum oxide (Al2O3) |
1355357833 | Aluminum oxide (Al2O3) |
1493598529 | Aluminum oxide (Al2O3) |
11074274 | Aluminum oxide silicate (Al6O5(SiO4)2) |
12068563 | Aluminum oxide silicate (Al6O5(SiO4)2) |
64885489 | Aluminum oxide silicate (Al6O5(SiO4)2) |
124567028 | Aluminum oxide silicate (Al6O5(SiO4)2) |
163611038 | Aluminum oxide silicate (Al6O5(SiO4)2) |
164525319 | Aluminum oxide silicate (Al6O5(SiO4)2) |
220914476 | Aluminum oxide silicate (Al6O5(SiO4)2) |
1302450 | Aluminum phosphide (AlP) |
8005489 | Aluminum phosphide (AlP) |
20859738 | Aluminum phosphide (AlP) |
71751047 | Aluminum phosphide (AlP) |
182321386 | Aluminum phosphide (AlP) |
12005480 | Aluminum sodium oxide (Al11NaO17) |
155275528 | Aluminum sodium oxide (Al11NaO17) |
12005162 | Aluminum sodium oxide (Al5NaO8) |
142030 | Aluminum, bis(acetato-.kappa.O)hydroxy- |
8000611 | Aluminum, bis(acetato-.kappa.O)hydroxy- |
8012382 | Aluminum, bis(acetato-.kappa.O)hydroxy- |
7219650 | Aluminum, bis[2-(acetyloxy)benzoato-.kappa.O]hydroxy- |
12568728 | Aluminum, bis[2-(acetyloxy)benzoato-.kappa.O]hydroxy- |
23413801 | Aluminum, bis[2-(acetyloxy)benzoato-.kappa.O]hydroxy- |
61891325 | Aluminum, bis[2-(acetyloxy)benzoato-.kappa.O]hydroxy- |
1191157 | Aluminum, hydrobis(2-methylpropyl)- |
22537231 | Aluminum, ion (Al3+) |
97938 | Aluminum, triethyl- |
13482150 | Aluminum, triethyl- |
100992 | Aluminum, tris(2-methylpropyl)- |
130565627 | Aluminum, tris(2-methylpropyl)- |
18917914 | Aluminum, tris[2-(hydroxy-.kappa.O)propanoato-.kappa.O]- |
52100626 | Aluminum, tris[2-(hydroxy-.kappa.O)propanoato-.kappa.O]- |
13771227 | Aluminum, tris[tetrahydroborato(1-)-.kappa.H,.kappa.H']-, (OC-6-11)- |
7440359 | Americium, isotope of mass 241 |
14596102 | Americium, isotope of mass 241 |
8036484 | Amides, coco, N,N-bis(hydroxyethyl) |
8040311 | Amides, coco, N,N-bis(hydroxyethyl) |
8040333 | Amides, coco, N,N-bis(hydroxyethyl) |
12751063 | Amides, coco, N,N-bis(hydroxyethyl) |
53028629 | Amides, coco, N,N-bis(hydroxyethyl) |
56448727 | Amides, coco, N,N-bis(hydroxyethyl) |
56832667 | Amides, coco, N,N-bis(hydroxyethyl) |
63091316 | Amides, coco, N,N-bis(hydroxyethyl) |
66984585 | Amides, coco, N,N-bis(hydroxyethyl) |
67785108 | Amides, coco, N,N-bis(hydroxyethyl) |
67785142 | Amides, coco, N,N-bis(hydroxyethyl) |
68603429 | Amides, coco, N,N-bis(hydroxyethyl) |
71343516 | Amides, coco, N,N-bis(hydroxyethyl) |
71343710 | Amides, coco, N,N-bis(hydroxyethyl) |
83652146 | Amides, coco, N,N-bis(hydroxyethyl) |
87714189 | Amides, coco, N,N-bis(hydroxyethyl) |
90651471 | Amides, coco, N,N-bis(hydroxyethyl) |
118104135 | Amides, coco, N,N-bis(hydroxyethyl) |
153189696 | Amides, coco, N,N-bis(hydroxyethyl) |
186615781 | Amides, coco, N,N-bis(hydroxyethyl) |
7664417 | Ammonia |
8007576 | Ammonia |
208990072 | Ammonia |
214478054 | Ammonia |
558443520 | Ammonia |
7789324 | Ammonium bromide ((NH4)Br) |
12124979 | Ammonium bromide ((NH4)Br) |
14216865 | Ammonium bromide ((NH4)Br) |
80209354 | Ammonium bromide ((NH4)Br) |
101215763 | Ammonium bromide ((NH4)Br) |
204322883 | Ammonium bromide ((NH4)Br) |
252189563 | Ammonium bromide ((NH4)Br) |
357290881 | Ammonium bromide ((NH4)Br) |
12125029 | Ammonium chloride ((NH4)Cl) |
15630612 | Ammonium chloride ((NH4)Cl) |
20548087 | Ammonium chloride ((NH4)Cl) |
50295880 | Ammonium chloride ((NH4)Cl) |
55871051 | Ammonium chloride ((NH4)Cl) |
75944364 | Ammonium chloride ((NH4)Cl) |
89485847 | Ammonium chloride ((NH4)Cl) |
89485858 | Ammonium chloride ((NH4)Cl) |
127634246 | Ammonium chloride ((NH4)Cl) |
128532423 | Ammonium chloride ((NH4)Cl) |
154383489 | Ammonium chloride ((NH4)Cl) |
867060751 | Ammonium chloride ((NH4)Cl) |
1260366184 | Ammonium chloride ((NH4)Cl) |
1336216 | Ammonium hydroxide ((NH4)(OH)) |
16393490 | Ammonium hydroxide ((NH4)(OH)) |
125888871 | Ammonium hydroxide ((NH4)(OH)) |
132103607 | Ammonium hydroxide ((NH4)(OH)) |
178115930 | Ammonium hydroxide ((NH4)(OH)) |
1252662615 | Ammonium hydroxide ((NH4)(OH)) |
1269620598 | Ammonium hydroxide ((NH4)(OH)) |
1313584687 | Ammonium hydroxide ((NH4)(OH)) |
1398052851 | Ammonium hydroxide ((NH4)(OH)) |
52628258 | Ammonium zinc chloride |
1318098 | Amphibole-group minerals |
1332214 | Amphibole-group minerals |
1397893 | Amphotericin B |
30652870 | Amphotericin B |
57852 | Androst-4-en-3-one, 17-(1-oxopropoxy)-, (17.beta.)- |
1050678755 | Androst-4-en-3-one, 17-(1-oxopropoxy)-, (17.beta.)- |
79641 | Androst-4-en-3-one, 17-hydroxy-6-methyl-17-(1-propynyl)-, (6.alpha.,17.beta.)- |
434071 | Androstan-3-one, 17-hydroxy-2-(hydroxymethylene)-17-methyl-, (5.alpha.,17.beta.)- |
120127 | Anthracene |
120207 | Anthracene |
142041 | Anthracene |
602608 | Anthracene, 9-nitro- |
1719068 | Anthracene-d10 |
17111954 | Antimonate(1-), hexafluoro-, (OC-6-11)- |
22359882 | Antimonate(1-), hexafluoro-, (OC-6-11)- |
77392724 | Antimonate(1-), hexafluoro-, (OC-6-11)- |
304610 | Antimonate(2-), bis[.mu.-[2,3-di(hydroxy-.kappa.O)butanedioato(4-)-.kappa.O1:.kappa.O4]]di-, dipotassium, trihydrate, stereoisomer |
1332418 | Antimonate(2-), bis[.mu.-[2,3-di(hydroxy-.kappa.O)butanedioato(4-)-.kappa.O1:.kappa.O4]]di-, dipotassium, trihydrate, stereoisomer |
1332430 | Antimonate(2-), bis[.mu.-[2,3-di(hydroxy-.kappa.O)butanedioato(4-)-.kappa.O1:.kappa.O4]]di-, dipotassium, trihydrate, stereoisomer |
6780105 | Antimonate(2-), bis[.mu.-[2,3-di(hydroxy-.kappa.O)butanedioato(4-)-.kappa.O1:.kappa.O4]]di-, dipotassium, trihydrate, stereoisomer |
8012644 | Antimonate(2-), bis[.mu.-[2,3-di(hydroxy-.kappa.O)butanedioato(4-)-.kappa.O1:.kappa.O4]]di-, dipotassium, trihydrate, stereoisomer |
12125109 | Antimonate(2-), bis[.mu.-[2,3-di(hydroxy-.kappa.O)butanedioato(4-)-.kappa.O1:.kappa.O4]]di-, dipotassium, trihydrate, stereoisomer |
16039648 | Antimonate(2-), bis[.mu.-[2,3-di(hydroxy-.kappa.O)butanedioato(4-)-.kappa.O1:.kappa.O4]]di-, dipotassium, trihydrate, stereoisomer |
26282951 | Antimonate(2-), bis[.mu.-[2,3-di(hydroxy-.kappa.O)butanedioato(4-)-.kappa.O1:.kappa.O4]]di-, dipotassium, trihydrate, stereoisomer |
28300745 | Antimonate(2-), bis[.mu.-[2,3-di(hydroxy-.kappa.O)butanedioato(4-)-.kappa.O1:.kappa.O4]]di-, dipotassium, trihydrate, stereoisomer |
53318722 | Antimonate(2-), bis[.mu.-[2,3-di(hydroxy-.kappa.O)butanedioato(4-)-.kappa.O1:.kappa.O4]]di-, dipotassium, trihydrate, stereoisomer |
255877157 | Antimonate(2-), bis[.mu.-[2,3-di(hydroxy-.kappa.O)butanedioato(4-)-.kappa.O1:.kappa.O4]]di-, dipotassium, trihydrate, stereoisomer |
7440360 | Antimony |
73063679 | Antimony |
117011479 | Antimony |
7783702 | Antimony fluoride (SbF5) |
1327339 | Antimony oxide |
1309644 | Antimony oxide (Sb2O3) |
10042996 | Antimony oxide (Sb2O3) |
12423584 | Antimony oxide (Sb2O3) |
97048221 | Antimony oxide (Sb2O3) |
97048232 | Antimony oxide (Sb2O3) |
154396415 | Antimony oxide (Sb2O3) |
178989930 | Antimony oxide (Sb2O3) |
212793414 | Antimony oxide (Sb2O3) |
14374799 | Antimony, isotope of mass 122 |
14683104 | Antimony, isotope of mass 124 |
14234356 | Antimony, isotope of mass 125 |
13968508 | Antimony, isotope of mass 127 |
1397940 | Antimycin A |
37330191 | Antimycin A |
50858985 | Antimycin A |
506616 | Argentate(1-), bis(cyano-.kappa.C)-, potassium (1:1) |
2541675 | Argentate(1-), bis(cyano-.kappa.C)-, potassium (1:1) |
1336363 | Aroclor |
12767792 | Aroclor |
12674112 | Aroclor 1016 |
11104282 | Aroclor 1221 |
11141165 | Aroclor 1232 |
37324235 | Aroclor 1262 |
11100144 | Aroclor 1268 |
1264238 | Aroclor 5442 |
12642238 | Aroclor 5442 |
8042566 | Aromatic hydrocarbons |
8043978 | Aromatic hydrocarbons |
8043989 | Aromatic hydrocarbons |
8043990 | Aromatic hydrocarbons |
12738497 | Aromatic hydrocarbons |
37232045 | Aromatic hydrocarbons |
42615236 | Aromatic hydrocarbons |
50958286 | Aromatic hydrocarbons |
51990148 | Aromatic hydrocarbons |
52622885 | Aromatic hydrocarbons |
52623402 | Aromatic hydrocarbons |
60616980 | Aromatic hydrocarbons |
60937737 | Aromatic hydrocarbons |
63231516 | Aromatic hydrocarbons |
65987748 | Aromatic hydrocarbons |
92308140 | Aromatic hydrocarbons |
96538511 | Aromatic hydrocarbons |
102257318 | Aromatic hydrocarbons |
107991242 | Aromatic hydrocarbons |
115831873 | Aromatic hydrocarbons |
7784465 | Arsenenous acid, sodium salt (1:1) |
7440382 | Arsenic |
39277515 | Arsenic |
55624629 | Arsenic |
1327522 | Arsenic acid (H3AsO4) |
7778394 | Arsenic acid (H3AsO4) |
58076827 | Arsenic acid (H3AsO4) |
1333251 | Arsenic acid (H3AsO4), calcium salt (2:3) |
7778441 | Arsenic acid (H3AsO4), calcium salt (2:3) |
1450620866 | Arsenic acid (H3AsO4), calcium salt (2:3) |
10103614 | Arsenic acid (H3AsO4), copper salt (1:?) |
56626063 | Arsenic acid (H3AsO4), copper salt (1:?) |
10048950 | Arsenic acid (H3AsO4), disodium salt, heptahydrate |
7784409 | Arsenic acid (H3AsO4), lead(2+) salt (1:1) |
14034765 | Arsenic acid (H3AsO4), lead(2+) salt (1:1) |
37196284 | Arsenic acid (H3AsO4), lead(2+) salt (1:1) |
7645252 | Arsenic acid (H3AsO4), lead(4+) salt (3:2) |
10102484 | Arsenic acid (H3AsO4), lead(4+) salt (3:2) |
7631892 | Arsenic acid (H3AsO4), sodium salt (1:?) |
11105047 | Arsenic acid (H3AsO4), sodium salt (1:?) |
7440382 | Arsenic compounds |
8028737 | Arsenic compounds |
1327533 | Arsenic oxide (As2O3) |
28380383 | Arsenic oxide (As2O3) |
856307432 | Arsenic oxide (As2O3) |
1303282 | Arsenic oxide (As2O5) |
12355850 | Arsenic oxide (As2O5) |
13843657 | Arsenic oxide (As2O5) |
856565656 | Arsenic oxide (As2O5) |
1303339 | Arsenic sulfide (As2S3) |
12393612 | Arsenic sulfide (As2S3) |
188947559 | Arsenic sulfide (As2S3) |
217972775 | Arsenic sulfide (As2S3) |
352030729 | Arsenic sulfide (As2S3) |
1315336312 | Arsenic sulfide (As2S3) |
22541544 | Arsenic, ion (As3+) |
22569728 | Arsenic, ion (As3+) |
15422590 | Arsenic, isotope of mass 73 |
14304780 | Arsenic, isotope of mass 74 |
15575209 | Arsenic, isotope of mass 76 |
14687617 | Arsenic, isotope of mass 77 |
7784341 | Arsenous trichloride |
8011674 | Arsenous trichloride |
7784421 | Arsine |
692422 | Arsine, diethyl- |
75605 | Arsinic acid, As,As-dimethyl- |
8073107 | Arsinic acid, As,As-dimethyl- |
11126731 | Arsinic acid, As,As-dimethyl- |
58114731 | Arsinic acid, As,As-dimethyl- |
124652 | Arsinic acid, As,As-dimethyl-, sodium salt (1:1) |
63665225 | Arsinic acid, As,As-dimethyl-, sodium salt (1:1) |
127855 | Arsonic acid, (4-aminophenyl)-, monosodium salt |
121197 | Arsonic acid, As-(4-hydroxy-3-nitrophenyl)- |
8028226 | Arsonic acid, As-(4-hydroxy-3-nitrophenyl)- |
8028237 | Arsonic acid, As-(4-hydroxy-3-nitrophenyl)- |
98055 | Arsonic acid, As-phenyl- |
50641753 | Arsonic acid, [4-[(aminoacetyl)amino]phenyl]-, bismuth salt, mixt. with N4-(7-chloro-4-quinolinyl)-N1,N1-diethyl-1,4-pentanediamine phosphate, 5,7-diiodo-8-quinolinol and 3-pyridinecarboxamide |
121595 | Arsonic acid, [4-[(aminocarbonyl)amino]phenyl]- |
1333240 | Arsonic acid, calcium salt (1:1) |
52740166 | Arsonic acid, calcium salt (1:1) |
75348311 | Arsonic acid, calcium salt (1:1) |
117746551 | Arsonic acid, calcium salt (1:1) |
124583 | Arsonic acid, methyl-, monosodium salt |
2163806 | Arsonic acid, methyl-, monosodium salt |
10124502 | Arsonic acid, potassium salt |
696286 | Arsonous dichloride, As-phenyl- |
1332214 | Asbestos |
12413455 | Asbestos |
77641599 | Asbestos |
329202133 | Asbestos |
12001295 | Asbestos, chrysotile |
132207320 | Asbestos, chrysotile |
68131748 | Ashes (residues) |
68308178 | Ashes (residues) |
68308189 | Ashes (residues) |
68439849 | Ashes (residues) |
69012846 | Ashes (residues) |
329065125 | Ashes (residues) |
8052424 | Asphalt |
12197227 | Asphalt |
50922300 | Asphalt |
308062773 | Asphalt |
851786522 | Asphalt |
8052424 | Asphalt, cutback |
308062762 | Asphalt, cutback |
65195553 | Avermectin B1 |
71751412 | Avermectin B1 |
86753299 | Avermectin B1 |
100920727 | Avermectin B1 |
122666971 | Avermectin B1 |
138794431 | Avermectin B1 |
181658855 | Avermectin B1 |
4396274 | Azecine, decahydro- |
14343692 | Azide |
17778880 | Azide |
26628228 | Azide |
151564 | Aziridine |
99932760 | Aziridine |
52224 | Aziridine, 1,1',1''-phosphinothioylidynetris- |
52244 | Aziridine, 1,1',1''-phosphinothioylidynetris- |
75558 | Aziridine, 2-methyl- |
18961449 | Aziridine, 2-methyl- |
18961450 | Aziridine, 2-methyl- |
59204103 | Aziridine, 2-methyl- |
50077 | Azirino[2',3':3,4]pyrrolo[1,2-a]indole-4,7-dione, 6-amino-8-[[(aminocarbonyl)oxy]methyl]-1,1a,2,8,8a,8b-hexahydro-8a-methoxy-5-methyl-, (1aS,8S,8aR,8bS)- |
7481687 | Azirino[2',3':3,4]pyrrolo[1,2-a]indole-4,7-dione, 6-amino-8-[[(aminocarbonyl)oxy]methyl]-1,1a,2,8,8a,8b-hexahydro-8a-methoxy-5-methyl-, (1aS,8S,8aR,8bS)- |
74349487 | Azirino[2',3':3,4]pyrrolo[1,2-a]indole-4,7-dione, 6-amino-8-[[(aminocarbonyl)oxy]methyl]-1,1a,2,8,8a,8b-hexahydro-8a-methoxy-5-methyl-, (1aS,8S,8aR,8bS)- |
144085530 | Azirino[2',3':3,4]pyrrolo[1,2-a]indole-4,7-dione, 6-amino-8-[[(aminocarbonyl)oxy]methyl]-1,1a,2,8,8a,8b-hexahydro-8a-methoxy-5-methyl-, (1aS,8S,8aR,8bS)- |
7440393 | Barium |
10361372 | Barium chloride (BaCl2) |
10326279 | Barium chloride (BaCl2), dihydrate |
7440393 | Barium compounds |
10361372 | Barium compounds |
542621 | Barium cyanide (Ba(CN)2) |
1304285 | Barium oxide (BaO) |
12231515 | Barium oxide (BaO) |
1269419455 | Barium oxide (BaO) |
13981414 | Barium, isotope of mass 133 |
14798084 | Barium, isotope of mass 140 |
1318167 | Bauxite |
1302789 | Bentonite |
10043079 | Bentonite |
11004129 | Bentonite |
12198924 | Bentonite |
12199698 | Bentonite |
37320722 | Bentonite |
52623662 | Bentonite |
70131509 | Bentonite |
115628712 | Bentonite |
135945016 | Bentonite |
850872774 | Bentonite |
868047512 | Bentonite |
56553 | Benz[a]anthracene |
56564 | Benz[a]anthracene, 7,12-dimethyl- |
57976 | Benz[a]anthracene, 7,12-dimethyl- |
16238565 | Benz[a]anthracene, 7-(bromomethyl)-12-methyl- |
517282 | Benz[b]indeno[1,2-d]pyran-3,4,6a,9,10(6H)-pentol, 7,11b-dihydro-, (6aS,11bR)- |
1412197 | Benz[b]indeno[1,2-d]pyran-3,4,6a,9,10(6H)-pentol, 7,11b-dihydro-, (6aS,11bR)- |
22562636 | Benz[b]indeno[1,2-d]pyran-3,4,6a,9,10(6H)-pentol, 7,11b-dihydro-, (6aS,11bR)- |
225514 | Benz[c]acridine |
345623496 | Benz[c]acridine |
963893 | Benz[c]acridine, 7,9-dimethyl- |
205992 | Benz[e]acephenanthrylene |
858790600 | Benz[e]acephenanthrylene |
56832736 | Benz[e]acephenanthrylene and/or Benzo[k]fluoranthene |
56495 | Benz[j]aceanthrylene, 1,2-dihydro-3-methyl- |
345299312 | Benz[j]aceanthrylene, 1,2-dihydro-3-methyl- |
100527 | Benzaldehyde |
4460860 | Benzaldehyde, 2,4,5-trimethoxy- |
14374620 | Benzaldehyde, 2,4,5-trimethoxy- |
89985 | Benzaldehyde, 2-chloro- |
76341690 | Benzaldehyde, 2-chloro-4-hydroxy-3,5-dimethoxy- |
529204 | Benzaldehyde, 2-methyl- |
120149 | Benzaldehyde, 3,4-dimethoxy- |
121324 | Benzaldehyde, 3-ethoxy-4-hydroxy- |
620235 | Benzaldehyde, 3-methyl- |
939979 | Benzaldehyde, 4-(1,1-dimethylethyl)- |
34032412 | Benzaldehyde, 4-(1,1-dimethylethyl)- |
104881 | Benzaldehyde, 4-chloro- |
68359579 | Benzaldehyde, 4-fluoro-3-phenoxy- |
121335 | Benzaldehyde, 4-hydroxy-3-methoxy- |
8014424 | Benzaldehyde, 4-hydroxy-3-methoxy- |
52447639 | Benzaldehyde, 4-hydroxy-3-methoxy- |
1334787 | Benzaldehyde, methyl- |
8027790 | Benzaldehyde, methyl- |
55210 | Benzamide |
27208384 | Benzamide |
65452 | Benzamide, 2-hydroxy- |
527855 | Benzamide, 2-methyl- |
148016 | Benzamide, 2-methyl-3,5-dinitro- |
610151 | Benzamide, 2-nitro- |
11097113 | Benzamide, 3,5-dichloro-N-(1,1-dimethyl-2-propynyl)- |
11097124 | Benzamide, 3,5-dichloro-N-(1,1-dimethyl-2-propynyl)- |
23950585 | Benzamide, 3,5-dichloro-N-(1,1-dimethyl-2-propynyl)- |
66393622 | Benzamide, 3,5-dichloro-N-(1,1-dimethyl-2-propynyl)- |
645090 | Benzamide, 3-nitro- |
97325 | Benzamide, 4-methoxy-3-nitro-N-phenyl- |
619807 | Benzamide, 4-nitro- |
72178020 | Benzamide, 5-[2-chloro-4-(trifluoromethyl)phenoxy]-N-(methylsulfonyl)-2-nitro- |
108731700 | Benzamide, 5-[2-chloro-4-(trifluoromethyl)phenoxy]-N-(methylsulfonyl)-2-nitro- |
50657 | Benzamide, 5-chloro-N-(2-chloro-4-nitrophenyl)-2-hydroxy-, compound with 2-aminoethanol (1:1) |
1420048 | Benzamide, 5-chloro-N-(2-chloro-4-nitrophenyl)-2-hydroxy-, compound with 2-aminoethanol (1:1) |
131920 | Benzamide, N,N'-(10,15,16,17-tetrahydro-5,10,15,17-tetraoxo-5H-dinaphtho[2,3-a:2',3'-i]carbazole-4,9-diyl)bis- |
11098296 | Benzamide, N,N'-(10,15,16,17-tetrahydro-5,10,15,17-tetraoxo-5H-dinaphtho[2,3-a:2',3'-i]carbazole-4,9-diyl)bis- |
134623 | Benzamide, N,N-diethyl-3-methyl- |
94271031 | Benzamide, N,N-diethyl-3-methyl- |
671169 | Benzamide, N-(1-methylethyl)-4-[(2-methylhydrazino)methyl]- |
366701 | Benzamide, N-(1-methylethyl)-4-[(2-methylhydrazino)methyl]-, monohydrochloride |
5789720 | Benzamide, N-[(2-amino-6-methyl-3-pyridinyl)methyl]-3,4,5-trimethoxy- |
127719 | Benzamide, N-[(4-aminophenyl)sulfonyl]- |
35367385 | Benzamide, N-[[(4-chlorophenyl)amino]carbonyl]-2,6-difluoro- |
51026041 | Benzamide, N-[[(4-chlorophenyl)amino]carbonyl]-2,6-difluoro- |
53026032 | Benzamide, N-[[(4-chlorophenyl)amino]carbonyl]-2,6-difluoro- |
66594181 | Benzamide, N-[[(4-chlorophenyl)amino]carbonyl]-2,6-difluoro- |
104790810 | Benzamide, N-[[(4-chlorophenyl)amino]carbonyl]-2,6-difluoro- |
495181 | Benzamide, N-hydroxy- |
1005001 | Benzamide, N-hydroxy- |
613934 | Benzamide, N-methyl- |
4165611 | Benzen-d5-amine |
62533 | Benzenamine |
37342168 | Benzenamine |
146997946 | Benzenamine |
608275 | Benzenamine, 2,3-dichloro- |
87592 | Benzenamine, 2,3-dimethyl- |
137177 | Benzenamine, 2,4,5-trimethyl- |
634935 | Benzenamine, 2,4,6-trichloro- |
88051 | Benzenamine, 2,4,6-trimethyl- |
489985 | Benzenamine, 2,4,6-trinitro- |
1747848 | Benzenamine, 2,4-bis[(4-aminophenyl)methyl]- |
25834804 | Benzenamine, 2,4-bis[(4-aminophenyl)methyl]- |
85023296 | Benzenamine, 2,4-bis[(4-aminophenyl)methyl]- |
367259 | Benzenamine, 2,4-difluoro- |
2735048 | Benzenamine, 2,4-dimethoxy- |
54150695 | Benzenamine, 2,4-dimethoxy-, hydrochloride |
95681 | Benzenamine, 2,4-dimethyl- |
97029 | Benzenamine, 2,4-dinitro- |
95829 | Benzenamine, 2,5-dichloro- |
95783 | Benzenamine, 2,5-dimethyl- |
99309 | Benzenamine, 2,6-dichloro-4-nitro- |
102307 | Benzenamine, 2,6-dichloro-4-nitro- |
58916704 | Benzenamine, 2,6-dichloro-4-nitro- |
1135443694 | Benzenamine, 2,6-dichloro-4-nitro- |
87627 | Benzenamine, 2,6-dimethyl- |
1123533243 | Benzenamine, 2,6-dimethyl- |
1582098 | Benzenamine, 2,6-dinitro-N,N-dipropyl-4-(trifluoromethyl)- |
39300533 | Benzenamine, 2,6-dinitro-N,N-dipropyl-4-(trifluoromethyl)- |
52627528 | Benzenamine, 2,6-dinitro-N,N-dipropyl-4-(trifluoromethyl)- |
61373953 | Benzenamine, 2,6-dinitro-N,N-dipropyl-4-(trifluoromethyl)- |
71281306 | Benzenamine, 2,6-dinitro-N,N-dipropyl-4-(trifluoromethyl)- |
75635233 | Benzenamine, 2,6-dinitro-N,N-dipropyl-4-(trifluoromethyl)- |
643287 | Benzenamine, 2-(1-methylethyl)- |
1817738 | Benzenamine, 2-bromo-4,6-dinitro- |
95512 | Benzenamine, 2-chloro- |
108429 | Benzenamine, 2-chloro- |
121879 | Benzenamine, 2-chloro-4-nitro- |
94702 | Benzenamine, 2-ethoxy- |
578541 | Benzenamine, 2-ethyl- |
90040 | Benzenamine, 2-methoxy- |
134292 | Benzenamine, 2-methoxy- |
134292 | Benzenamine, 2-methoxy-, hydrochloride |
120718 | Benzenamine, 2-methoxy-5-methyl- |
99592 | Benzenamine, 2-methoxy-5-nitro- |
52756544 | Benzenamine, 2-methoxy-5-nitro- |
95534 | Benzenamine, 2-methyl- |
636215 | Benzenamine, 2-methyl-, hydrochloride (1:1) |
603838 | Benzenamine, 2-methyl-3-nitro- |
97563 | Benzenamine, 2-methyl-4-[2-(2-methylphenyl)diazenyl]- |
28676133 | Benzenamine, 2-methyl-4-[2-(2-methylphenyl)diazenyl]- |
99525 | Benzenamine, 2-methyl-4-nitro- |
99558 | Benzenamine, 2-methyl-5-nitro- |
570241 | Benzenamine, 2-methyl-6-nitro- |
88744 | Benzenamine, 2-nitro- |
119755 | Benzenamine, 2-nitro-N-phenyl- |
95761 | Benzenamine, 3,4-dichloro- |
6315895 | Benzenamine, 3,4-dimethoxy- |
95647 | Benzenamine, 3,4-dimethyl- |
108690 | Benzenamine, 3,5-dimethyl- |
98168 | Benzenamine, 3-(trifluoromethyl)- |
108429 | Benzenamine, 3-chloro- |
1083238510 | Benzenamine, 3-chloro- |
95749 | Benzenamine, 3-chloro-4-methyl- |
621330 | Benzenamine, 3-ethoxy- |
536903 | Benzenamine, 3-methoxy- |
918666974 | Benzenamine, 3-methoxy- |
16452010 | Benzenamine, 3-methoxy-4-methyl- |
108441 | Benzenamine, 3-methyl- |
638039 | Benzenamine, 3-methyl-, hydrochloride |
99092 | Benzenamine, 3-nitro- |
12262634 | Benzenamine, 3-nitro- |
479732 | Benzenamine, 4,4'-[(4-imino-2,5-cyclohexadien-1-ylidene)methylene]bis-, hydrochloride (1:1) |
569619 | Benzenamine, 4,4'-[(4-imino-2,5-cyclohexadien-1-ylidene)methylene]bis-, hydrochloride (1:1) |
70426607 | Benzenamine, 4,4'-[(4-imino-2,5-cyclohexadien-1-ylidene)methylene]bis-, hydrochloride (1:1) |
131883551 | Benzenamine, 4,4'-[(4-imino-2,5-cyclohexadien-1-ylidene)methylene]bis-, hydrochloride (1:1) |
187112409 | Benzenamine, 4,4'-[(4-imino-2,5-cyclohexadien-1-ylidene)methylene]bis-, hydrochloride (1:1) |
492808 | Benzenamine, 4,4'-carbonimidoylbis[N,N-dimethyl- |
2465272 | Benzenamine, 4,4'-carbonimidoylbis[N,N-dimethyl- |
105913608 | Benzenamine, 4,4'-carbonimidoylbis[N,N-dimethyl- |
101779 | Benzenamine, 4,4'-methylenebis- |
28602611 | Benzenamine, 4,4'-methylenebis- |
83712441 | Benzenamine, 4,4'-methylenebis- |
120859327 | Benzenamine, 4,4'-methylenebis- |
136601304 | Benzenamine, 4,4'-methylenebis- |
148263712 | Benzenamine, 4,4'-methylenebis- |
13552448 | Benzenamine, 4,4'-methylenebis-, hydrochloride (1:2) |
158963907 | Benzenamine, 4,4'-methylenebis-, hydrochloride (1:2) |
101144 | Benzenamine, 4,4'-methylenebis[2-chloro- |
104144 | Benzenamine, 4,4'-methylenebis[2-chloro- |
29371140 | Benzenamine, 4,4'-methylenebis[2-chloro- |
51065077 | Benzenamine, 4,4'-methylenebis[2-chloro- |
78642656 | Benzenamine, 4,4'-methylenebis[2-chloro- |
126699692 | Benzenamine, 4,4'-methylenebis[2-chloro- |
142661367 | Benzenamine, 4,4'-methylenebis[2-chloro- |
913092918 | Benzenamine, 4,4'-methylenebis[2-chloro- |
101611 | Benzenamine, 4,4'-methylenebis[N,N-dimethyl- |
30135649 | Benzenamine, 4,4'-methylenebis[N,N-dimethyl- |
101804 | Benzenamine, 4,4'-oxybis- |
121509793 | Benzenamine, 4,4'-oxybis- |
928208611 | Benzenamine, 4,4'-oxybis- |
80080 | Benzenamine, 4,4'-sulfonylbis- |
1246638152 | Benzenamine, 4,4'-sulfonylbis- |
139651 | Benzenamine, 4,4'-thiobis- |
101735 | Benzenamine, 4-(1-methylethoxy)-N-phenyl- |
33820530 | Benzenamine, 4-(1-methylethyl)-2,6-dinitro-N,N-dipropyl- |
34113218 | Benzenamine, 4-(1-methylethyl)-2,6-dinitro-N,N-dipropyl- |
60093 | Benzenamine, 4-(2-phenyldiazenyl)- |
81691681 | Benzenamine, 4-(2-phenyldiazenyl)- |
92364 | Benzenamine, 4-(6-methyl-2-benzothiazolyl)- |
632995 | Benzenamine, 4-[(4-aminophenyl)(4-imino-2,5-cyclohexadien-1-ylidene)methyl]-2-methyl-, hydrochloride (1:1) |
8053096 | Benzenamine, 4-[(4-aminophenyl)(4-imino-2,5-cyclohexadien-1-ylidene)methyl]-2-methyl-, hydrochloride (1:1) |
147299783 | Benzenamine, 4-[(4-aminophenyl)(4-imino-2,5-cyclohexadien-1-ylidene)methyl]-2-methyl-, hydrochloride (1:1) |
884244751 | Benzenamine, 4-[(4-aminophenyl)(4-imino-2,5-cyclohexadien-1-ylidene)methyl]-2-methyl-, hydrochloride (1:1) |
106401 | Benzenamine, 4-bromo- |
26227736 | Benzenamine, 4-butyl-N-[(4-methoxyphenyl)methylene]- |
128758963 | Benzenamine, 4-butyl-N-[(4-methoxyphenyl)methylene]- |
106478 | Benzenamine, 4-chloro- |
95692 | Benzenamine, 4-chloro-2-methyl- |
3165933 | Benzenamine, 4-chloro-2-methyl-, hydrochloride (1:1) |
89634 | Benzenamine, 4-chloro-2-nitro- |
156434 | Benzenamine, 4-ethoxy- |
589162 | Benzenamine, 4-ethyl- |
104949 | Benzenamine, 4-methoxy- |
20265978 | Benzenamine, 4-methoxy-, hydrochloride (1:1) |
102501 | Benzenamine, 4-methoxy-2-methyl- |
101702 | Benzenamine, 4-methoxy-N-(4-methoxyphenyl)- |
106490 | Benzenamine, 4-methyl- |
12221033 | Benzenamine, 4-methyl- |
540238 | Benzenamine, 4-methyl-, hydrochloride (1:1) |
89623 | Benzenamine, 4-methyl-2-nitro- |
119324 | Benzenamine, 4-methyl-3-nitro- |
100016 | Benzenamine, 4-nitro- |
156105 | Benzenamine, 4-nitroso-N-phenyl- |
101677 | Benzenamine, 4-octyl-N-(4-octylphenyl)- |
95794 | Benzenamine, 5-chloro-2-methyl- |
578461 | Benzenamine, 5-methyl-2-nitro- |
54886 | Benzenamine, N,N,3-trimethyl-4-(phenylazo)- |
91667 | Benzenamine, N,N-diethyl- |
54289462 | Benzenamine, N,N-diethyl-4-[2-(5-nitro-2-thiazolyl)diazenyl]- |
109048944 | Benzenamine, N,N-diethyl-4-[2-(5-nitro-2-thiazolyl)diazenyl]- |
121697 | Benzenamine, N,N-dimethyl- |
162744630 | Benzenamine, N,N-dimethyl- |
168153217 | Benzenamine, N,N-dimethyl- |
171745678 | Benzenamine, N,N-dimethyl- |
60117 | Benzenamine, N,N-dimethyl-4-(2-phenyldiazenyl)- |
55964959 | Benzenamine, N,N-dimethyl-4-(2-phenyldiazenyl)- |
77126002 | Benzenamine, N,N-dimethyl-4-(2-phenyldiazenyl)- |
3731393 | Benzenamine, N,N-dimethyl-4-[(2-methylphenyl)azo]- |
138896 | Benzenamine, N,N-dimethyl-4-nitroso- |
603349 | Benzenamine, N,N-diphenyl- |
149006348 | Benzenamine, N,N-diphenyl- |
39336602 | Benzenamine, N-(1-ethylpropyl)-3,4-dimethyl-2,6-dinitro- |
40487421 | Benzenamine, N-(1-ethylpropyl)-3,4-dimethyl-2,6-dinitro- |
64667170 | Benzenamine, N-(1-ethylpropyl)-3,4-dimethyl-2,6-dinitro- |
64719411 | Benzenamine, N-(1-ethylpropyl)-3,4-dimethyl-2,6-dinitro- |
155421402 | Benzenamine, N-(1-ethylpropyl)-3,4-dimethyl-2,6-dinitro- |
768525 | Benzenamine, N-(1-methylethyl)- |
24458488 | Benzenamine, N-(2-methyl-2-nitropropyl)-4-nitroso- |
29743155 | Benzenamine, N-[(4-butoxyphenyl)methylene]-4-ethyl- |
1861401 | Benzenamine, N-butyl-N-ethyl-2,6-dinitro-4-(trifluoromethyl)- |
66152770 | Benzenamine, N-butyl-N-ethyl-2,6-dinitro-4-(trifluoromethyl)- |
87209903 | Benzenamine, N-butyl-N-ethyl-2,6-dinitro-4-(trifluoromethyl)- |
103695 | Benzenamine, N-ethyl- |
3665803 | Benzenamine, N-ethyl-4-nitro- |
55283686 | Benzenamine, N-ethyl-N-(2-methyl-2-propen-1-yl)-2,6-dinitro-4-(trifluoromethyl)- |
612646 | Benzenamine, N-ethyl-N-nitroso- |
100652 | Benzenamine, N-hydroxy- |
135206 | Benzenamine, N-hydroxy-N-nitroso-, ammonium salt (1:1) |
7564707 | Benzenamine, N-hydroxy-N-nitroso-, ammonium salt (1:1) |
21255914 | Benzenamine, N-hydroxy-N-nitroso-, ammonium salt (1:1) |
125141562 | Benzenamine, N-hydroxy-N-nitroso-, ammonium salt (1:1) |
862780685 | Benzenamine, N-hydroxy-N-nitroso-, ammonium salt (1:1) |
1313437272 | Benzenamine, N-hydroxy-N-nitroso-, ammonium salt (1:1) |
100618 | Benzenamine, N-methyl- |
100152 | Benzenamine, N-methyl-4-nitro- |
479458 | Benzenamine, N-methyl-N,2,4,6-tetranitro- |
614006 | Benzenamine, N-methyl-N-nitroso- |
86306 | Benzenamine, N-nitroso-N-phenyl- |
156105 | Benzenamine, N-nitroso-N-phenyl- |
122394 | Benzenamine, N-phenyl- |
1135443741 | Benzenamine, N-phenyl- |
1300738 | Benzenamine, ar,ar-dimethyl- |
1330738 | Benzenamine, ar,ar-dimethyl- |
29191524 | Benzenamine, ar-methoxy- |
25640748 | Benzenamine, ar-methyl- |
26915128 | Benzenamine, ar-methyl- |
142041 | Benzenamine, hydrochloride (1:1) |
1415719731 | Benzenamine, hydrochloride (1:1) |
71432 | Benzene |
54682869 | Benzene |
174973661 | Benzene |
1053658437 | Benzene |
98066 | Benzene, (1,1-dimethylethyl)- |
27138212 | Benzene, (1,1-dimethylethyl)methyl- |
98839 | Benzene, (1-methylethenyl)- |
90828 | Benzene, (1-methylethyl)- |
98828 | Benzene, (1-methylethyl)- |
98839 | Benzene, (1-methylethyl)- |
135988 | Benzene, (1-methylpropyl)- |
135989 | Benzene, (1-methylpropyl)- |
36383150 | Benzene, (1-methylpropyl)- |
7166190 | Benzene, (2-bromo-2-nitroethenyl)- |
102965 | Benzene, (2-nitroethenyl)- |
100390 | Benzene, (bromomethyl)- |
1401918817 | Benzene, (bromomethyl)- |
447 | Benzene, (chloromethyl)- |
100447 | Benzene, (chloromethyl)- |
98873 | Benzene, (dichloromethyl)- |
149746 | Benzene, (dichloromethylsilyl)- |
155684416 | Benzene, (dichloromethylsilyl)- |
199330988 | Benzene, (dichloromethylsilyl)- |
3027212 | Benzene, (dimethoxymethylsilyl)- |
98077 | Benzene, (trichloromethyl)- |
98088 | Benzene, (trifluoromethyl)- |
98157 | Benzene, (trifluoromethyl)- |
569573 | Benzene, 1,1',1''-(1-chloro-1-ethenyl-2-ylidene)tris[4-methoxy- |
58720 | Benzene, 1,1',1''-(1-ethenyl-2-ylidene)tris- |
103300 | Benzene, 1,1'-(1E)-1,2-ethenediylbis- |
645498 | Benzene, 1,1'-(1Z)-1,2-ethenediylbis- |
50293 | Benzene, 1,1'-(2,2,2-trichloroethylidene)bis[4-chloro- |
1081843153 | Benzene, 1,1'-(2,2,2-trichloroethylidene)bis[4-chloro- |
72435 | Benzene, 1,1'-(2,2,2-trichloroethylidene)bis[4-methoxy- |
72548 | Benzene, 1,1'-(2,2-dichloroethylidene)bis[4-chloro- |
3547044 | Benzene, 1,1'-(2,2-dichloroethylidene)bis[4-chloro- |
6088513 | Benzene, 1,1'-(2,2-dichloroethylidene)bis[4-chloro- |
72560 | Benzene, 1,1'-(2,2-dichloroethylidene)bis[4-ethyl- |
72559 | Benzene, 1,1'-(dichloroethenylidene)bis[4-chloro- |
3547044 | Benzene, 1,1'-(dichloroethenylidene)bis[4-chloro- |
37853591 | Benzene, 1,1'-[1,2-ethanediylbis(oxy)]bis[2,4,6-tribromo- |
59764362 | Benzene, 1,1'-[1,2-ethanediylbis(oxy)]bis[2,4,6-tribromo- |
70226425 | Benzene, 1,1'-[1,2-ethanediylbis(oxy)]bis[2,4,6-tribromo- |
1071720507 | Benzene, 1,1'-[1,2-ethanediylbis(oxy)]bis[2,4,6-tribromo- |
538749 | Benzene, 1,1'-[thiobis(methylene)]bis- |
211578040 | Benzene, 1,1'-ethylidenebis-, isopropylated, distn. residues |
101688 | Benzene, 1,1'-methylenebis[4-isocyanato- |
140494 | Benzene, 1,1'-methylenebis[4-isocyanato- |
53633140 | Benzene, 1,1'-methylenebis[4-isocyanato- |
55157410 | Benzene, 1,1'-methylenebis[4-isocyanato- |
57460669 | Benzene, 1,1'-methylenebis[4-isocyanato- |
77090483 | Benzene, 1,1'-methylenebis[4-isocyanato- |
88001949 | Benzene, 1,1'-methylenebis[4-isocyanato- |
97568337 | Benzene, 1,1'-methylenebis[4-isocyanato- |
142690071 | Benzene, 1,1'-methylenebis[4-isocyanato- |
153986891 | Benzene, 1,1'-methylenebis[4-isocyanato- |
201528770 | Benzene, 1,1'-methylenebis[4-isocyanato- |
1211266599 | Benzene, 1,1'-methylenebis[4-isocyanato- |
1211316641 | Benzene, 1,1'-methylenebis[4-isocyanato- |
1220313654 | Benzene, 1,1'-methylenebis[4-isocyanato- |
1400594708 | Benzene, 1,1'-methylenebis[4-isocyanato- |
12125472 | Benzene, 1,1'-methylenebis[isocyanato- |
26447405 | Benzene, 1,1'-methylenebis[isocyanato- |
28515380 | Benzene, 1,1'-methylenebis[isocyanato- |
65916894 | Benzene, 1,1'-methylenebis[isocyanato- |
156580595 | Benzene, 1,1'-methylenebis[isocyanato- |
327155873 | Benzene, 1,1'-methylenebis[isocyanato- |
101848 | Benzene, 1,1'-oxybis- |
31242930 | Benzene, 1,1'-oxybis-, hexachloro deriv. |
55720995 | Benzene, 1,1'-oxybis-, hexachloro deriv. |
32534819 | Benzene, 1,1'-oxybis-, pentabromo deriv. |
132405960 | Benzene, 1,1'-oxybis-, pentabromo deriv. |
134206432 | Benzene, 1,1'-oxybis-, pentabromo deriv. |
95807 | Benzene, 1,1'-oxybis[2,3,4,5,6-pentabromo- |
1163195 | Benzene, 1,1'-oxybis[2,3,4,5,6-pentabromo- |
109945702 | Benzene, 1,1'-oxybis[2,3,4,5,6-pentabromo- |
145538745 | Benzene, 1,1'-oxybis[2,3,4,5,6-pentabromo- |
1201677328 | Benzene, 1,1'-oxybis[2,3,4,5,6-pentabromo- |
127639 | Benzene, 1,1'-sulfonylbis- |
87821 | Benzene, 1,2,3,4,5,6-hexabromo- |
118741 | Benzene, 1,2,3,4,5,6-hexachloro- |
38380073 | Benzene, 1,2,3,4,5,6-hexachloro- |
1135443456 | Benzene, 1,2,3,4,5,6-hexachloro- |
87854 | Benzene, 1,2,3,4,5,6-hexamethyl- |
46010495 | Benzene, 1,2,3,4,5,6-hexamethyl- |
85223 | Benzene, 1,2,3,4,5-pentabromo-6-ethyl- |
87832 | Benzene, 1,2,3,4,5-pentabromo-6-methyl- |
26101973 | Benzene, 1,2,3,4,5-pentabromo-6-methyl- |
608935 | Benzene, 1,2,3,4,5-pentachloro- |
82688 | Benzene, 1,2,3,4,5-pentachloro-6-nitro- |
39378262 | Benzene, 1,2,3,4,5-pentachloro-6-nitro- |
55353349 | Benzene, 1,2,3,4,5-pentachloro-6-nitro- |
56573570 | Benzene, 1,2,3,4,5-pentachloro-6-nitro- |
1135443489 | Benzene, 1,2,3,4,5-pentachloro-6-nitro- |
95943 | Benzene, 1,2,3,4-tetrachloro- |
634662 | Benzene, 1,2,3,4-tetrachloro- |
89939093 | Benzene, 1,2,3,4-tetrachloro-5-(trichloroethenyl)- |
879390 | Benzene, 1,2,3,4-tetrachloro-5-nitro- |
634902 | Benzene, 1,2,3,5-tetrachloro- |
87616 | Benzene, 1,2,3-trichloro- |
108907 | Benzene, 1,2,3-trichloro- |
17700093 | Benzene, 1,2,3-trichloro-4-nitro- |
526738 | Benzene, 1,2,3-trimethyl- |
95943 | Benzene, 1,2,4,5-tetrachloro- |
2438882 | Benzene, 1,2,4,5-tetrachloro-3-methoxy-6-nitro- |
117180 | Benzene, 1,2,4,5-tetrachloro-3-nitro- |
95932 | Benzene, 1,2,4,5-tetramethyl- |
120821 | Benzene, 1,2,4-trichloro- |
116290 | Benzene, 1,2,4-trichloro-5-[(4-chlorophenyl)sulfonyl]- |
89690 | Benzene, 1,2,4-trichloro-5-nitro- |
877441 | Benzene, 1,2,4-triethyl- |
95636 | Benzene, 1,2,4-trimethyl- |
95501 | Benzene, 1,2-dichloro- |
3209221 | Benzene, 1,2-dichloro-3-nitro- |
99547 | Benzene, 1,2-dichloro-4-nitro- |
93152 | Benzene, 1,2-dimethoxy-4-(2-propen-1-yl)- |
95476 | Benzene, 1,2-dimethyl- |
83410 | Benzene, 1,2-dimethyl-3-nitro- |
99514 | Benzene, 1,2-dimethyl-4-nitro- |
528290 | Benzene, 1,2-dinitro- |
179601231 | Benzene, 1,3(or 1,4)-dimethyl- |
108703 | Benzene, 1,3,5-trichloro- |
18708708 | Benzene, 1,3,5-trichloro-2-nitro- |
108678 | Benzene, 1,3,5-trimethyl- |
99354 | Benzene, 1,3,5-trinitro- |
856948613 | Benzene, 1,3,5-trinitro- |
541731 | Benzene, 1,3-dichloro- |
81196 | Benzene, 1,3-dichloro-2-(dichloromethyl)- |
108576 | Benzene, 1,3-diethenyl- |
91087 | Benzene, 1,3-diisocyanato-2-methyl- |
137091340 | Benzene, 1,3-diisocyanato-2-methyl- |
1321397 | Benzene, 1,3-diisocyanatomethyl- |
25321340 | Benzene, 1,3-diisocyanatomethyl- |
26471625 | Benzene, 1,3-diisocyanatomethyl- |
29033292 | Benzene, 1,3-diisocyanatomethyl- |
50853479 | Benzene, 1,3-diisocyanatomethyl- |
50985245 | Benzene, 1,3-diisocyanatomethyl- |
71215639 | Benzene, 1,3-diisocyanatomethyl- |
72214347 | Benzene, 1,3-diisocyanatomethyl- |
80498233 | Benzene, 1,3-diisocyanatomethyl- |
89698920 | Benzene, 1,3-diisocyanatomethyl- |
104213334 | Benzene, 1,3-diisocyanatomethyl- |
110681066 | Benzene, 1,3-diisocyanatomethyl- |
136154228 | Benzene, 1,3-diisocyanatomethyl- |
1186289235 | Benzene, 1,3-diisocyanatomethyl- |
1204229139 | Benzene, 1,3-diisocyanatomethyl- |
1204746086 | Benzene, 1,3-diisocyanatomethyl- |
1211316674 | Benzene, 1,3-diisocyanatomethyl- |
1326716942 | Benzene, 1,3-diisocyanatomethyl- |
1421949894 | Benzene, 1,3-diisocyanatomethyl- |
1422250416 | Benzene, 1,3-diisocyanatomethyl- |
1422343790 | Benzene, 1,3-diisocyanatomethyl- |
1432062264 | Benzene, 1,3-diisocyanatomethyl- |
108383 | Benzene, 1,3-dimethyl- |
81209 | Benzene, 1,3-dimethyl-2-nitro- |
99127 | Benzene, 1,3-dimethyl-5-nitro- |
99650 | Benzene, 1,3-dinitro- |
106467 | Benzene, 1,4-dichloro- |
2675776 | Benzene, 1,4-dichloro-2,5-dimethoxy- |
105055 | Benzene, 1,4-diethyl- |
104494 | Benzene, 1,4-diisocyanato- |
51807239 | Benzene, 1,4-diisocyanato- |
150787 | Benzene, 1,4-dimethoxy- |
106423 | Benzene, 1,4-dimethyl- |
89587 | Benzene, 1,4-dimethyl-2-nitro- |
35254683 | Benzene, 1,4-dimethyl-2-nitro- |
100254 | Benzene, 1,4-dinitro- |
83669 | Benzene, 1-(1,1-dimethylethyl)-2-methoxy-4-methyl-3,5-dinitro- |
98511 | Benzene, 1-(1,1-dimethylethyl)-4-methyl- |
612237 | Benzene, 1-(chloromethyl)-2-nitro- |
619238 | Benzene, 1-(chloromethyl)-3-nitro- |
100141 | Benzene, 1-(chloromethyl)-4-nitro- |
95465 | Benzene, 1-bromo-2-methyl- |
591173 | Benzene, 1-bromo-3-methyl- |
460004 | Benzene, 1-bromo-4-fluoro- |
106387 | Benzene, 1-bromo-4-methyl- |
101553 | Benzene, 1-bromo-4-phenoxy- |
97007 | Benzene, 1-chloro-2,4-dinitro- |
611198 | Benzene, 1-chloro-2-(chloromethyl)- |
40380152 | Benzene, 1-chloro-2-(chloromethyl)- |
88164 | Benzene, 1-chloro-2-(trifluoromethyl)- |
789026 | Benzene, 1-chloro-2-[2,2,2-trichloro-1-(4-chlorophenyl)ethyl]- |
58633173 | Benzene, 1-chloro-2-[2,2,2-trichloro-1-(4-chlorophenyl)ethyl]- |
3424826 | Benzene, 1-chloro-2-[2,2-dichloro-1-(4-chlorophenyl)ethenyl]- |
53190 | Benzene, 1-chloro-2-[2,2-dichloro-1-(4-chlorophenyl)ethyl]- |
1331288 | Benzene, 1-chloro-2-ethenyl- |
2039874 | Benzene, 1-chloro-2-ethenyl- |
95498 | Benzene, 1-chloro-2-methyl- |
88733 | Benzene, 1-chloro-2-nitro- |
121175 | Benzene, 1-chloro-2-nitro-4-(trifluoromethyl)- |
98157 | Benzene, 1-chloro-3-(trifluoromethyl)- |
108418 | Benzene, 1-chloro-3-methyl- |
121733 | Benzene, 1-chloro-3-nitro- |
123091 | Benzene, 1-chloro-4-(methylthio)- |
5216251 | Benzene, 1-chloro-4-(trichloromethyl)- |
98566 | Benzene, 1-chloro-4-(trifluoromethyl)- |
92709165 | Benzene, 1-chloro-4-(trifluoromethyl)- |
104121 | Benzene, 1-chloro-4-isocyanato- |
106434 | Benzene, 1-chloro-4-methyl- |
100005 | Benzene, 1-chloro-4-nitro- |
25167935 | Benzene, 1-chloro-4-nitro- |
7005723 | Benzene, 1-chloro-4-phenoxy- |
611143 | Benzene, 1-ethyl-2-methyl- |
620144 | Benzene, 1-ethyl-3-methyl- |
622968 | Benzene, 1-ethyl-4-methyl- |
70348 | Benzene, 1-fluoro-2,4-dinitro- |
91236 | Benzene, 1-methoxy-2-nitro- |
35973138 | Benzene, 1-methoxy-2-nitro- |
104461 | Benzene, 1-methoxy-4-(1-propen-1-yl)- |
8022080 | Benzene, 1-methoxy-4-(1-propen-1-yl)- |
12002403 | Benzene, 1-methoxy-4-(1-propen-1-yl)- |
140670 | Benzene, 1-methoxy-4-(2-propen-1-yl)- |
1407278 | Benzene, 1-methoxy-4-(2-propen-1-yl)- |
77525189 | Benzene, 1-methoxy-4-(2-propen-1-yl)- |
121142 | Benzene, 1-methyl-2,4-dinitro- |
88722 | Benzene, 1-methyl-2-nitro- |
57158051 | Benzene, 1-methyl-2-nitro- |
99081 | Benzene, 1-methyl-3-nitro- |
554847 | Benzene, 1-methyl-3-nitro- |
99865 | Benzene, 1-methyl-4-(1-methylethyl)- |
99876 | Benzene, 1-methyl-4-(1-methylethyl)- |
25155151 | Benzene, 1-methyl-4-(1-methylethyl)- |
99990 | Benzene, 1-methyl-4-nitro- |
384225 | Benzene, 1-nitro-2-(trifluoromethyl)- |
98464 | Benzene, 1-nitro-3-(trifluoromethyl)- |
1836755 | Benzene, 2,4-dichloro-1-(4-nitrophenoxy)- |
51274078 | Benzene, 2,4-dichloro-1-(4-nitrophenoxy)- |
95738 | Benzene, 2,4-dichloro-1-methyl- |
611063 | Benzene, 2,4-dichloro-1-nitro- |
86919 | Benzene, 2,4-diisocyanato-1-methyl- |
584840 | Benzene, 2,4-diisocyanato-1-methyl- |
584849 | Benzene, 2,4-diisocyanato-1-methyl- |
59539763 | Benzene, 2,4-diisocyanato-1-methyl- |
856307567 | Benzene, 2,4-diisocyanato-1-methyl- |
1358624380 | Benzene, 2,4-diisocyanato-1-methyl- |
89872 | Benzene, 2,4-dimethyl-1-nitro- |
25245345 | Benzene, 2-bromo-1,4-dimethoxy- |
88880 | Benzene, 2-chloro-1,3,5-trinitro- |
393759 | Benzene, 2-chloro-1,3-dinitro-5-(trifluoromethyl)- |
42874033 | Benzene, 2-chloro-1-(3-ethoxy-4-nitrophenoxy)-4-(trifluoromethyl)- |
55599401 | Benzene, 2-chloro-1-(3-ethoxy-4-nitrophenoxy)-4-(trifluoromethyl)- |
55840249 | Benzene, 2-chloro-1-(3-ethoxy-4-nitrophenoxy)-4-(trifluoromethyl)- |
118967 | Benzene, 2-methyl-1,3,5-trinitro- |
606202 | Benzene, 2-methyl-1,3-dinitro- |
28347139 | Benzene, bis(chloromethyl)- |
10861 | Benzene, bromo- |
108861 | Benzene, bromo- |
104518 | Benzene, butyl- |
74296325 | Benzene, butyl- |
108907 | Benzene, chloro- |
1089070 | Benzene, chloro- |
50717458 | Benzene, chloro- |
1331288 | Benzene, chloroethenyl- |
8063965 | Benzene, chloroethenyl- |
25338890 | Benzene, chloroethenyl- |
27213805 | Benzene, chloroethenyl- |
50973643 | Benzene, chloroethenyl- |
25168052 | Benzene, chloromethyl- |
27987139 | Benzene, chloromethyl- |
25167935 | Benzene, chloronitro- |
30498352 | Benzene, dichloro(trifluoromethyl)- |
25321226 | Benzene, dichloro- |
29797408 | Benzene, dichloromethyl- |
37808212 | Benzene, dichloromethyl- |
1321740 | Benzene, diethenyl- |
61804500 | Benzene, diethenyl- |
142315591 | Benzene, diethenyl- |
1161074323 | Benzene, diethenyl- |
1300829 | Benzene, diethyl- |
25340174 | Benzene, diethyl- |
1330207 | Benzene, dimethyl- |
8026093 | Benzene, dimethyl- |
36059219 | Benzene, dimethyl-, tetrabromo deriv. |
25154545 | Benzene, dinitro- |
121013 | Benzene, dodecyl- |
123013 | Benzene, dodecyl- |
28776387 | Benzene, dodecyl- |
97234 | Benzene, ethenyl- |
100425 | Benzene, ethenyl- |
79637119 | Benzene, ethenyl- |
1161074301 | Benzene, ethenyl- |
1198090468 | Benzene, ethenyl- |
1453489934 | Benzene, ethenyl- |
61255810 | Benzene, ethenyl-, heptachloro deriv. |
9003536 | Benzene, ethenyl-, homopolymer |
9044648 | Benzene, ethenyl-, homopolymer |
9055918 | Benzene, ethenyl-, homopolymer |
11120460 | Benzene, ethenyl-, homopolymer |
12627111 | Benzene, ethenyl-, homopolymer |
25038602 | Benzene, ethenyl-, homopolymer |
39470876 | Benzene, ethenyl-, homopolymer |
40494153 | Benzene, ethenyl-, homopolymer |
51609837 | Benzene, ethenyl-, homopolymer |
51609871 | Benzene, ethenyl-, homopolymer |
52932497 | Benzene, ethenyl-, homopolymer |
53112495 | Benzene, ethenyl-, homopolymer |
53986848 | Benzene, ethenyl-, homopolymer |
54578244 | Benzene, ethenyl-, homopolymer |
54596417 | Benzene, ethenyl-, homopolymer |
55128068 | Benzene, ethenyl-, homopolymer |
55465004 | Benzene, ethenyl-, homopolymer |
56451720 | Benzene, ethenyl-, homopolymer |
56748620 | Benzene, ethenyl-, homopolymer |
57657064 | Benzene, ethenyl-, homopolymer |
58033913 | Benzene, ethenyl-, homopolymer |
60120163 | Benzene, ethenyl-, homopolymer |
60328463 | Benzene, ethenyl-, homopolymer |
60880980 | Benzene, ethenyl-, homopolymer |
61584892 | Benzene, ethenyl-, homopolymer |
61584905 | Benzene, ethenyl-, homopolymer |
63849490 | Benzene, ethenyl-, homopolymer |
78354479 | Benzene, ethenyl-, homopolymer |
81834120 | Benzene, ethenyl-, homopolymer |
86090917 | Benzene, ethenyl-, homopolymer |
98444305 | Benzene, ethenyl-, homopolymer |
105270051 | Benzene, ethenyl-, homopolymer |
110866507 | Benzene, ethenyl-, homopolymer |
120037992 | Benzene, ethenyl-, homopolymer |
120534261 | Benzene, ethenyl-, homopolymer |
124229318 | Benzene, ethenyl-, homopolymer |
124229487 | Benzene, ethenyl-, homopolymer |
130243060 | Benzene, ethenyl-, homopolymer |
131495391 | Benzene, ethenyl-, homopolymer |
132827431 | Benzene, ethenyl-, homopolymer |
137262454 | Benzene, ethenyl-, homopolymer |
144637934 | Benzene, ethenyl-, homopolymer |
149212191 | Benzene, ethenyl-, homopolymer |
155197458 | Benzene, ethenyl-, homopolymer |
157243215 | Benzene, ethenyl-, homopolymer |
157929027 | Benzene, ethenyl-, homopolymer |
161776450 | Benzene, ethenyl-, homopolymer |
171022029 | Benzene, ethenyl-, homopolymer |
171022096 | Benzene, ethenyl-, homopolymer |
172641484 | Benzene, ethenyl-, homopolymer |
172867640 | Benzene, ethenyl-, homopolymer |
219782522 | Benzene, ethenyl-, homopolymer |
260975799 | Benzene, ethenyl-, homopolymer |
359762951 | Benzene, ethenyl-, homopolymer |
360046704 | Benzene, ethenyl-, homopolymer |
373601208 | Benzene, ethenyl-, homopolymer |
441772629 | Benzene, ethenyl-, homopolymer |
471865108 | Benzene, ethenyl-, homopolymer |
487021465 | Benzene, ethenyl-, homopolymer |
644984361 | Benzene, ethenyl-, homopolymer |
726192116 | Benzene, ethenyl-, homopolymer |
730985598 | Benzene, ethenyl-, homopolymer |
851588700 | Benzene, ethenyl-, homopolymer |
852837173 | Benzene, ethenyl-, homopolymer |
1083095639 | Benzene, ethenyl-, homopolymer |
1160710791 | Benzene, ethenyl-, homopolymer |
1187742342 | Benzene, ethenyl-, homopolymer |
1191987173 | Benzene, ethenyl-, homopolymer |
1227265555 | Benzene, ethenyl-, homopolymer |
1263545749 | Benzene, ethenyl-, homopolymer |
1397706692 | Benzene, ethenyl-, homopolymer |
1415127068 | Benzene, ethenyl-, homopolymer |
1415263614 | Benzene, ethenyl-, homopolymer |
1430218840 | Benzene, ethenyl-, homopolymer |
1462855566 | Benzene, ethenyl-, homopolymer |
1321455 | Benzene, ethenylmethyl- |
25013154 | Benzene, ethenylmethyl- |
1202865108 | Benzene, ethenylmethyl- |
1216569457 | Benzene, ethenylmethyl- |
100414 | Benzene, ethyl- |
27536896 | Benzene, ethyl-, homopolymer |
25154476 | Benzene, ethylmethyl- |
25550145 | Benzene, ethylmethyl- |
1171156163 | Benzene, ethylmethyl- |
462066 | Benzene, fluoro- |
103719 | Benzene, isocyanato- |
1025436183 | Benzene, isocyanato- |
71432 | Benzene, methyl benzene, and dimethyl benzene, total |
108883 | Benzene, methyl benzene, and dimethyl benzene, total |
1330207 | Benzene, methyl benzene, and dimethyl benzene, total |
8030306 | Benzene, methyl benzene, and dimethyl benzene, total |
108883 | Benzene, methyl- |
1053657774 | Benzene, methyl- |
1202864978 | Benzene, methyl- |
26898179 | Benzene, methylbis(phenylmethyl)- |
51176988 | Benzene, methylbis(phenylmethyl)- |
121142 | Benzene, methyldinitro- |
25321146 | Benzene, methyldinitro- |
29656153 | Benzene, methyldinitro- |
99081 | Benzene, methylnitro- |
1321126 | Benzene, methylnitro- |
98953 | Benzene, nitro- |
29082755 | Benzene, pentachloro(2,2-dichloroethenyl)- |
61593440 | Benzene, pentachloro(dichloroethenyl)- |
2982744 | Benzene, pentachloro(trichloroethenyl)- |
29082744 | Benzene, pentachloro(trichloroethenyl)- |
29086382 | Benzene, pentachloro[(1E)-1,2-dichloroethenyl]- |
29086393 | Benzene, pentachloro[(1Z)-1,2-dichloroethenyl]- |
1825214 | Benzene, pentachloromethoxy- |
103651 | Benzene, propyl- |
74296314 | Benzene, propyl- |
12408105 | Benzene, tetrachloro- |
25619607 | Benzene, tetramethyl- |
37235624 | Benzene, tetramethyl- |
50317 | Benzene, trichloro- |
12002481 | Benzene, trichloro- |
26601650 | Benzene, trichloromethyl- |
30583336 | Benzene, trichloromethyl- |
2551137 | Benzene, trimethyl- |
15551137 | Benzene, trimethyl- |
25551137 | Benzene, trimethyl- |
1076433 | Benzene-1,2,3,4,5,6-d6 |
2199691 | Benzene-1,2,3,4-d4, 5,6-dichloro- |
4165575 | Benzene-d5, bromo- |
20302265 | Benzene-d5, ethyl- |
4165600 | Benzene-d5, nitro- |
957517 | Benzeneacetamide, N,N-dimethyl-.alpha.-phenyl- |
12697948 | Benzeneacetamide, N,N-dimethyl-.alpha.-phenyl- |
73413066 | Benzeneacetamide, N,N-dimethyl-.alpha.-phenyl- |
70508 | Benzeneacetic acid, .alpha.-(hydroxymethyl)-, (1.alpha.,2.beta.,4.beta.,5.alpha.,7.beta.)-9-methyl-3-oxa-9-azatricyclo[3.3.1.02,4]non-7-yl ester, hydrobromide (1:1), (.alpha.S)- |
114498 | Benzeneacetic acid, .alpha.-(hydroxymethyl)-, (1.alpha.,2.beta.,4.beta.,5.alpha.,7.beta.)-9-methyl-3-oxa-9-azatricyclo[3.3.1.02,4]non-7-yl ester, hydrobromide (1:1), (.alpha.S)- |
8013727 | Benzeneacetic acid, .alpha.-(hydroxymethyl)-, (1.alpha.,2.beta.,4.beta.,5.alpha.,7.beta.)-9-methyl-3-oxa-9-azatricyclo[3.3.1.02,4]non-7-yl ester, hydrobromide (1:1), (.alpha.S)- |
6533682 | Benzeneacetic acid, .alpha.-(hydroxymethyl)-, (1.alpha.,2.beta.,4.beta.,5.alpha.,7.beta.)-9-methyl-3-oxa-9-azatricyclo[3.3.1.02,4]non-7-yl ester, hydrobromide, trihydrate, (.alpha.S)- |
6106816 | Benzeneacetic acid, .alpha.-(hydroxymethyl)-, (1.alpha.,2.beta.,4.beta.,5.alpha.,7.beta.)-9-methyl-9-oxido-3-oxa-9-azatricyclo[3.3.1.02,4]non-7-yl ester, hydrobromide (1:1), (.alpha.S)- |
66230044 | Benzeneacetic acid, 4-chloro-.alpha.-(1-methylethyl)-, (S)-cyano(3-phenoxyphenyl)methyl ester, (.alpha.S)- |
72650283 | Benzeneacetic acid, 4-chloro-.alpha.-(1-methylethyl)-, (S)-cyano(3-phenoxyphenyl)methyl ester, (.alpha.S)- |
51630581 | Benzeneacetic acid, 4-chloro-.alpha.-(1-methylethyl)-, cyano(3-phenoxyphenyl)methyl ester |
131641628 | Benzeneacetic acid, 4-chloro-.alpha.-(1-methylethyl)-, cyano(3-phenoxyphenyl)methyl ester |
510156 | Benzeneacetic acid, 4-chloro-.alpha.-(4-chlorophenyl)-.alpha.-hydroxy-, ethyl ester |
1336363 | Benzeneacetic acid, 4-chloro-.alpha.-(4-chlorophenyl)-.alpha.-hydroxy-, ethyl ester |
306081 | Benzeneacetic acid, 4-hydroxy-3-methoxy- |
140294 | Benzeneacetonitrile |
532285 | Benzeneacetonitrile, .alpha.-hydroxy- |
613887 | Benzeneacetonitrile, .alpha.-hydroxy- |
610662 | Benzeneacetonitrile, 2-nitro- |
305033 | Benzenebutanoic acid, 4-[bis(2-chloroethyl)amino]- |
614459 | Benzenecarboperoxoic acid, 1,1-dimethylethyl ester |
25376458 | Benzenediamine, ar-methyl- |
122098 | Benzeneethanamine, .alpha.,.alpha.-dimethyl- |
9008940 | Benzeneethanamine, .alpha.,.alpha.-dimethyl- |
12674134 | Benzeneethanamine, .alpha.,.alpha.-dimethyl- |
60139 | Benzeneethanamine, .alpha.-methyl-, sulfate |
60128 | Benzeneethanol |
15121843 | Benzeneethanol, 2-nitro- |
100276 | Benzeneethanol, 4-nitro- |
100469 | Benzenemethanamine |
857483239 | Benzenemethanamine |
858831933 | Benzenemethanamine |
92591 | Benzenemethanamine, N-ethyl-N-phenyl- |
56939 | Benzenemethanaminium, N,N,N-trimethyl-, chloride (1:1) |
121540 | Benzenemethanaminium, N,N-dimethyl-N-[2-[2-[4-(1,1,3,3-tetramethylbutyl)phenoxy]ethoxy]ethyl]-, chloride (1:1) |
39362384 | Benzenemethanaminium, N,N-dimethyl-N-[2-[2-[4-(1,1,3,3-tetramethylbutyl)phenoxy]ethoxy]ethyl]-, chloride (1:1) |
324034095 | Benzenemethanaminium, N,N-dimethyl-N-[2-[2-[4-(1,1,3,3-tetramethylbutyl)phenoxy]ethoxy]ethyl]-, chloride (1:1) |
5929099 | Benzenemethanaminium, N,N-dimethyl-N-[2-[2-[4-(1,1,3,3-tetramethylbutyl)phenoxy]ethoxy]ethyl]-, chloride, monohydrate |
122190 | Benzenemethanaminium, N,N-dimethyl-N-octadecyl-, chloride (1:1) |
37243600 | Benzenemethanaminium, N,N-dimethyl-N-octadecyl-, chloride (1:1) |
60650762 | Benzenemethanaminium, N,N-dimethyl-N-octadecyl-, chloride (1:1) |
89004386 | Benzenemethanaminium, N,N-dimethyl-N-octadecyl-, chloride (1:1) |
1334072 | Benzenemethanaminium, N-ethyl-N-[4-[[4-[ethyl[(3-sulfophenyl)methyl]amino]phenyl](2-sulfophenyl)methylene]-2,5-cyclohexadien-1-ylidene]-3-sulfo-, inner salt, ammonium salt (1:2) |
2650182 | Benzenemethanaminium, N-ethyl-N-[4-[[4-[ethyl[(3-sulfophenyl)methyl]amino]phenyl](2-sulfophenyl)methylene]-2,5-cyclohexadien-1-ylidene]-3-sulfo-, inner salt, ammonium salt (1:2) |
29519651 | Benzenemethanaminium, N-ethyl-N-[4-[[4-[ethyl[(3-sulfophenyl)methyl]amino]phenyl](2-sulfophenyl)methylene]-2,5-cyclohexadien-1-ylidene]-3-sulfo-, inner salt, ammonium salt (1:2) |
37307554 | Benzenemethanaminium, N-ethyl-N-[4-[[4-[ethyl[(3-sulfophenyl)methyl]amino]phenyl](2-sulfophenyl)methylene]-2,5-cyclohexadien-1-ylidene]-3-sulfo-, inner salt, ammonium salt (1:2) |
37307565 | Benzenemethanaminium, N-ethyl-N-[4-[[4-[ethyl[(3-sulfophenyl)methyl]amino]phenyl](2-sulfophenyl)methylene]-2,5-cyclohexadien-1-ylidene]-3-sulfo-, inner salt, ammonium salt (1:2) |
37307781 | Benzenemethanaminium, N-ethyl-N-[4-[[4-[ethyl[(3-sulfophenyl)methyl]amino]phenyl](2-sulfophenyl)methylene]-2,5-cyclohexadien-1-ylidene]-3-sulfo-, inner salt, ammonium salt (1:2) |
51609246 | Benzenemethanaminium, N-ethyl-N-[4-[[4-[ethyl[(3-sulfophenyl)methyl]amino]phenyl](2-sulfophenyl)methylene]-2,5-cyclohexadien-1-ylidene]-3-sulfo-, inner salt, ammonium salt (1:2) |
55819299 | Benzenemethanaminium, N-ethyl-N-[4-[[4-[ethyl[(3-sulfophenyl)methyl]amino]phenyl](2-sulfophenyl)methylene]-2,5-cyclohexadien-1-ylidene]-3-sulfo-, inner salt, ammonium salt (1:2) |
86924529 | Benzenemethanaminium, N-ethyl-N-[4-[[4-[ethyl[(3-sulfophenyl)methyl]amino]phenyl](2-sulfophenyl)methylene]-2,5-cyclohexadien-1-ylidene]-3-sulfo-, inner salt, ammonium salt (1:2) |
99149436 | Benzenemethanaminium, N-ethyl-N-[4-[[4-[ethyl[(3-sulfophenyl)methyl]amino]phenyl](2-sulfophenyl)methylene]-2,5-cyclohexadien-1-ylidene]-3-sulfo-, inner salt, ammonium salt (1:2) |
511534546 | Benzenemethanaminium, N-ethyl-N-[4-[[4-[ethyl[(3-sulfophenyl)methyl]amino]phenyl](2-sulfophenyl)methylene]-2,5-cyclohexadien-1-ylidene]-3-sulfo-, inner salt, ammonium salt (1:2) |
3844459 | Benzenemethanaminium, N-ethyl-N-[4-[[4-[ethyl[(3-sulfophenyl)methyl]amino]phenyl](2-sulfophenyl)methylene]-2,5-cyclohexadien-1-ylidene]-3-sulfo-, inner salt, sodium salt (1:2) |
70992302 | Benzenemethanaminium, N-ethyl-N-[4-[[4-[ethyl[(3-sulfophenyl)methyl]amino]phenyl](2-sulfophenyl)methylene]-2,5-cyclohexadien-1-ylidene]-3-sulfo-, inner salt, sodium salt (1:2) |
73319025 | Benzenemethanaminium, N-ethyl-N-[4-[[4-[ethyl[(3-sulfophenyl)methyl]amino]phenyl](2-sulfophenyl)methylene]-2,5-cyclohexadien-1-ylidene]-3-sulfo-, inner salt, sodium salt (1:2) |
82526327 | Benzenemethanaminium, N-ethyl-N-[4-[[4-[ethyl[(3-sulfophenyl)methyl]amino]phenyl](2-sulfophenyl)methylene]-2,5-cyclohexadien-1-ylidene]-3-sulfo-, inner salt, sodium salt (1:2) |
83155139 | Benzenemethanaminium, N-ethyl-N-[4-[[4-[ethyl[(3-sulfophenyl)methyl]amino]phenyl](2-sulfophenyl)methylene]-2,5-cyclohexadien-1-ylidene]-3-sulfo-, inner salt, sodium salt (1:2) |
145087805 | Benzenemethanaminium, N-ethyl-N-[4-[[4-[ethyl[(3-sulfophenyl)methyl]amino]phenyl](2-sulfophenyl)methylene]-2,5-cyclohexadien-1-ylidene]-3-sulfo-, inner salt, sodium salt (1:2) |
511534535 | Benzenemethanaminium, N-ethyl-N-[4-[[4-[ethyl[(3-sulfophenyl)methyl]amino]phenyl](2-sulfophenyl)methylene]-2,5-cyclohexadien-1-ylidene]-3-sulfo-, inner salt, sodium salt (1:2) |
1314116658 | Benzenemethanaminium, N-ethyl-N-[4-[[4-[ethyl[(3-sulfophenyl)methyl]amino]phenyl](2-sulfophenyl)methylene]-2,5-cyclohexadien-1-ylidene]-3-sulfo-, inner salt, sodium salt (1:2) |
4857834 | Benzenemethanaminium, N-ethyl-N-[4-[[4-[ethyl[(3-sulfophenyl)methyl]amino]phenyl](4-sulfophenyl)methylene]-2,5-cyclohexadien-1-ylidene]-3-sulfo-, inner salt, sodium salt (1:2) |
5141208 | Benzenemethanaminium, N-ethyl-N-[4-[[4-[ethyl[(3-sulfophenyl)methyl]amino]phenyl](4-sulfophenyl)methylene]-2,5-cyclohexadien-1-ylidene]-3-sulfo-, inner salt, sodium salt (1:2) |
4680788 | Benzenemethanaminium, N-ethyl-N-[4-[[4-[ethyl[(3-sulfophenyl)methyl]amino]phenyl]phenylmethylene]-2,5-cyclohexadien-1-ylidene]-3-sulfo-, inner salt, sodium salt (1:1) |
260057952 | Benzenemethanaminium, N-ethyl-N-[4-[[4-[ethyl[(3-sulfophenyl)methyl]amino]phenyl]phenylmethylene]-2,5-cyclohexadien-1-ylidene]-3-sulfo-, inner salt, sodium salt (1:1) |
100516 | Benzenemethanol |
1336272 | Benzenemethanol |
185532712 | Benzenemethanol |
134601 | Benzenemethanol, .alpha.-[(1R)-1-aminoethyl]-, (.alpha.S)-rel- |
700652 | Benzenemethanol, .alpha.-[(1R)-1-aminoethyl]-, (.alpha.S)-rel- |
14838154 | Benzenemethanol, .alpha.-[(1R)-1-aminoethyl]-, (.alpha.S)-rel- |
36393574 | Benzenemethanol, .alpha.-[(1R)-1-aminoethyl]-, (.alpha.S)-rel- |
134725 | Benzenemethanol, .alpha.-[(1S)-1-(methylamino)ethyl]-, (.alpha.R)-, sulfate (2:1) |
8048371 | Benzenemethanol, .alpha.-[(1S)-1-(methylamino)ethyl]-, (.alpha.R)-, sulfate (2:1) |
8052220 | Benzenemethanol, .alpha.-[(1S)-1-(methylamino)ethyl]-, (.alpha.R)-, sulfate (2:1) |
17140500 | Benzenemethanol, .alpha.-[(1S)-1-(methylamino)ethyl]-, (.alpha.R)-, sulfate (2:1) |
33096525 | Benzenemethanol, .alpha.-[(1S)-1-(methylamino)ethyl]-, (.alpha.R)-, sulfate (2:1) |
95330226 | Benzenemethanol, .alpha.-[(1S)-1-(methylamino)ethyl]-, (.alpha.R)-, sulfate (2:1) |
909278779 | Benzenemethanol, .alpha.-[(1S)-1-(methylamino)ethyl]-, (.alpha.R)-, sulfate (2:1) |
553695 | Benzenemethanol, .alpha.-[(2-pyridinylamino)methyl]- |
98851 | Benzenemethanol, .alpha.-methyl- |
13323814 | Benzenemethanol, .alpha.-methyl- |
61767 | Benzenemethanol, 3-hydroxy-.alpha.-[(methylamino)methyl]-, hydrochloride (1:1), (.alpha.R)- |
644224 | Benzenemethanol, 3-hydroxy-.alpha.-[(methylamino)methyl]-, hydrochloride (1:1), (.alpha.R)- |
827623 | Benzenemethanol, 3-hydroxy-.alpha.-[(methylamino)methyl]-, hydrochloride (1:1), (.alpha.R)- |
50741769 | Benzenemethanol, 3-hydroxy-.alpha.-[(methylamino)methyl]-, hydrochloride (1:1), (.alpha.R)- |
115322 | Benzenemethanol, 4-chloro-.alpha.-(4-chlorophenyl)-.alpha.-(trichloromethyl)- |
55599547 | Benzenemethanol, 4-chloro-.alpha.-(4-chlorophenyl)-.alpha.-(trichloromethyl)- |
395288 | Benzenemethanol, 4-hydroxy-.alpha.-[1-[(1-methyl-2-phenoxyethyl)amino]ethyl]- |
395299 | Benzenemethanol, 4-hydroxy-.alpha.-[1-[(1-methyl-2-phenoxyethyl)amino]ethyl]- |
1134470 | Benzenepropanoic acid, .beta.-(aminomethyl)-4-chloro- |
33069624 | Benzenepropanoic acid, .beta.-(benzoylamino)-.alpha.-hydroxy-, (2aR,4S,4aS,6R,9S,11S,12S,12aR,12bS)-6,12b-bis(acetyloxy)-12-(benzoyloxy)-2a,3,4,4a,5,6,9,10,11,12,12a,12b-dodecahydro-4,11-dihydroxy-4a,8,13,13-tetramethyl-5-oxo-7,11-methano-1H-cyclodeca[3,4]benz[1,2-b]oxet-9-yl ester, (.alpha.R,.beta.S)- |
2021285 | Benzenepropanoic acid, ethyl ester |
103059 | Benzenepropanol, .alpha.,.alpha.-dimethyl- |
64902723 | Benzenesulfonamide, 2-chloro-N-[[(4-methoxy-6-methyl-1,3,5-triazin-2-yl)amino]carbonyl]- |
112143778 | Benzenesulfonamide, 2-chloro-N-[[(4-methoxy-6-methyl-1,3,5-triazin-2-yl)amino]carbonyl]- |
19044883 | Benzenesulfonamide, 4-(dipropylamino)-3,5-dinitro- |
968810 | Benzenesulfonamide, 4-acetyl-N-[(cyclohexylamino)carbonyl]- |
8054328 | Benzenesulfonamide, 4-acetyl-N-[(cyclohexylamino)carbonyl]- |
63741 | Benzenesulfonamide, 4-amino- |
1337366 | Benzenesulfonamide, 4-amino- |
1337399 | Benzenesulfonamide, 4-amino- |
12765809 | Benzenesulfonamide, 4-amino- |
24706250 | Benzenesulfonamide, 4-amino- |
102489349 | Benzenesulfonamide, 4-amino- |
127695 | Benzenesulfonamide, 4-amino-N-(3,4-dimethyl-5-isoxazolyl)- |
207522063 | Benzenesulfonamide, 4-amino-N-(3,4-dimethyl-5-isoxazolyl)- |
57681 | Benzenesulfonamide, 4-amino-N-(4,6-dimethyl-2-pyrimidinyl)- |
144821 | Benzenesulfonamide, 4-amino-N-(5-methyl-1,3,4-thiadiazol-2-yl)- |
723466 | Benzenesulfonamide, 4-amino-N-(5-methyl-3-isoxazolyl)- |
129378898 | Benzenesulfonamide, 4-amino-N-(5-methyl-3-isoxazolyl)- |
72140 | Benzenesulfonamide, 4-amino-N-2-thiazolyl- |
6052331 | Benzenesulfonamide, 4-amino-N-2-thiazolyl- |
158269466 | Benzenesulfonamide, 4-amino-N-2-thiazolyl- |
859037277 | Benzenesulfonamide, 4-amino-N-2-thiazolyl- |
94202 | Benzenesulfonamide, 4-chloro-N-[(propylamino)carbonyl]- |
64777 | Benzenesulfonamide, N-[(butylamino)carbonyl]-4-methyl- |
100735340 | Benzenesulfonamide, N-[(butylamino)carbonyl]-4-methyl- |
1156190 | Benzenesulfonamide, N-[[(hexahydro-1H-azepin-1-yl)amino]carbonyl]-4-methyl- |
3622842 | Benzenesulfonamide, N-butyl- |
1028684141 | Benzenesulfonamide, N-butyl- |
80308 | Benzenesulfonamide, N-cyclohexyl-4-methyl- |
8047992 | Benzenesulfonamide, N-ethyl-2(or 4)-methyl- |
80397 | Benzenesulfonamide, N-ethyl-4-methyl- |
825629310 | Benzenesulfonamide, N-ethyl-4-methyl- |
5183788 | Benzenesulfonamide, N-methyl- |
98113 | Benzenesulfonic acid |
81118 | Benzenesulfonic acid, 2,2'-(1,2-ethenediyl)bis[5-amino- |
65941982 | Benzenesulfonic acid, 2,2'-(1,2-ethenediyl)bis[5-amino- |
7336201 | Benzenesulfonic acid, 2,2'-(1,2-ethenediyl)bis[5-amino-, sodium salt (1:2) |
465534694 | Benzenesulfonic acid, 2,2'-(1,2-ethenediyl)bis[5-amino-, sodium salt (1:2) |
88211 | Benzenesulfonic acid, 2-amino- |
121471 | Benzenesulfonic acid, 3-amino- |
96673 | Benzenesulfonic acid, 3-amino-2-hydroxy-5-nitro- |
861511935 | Benzenesulfonic acid, 3-amino-2-hydroxy-5-nitro- |
98373 | Benzenesulfonic acid, 3-amino-4-hydroxy- |
96935 | Benzenesulfonic acid, 3-amino-4-hydroxy-5-nitro- |
88233 | Benzenesulfonic acid, 3-amino-5-chloro-2-hydroxy- |
547580 | Benzenesulfonic acid, 4-[2-[4-(dimethylamino)phenyl]diazenyl]-, sodium salt (1:1) |
1342241 | Benzenesulfonic acid, 4-[2-[4-(dimethylamino)phenyl]diazenyl]-, sodium salt (1:1) |
66777171 | Benzenesulfonic acid, 4-[2-[4-(dimethylamino)phenyl]diazenyl]-, sodium salt (1:1) |
121573 | Benzenesulfonic acid, 4-amino- |
856062061 | Benzenesulfonic acid, 4-amino- |
98679 | Benzenesulfonic acid, 4-hydroxy- |
104154 | Benzenesulfonic acid, 4-methyl- |
402471 | Benzenesulfonic acid, 4-methyl- |
51506297 | Benzenesulfonic acid, 4-methyl- |
100901722 | Benzenesulfonic acid, 4-methyl- |
114213966 | Benzenesulfonic acid, 4-methyl- |
126033270 | Benzenesulfonic acid, 4-methyl- |
128739800 | Benzenesulfonic acid, 4-methyl- |
144647927 | Benzenesulfonic acid, 4-methyl- |
156627462 | Benzenesulfonic acid, 4-methyl- |
185568483 | Benzenesulfonic acid, 4-methyl- |
210357816 | Benzenesulfonic acid, 4-methyl- |
227313497 | Benzenesulfonic acid, 4-methyl- |
369371255 | Benzenesulfonic acid, 4-methyl- |
613262310 | Benzenesulfonic acid, 4-methyl- |
1023356140 | Benzenesulfonic acid, 4-methyl- |
6373746 | Benzenesulfonic acid, 5-[(2,4-dinitrophenyl)amino]-2-(phenylamino)-, sodium salt (1:1) |
74968368 | Benzenesulfonic acid, 5-[(2,4-dinitrophenyl)amino]-2-(phenylamino)-, sodium salt (1:1) |
5160021 | Benzenesulfonic acid, 5-chloro-2-[2-(2-hydroxy-1-naphthalenyl)diazenyl]-4-methyl-, barium salt (2:1) |
12237524 | Benzenesulfonic acid, 5-chloro-2-[2-(2-hydroxy-1-naphthalenyl)diazenyl]-4-methyl-, barium salt (2:1) |
12238390 | Benzenesulfonic acid, 5-chloro-2-[2-(2-hydroxy-1-naphthalenyl)diazenyl]-4-methyl-, barium salt (2:1) |
12238414 | Benzenesulfonic acid, 5-chloro-2-[2-(2-hydroxy-1-naphthalenyl)diazenyl]-4-methyl-, barium salt (2:1) |
12238436 | Benzenesulfonic acid, 5-chloro-2-[2-(2-hydroxy-1-naphthalenyl)diazenyl]-4-methyl-, barium salt (2:1) |
24777239 | Benzenesulfonic acid, 5-chloro-2-[2-(2-hydroxy-1-naphthalenyl)diazenyl]-4-methyl-, barium salt (2:1) |
52627686 | Benzenesulfonic acid, 5-chloro-2-[2-(2-hydroxy-1-naphthalenyl)diazenyl]-4-methyl-, barium salt (2:1) |
68894031 | Benzenesulfonic acid, 5-chloro-2-[2-(2-hydroxy-1-naphthalenyl)diazenyl]-4-methyl-, barium salt (2:1) |
42615292 | Benzenesulfonic acid, alkyl derivs. |
1300727 | Benzenesulfonic acid, dimethyl-, sodium salt (1:1) |
39340937 | Benzenesulfonic acid, dimethyl-, sodium salt (1:1) |
1323122 | Benzenesulfonic acid, dodecyl- |
1886813 | Benzenesulfonic acid, dodecyl- |
27157977 | Benzenesulfonic acid, dodecyl- |
27176870 | Benzenesulfonic acid, dodecyl- |
37321087 | Benzenesulfonic acid, dodecyl- |
39355458 | Benzenesulfonic acid, dodecyl- |
54824361 | Benzenesulfonic acid, dodecyl- |
61400713 | Benzenesulfonic acid, dodecyl- |
106602895 | Benzenesulfonic acid, dodecyl- |
111839635 | Benzenesulfonic acid, dodecyl- |
112509316 | Benzenesulfonic acid, dodecyl- |
124743211 | Benzenesulfonic acid, dodecyl- |
147625749 | Benzenesulfonic acid, dodecyl- |
175069519 | Benzenesulfonic acid, dodecyl- |
210106051 | Benzenesulfonic acid, dodecyl- |
219316004 | Benzenesulfonic acid, dodecyl- |
220880999 | Benzenesulfonic acid, dodecyl- |
313478896 | Benzenesulfonic acid, dodecyl- |
811862518 | Benzenesulfonic acid, dodecyl- |
889890180 | Benzenesulfonic acid, dodecyl- |
1232441143 | Benzenesulfonic acid, dodecyl- |
98099 | Benzenesulfonyl chloride |
11441579 | Benzenesulfonyl chloride |
114415791 | Benzenesulfonyl chloride |
108955 | Benzenethiol |
108985 | Benzenethiol |
50328 | Benzo[a]pyrene |
819804289 | Benzo[a]pyrene |
63466717 | Benzo[a]pyrene-d12 |
192972 | Benzo[e]pyrene |
85029 | Benzo[f]quinoline |
191242 | Benzo[ghi]perylene |
205823 | Benzo[j]fluoranthene |
207089 | Benzo[k]fluoranthene |
68756796 | Benzo[k]fluoranthene |
189559 | Benzo[rst]pentaphene |
112307730 | Benzo[rst]pentaphene |
271896 | Benzofuran |
65850 | Benzoic acid |
8013636 | Benzoic acid |
331473086 | Benzoic acid |
1918009 | Benzoic acid, 2,5-dichloro-3-hydroxy-6-methoxy- |
7600502 | Benzoic acid, 2,5-dichloro-3-hydroxy-6-methoxy- |
50782 | Benzoic acid, 2-(acetyloxy)- |
2349942 | Benzoic acid, 2-(acetyloxy)- |
11126355 | Benzoic acid, 2-(acetyloxy)- |
11126377 | Benzoic acid, 2-(acetyloxy)- |
26914136 | Benzoic acid, 2-(acetyloxy)- |
98201606 | Benzoic acid, 2-(acetyloxy)- |
8003030 | Benzoic acid, 2-(acetyloxy)-, mixt. with 3,7-dihydro-1,3,7-trimethyl-1H-purine-2,6-dione and N-(4-ethoxyphenyl)acetamide |
90982324 | Benzoic acid, 2-[[[[(4-chloro-6-methoxy-2-pyrimidinyl)amino]carbonyl]amino]sulfonyl]-, ethyl ester |
94365910 | Benzoic acid, 2-[[[[(4-chloro-6-methoxy-2-pyrimidinyl)amino]carbonyl]amino]sulfonyl]-, ethyl ester |
95754339 | Benzoic acid, 2-[[[[(4-chloro-6-methoxy-2-pyrimidinyl)amino]carbonyl]amino]sulfonyl]-, ethyl ester |
101200480 | Benzoic acid, 2-[[[[(4-methoxy-6-methyl-1,3,5-triazin-2-yl)methylamino]carbonyl]amino]sulfonyl]-, methyl ester |
25311711 | Benzoic acid, 2-[[ethoxy[(1-methylethyl)amino]phosphinothioyl]oxy]-, 1-methylethyl ester |
52907241 | Benzoic acid, 2-[[ethoxy[(1-methylethyl)amino]phosphinothioyl]oxy]-, 1-methylethyl ester |
61711635 | Benzoic acid, 2-[[ethoxy[(1-methylethyl)amino]phosphinothioyl]oxy]-, 1-methylethyl ester |
117176666 | Benzoic acid, 2-[[ethoxy[(1-methylethyl)amino]phosphinothioyl]oxy]-, 1-methylethyl ester |
118923 | Benzoic acid, 2-amino- |
80206344 | Benzoic acid, 2-amino- |
7779773 | Benzoic acid, 2-amino-, 2-methylpropyl ester |
133186 | Benzoic acid, 2-amino-, 2-phenylethyl ester |
7493632 | Benzoic acid, 2-amino-, 2-propenyl ester |
7756969 | Benzoic acid, 2-amino-, butyl ester |
7779160 | Benzoic acid, 2-amino-, cyclohexyl ester |
87252 | Benzoic acid, 2-amino-, ethyl ester |
134203 | Benzoic acid, 2-amino-, methyl ester |
619170 | Benzoic acid, 2-amino-4-nitro- |
3577637 | Benzoic acid, 2-amino-5-sulfo- |
118912 | Benzoic acid, 2-chloro- |
118569 | Benzoic acid, 2-hydroxy-, 3,3,5-trimethylcyclohexyl ester |
8045714 | Benzoic acid, 2-hydroxy-, 3,3,5-trimethylcyclohexyl ester |
50610407 | Benzoic acid, 2-hydroxy-, 3,3,5-trimethylcyclohexyl ester |
52253937 | Benzoic acid, 2-hydroxy-, 3,3,5-trimethylcyclohexyl ester |
194304239 | Benzoic acid, 2-hydroxy-, 3,3,5-trimethylcyclohexyl ester |
57647 | Benzoic acid, 2-hydroxy-, compd. with (3aS,8aR)-1,2,3,3a,8,8a-hexahydro-1,3a,8-trimethylpyrrolo[2,3-b]indol-5-yl N-methylcarbamate (1:1) |
11033048 | Benzoic acid, 2-hydroxy-, compd. with (3aS,8aR)-1,2,3,3a,8,8a-hexahydro-1,3a,8-trimethylpyrrolo[2,3-b]indol-5-yl N-methylcarbamate (1:1) |
11036661 | Benzoic acid, 2-hydroxy-, compd. with (3aS,8aR)-1,2,3,3a,8,8a-hexahydro-1,3a,8-trimethylpyrrolo[2,3-b]indol-5-yl N-methylcarbamate (1:1) |
119368 | Benzoic acid, 2-hydroxy-, methyl ester |
8022864 | Benzoic acid, 2-hydroxy-, methyl ester |
8024542 | Benzoic acid, 2-hydroxy-, methyl ester |
68917759 | Benzoic acid, 2-hydroxy-, methyl ester |
648434075 | Benzoic acid, 2-hydroxy-, methyl ester |
118558 | Benzoic acid, 2-hydroxy-, phenyl ester |
118581 | Benzoic acid, 2-hydroxy-, phenylmethyl ester |
599791 | Benzoic acid, 2-hydroxy-5-[[4-[(2-pyridinylamino)sulfonyl]phenyl]azo]- |
1975504 | Benzoic acid, 2-methyl-3-nitro- |
1975526 | Benzoic acid, 2-methyl-5-nitro- |
13506768 | Benzoic acid, 2-methyl-6-nitro- |
552169 | Benzoic acid, 2-nitro- |
149917 | Benzoic acid, 3,4,5-trihydroxy- |
121799 | Benzoic acid, 3,4,5-trihydroxy-, propyl ester |
56274954 | Benzoic acid, 3,4,5-trihydroxy-, propyl ester |
51445 | Benzoic acid, 3,4-dichloro- |
5473165 | Benzoic acid, 3,5-dinitro-, compd.with cyclohexanamine (1:1) |
1918009 | Benzoic acid, 3,6-dichloro-2-methoxy- |
62610393 | Benzoic acid, 3,6-dichloro-2-methoxy- |
856565781 | Benzoic acid, 3,6-dichloro-2-methoxy- |
2300665 | Benzoic acid, 3,6-dichloro-2-methoxy-, compd. with N-methylmethanamine (1:1) |
136365678 | Benzoic acid, 3,6-dichloro-2-methoxy-, compd. with N-methylmethanamine (1:1) |
1982690 | Benzoic acid, 3,6-dichloro-2-methoxy-, sodium salt (1:1) |
133904 | Benzoic acid, 3-amino-2,5-dichloro- |
6201861 | Benzoic acid, 3-amino-2-hydroxy-5-sulfo- |
535808 | Benzoic acid, 3-chloro- |
5437387 | Benzoic acid, 3-methyl-2-nitro- |
3113711 | Benzoic acid, 3-methyl-4-nitro- |
121926 | Benzoic acid, 3-nitro- |
34139623 | Benzoic acid, 3-nitro-, compd. with cyclohexanamine (1:1) |
98737 | Benzoic acid, 4-(1,1-dimethylethyl)- |
2493847 | Benzoic acid, 4-(octyloxy)- |
3782807 | Benzoic acid, 4-[([1,1'-biphenyl]-4-ylmethylene)amino]-, ethyl ester |
80137 | Benzoic acid, 4-[(dichloroamino)sulfonyl]- |
57669 | Benzoic acid, 4-[(dipropylamino)sulfonyl]- |
150130 | Benzoic acid, 4-amino- |
8014651 | Benzoic acid, 4-amino- |
94257 | Benzoic acid, 4-amino-, butyl ester |
586765 | Benzoic acid, 4-bromo- |
74113 | Benzoic acid, 4-chloro- |
96980 | Benzoic acid, 4-methyl-3-nitro- |
62237 | Benzoic acid, 4-nitro- |
29788292 | Benzoic acid, 4-nitro- |
34067500 | Benzoic acid, 4-nitro-, compd. with cyclohexanamine (1:1) |
54319 | Benzoic acid, 5-(aminosulfonyl)-4-chloro-2-((2-furanylmethyl)amino)- |
6265152 | Benzoic acid, 5-[(4-aminobenzoyl)amino]-2-hydroxy-3-methyl- |
6637883 | Benzoic acid, 5-[2-[4'-[2-(2,6-diamino-3-methyl-5-sulfophenyl)diazenyl]-3,3'-dimethyl[1,1'-biphenyl]-4-yl]diazenyl]-2-hydroxy-, sodium salt (1:2) |
61814855 | Benzoic acid, 5-[2-[4'-[2-(2,6-diamino-3-methyl-5-sulfophenyl)diazenyl]-3,3'-dimethyl[1,1'-biphenyl]-4-yl]diazenyl]-2-hydroxy-, sodium salt (1:2) |
2429825 | Benzoic acid, 5-[2-[4'-[2-(7-amino-1-hydroxy-3-sulfo-2-naphthalenyl)diazenyl][1,1'-biphenyl]-4-yl]diazenyl]-2-hydroxy-, sodium salt (1:2) |
1092061318 | Benzoic acid, 5-[2-[4'-[2-(7-amino-1-hydroxy-3-sulfo-2-naphthalenyl)diazenyl][1,1'-biphenyl]-4-yl]diazenyl]-2-hydroxy-, sodium salt (1:2) |
50594666 | Benzoic acid, 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitro- |
62476599 | Benzoic acid, 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitro- |
94128048 | Benzoic acid, 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitro- |
77501634 | Benzoic acid, 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitro-, 2-ethoxy-1-methyl-2-oxoethyl ester |
83513604 | Benzoic acid, 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitro-, 2-ethoxy-1-methyl-2-oxoethyl ester |
143956870 | Benzoic acid, 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitro-, 2-ethoxy-1-methyl-2-oxoethyl ester |
62476599 | Benzoic acid, 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitro-, sodium salt (1:1) |
63748594 | Benzoic acid, 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitro-, sodium salt (1:1) |
74434449 | Benzoic acid, 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitro-, sodium salt (1:1) |
94128037 | Benzoic acid, 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitro-, sodium salt (1:1) |
6201872 | Benzoic acid, 5-amino-2-hydroxy-3-sulfo- |
3113722 | Benzoic acid, 5-methyl-2-nitro- |
26264095 | Benzoic acid, chloro- |
3129928 | Benzoic acid, compd. with cyclohexanamine (1:1) |
120514 | Benzoic acid, phenylmethyl ester |
120558 | Benzoic acid, phenylmethyl ester |
100470 | Benzonitrile |
529191 | Benzonitrile, 2-methyl- |
1689845 | Benzonitrile, 3,5-dibromo-4-hydroxy- |
620224 | Benzonitrile, 3-methyl- |
104858 | Benzonitrile, 4-methyl- |
191242 | Benzoperylene |
11057457 | Benzoperylene |
73467762 | Benzopyrene |
95169 | Benzothiazole |
128366289 | Benzothiazole |
120785 | Benzothiazole, 2,2'-dithiobis- |
109767808 | Benzothiazole, 2,2'-dithiobis- |
137497188 | Benzothiazole, 2,2'-dithiobis- |
258278976 | Benzothiazole, 2,2'-dithiobis- |
615225 | Benzothiazole, 2-(methylthio)- |
98884 | Benzoyl chloride |
1258517804 | Benzoyl chloride |
393522 | Benzoyl chloride, 2-fluoro- |
610140 | Benzoyl chloride, 2-nitro- |
121904 | Benzoyl chloride, 3-nitro- |
122043 | Benzoyl chloride, 4-nitro- |
63923 | Benzylamine, N-(2-chloroethyl)-N-(1-methyl-2-phenoxyethyl)-, hydrochloride |
2399873 | Beryllate(1-), [N,N-bis(carboxymethyl)glycinato(3-)-N,O,O',O'']-, potassium, (T-4)- |
18983727 | Beryllate(1-), [N,N-bis(carboxymethyl)glycinato(3-)-N,O,O',O'']-, potassium, (T-4)- |
7440417 | Beryllium |
1312815261 | Beryllium |
7787475 | Beryllium chloride (BeCl2) |
7440417 | Beryllium compounds |
7787497 | Beryllium fluoride (BeF2) |
12323056 | Beryllium fluoride (BeF2) |
1304569 | Beryllium oxide (BeO) |
61279730 | Beryllium oxide (BeO) |
61279741 | Beryllium oxide (BeO) |
61279752 | Beryllium oxide (BeO) |
61279763 | Beryllium oxide (BeO) |
14390897 | Beryllium, isotope of mass 10 |
13966024 | Beryllium, isotope of mass 7 |
12587472 | Beta particle |
16219753 | Bicyclo[2.2.1]hept-2-ene, 5-ethylidene- |
59006745 | Bicyclo[2.2.1]hept-2-ene, 5-ethylidene- |
62181742 | Bicyclo[2.2.1]hept-2-ene, 5-ethylidene- |
1135584950 | Bicyclo[2.2.1]hept-2-ene, 5-ethylidene- |
115286 | Bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid, 1,4,5,6,7,7-hexachloro- |
5343975 | Bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid, 1,4,5,6,7,7-hexachloro- |
7374789 | Bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid, 1,4,5,6,7,7-hexachloro- |
888949131 | Bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid, 1,4,5,6,7,7-hexachloro- |
3389717 | Bicyclo[2.2.1]hepta-2,5-diene, 1,2,3,4,7,7-hexachloro- |
76222 | Bicyclo[2.2.1]heptan-2-one, 1,7,7-trimethyl- |
464482 | Bicyclo[2.2.1]heptan-2-one, 1,7,7-trimethyl- |
8013556 | Bicyclo[2.2.1]heptan-2-one, 1,7,7-trimethyl- |
8022773 | Bicyclo[2.2.1]heptan-2-one, 1,7,7-trimethyl- |
21368683 | Bicyclo[2.2.1]heptan-2-one, 1,7,7-trimethyl- |
48113220 | Bicyclo[2.2.1]heptan-2-one, 1,7,7-trimethyl- |
80568 | Bicyclo[3.1.1]hept-2-ene, 2,6,6-trimethyl- |
2437958 | Bicyclo[3.1.1]hept-2-ene, 2,6,6-trimethyl- |
127913 | Bicyclo[3.1.1]heptane, 6,6-dimethyl-2-methylene- |
23089329 | Bicyclo[3.1.1]heptane, 6,6-dimethyl-2-methylene- |
4424060 | Bisbenzimidazo[2,1-b:2',1'-i]benzo[lmn][3,8]phenanthroline-8,17-dione |
42612215 | Bisbenzimidazo[2,1-b:2',1'-i]benzo[lmn][3,8]phenanthroline-8,17-dione |
67053854 | Bisbenzimidazo[2,1-b:2',1'-i]benzo[lmn][3,8]phenanthroline-8,17-dione |
75662418 | Bisbenzimidazo[2,1-b:2',1'-i]benzo[lmn][3,8]phenanthroline-8,17-dione |
79586962 | Bisbenzimidazo[2,1-b:2',1'-i]benzo[lmn][3,8]phenanthroline-8,17-dione |
104432602 | Bisbenzimidazo[2,1-b:2',1'-i]benzo[lmn][3,8]phenanthroline-8,17-dione |
126602786 | Bisbenzimidazo[2,1-b:2',1'-i]benzo[lmn][3,8]phenanthroline-8,17-dione |
136298094 | Bisbenzimidazo[2,1-b:2',1'-i]benzo[lmn][3,8]phenanthroline-8,17-dione |
156841348 | Bisbenzimidazo[2,1-b:2',1'-i]benzo[lmn][3,8]phenanthroline-8,17-dione |
7440699 | Bismuth |
24267489 | Bismuth |
25243769 | Bismuth |
1304763 | Bismuth oxide (Bi2O3) |
11090098 | Bismuth oxide (Bi2O3) |
163831490 | Bismuth oxide (Bi2O3) |
477850832 | Bismuth oxide (Bi2O3) |
1304821 | Bismuth telluride (Bi2Te3) |
1269232645 | Bismuth telluride (Bi2Te3) |
15776199 | Bismuth, isotope of mass 206 |
13982382 | Bismuth, isotope of mass 207 |
14331794 | Bismuth, isotope of mass 210 |
14913496 | Bismuth, isotope of mass 212 |
14733030 | Bismuth, isotope of mass 214 |
11056067 | Bleomycin |
5967373 | Borane, tribromo- |
10294334 | Borane, tribromo- |
10294345 | Borane, trichloro- |
31012041 | Borane, trichloro- |
102943645 | Borane, trichloro- |
372850 | Borane, trifluoro- |
7637072 | Borane, trifluoro- |
109704872 | Borane, trifluoro- |
155123447 | Borane, trifluoro- |
1303679 | Borate(1-), tetrafluoro-, hydrogen (1:1) |
13767367 | Borate(1-), tetrafluoro-, hydrogen (1:1) |
16872110 | Borate(1-), tetrafluoro-, hydrogen (1:1) |
36835640 | Borate(1-), tetrafluoro-, hydrogen (1:1) |
65814439 | Borate(1-), tetrafluoro-, hydrogen (1:1) |
67116136 | Borate(1-), tetrafluoro-, hydrogen (1:1) |
72802723 | Borate(1-), tetrafluoro-, hydrogen (1:1) |
74618512 | Borate(1-), tetrafluoro-, hydrogen (1:1) |
81586245 | Borate(1-), tetrafluoro-, hydrogen (1:1) |
96958962 | Borate(1-), tetrafluoro-, hydrogen (1:1) |
102931964 | Borate(1-), tetrafluoro-, hydrogen (1:1) |
122141735 | Borate(1-), tetrafluoro-, hydrogen (1:1) |
127408008 | Borate(1-), tetrafluoro-, hydrogen (1:1) |
133097004 | Borate(1-), tetrafluoro-, hydrogen (1:1) |
133951389 | Borate(1-), tetrafluoro-, hydrogen (1:1) |
140148874 | Borate(1-), tetrafluoro-, hydrogen (1:1) |
172515296 | Borate(1-), tetrafluoro-, hydrogen (1:1) |
172908188 | Borate(1-), tetrafluoro-, hydrogen (1:1) |
183135742 | Borate(1-), tetrafluoro-, hydrogen (1:1) |
191665415 | Borate(1-), tetrafluoro-, hydrogen (1:1) |
350009051 | Borate(1-), tetrafluoro-, hydrogen (1:1) |
496925145 | Borate(1-), tetrafluoro-, hydrogen (1:1) |
547767066 | Borate(1-), tetrafluoro-, hydrogen (1:1) |
845825709 | Borate(1-), tetrafluoro-, hydrogen (1:1) |
900178907 | Borate(1-), tetrafluoro-, hydrogen (1:1) |
1056477098 | Borate(1-), tetrafluoro-, hydrogen (1:1) |
1178564641 | Borate(1-), tetrafluoro-, hydrogen (1:1) |
1262801477 | Borate(1-), tetrafluoro-, hydrogen (1:1) |
1414852519 | Borate(1-), tetrafluoro-, hydrogen (1:1) |
1303964 | Borax (B4Na2O7.10H2O) |
1344907 | Borax (B4Na2O7.10H2O) |
12322859 | Borax (B4Na2O7.10H2O) |
12447404 | Borax (B4Na2O7.10H2O) |
61028248 | Borax (B4Na2O7.10H2O) |
71377021 | Borax (B4Na2O7.10H2O) |
910783710 | Borax (B4Na2O7.10H2O) |
950582602 | Borax (B4Na2O7.10H2O) |
1242163036 | Borax (B4Na2O7.10H2O) |
1443500228 | Borax (B4Na2O7.10H2O) |
10043353 | Boric acid (H3BO3) |
12795049 | Boric acid (H3BO3) |
30698987 | Boric acid (H3BO3) |
688744 | Boric acid (H3BO3), tributyl ester |
13453695 | Boric acid (HBO2), lithium salt (1:1) |
56626449 | Boric acid (HBO2), lithium salt (1:1) |
891827682 | Boric acid (HBO2), lithium salt (1:1) |
950582544 | Boric acid (HBO2), lithium salt (1:1) |
11121167 | Boric acid, aluminum salt |
12794911 | Boric acid, aluminum salt |
134914322 | Boric acid, aluminum salt |
7440428 | Boron |
1416162123 | Boron |
12007602 | Boron lithium oxide (B4Li2O7) |
12688516 | Boron lithium oxide (B4Li2O7) |
108662777 | Boron lithium oxide (B4Li2O7) |
110271562 | Boron lithium oxide (B4Li2O7) |
796879317 | Boron lithium oxide (B4Li2O7) |
1303862 | Boron oxide (B2O3) |
12640425 | Boron oxide (B2O3) |
56116042 | Boron oxide (B2O3) |
56145449 | Boron oxide (B2O3) |
56312915 | Boron oxide (B2O3) |
56312926 | Boron oxide (B2O3) |
56312937 | Boron oxide (B2O3) |
56312948 | Boron oxide (B2O3) |
91863273 | Boron oxide (B2O3) |
102967737 | Boron oxide (B2O3) |
144919642 | Boron oxide (B2O3) |
163701880 | Boron oxide (B2O3) |
353424 | Boron, trifluoro[oxybis[methane]]-, (T-4)- |
19306593 | Boron, trifluoro[oxybis[methane]]-, (T-4)- |
121263578 | Boron, trifluoro[oxybis[methane]]-, (T-4)- |
139754817 | Boron, trifluoro[oxybis[methane]]-, (T-4)- |
342905924 | Boron, trifluoro[oxybis[methane]]-, (T-4)- |
707542878 | Boron, trifluoro[oxybis[methane]]-, (T-4)- |
879635628 | Boron, trifluoro[oxybis[methane]]-, (T-4)- |
15541454 | Bromate |
7758012 | Bromic acid, potassium salt (1:1) |
24959679 | Bromide |
405267472 | Bromide |
7726956 | Bromine |
7726965 | Bromine |
7926956 | Bromine |
23724814 | Bromine |
13863417 | Bromine chloride (BrCl) |
7789302 | Bromine fluoride (BrF5) |
14686692 | Bromine, isotope of mass 82 |
123728 | Butanal |
590863 | Butanal, 3-methyl- |
6358856 | Butanamide, 2,2'-[(3,3'-dichloro[1,1'-biphenyl]-4,4'-diyl)bis(2,1-diazenediyl)]bis[3-oxo-N-phenyl- |
82197931 | Butanamide, 2,2'-[(3,3'-dichloro[1,1'-biphenyl]-4,4'-diyl)bis(2,1-diazenediyl)]bis[3-oxo-N-phenyl- |
82249352 | Butanamide, 2,2'-[(3,3'-dichloro[1,1'-biphenyl]-4,4'-diyl)bis(2,1-diazenediyl)]bis[3-oxo-N-phenyl- |
97794075 | Butanamide, 2,2'-[(3,3'-dichloro[1,1'-biphenyl]-4,4'-diyl)bis(2,1-diazenediyl)]bis[3-oxo-N-phenyl- |
127546116 | Butanamide, 2,2'-[(3,3'-dichloro[1,1'-biphenyl]-4,4'-diyl)bis(2,1-diazenediyl)]bis[3-oxo-N-phenyl- |
142583275 | Butanamide, 2,2'-[(3,3'-dichloro[1,1'-biphenyl]-4,4'-diyl)bis(2,1-diazenediyl)]bis[3-oxo-N-phenyl- |
912849924 | Butanamide, 2,2'-[(3,3'-dichloro[1,1'-biphenyl]-4,4'-diyl)bis(2,1-diazenediyl)]bis[3-oxo-N-phenyl- |
6358312 | Butanamide, 2-[2-(2-methoxy-4-nitrophenyl)diazenyl]-N-(2-methoxyphenyl)-3-oxo- |
15792297 | Butanamide, 2-[2-(2-methoxy-4-nitrophenyl)diazenyl]-N-(2-methoxyphenyl)-3-oxo- |
57769752 | Butanamide, 2-[2-(2-methoxy-4-nitrophenyl)diazenyl]-N-(2-methoxyphenyl)-3-oxo- |
68859596 | Butanamide, 2-[2-(2-methoxy-4-nitrophenyl)diazenyl]-N-(2-methoxyphenyl)-3-oxo- |
95660494 | Butanamide, 2-[2-(2-methoxy-4-nitrophenyl)diazenyl]-N-(2-methoxyphenyl)-3-oxo- |
96352248 | Butanamide, 2-[2-(2-methoxy-4-nitrophenyl)diazenyl]-N-(2-methoxyphenyl)-3-oxo- |
807629761 | Butanamide, 2-[2-(2-methoxy-4-nitrophenyl)diazenyl]-N-(2-methoxyphenyl)-3-oxo- |
865089221 | Butanamide, 2-[2-(2-methoxy-4-nitrophenyl)diazenyl]-N-(2-methoxyphenyl)-3-oxo- |
885613638 | Butanamide, 2-[2-(2-methoxy-4-nitrophenyl)diazenyl]-N-(2-methoxyphenyl)-3-oxo- |
904293272 | Butanamide, 2-[2-(2-methoxy-4-nitrophenyl)diazenyl]-N-(2-methoxyphenyl)-3-oxo- |
904293283 | Butanamide, 2-[2-(2-methoxy-4-nitrophenyl)diazenyl]-N-(2-methoxyphenyl)-3-oxo- |
1309890047 | Butanamide, 2-[2-(2-methoxy-4-nitrophenyl)diazenyl]-N-(2-methoxyphenyl)-3-oxo- |
102012 | Butanamide, 3-oxo-N-phenyl- |
77656 | Butanamide, N-(aminocarbonyl)-2-bromo-2-ethyl- |
106978 | Butane |
142961 | Butane, 1,1'-oxybis- |
110565 | Butane, 1,4-dichloro- |
109693 | Butane, 1-chloro- |
627054 | Butane, 1-nitro- |
75832 | Butane, 2,2-dimethyl- |
79298 | Butane, 2,2-dimethyl- |
78784 | Butane, 2-methyl- |
68923444 | Butane, 2-methyl- |
92046463 | Butane, 2-methyl- |
1326305741 | Butane, 2-methyl- |
141529320 | Butane, pentafluoro- |
83547960 | Butane-1,1,2,2,3,3,4,4-d8, 1,4-dichloro- |
110612 | Butanedinitrile |
191362217 | Butanedinitrile |
3333526 | Butanedinitrile, tetramethyl- |
1634782 | Butanedioic acid, ((dimethoxyphosphinyl)thio)-, diethyl ester |
4345033 | Butanedioic acid, 1-[(2R)-3,4-dihydro-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-2H-1-benzopyran-6-yl] ester |
53532120 | Butanedioic acid, 1-[(2R)-3,4-dihydro-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-2H-1-benzopyran-6-yl] ester |
55134515 | Butanedioic acid, 1-[(2R)-3,4-dihydro-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-2H-1-benzopyran-6-yl] ester |
120246471 | Butanedioic acid, 1-[(2R)-3,4-dihydro-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-2H-1-benzopyran-6-yl] ester |
121755 | Butanedioic acid, [(dimethoxyphosphinothioyl)thio]-, diethyl ester |
11096676 | Butanedioic acid, [(dimethoxyphosphinothioyl)thio]-, diethyl ester |
11130602 | Butanedioic acid, [(dimethoxyphosphinothioyl)thio]-, diethyl ester |
12737198 | Butanedioic acid, [(dimethoxyphosphinothioyl)thio]-, diethyl ester |
12767623 | Butanedioic acid, [(dimethoxyphosphinothioyl)thio]-, diethyl ester |
75513836 | Butanedioic acid, [(dimethoxyphosphinothioyl)thio]-, diethyl ester |
141263969 | Butanedioic acid, [(dimethoxyphosphinothioyl)thio]-, diethyl ester |
562107 | Butanedioic acid, compd. with N,N-dimethyl-2-[1-phenyl-1-(2-pyridinyl)ethoxy]ethanamine (1:1) |
8064775 | Butanedioic acid, compd. with N,N-dimethyl-2-[1-phenyl-1-(2-pyridinyl)ethoxy]ethanamine (1:1), mixt. with 2-(diethylamino)ethyl [1,1'-bicyclohexyl]-1-carboxylate hydrochloride and 5-hydroxy-6-methyl-3,4-pyridinedimethanol hydrochloride |
1596845 | Butanedioic acid, mono(2,2-dimethylhydrazide) |
1861263 | Butanedioic acid, mono(2,2-dimethylhydrazide) |
74913158 | Butanedioic acid, mono(2,2-dimethylhydrazide) |
982570 | Butanedioic acid, mono[(2R,3R)-2-[(dichloroacetyl)amino]-3-hydroxy-3-(4-nitrophenyl)propyl] ester, monosodium salt |
70198297 | Butanedioic acid, polymer with 4-hydroxy-2,2,6,6-tetramethyl-1-piperidineethanol |
71990595 | Butanedioic acid, polymer with 4-hydroxy-2,2,6,6-tetramethyl-1-piperidineethanol |
76633200 | Butanedioic acid, polymer with 4-hydroxy-2,2,6,6-tetramethyl-1-piperidineethanol |
98388466 | Butanedioic acid, polymer with 4-hydroxy-2,2,6,6-tetramethyl-1-piperidineethanol |
182071767 | Butanedioic acid, polymer with 4-hydroxy-2,2,6,6-tetramethyl-1-piperidineethanol |
439590075 | Butanedioic acid, polymer with 4-hydroxy-2,2,6,6-tetramethyl-1-piperidineethanol |
848843094 | Butanedioic acid, polymer with 4-hydroxy-2,2,6,6-tetramethyl-1-piperidineethanol |
896469946 | Butanedioic acid, polymer with 4-hydroxy-2,2,6,6-tetramethyl-1-piperidineethanol |
1213835518 | Butanedioic acid, polymer with 4-hydroxy-2,2,6,6-tetramethyl-1-piperidineethanol |
1262431526 | Butanedioic acid, polymer with 4-hydroxy-2,2,6,6-tetramethyl-1-piperidineethanol |
109740 | Butanenitrile |
107926 | Butanoic acid |
37558160 | Butanoic acid, (1aR,1bS,4aR,7aS,7bS,8R,9R,9aS)-1,1a,1b,4,4a,5,7a,7b,8,9-decahydro-4a,7b-dihydroxy-3-(hydroxymethyl)-1,1,6,8-tetramethyl-5-oxo-9aH-cyclopropa[3,4]benz[1,2-e]azulene-9,9a-diyl ester |
2835394 | Butanoic acid, 3-methyl-, 2-propen-1-yl ester |
94826 | Butanoic acid, 4-(2,4-dichlorophenoxy)- |
94815 | Butanoic acid, 4-(4-chloro-2-methylphenoxy)- |
141753 | Butanoyl chloride |
25167673 | Butene |
11069195 | Butene, dichloro- |
61703057 | C.I. Direct Black 114 |
1325377 | C.I. Direct Yellow 11 |
37279553 | C.I. Direct Yellow 11 |
59764124 | C.I. Direct Yellow 11 |
93820667 | C.I. Direct Yellow 11 |
1299883 | C.I. Pigment Green 21 |
11075324 | C.I. Pigment Green 21 |
12002038 | C.I. Pigment Green 21 |
12224941 | C.I. Pigment Green 36 |
12224963 | C.I. Pigment Green 36 |
12236601 | C.I. Pigment Green 36 |
14302137 | C.I. Pigment Green 36 |
53124893 | C.I. Pigment Green 36 |
71819722 | C.I. Pigment Green 36 |
96956513 | C.I. Pigment Green 36 |
99149470 | C.I. Pigment Green 36 |
186811563 | C.I. Pigment Green 36 |
872217782 | C.I. Pigment Green 36 |
1328536 | C.I. Pigment Green 7 |
11118595 | C.I. Pigment Green 7 |
11129832 | C.I. Pigment Green 7 |
12224952 | C.I. Pigment Green 7 |
12240118 | C.I. Pigment Green 7 |
12619691 | C.I. Pigment Green 7 |
16143810 | C.I. Pigment Green 7 |
37340128 | C.I. Pigment Green 7 |
39362522 | C.I. Pigment Green 7 |
39380659 | C.I. Pigment Green 7 |
50642994 | C.I. Pigment Green 7 |
51653135 | C.I. Pigment Green 7 |
52499704 | C.I. Pigment Green 7 |
64333626 | C.I. Pigment Green 7 |
67053865 | C.I. Pigment Green 7 |
72779625 | C.I. Pigment Green 7 |
73560404 | C.I. Pigment Green 7 |
81180930 | C.I. Pigment Green 7 |
85256457 | C.I. Pigment Green 7 |
90651642 | C.I. Pigment Green 7 |
97380886 | C.I. Pigment Green 7 |
104492026 | C.I. Pigment Green 7 |
108137026 | C.I. Pigment Green 7 |
109319611 | C.I. Pigment Green 7 |
127546069 | C.I. Pigment Green 7 |
128281890 | C.I. Pigment Green 7 |
194554648 | C.I. Pigment Green 7 |
914378317 | C.I. Pigment Green 7 |
1342489 | C.I. Pigment Yellow 100 |
12225217 | C.I. Pigment Yellow 100 |
12227699 | C.I. Pigment Yellow 100 |
15790064 | C.I. Pigment Yellow 100 |
53026634 | C.I. Pigment Yellow 100 |
8005014 | C.I. Solvent Black 5 |
11099039 | C.I. Solvent Black 5 |
52276978 | C.I. Solvent Black 5 |
88651756 | C.I. Solvent Black 5 |
94335941 | C.I. Solvent Black 5 |
114654294 | C.I. Solvent Black 5 |
8005025 | C.I. Solvent Black 7 |
12227804 | C.I. Solvent Black 7 |
53802383 | C.I. Solvent Black 7 |
59494267 | C.I. Solvent Black 7 |
65721984 | C.I. Solvent Black 7 |
70431571 | C.I. Solvent Black 7 |
72626245 | C.I. Solvent Black 7 |
87003358 | C.I. Solvent Black 7 |
114013319 | C.I. Solvent Black 7 |
162731499 | C.I. Solvent Black 7 |
8002877 | C.I. Solvent Yellow 33 |
8003223 | C.I. Solvent Yellow 33 |
18432547 | Cadmate(1-), [N,N-bis[(carboxy-.kappa.O)methyl]glycinato(3-)-.kappa.N,.kappa.O]-, (T-4)- |
7440439 | Cadmium |
39638329 | Cadmium |
7789426 | Cadmium bromide (CdBr2) |
53168835 | Cadmium bromide (CdBr2) |
10108642 | Cadmium chloride (CdCl2) |
1306190 | Cadmium oxide (CdO) |
1436666975 | Cadmium oxide (CdO) |
14109321 | Cadmium, isotope of mass 109 |
14336664 | Cadmium, isotope of mass 113m(14.1 yr) |
378253442 | Cadmium, isotope of mass 113m(14.1 yr) |
14336686 | Cadmium, isotope of mass 115 |
14336686 | Cadmium, isotope of mass 115m(44.6 d) |
378253453 | Cadmium, isotope of mass 115m(44.6 d) |
7440702 | Calcium |
8047594 | Calcium |
10043524 | Calcium chloride (CaCl2) |
139468932 | Calcium chloride (CaCl2) |
592018 | Calcium cyanide (Ca(CN)2) |
18724704 | Calcium cyanide (Ca(CN)2) |
7789755 | Calcium fluoride (CaF2) |
29070153 | Calcium fluoride (CaF2) |
1357089758 | Calcium fluoride (CaF2) |
1414597935 | Calcium fluoride (CaF2) |
1305620 | Calcium hydroxide (Ca(OH)2) |
1333295 | Calcium hydroxide (Ca(OH)2) |
7719019 | Calcium hydroxide (Ca(OH)2) |
1305788 | Calcium oxide (CaO) |
12610149 | Calcium oxide (CaO) |
60873850 | Calcium oxide (CaO) |
104624966 | Calcium oxide (CaO) |
245321522 | Calcium oxide (CaO) |
13966057 | Calcium, isotope of mass 45 |
1439992 | Calcium, isotope of mass 47 |
14391992 | Calcium, isotope of mass 47 |
78444 | Carbamic acid, (1-methylethyl)-, 2-[[(aminocarbonyl)oxy]methyl]-2-methylpentyl ester |
8053632 | Carbamic acid, (1-methylethyl)-, 2-[[(aminocarbonyl)oxy]methyl]-2-methylpentyl ester |
1918189 | Carbamic acid, (3,4-dichlorophenyl)-, methyl ester |
101213 | Carbamic acid, (3-chlorophenyl)-, 1-methylethyl ester |
11097022 | Carbamic acid, (3-chlorophenyl)-, 1-methylethyl ester |
101279 | Carbamic acid, (3-chlorophenyl)-, 4-chloro-2-butynyl ester |
13684565 | Carbamic acid, (3-methylphenyl)-, 3-[(methoxycarbonyl)amino]phenyl ester |
13684634 | Carbamic acid, (3-methylphenyl)-, 3-[(methoxycarbonyl)amino]phenyl ester |
35067675 | Carbamic acid, (3-methylphenyl)-, 3-[(methoxycarbonyl)amino]phenyl ester |
14255879 | Carbamic acid, (5-butyl-1H-benzimidazol-2-yl)-, methyl ester |
10605217 | Carbamic acid, N-1H-benzimidazol-2-yl-, methyl ester |
39413199 | Carbamic acid, N-1H-benzimidazol-2-yl-, methyl ester |
59758951 | Carbamic acid, N-1H-benzimidazol-2-yl-, methyl ester |
63090404 | Carbamic acid, N-1H-benzimidazol-2-yl-, methyl ester |
63278706 | Carbamic acid, N-1H-benzimidazol-2-yl-, methyl ester |
102040017 | Carbamic acid, N-1H-benzimidazol-2-yl-, methyl ester |
105268959 | Carbamic acid, N-1H-benzimidazol-2-yl-, methyl ester |
110342671 | Carbamic acid, N-1H-benzimidazol-2-yl-, methyl ester |
212384286 | Carbamic acid, N-1H-benzimidazol-2-yl-, methyl ester |
276680081 | Carbamic acid, N-1H-benzimidazol-2-yl-, methyl ester |
1135441267 | Carbamic acid, N-1H-benzimidazol-2-yl-, methyl ester |
1155875947 | Carbamic acid, N-1H-benzimidazol-2-yl-, methyl ester |
1203557883 | Carbamic acid, N-1H-benzimidazol-2-yl-, methyl ester |
17804352 | Carbamic acid, N-[1-[(butylamino)carbonyl]-1H-benzimidazol-2-yl]-, methyl ester |
39357409 | Carbamic acid, N-[1-[(butylamino)carbonyl]-1H-benzimidazol-2-yl]-, methyl ester |
52683564 | Carbamic acid, N-[1-[(butylamino)carbonyl]-1H-benzimidazol-2-yl]-, methyl ester |
1135441256 | Carbamic acid, N-[1-[(butylamino)carbonyl]-1H-benzimidazol-2-yl]-, methyl ester |
55406536 | Carbamic acid, N-butyl-, 3-iodo-2-propyn-1-yl ester |
84826915 | Carbamic acid, N-butyl-, 3-iodo-2-propyn-1-yl ester |
85045096 | Carbamic acid, N-butyl-, 3-iodo-2-propyn-1-yl ester |
104732425 | Carbamic acid, N-butyl-, 3-iodo-2-propyn-1-yl ester |
161849418 | Carbamic acid, N-butyl-, 3-iodo-2-propyn-1-yl ester |
1129415 | Carbamic acid, N-methyl-, 3-methylphenyl ester |
105408 | Carbamic acid, N-methyl-, ethyl ester |
615532 | Carbamic acid, N-methyl-N-nitroso-, ethyl ester |
122249 | Carbamic acid, N-phenyl-, 1-methylethyl ester |
122429 | Carbamic acid, N-phenyl-, 1-methylethyl ester |
55285148 | Carbamic acid, [(dibutylamino)thio]methyl-, 2,3-dihydro-2,2-dimethyl-7-benzofuranyl ester |
73468618 | Carbamic acid, [(dibutylamino)thio]methyl-, 2,3-dihydro-2,2-dimethyl-7-benzofuranyl ester |
23564069 | Carbamic acid, [1,2-phenylenebis(iminocarbonothioyl)]bis-, diethyl ester |
37233548 | Carbamic acid, [1,2-phenylenebis(iminocarbonothioyl)]bis-, diethyl ester |
37359516 | Carbamic acid, [1,2-phenylenebis(iminocarbonothioyl)]bis-, diethyl ester |
39300544 | Carbamic acid, [1,2-phenylenebis(iminocarbonothioyl)]bis-, diethyl ester |
23564058 | Carbamic acid, [1,2-phenylenebis(iminocarbonothioyl)]bis-, dimethyl ester |
50814125 | Carbamic acid, [1,2-phenylenebis(iminocarbonothioyl)]bis-, dimethyl ester |
17804352 | Carbamic acid, [1-[(butylamino)carbonyl]-1H-benzimidazol-2-yl]-, methyl ester and methyl 1H-benzimidazol-2-ylcarbamate, total |
72490018 | Carbamic acid, [2-(4-phenoxyphenoxy)ethyl]-, ethyl ester |
79127803 | Carbamic acid, [2-(4-phenoxyphenoxy)ethyl]-, ethyl ester |
13684565 | Carbamic acid, [3-[[(phenylamino)carbonyl]oxy]phenyl]-, ethyl ester |
125579955 | Carbamic acid, [3-[[(phenylamino)carbonyl]oxy]phenyl]-, ethyl ester |
153703696 | Carbamic acid, [3-[[(phenylamino)carbonyl]oxy]phenyl]-, ethyl ester |
31430189 | Carbamic acid, [5-(2-thienylcarbonyl)-1H-benzimidazol-2-yl]-, methyl ester |
644644 | Carbamic acid, dimethyl-, 1-[(dimethylamino)carbonyl]-5-methyl-1H-pyrazol-3-yl ester |
23103982 | Carbamic acid, dimethyl-, 2-(dimethylamino)-5,6-dimethyl-4-pyrimidinyl ester |
119380 | Carbamic acid, dimethyl-, 3-methyl-1-(1-methylethyl)-1H-pyrazol-5-yl ester |
51796 | Carbamic acid, ethyl ester |
121382272 | Carbamic acid, ethyl ester |
614959 | Carbamic acid, ethylnitroso-, ethyl ester |
598550 | Carbamic acid, methyl ester |
88108 | Carbamic chloride, N,N-diethyl- |
79447 | Carbamic chloride, N,N-dimethyl- |
342009250 | Carbamic chloride, N,N-dimethyl- |
51026289 | Carbamodithioic acid, (hydroxymethyl)methyl-, monopotassium salt |
34731323 | Carbamodithioic acid, 1,2-ethanediyl ester |
111546 | Carbamodithioic acid, 1,2-ethanediylbis- |
111546 | Carbamodithioic acid, 1,2-ethanediylbis-, salts and esters |
142596 | Carbamodithioic acid, N,N'-1,2-ethanediylbis-, sodium salt (1:2) |
148185 | Carbamodithioic acid, N,N-diethyl-, sodium salt (1:1) |
19622061 | Carbamodithioic acid, N,N-diethyl-, sodium salt (1:1) |
143189633 | Carbamodithioic acid, N,N-diethyl-, sodium salt (1:1) |
149099810 | Carbamodithioic acid, N,N-diethyl-, sodium salt (1:1) |
1086257944 | Carbamodithioic acid, N,N-diethyl-, sodium salt (1:1) |
1240386508 | Carbamodithioic acid, N,N-diethyl-, sodium salt (1:1) |
128030 | Carbamodithioic acid, N,N-dimethyl-, potassium salt (1:1) |
81990014 | Carbamodithioic acid, N,N-dimethyl-, potassium salt (1:1) |
128041 | Carbamodithioic acid, N,N-dimethyl-, sodium salt (1:1) |
8000962 | Carbamodithioic acid, N,N-dimethyl-, sodium salt (1:1) |
122544461 | Carbamodithioic acid, N,N-dimethyl-, sodium salt (1:1) |
165724027 | Carbamodithioic acid, N,N-dimethyl-, sodium salt (1:1) |
191490263 | Carbamodithioic acid, N,N-dimethyl-, sodium salt (1:1) |
138932 | Carbamodithioic acid, cyano-, disodium salt |
95067 | Carbamodithioic acid, diethyl-, 2-chloro-2-propenyl ester |
4384821 | Carbamodithioic acid, ion(1-) |
137417 | Carbamodithioic acid, methyl-, monopotassium salt |
137428 | Carbamodithioic acid, methyl-, monosodium salt |
6734801 | Carbamodithioic acid, methyl-, monosodium salt |
118939687 | Carbamodithioic acid, methyl-, monosodium salt |
2008415 | Carbamothioic acid, N,N-bis(2-methylpropyl)-, S-ethyl ester |
759944 | Carbamothioic acid, N,N-dipropyl-, S-ethyl ester |
2398961 | Carbamothioic acid, N-methyl-N-(3-methylphenyl)-, O-2-naphthalenyl ester |
94256641 | Carbamothioic acid, N-methyl-N-(3-methylphenyl)-, O-2-naphthalenyl ester |
2303175 | Carbamothioic acid, bis(1-methylethyl)-, S-(2,3,3-trichloro-2-propenyl) ester |
2303164 | Carbamothioic acid, bis(1-methylethyl)-, S-(2,3-dichloro-2-propenyl) ester |
1114712 | Carbamothioic acid, butylethyl-, S-propyl ester |
1134232 | Carbamothioic acid, cyclohexylethyl-, S-ethyl ester |
71330397 | Carbamothioic acid, cyclohexylethyl-, S-ethyl ester |
102827021 | Carbamothioic acid, cyclohexylethyl-, S-ethyl ester |
11099664 | Carbamothioic acid, diethyl-, S-[(4-chlorophenyl)methyl] ester |
28249776 | Carbamothioic acid, diethyl-, S-[(4-chlorophenyl)methyl] ester |
52888809 | Carbamothioic acid, dipropyl-, S-(phenylmethyl) ester |
123780416 | Carbamothioic acid, dipropyl-, S-(phenylmethyl) ester |
1929777 | Carbamothioic acid, dipropyl-, S-propyl ester |
7440440 | Carbon |
12789229 | Carbon |
26837672 | Carbon |
37196295 | Carbon |
39422043 | Carbon |
39434349 | Carbon |
67167413 | Carbon |
76416610 | Carbon |
76543732 | Carbon |
82600586 | Carbon |
83138287 | Carbon |
90452985 | Carbon |
114680001 | Carbon |
116788820 | Carbon |
130960031 | Carbon |
137322215 | Carbon |
208519328 | Carbon |
208728205 | Carbon |
263716832 | Carbon |
798556124 | Carbon |
798556146 | Carbon |
1173019221 | Carbon |
1194406524 | Carbon |
1431285936 | Carbon |
1333864 | Carbon black |
1343039 | Carbon black |
7440440 | Carbon black |
12768988 | Carbon black |
52623242 | Carbon black |
53095526 | Carbon black |
53851028 | Carbon black |
55353429 | Carbon black |
55607959 | Carbon black |
56257795 | Carbon black |
56257808 | Carbon black |
56274590 | Carbon black |
56729250 | Carbon black |
56729261 | Carbon black |
58517296 | Carbon black |
61512592 | Carbon black |
63661314 | Carbon black |
64427561 | Carbon black |
72536891 | Carbon black |
73560380 | Carbon black |
75026754 | Carbon black |
76632923 | Carbon black |
79921098 | Carbon black |
97708446 | Carbon black |
97793378 | Carbon black |
101239809 | Carbon black |
106907704 | Carbon black |
109766769 | Carbon black |
124760061 | Carbon black |
131640454 | Carbon black |
133136502 | Carbon black |
138464412 | Carbon black |
147335737 | Carbon black |
179607251 | Carbon black |
181719824 | Carbon black |
186708929 | Carbon black |
186708963 | Carbon black |
208728216 | Carbon black |
214540860 | Carbon black |
334869088 | Carbon black |
429685074 | Carbon black |
566149766 | Carbon black |
681225934 | Carbon black |
914651142 | Carbon black |
1228663533 | Carbon black |
124389 | Carbon dioxide |
18923201 | Carbon dioxide |
957761352 | Carbon dioxide |
1053656668 | Carbon dioxide |
1053659601 | Carbon dioxide |
1202865277 | Carbon dioxide |
75150 | Carbon disulfide |
355120853 | Carbon disulfide |
630080 | Carbon monoxide |
18421608 | Carbon monoxide |
82063465 | Carbon monoxide |
153929545 | Carbon monoxide |
155399523 | Carbon monoxide |
162342485 | Carbon monoxide |
167416300 | Carbon monoxide |
192819800 | Carbon monoxide |
724693690 | Carbon monoxide |
740776492 | Carbon monoxide |
807306747 | Carbon monoxide |
463581 | Carbon oxide sulfide (COS) |
20684882 | Carbon oxide sulfide (COS) |
14762755 | Carbon, isotope of mass 14 |
22143164 | Carbon, isotope of mass 14 |
7440440 | Carbon, organic |
3812326 | Carbonate |
71523 | Carbonate, hydrogen |
471341 | Carbonic acid calcium salt (1:1) |
39454552 | Carbonic acid calcium salt (1:1) |
60083796 | Carbonic acid calcium salt (1:1) |
63660979 | Carbonic acid calcium salt (1:1) |
71060883 | Carbonic acid calcium salt (1:1) |
72608129 | Carbonic acid calcium salt (1:1) |
114453699 | Carbonic acid calcium salt (1:1) |
137803942 | Carbonic acid calcium salt (1:1) |
146358954 | Carbonic acid calcium salt (1:1) |
148092937 | Carbonic acid calcium salt (1:1) |
166516014 | Carbonic acid calcium salt (1:1) |
172307276 | Carbonic acid calcium salt (1:1) |
180616313 | Carbonic acid calcium salt (1:1) |
197809384 | Carbonic acid calcium salt (1:1) |
198352339 | Carbonic acid calcium salt (1:1) |
251358288 | Carbonic acid calcium salt (1:1) |
459411100 | Carbonic acid calcium salt (1:1) |
878759263 | Carbonic acid calcium salt (1:1) |
1352815510 | Carbonic acid calcium salt (1:1) |
144558 | Carbonic acid sodium salt (1:1) |
151127729 | Carbonic acid sodium salt (1:1) |
172672172 | Carbonic acid sodium salt (1:1) |
196216689 | Carbonic acid sodium salt (1:1) |
199723767 | Carbonic acid sodium salt (1:1) |
246180972 | Carbonic acid sodium salt (1:1) |
1182403480 | Carbonic acid sodium salt (1:1) |
497198 | Carbonic acid sodium salt (1:2) |
1332576 | Carbonic acid sodium salt (1:2) |
1314087392 | Carbonic acid sodium salt (1:2) |
20227923 | Carbonic acid, compd. with cyclohexanamine |
105588 | Carbonic acid, diethyl ester |
554132 | Carbonic acid, lithium salt (1:2) |
12767190 | Carbonic acid, lithium salt (1:2) |
216964613 | Carbonic acid, lithium salt (1:2) |
1312765653 | Carbonic acid, lithium salt (1:2) |
534087 | Carbonic acid, potassium salt (1:2) |
584087 | Carbonic acid, potassium salt (1:2) |
30095944 | Carbonic acid, potassium salt (1:2) |
6533739 | Carbonic acid, thallium(1+) salt (1:2) |
75445 | Carbonic dichloride |
957761045 | Carbonic dichloride |
353504 | Carbonic difluoride |
497187 | Carbonic dihydrazide |
108236 | Carbonochloridic acid, 1-methylethyl ester |
94274223 | Carbonochloridic acid, 1-methylethyl ester |
541413 | Carbonochloridic acid, ethyl ester |
52803299 | Carbonochloridic acid, ethyl ester |
503842497 | Carbonochloridic acid, ethyl ester |
79221 | Carbonochloridic acid, methyl ester |
109615 | Carbonochloridic acid, propyl ester |
2812739 | Carbonochloridothioic acid |
16890850 | Carbonochloridothioic acid |
2941642 | Carbonochloridothioic acid, S-ethyl ester |
1082068754 | Carbonochloridothioic acid, S-ethyl ester |
13889924 | Carbonochloridothioic acid, S-propyl ester |
463718 | Carbonothioic dichloride |
9000402 | Carob gum |
9010359 | Carob gum |
9010519 | Carob gum |
37231315 | Carob gum |
37231326 | Carob gum |
72980804 | Carob gum |
73379789 | Carob gum |
8001794 | Castor oil |
8013567 | Castor oil |
8015574 | Castor oil |
8021372 | Castor oil |
8036086 | Castor oil |
8041223 | Castor oil |
8041950 | Castor oil |
89958327 | Castor oil |
151438721 | Castor oil |
898831113 | Castor oil |
9004346 | Cellulose |
9012195 | Cellulose |
9037507 | Cellulose |
9076306 | Cellulose |
12656529 | Cellulose |
39394439 | Cellulose |
51395767 | Cellulose |
58968675 | Cellulose |
61991217 | Cellulose |
61991228 | Cellulose |
67016755 | Cellulose |
67016766 | Cellulose |
68073052 | Cellulose |
70225795 | Cellulose |
74623168 | Cellulose |
75398833 | Cellulose |
77907701 | Cellulose |
84503753 | Cellulose |
89468666 | Cellulose |
99331825 | Cellulose |
152231691 | Cellulose |
189398865 | Cellulose |
209533959 | Cellulose |
324745495 | Cellulose |
358787629 | Cellulose |
1161712522 | Cellulose |
1374408522 | Cellulose |
9004675 | Cellulose, methyl ether |
39384651 | Cellulose, methyl ether |
53568346 | Cellulose, methyl ether |
71812196 | Cellulose, methyl ether |
88402840 | Cellulose, methyl ether |
99638592 | Cellulose, methyl ether |
730985587 | Cellulose, methyl ether |
1339760 | Cellulose, nitrate |
8050699 | Cellulose, nitrate |
8050702 | Cellulose, nitrate |
9004700 | Cellulose, nitrate |
37228312 | Cellulose, nitrate |
37317489 | Cellulose, nitrate |
60649572 | Cellulose, nitrate |
72026643 | Cellulose, nitrate |
72026687 | Cellulose, nitrate |
88386258 | Cellulose, nitrate |
124362830 | Cellulose, nitrate |
152264125 | Cellulose, nitrate |
188626791 | Cellulose, nitrate |
246848293 | Cellulose, nitrate |
353274563 | Cellulose, nitrate |
909342547 | Cellulose, nitrate |
7440451 | Cerium |
110123494 | Cerium |
196959418 | Cerium |
13967743 | Cerium, isotope of mass 141 |
14119198 | Cerium, isotope of mass 143 |
14762788 | Cerium, isotope of mass 144 |
7440462 | Cesium |
24347124 | Cesium |
1093650975 | Cesium |
1308470 | Cesium hydroxide (Cs(OH)) |
21351791 | Cesium hydroxide (Cs(OH)) |
14914762 | Cesium, isotope of mass 131 |
13967709 | Cesium, isotope of mass 134 |
15726304 | Cesium, isotope of mass 135 |
14234298 | Cesium, isotope of mass 136 |
10045973 | Cesium, isotope of mass 137 |
17032303 | Cesium, isotope of mass 137 |
100045973 | Cesium, isotope of mass 137 |
55867 | Chloramide |
10599903 | Chloramide |
1428979514 | Chloramide |
14866683 | Chlorate |
12789036 | Chlordane, technical |
15477335 | Chloric acid, aluminum salt |
7775099 | Chloric acid, sodium salt (1:1) |
11096450 | Chloric acid, sodium salt (1:1) |
38869737 | Chloric acid, sodium salt (1:1) |
38869748 | Chloric acid, sodium salt (1:1) |
8012837 | Chloric acid, sodium salt, mixt. with boric acid (HBO2) sodium salt |
51990115 | Chloric acid, sodium salt, mixt. with boric acid (HBO2) sodium salt |
52623844 | Chloric acid, sodium salt, mixt. with boric acid (HBO2) sodium salt |
16887006 | Chloride |
68188885 | Chloride |
405267461 | Chloride |
136677093 | Chlorinated dibenzo-p-dioxins |
75003 | Chlorine |
7782505 | Chlorine |
7790912 | Chlorine fluoride (ClF3) |
12422229 | Chlorine fluoride (ClF3) |
12526022 | Chlorine fluoride (ClF3) |
7791211 | Chlorine oxide (Cl2O) |
1333819 | Chlorine oxide (ClO2) |
10049044 | Chlorine oxide (ClO2) |
24518476 | Chlorine oxide (ClO2) |
56310066 | Chlorine oxide (ClO2) |
69049770 | Chlorine oxide (ClO2) |
70134371 | Chlorine oxide (ClO2) |
72061906 | Chlorine oxide (ClO2) |
74296110 | Chlorine oxide (ClO2) |
77546179 | Chlorine oxide (ClO2) |
77546180 | Chlorine oxide (ClO2) |
93085224 | Chlorine oxide (ClO2) |
155808176 | Chlorine oxide (ClO2) |
744149539 | Chlorine oxide (ClO2) |
807261605 | Chlorine oxide (ClO2) |
1002158679 | Chlorine oxide (ClO2) |
1014743760 | Chlorine oxide (ClO2) |
1018807914 | Chlorine oxide (ClO2) |
1428979525 | Chlorine oxide (ClO2) |
13981436 | Chlorine, isotope of mass 36 |
14998277 | Chlorite |
7647010 | Chlorofluorocarbons |
11003455 | Chlorophyll c |
12777503 | Chlorophyll c |
7758192 | Chlorous acid, sodium salt (1:1) |
66554516 | Chlorous acid, sodium salt (1:1) |
1352826562 | Chlorous acid, sodium salt (1:1) |
434139 | Cholan-24-oic acid, 3-hydroxy-, (3.alpha.,5.beta.)- |
3546109 | Cholest-5-en-3-ol (3.beta.)-, 4-[bis(2-chloroethyl)amino]benzeneacetate |
9007265 | Cholestyramine |
11041126 | Cholestyramine |
58391370 | Cholestyramine |
12381485 | Chromate (CrO42-) |
13907454 | Chromate (CrO42-) |
76055691 | Chromate (CrO42-) |
795254943 | Chromate (CrO42-) |
13530682 | Chromic acid (H2Cr2O7) |
30441384 | Chromic acid (H2Cr2O7) |
7789095 | Chromic acid (H2Cr2O7), ammonium salt (1:2) |
7778509 | Chromic acid (H2Cr2O7), potassium salt (1:2) |
10588019 | Chromic acid (H2Cr2O7), sodium salt (1:2) |
12018325 | Chromic acid (H2Cr2O7), sodium salt (1:2) |
1018900849 | Chromic acid (H2Cr2O7), sodium salt (1:2) |
1088355138 | Chromic acid (H2Cr2O7), sodium salt (1:2) |
1391351000 | Chromic acid (H2Cr2O7), sodium salt (1:2) |
7738945 | Chromic acid (H2CrO4) |
9044104 | Chromic acid (H2CrO4) |
11115745 | Chromic acid (H2CrO4) |
24934609 | Chromic acid (H2CrO4) |
199384582 | Chromic acid (H2CrO4) |
237391945 | Chromic acid (H2CrO4) |
7788989 | Chromic acid (H2CrO4), ammonium salt (1:2) |
50929823 | Chromic acid (H2CrO4), ammonium salt (1:2) |
10294403 | Chromic acid (H2CrO4), barium salt (1:1) |
12000349 | Chromic acid (H2CrO4), barium salt (1:1) |
12231184 | Chromic acid (H2CrO4), barium salt (1:1) |
1189851 | Chromic acid (H2CrO4), bis(1,1-dimethylethyl) ester |
13765190 | Chromic acid (H2CrO4), calcium salt (1:1) |
8012757 | Chromic acid (H2CrO4), calcium salt (1:1), dihydrate |
10060089 | Chromic acid (H2CrO4), calcium salt (1:1), dihydrate |
12640685 | Chromic acid (H2CrO4), compd. with cyclohexanamine |
20736645 | Chromic acid (H2CrO4), compd. with cyclohexanamine |
7758976 | Chromic acid (H2CrO4), lead(2+) salt (1:1) |
8049647 | Chromic acid (H2CrO4), lead(2+) salt (1:1) |
18454121 | Chromic acid (H2CrO4), lead(2+) salt (1:1) |
181768989 | Chromic acid (H2CrO4), lead(2+) salt (1:1) |
14307358 | Chromic acid (H2CrO4), lithium salt (1:2) |
7789006 | Chromic acid (H2CrO4), potassium salt (1:2) |
7775113 | Chromic acid (H2CrO4), sodium salt (1:2) |
7789062 | Chromic acid (H2CrO4), strontium salt (1:1) |
54322600 | Chromic acid (H2CrO4), strontium salt (1:1) |
166269552 | Chromic acid (H2CrO4), strontium salt (1:1) |
1308130 | Chromic acid (H2CrO4), zinc salt (1:1) |
1328672 | Chromic acid (H2CrO4), zinc salt (1:1) |
13530659 | Chromic acid (H2CrO4), zinc salt (1:1) |
14675413 | Chromic acid (H2CrO4), zinc salt (1:1) |
7440473 | Chromium |
188785877 | Chromium |
195161821 | Chromium |
13007926 | Chromium carbonyl (Cr(CO)6), (OC-6-11)- |
13930944 | Chromium carbonyl (Cr(CO)6), (OC-6-11)- |
51053453 | Chromium carbonyl (Cr(CO)6), (OC-6-11)- |
848779191 | Chromium carbonyl (Cr(CO)6), (OC-6-11)- |
10025737 | Chromium chloride (CrCl3) |
7440473 | Chromium compounds |
1308141 | Chromium hydroxide (Cr(OH)3) |
1331820 | Chromium oxide (CrO3) |
1333820 | Chromium oxide (CrO3) |
7738945 | Chromium oxide (CrO3) |
12324059 | Chromium oxide (CrO3) |
12324082 | Chromium oxide (CrO3) |
7791142 | Chromium, dichlorodioxo-, (T-4)- |
14977618 | Chromium, dichlorodioxo-, (T-4)- |
34848094 | Chromium, dichlorodioxo-, (T-4)- |
7788967 | Chromium, difluorodioxo-, (T-4)- |
22030462 | Chromium, difluorodioxo-, (T-4)- |
7440473 | Chromium, ion (Cr3+) |
16065831 | Chromium, ion (Cr3+) |
18540299 | Chromium, ion (Cr6+) |
14392020 | Chromium, isotope of mass 51 |
122123 | Chromium, tetrachloro-.mu.-hydroxy[.mu.-(octadecanoato-.kappa.O:.kappa.O')]di- |
1338450 | Chromium, tetrachloro-.mu.-hydroxy[.mu.-(octadecanoato-.kappa.O:.kappa.O')]di- |
12295920 | Chromium, tetrachloro-.mu.-hydroxy[.mu.-(octadecanoato-.kappa.O:.kappa.O')]di- |
15242963 | Chromium, tetrachloro-.mu.-hydroxy[.mu.-(octadecanoato-.kappa.O:.kappa.O')]di- |
29543860 | Chromium, tetrachloro-.mu.-hydroxy[.mu.-(octadecanoato-.kappa.O:.kappa.O')]di- |
39279920 | Chromium, tetrachloro-.mu.-hydroxy[.mu.-(octadecanoato-.kappa.O:.kappa.O')]di- |
113285624 | Chromium, tetrachloro-.mu.-hydroxy[.mu.-(octadecanoato-.kappa.O:.kappa.O')]di- |
1271245 | Chromocene |
218019 | Chrysene |
27274051 | Chrysene |
1719035 | Chrysene-d12 |
12001295 | Chrysotile (Mg3H2(SiO4)2.H2O) |
12426981 | Chrysotile (Mg3H2(SiO4)2.H2O) |
61076979 | Chrysotile (Mg3H2(SiO4)2.H2O) |
132207320 | Chrysotile (Mg3H2(SiO4)2.H2O) |
56542 | Cinchonan-9-ol, 6'-methoxy-, (9S)- |
11010734 | Cinchonan-9-ol, 6'-methoxy-, (9S)- |
500225456 | Cinchonan-9-ol, 6'-methoxy-, (9S)- |
845886648 | Cinchonan-9-ol, 6'-methoxy-, (9S)- |
882741471 | Cinchonan-9-ol, 6'-methoxy-, (9S)- |
883881014 | Cinchonan-9-ol, 6'-methoxy-, (9S)- |
898814001 | Cinchonan-9-ol, 6'-methoxy-, (9S)- |
910899513 | Cinchonan-9-ol, 6'-methoxy-, (9S)- |
126851283 | Clam-Trol CT 1 |
193700059 | Clam-trol CT-2 |
7440484 | Cobalt |
132965607 | Cobalt |
177256358 | Cobalt |
184637910 | Cobalt |
195161796 | Cobalt |
335349434 | Cobalt |
1245817406 | Cobalt |
1262528324 | Cobalt |
7440484 | Cobalt compounds |
1307966 | Cobalt oxide (CoO) |
185461932 | Cobalt oxide (CoO) |
186373013 | Cobalt oxide (CoO) |
1317426 | Cobalt sulfide (CoS) |
23319519 | Cobalt, [N,N-bis(carboxymethyl)glycinato(3-)-N,O,O',O'']- |
57693024 | Cobalt, [[2,2'-[1,2-ethanediylbis[(nitrilo-.kappa.N)methylidyne]]bis[6-fluorophenolato-.kappa.O]](2-)]-, (SP-4-2)- |
62207765 | Cobalt, [[2,2'-[1,2-ethanediylbis[(nitrilo-.kappa.N)methylidyne]]bis[6-fluorophenolato-.kappa.O]](2-)]-, (SP-4-2)- |
10210681 | Cobalt, di-.mu.-carbonylhexacarbonyldi-, (Co-Co) |
12553616 | Cobalt, di-.mu.-carbonylhexacarbonyldi-, (Co-Co) |
14525269 | Cobalt, di-.mu.-carbonylhexacarbonyldi-, (Co-Co) |
19998880 | Cobalt, di-.mu.-carbonylhexacarbonyldi-, (Co-Co) |
24917042 | Cobalt, di-.mu.-carbonylhexacarbonyldi-, (Co-Co) |
90043995 | Cobalt, di-.mu.-carbonylhexacarbonyldi-, (Co-Co) |
13981505 | Cobalt, isotope of mass 57 |
13981389 | Cobalt, isotope of mass 58 |
7440484 | Cobalt, isotope of mass 60 |
10198400 | Cobalt, isotope of mass 60 |
16842038 | Cobalt, tetracarbonylhydro- |
53108502 | Cobaltate(1-), [N,N-bis[(carboxy-.kappa.O)methyl]glycinato(3-)-.kappa.N,.kappa.O]-, hydrogen (1:1), (T-4)- |
1277436 | Cobaltocene |
78206334 | Cobaltocene |
8007452 | Coke oven emissions -- CAA 112B |
7440508 | Copper |
65555900 | Copper |
72514831 | Copper |
133353465 | Copper |
133353476 | Copper |
195161809 | Copper |
7440508 | Copper 90th percentile exceedance |
7758896 | Copper chloride (CuCl) |
11093688 | Copper chloride (CuCl) |
12258967 | Copper chloride (CuCl) |
12622241 | Copper chloride (CuCl) |
53906700 | Copper chloride (CuCl) |
53906711 | Copper chloride (CuCl) |
53906722 | Copper chloride (CuCl) |
53906733 | Copper chloride (CuCl) |
1344678 | Copper chloride (CuCl2) |
7447394 | Copper chloride (CuCl2) |
423724634 | Copper chloride (CuCl2) |
8011776 | Copper chloride hydroxide (Cu2Cl(OH)3), mixt. with copper hydroxide sulfate (Cu4(OH)6(SO4)) |
8012699 | Copper chloride hydroxide (Cu2Cl(OH)3), mixt. with copper hydroxide sulfate (Cu4(OH)6(SO4)) |
7440508 | Copper compounds |
544923 | Copper cyanide (Cu(CN)) |
13092676 | Copper cyanide (Cu(CN)) |
1308572 | Copper hydroxide (Cu(OH)2) |
12191172 | Copper hydroxide (Cu(OH)2) |
20427592 | Copper hydroxide (Cu(OH)2) |
42616637 | Copper hydroxide (Cu(OH)2) |
177322393 | Copper hydroxide (Cu(OH)2) |
1135443536 | Copper hydroxide (Cu(OH)2) |
1317391 | Copper oxide (Cu2O) |
633343789 | Copper oxide (Cu2O) |
1317380 | Copper oxide (CuO) |
185461921 | Copper oxide (CuO) |
147148 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
10482390 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
11097566 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
11129843 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
12767678 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
34567549 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
37223817 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
39378751 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
39473104 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
51331329 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
53028776 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
53802065 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
55819493 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
57425522 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
57916968 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
59518911 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
59966880 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
60880515 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
60937793 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
61489665 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
61489778 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
61537108 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
64333579 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
66121195 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
69431772 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
78170271 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
78413599 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
85255954 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
85256775 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
90452203 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
92909143 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
95660314 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
95917741 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
96024350 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
104921995 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
109675776 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
109766952 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
115284429 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
143350474 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
158853862 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
172308315 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
172826469 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
175386671 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
177529543 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
177646058 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
184007781 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
209343486 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
211564975 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
211925803 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
213190864 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
220971302 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
244244868 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
281664468 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
345338752 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
392718626 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
681847789 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
807622862 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
819860690 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
819860850 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
863781220 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
876132977 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
878390739 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
898287575 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
924902001 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
929875821 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
1082606323 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
1200437053 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
1314884837 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
1400683455 | Copper, [29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- |
191071 | Coronene |
65426279 | Coronene |
8001294 | Cottonseed oil |
84650011 | Cottonseed oil |
89997977 | Cottonseed oil |
94279693 | Cottonseed oil |
94279706 | Cottonseed oil |
8001589 | Creosote |
8021394 | Creosote |
8001589 | Creosote, wood |
8021394 | Creosote, wood |
1317482 | Cristobalite (SiO2) |
14464461 | Cristobalite (SiO2) |
105269703 | Cristobalite (SiO2) |
1344758 | Cryolite (Na3(AlF6)) |
15096523 | Cryolite (Na3(AlF6)) |
10300740 | Cuprate(2-), [2-hydroxy-5-[2-[4'-[2-[2-(hydroxy-.kappa.O)-6-hydroxy-3-[2-[2-(hydroxy-.kappa.O)-5-sulfophenyl]diazenyl-.kappa.N1]phenyl]diazenyl][1,1'-biphenyl]-4-yl]diazenyl]benzoato(4-)]-, sodium (1:2) |
16071866 | Cuprate(2-), [2-hydroxy-5-[2-[4'-[2-[2-(hydroxy-.kappa.O)-6-hydroxy-3-[2-[2-(hydroxy-.kappa.O)-5-sulfophenyl]diazenyl-.kappa.N1]phenyl]diazenyl][1,1'-biphenyl]-4-yl]diazenyl]benzoato(4-)]-, sodium (1:2) |
39403888 | Cuprate(2-), [2-hydroxy-5-[2-[4'-[2-[2-(hydroxy-.kappa.O)-6-hydroxy-3-[2-[2-(hydroxy-.kappa.O)-5-sulfophenyl]diazenyl-.kappa.N1]phenyl]diazenyl][1,1'-biphenyl]-4-yl]diazenyl]benzoato(4-)]-, sodium (1:2) |
58601879 | Cuprate(2-), [2-hydroxy-5-[2-[4'-[2-[2-(hydroxy-.kappa.O)-6-hydroxy-3-[2-[2-(hydroxy-.kappa.O)-5-sulfophenyl]diazenyl-.kappa.N1]phenyl]diazenyl][1,1'-biphenyl]-4-yl]diazenyl]benzoato(4-)]-, sodium (1:2) |
76199832 | Cuprate(2-), [2-hydroxy-5-[2-[4'-[2-[2-(hydroxy-.kappa.O)-6-hydroxy-3-[2-[2-(hydroxy-.kappa.O)-5-sulfophenyl]diazenyl-.kappa.N1]phenyl]diazenyl][1,1'-biphenyl]-4-yl]diazenyl]benzoato(4-)]-, sodium (1:2) |
10401500 | Cuprate(4-), [.mu.-[[3,3'-[[3,3'-di(hydroxy-.kappa.O)[1,1'-biphenyl]-4,4'-diyl]bis(2,1-diazenediyl-.kappa.N1)]bis[5-amino-4-(hydroxy-.kappa.O)-2,7-naphthalenedisulfonato]](8-)]]di-, sodium (1:4) |
23909662 | Cuprate(4-), [.mu.-[[3,3'-[[3,3'-di(hydroxy-.kappa.O)[1,1'-biphenyl]-4,4'-diyl]bis(2,1-diazenediyl-.kappa.N1)]bis[5-amino-4-(hydroxy-.kappa.O)-2,7-naphthalenedisulfonato]](8-)]]di-, sodium (1:4) |
27569079 | Cuprate(4-), [.mu.-[[3,3'-[[3,3'-di(hydroxy-.kappa.O)[1,1'-biphenyl]-4,4'-diyl]bis(2,1-diazenediyl-.kappa.N1)]bis[5-amino-4-(hydroxy-.kappa.O)-2,7-naphthalenedisulfonato]](8-)]]di-, sodium (1:4) |
28407376 | Cuprate(4-), [.mu.-[[3,3'-[[3,3'-di(hydroxy-.kappa.O)[1,1'-biphenyl]-4,4'-diyl]bis(2,1-diazenediyl-.kappa.N1)]bis[5-amino-4-(hydroxy-.kappa.O)-2,7-naphthalenedisulfonato]](8-)]]di-, sodium (1:4) |
72882281 | Cuprate(4-), [.mu.-[[3,3'-[[3,3'-di(hydroxy-.kappa.O)[1,1'-biphenyl]-4,4'-diyl]bis(2,1-diazenediyl-.kappa.N1)]bis[5-amino-4-(hydroxy-.kappa.O)-2,7-naphthalenedisulfonato]](8-)]]di-, sodium (1:4) |
190258210 | Cuprate(4-), [.mu.-[[3,3'-[[3,3'-di(hydroxy-.kappa.O)[1,1'-biphenyl]-4,4'-diyl]bis(2,1-diazenediyl-.kappa.N1)]bis[5-amino-4-(hydroxy-.kappa.O)-2,7-naphthalenedisulfonato]](8-)]]di-, sodium (1:4) |
420042 | Cyanamide |
4200042 | Cyanamide |
32729718 | Cyanamide |
65931455 | Cyanamide |
1467794 | Cyanamide, N,N-dimethyl- |
156627 | Cyanamide, calcium salt (1:1) |
1015936910 | Cyanamide, calcium salt (1:1) |
1202864945 | Cyanamide, calcium salt (1:1) |
1203558433 | Cyanamide, calcium salt (1:1) |
661201 | Cyanate |
16610289 | Cyanate |
420053 | Cyanic acid |
661201 | Cyanic acid |
590283 | Cyanic acid, potassium salt (1:1) |
15586002 | Cyanic acid, potassium salt (1:1) |
40750901 | Cyanic acid, potassium salt (1:1) |
917613 | Cyanic acid, sodium salt (1:1) |
16910853 | Cyanic acid, sodium salt (1:1) |
64256366 | Cyanic acid, sodium salt (1:1) |
159334164 | Cyanic acid, sodium salt (1:1) |
57125 | Cyanide |
373513 | Cyanide |
143339 | Cyanide compounds |
506683 | Cyanogen bromide ((CN)Br) |
506774 | Cyanogen chloride ((CN)Cl) |
3194556 | Cyclododecane, hexabromo- |
22374578 | Cyclododecane, hexabromo- |
25637994 | Cyclododecane, hexabromo- |
108918 | Cyclohexanamine |
143247750 | Cyclohexanamine |
157973609 | Cyclohexanamine |
1761713 | Cyclohexanamine, 4,4'-methylenebis- |
123203350 | Cyclohexanamine, 4,4'-methylenebis- |
101837 | Cyclohexanamine, N-cyclohexyl- |
111487888 | Cyclohexanamine, N-cyclohexyl- |
111487935 | Cyclohexanamine, N-cyclohexyl- |
111522942 | Cyclohexanamine, N-cyclohexyl- |
157973632 | Cyclohexanamine, N-cyclohexyl- |
856793276 | Cyclohexanamine, N-cyclohexyl- |
3882062 | Cyclohexanamine, N-cyclohexyl-, nitrate |
3129917 | Cyclohexanamine, N-cyclohexyl-, nitrite (1:1) |
12640765 | Cyclohexanamine, N-cyclohexyl-, nitrite (1:1) |
75635313 | Cyclohexanamine, N-cyclohexyl-, nitrite (1:1) |
85531006 | Cyclohexanamine, N-cyclohexyl-, nitrite (1:1) |
108314121 | Cyclohexanamine, N-cyclohexyl-, nitrite (1:1) |
123789162 | Cyclohexanamine, N-cyclohexyl-, nitrite (1:1) |
856577725 | Cyclohexanamine, N-cyclohexyl-, nitrite (1:1) |
947922 | Cyclohexanamine, N-cyclohexyl-N-nitroso- |
110827 | Cyclohexane |
319846 | Cyclohexane |
5124301 | Cyclohexane, 1,1'-methylenebis[4-isocyanato- |
68966632 | Cyclohexane, 1,1'-methylenebis[4-isocyanato- |
73156157 | Cyclohexane, 1,1'-methylenebis[4-isocyanato- |
88504761 | Cyclohexane, 1,1'-methylenebis[4-isocyanato- |
103072215 | Cyclohexane, 1,1'-methylenebis[4-isocyanato- |
107314169 | Cyclohexane, 1,1'-methylenebis[4-isocyanato- |
123773488 | Cyclohexane, 1,1'-methylenebis[4-isocyanato- |
190601979 | Cyclohexane, 1,1'-methylenebis[4-isocyanato- |
201536778 | Cyclohexane, 1,1'-methylenebis[4-isocyanato- |
280144174 | Cyclohexane, 1,1'-methylenebis[4-isocyanato- |
1081805584 | Cyclohexane, 1,1'-methylenebis[4-isocyanato- |
608731 | Cyclohexane, 1,2,3,4,5,6-hexachloro- |
319858 | Cyclohexane, 1,2,3,4,5,6-hexachloro-, (1.alpha.,2.alpha.,3.alpha.,4.beta.,5.alpha.,6.beta.)- |
319868 | Cyclohexane, 1,2,3,4,5,6-hexachloro-, (1.alpha.,2.alpha.,3.alpha.,4.beta.,5.alpha.,6.beta.)- |
89609198 | Cyclohexane, 1,2,3,4,5,6-hexachloro-, (1.alpha.,2.alpha.,3.alpha.,4.beta.,5.alpha.,6.beta.)- |
58899 | Cyclohexane, 1,2,3,4,5,6-hexachloro-, (1.alpha.,2.alpha.,3.beta.,4.alpha.,5.alpha.,6.beta.)- |
8007429 | Cyclohexane, 1,2,3,4,5,6-hexachloro-, (1.alpha.,2.alpha.,3.beta.,4.alpha.,5.alpha.,6.beta.)- |
8073232 | Cyclohexane, 1,2,3,4,5,6-hexachloro-, (1.alpha.,2.alpha.,3.beta.,4.alpha.,5.alpha.,6.beta.)- |
25897487 | Cyclohexane, 1,2,3,4,5,6-hexachloro-, (1.alpha.,2.alpha.,3.beta.,4.alpha.,5.alpha.,6.beta.)- |
53529376 | Cyclohexane, 1,2,3,4,5,6-hexachloro-, (1.alpha.,2.alpha.,3.beta.,4.alpha.,5.alpha.,6.beta.)- |
55963796 | Cyclohexane, 1,2,3,4,5,6-hexachloro-, (1.alpha.,2.alpha.,3.beta.,4.alpha.,5.alpha.,6.beta.)- |
319846 | Cyclohexane, 1,2,3,4,5,6-hexachloro-, (1.alpha.,2.alpha.,3.beta.,4.alpha.,5.beta.,6.beta.)- |
20437972 | Cyclohexane, 1,2,3,4,5,6-hexachloro-, (1.alpha.,2.alpha.,3.beta.,4.alpha.,5.beta.,6.beta.)- |
60291329 | Cyclohexane, 1,2,3,4,5,6-hexachloro-, (1.alpha.,2.alpha.,3.beta.,4.alpha.,5.beta.,6.beta.)- |
319857 | Cyclohexane, 1,2,3,4,5,6-hexachloro-, (1.alpha.,2.beta.,3.alpha.,4.beta.,5.alpha.,6.beta.)- |
87843 | Cyclohexane, 1,2,3,4,5-pentabromo-6-chloro- |
25495992 | Cyclohexane, 1,2,3,4,5-pentabromo-6-chloro- |
3322938 | Cyclohexane, 1,2-dibromo-4-(1,2-dibromoethyl)- |
99821 | Cyclohexane, 1-methyl-4-(1-methylethyl)- |
374781461 | Cyclohexane, 1-methyl-4-(1-methylethyl)- |
4098719 | Cyclohexane, 5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethyl- |
26602937 | Cyclohexane, 5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethyl- |
50974997 | Cyclohexane, 5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethyl- |
52985930 | Cyclohexane, 5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethyl- |
63793408 | Cyclohexane, 5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethyl- |
66708074 | Cyclohexane, 5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethyl- |
70936979 | Cyclohexane, 5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethyl- |
74091637 | Cyclohexane, 5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethyl- |
74520926 | Cyclohexane, 5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethyl- |
88778749 | Cyclohexane, 5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethyl- |
101701808 | Cyclohexane, 5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethyl- |
102771744 | Cyclohexane, 5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethyl- |
105439029 | Cyclohexane, 5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethyl- |
110648356 | Cyclohexane, 5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethyl- |
111093755 | Cyclohexane, 5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethyl- |
124961520 | Cyclohexane, 5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethyl- |
129212175 | Cyclohexane, 5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethyl- |
146282599 | Cyclohexane, 5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethyl- |
146665385 | Cyclohexane, 5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethyl- |
149579362 | Cyclohexane, 5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethyl- |
194936840 | Cyclohexane, 5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethyl- |
1186289224 | Cyclohexane, 5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethyl- |
1199811147 | Cyclohexane, 5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethyl- |
1211316629 | Cyclohexane, 5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethyl- |
27154445 | Cyclohexane, hexachloro- |
69865470 | Cyclohexane, hexachloro- |
86752990 | Cyclohexane, hexachloro- |
86753926 | Cyclohexane, hexachloro- |
88161755 | Cyclohexane, hexachloro- |
99684238 | Cyclohexane, hexachloro- |
137497611 | Cyclohexane, hexachloro- |
139203319 | Cyclohexane, hexachloro- |
142443956 | Cyclohexane, hexachloro- |
146909559 | Cyclohexane, hexachloro- |
159940280 | Cyclohexane, hexachloro- |
186554450 | Cyclohexane, hexachloro- |
108872 | Cyclohexane, methyl- |
1122607 | Cyclohexane, nitro- |
931975 | Cyclohexanecarbonitrile, 1-hydroxy- |
4802204 | Cyclohexaneethanethiol, 3-mercapto-.beta.,4-dimethyl- |
7487312 | Cyclohexaneethanethiol, 3-mercapto-.beta.,4-dimethyl- |
31354968 | Cyclohexaneethanethiol, 3-mercapto-.beta.,4-dimethyl- |
80524 | Cyclohexanemethanamine, 4-amino-.alpha.,.alpha.,4-trimethyl- |
14720048 | Cyclohexanemethanamine, 4-amino-.alpha.,.alpha.,4-trimethyl- |
1569693 | Cyclohexanethiol |
108930 | Cyclohexanol |
67970 | Cyclohexanol, 3-[(2E)-2-[(1R,3aS,7aR)-1-[(1R)-1,5-dimethylhexyl]octahydro-7a-methyl-4H-inden-4-ylidene]ethylidene]-4-methylene-, (1S,3Z)- |
8024199 | Cyclohexanol, 3-[(2E)-2-[(1R,3aS,7aR)-1-[(1R)-1,5-dimethylhexyl]octahydro-7a-methyl-4H-inden-4-ylidene]ethylidene]-4-methylene-, (1S,3Z)- |
8050677 | Cyclohexanol, 3-[(2E)-2-[(1R,3aS,7aR)-1-[(1R)-1,5-dimethylhexyl]octahydro-7a-methyl-4H-inden-4-ylidene]ethylidene]-4-methylene-, (1S,3Z)- |
89781 | Cyclohexanol, 5-methyl-2-(1-methylethyl)-, (1R,2S,5R)-rel- |
15356704 | Cyclohexanol, 5-methyl-2-(1-methylethyl)-, (1R,2S,5R)-rel- |
1331233 | Cyclohexanol, methyl- |
25639423 | Cyclohexanol, methyl- |
108941 | Cyclohexanone |
583608 | Cyclohexanone, 2-methyl- |
24965842 | Cyclohexanone, 2-methyl- |
110838 | Cyclohexene |
33004067 | Cyclohexene |
138863 | Cyclohexene, 1-methyl-4-(1-methylethenyl)- |
555088 | Cyclohexene, 1-methyl-4-(1-methylethenyl)- |
7705148 | Cyclohexene, 1-methyl-4-(1-methylethenyl)- |
8022900 | Cyclohexene, 1-methyl-4-(1-methylethenyl)- |
8050326 | Cyclohexene, 1-methyl-4-(1-methylethenyl)- |
5989275 | Cyclohexene, 1-methyl-4-(1-methylethenyl)-, (4R)- |
7705137 | Cyclohexene, 1-methyl-4-(1-methylethenyl)-, (4R)- |
94765750 | Cyclohexene, 1-methyl-4-(1-methylethenyl)-, (4R)- |
95327983 | Cyclohexene, 1-methyl-4-(1-methylethenyl)-, (4R)- |
1051930869 | Cyclohexene, 1-methyl-4-(1-methylethenyl)-, (4R)- |
100403 | Cyclohexene, 4-ethenyl- |
92619437 | Cyclohexene, 4-ethenyl- |
1162658 | Cyclopenta(c)furo(3',2':4,5)furo(2,3-h)(1)benzopyran-1,11-dione, 2,3,6a,9a-tetrahydro-4-methoxy-, (6aR,9aS)- |
27208373 | Cyclopenta[cd]pyrene |
287923 | Cyclopentane |
96377 | Cyclopentane, methyl- |
120923 | Cyclopentanone |
142290 | Cyclopentene |
33004056 | Cyclopentene |
706785 | Cyclopentene, octachloro- |
75194 | Cyclopropane |
151821328 | Cyclopropane |
39515418 | Cyclopropanecarboxylic acid, 2,2,3,3-tetramethyl-, cyano(3-phenoxyphenyl)methyl ester |
64257847 | Cyclopropanecarboxylic acid, 2,2,3,3-tetramethyl-, cyano(3-phenoxyphenyl)methyl ester |
2735980 | Cyclopropanecarboxylic acid, 2,2-dimethyl-3-(2-methyl-1-propenyl)-, (1,3,4,5,6,7-hexahydro-1,3-dioxo-2H-isoindol-2-yl)methyl ester |
7696120 | Cyclopropanecarboxylic acid, 2,2-dimethyl-3-(2-methyl-1-propenyl)-, (1,3,4,5,6,7-hexahydro-1,3-dioxo-2H-isoindol-2-yl)methyl ester |
16047226 | Cyclopropanecarboxylic acid, 2,2-dimethyl-3-(2-methyl-1-propenyl)-, (1,3,4,5,6,7-hexahydro-1,3-dioxo-2H-isoindol-2-yl)methyl ester |
28643676 | Cyclopropanecarboxylic acid, 2,2-dimethyl-3-(2-methyl-1-propenyl)-, (1,3,4,5,6,7-hexahydro-1,3-dioxo-2H-isoindol-2-yl)methyl ester |
28752934 | Cyclopropanecarboxylic acid, 2,2-dimethyl-3-(2-methyl-1-propenyl)-, (1,3,4,5,6,7-hexahydro-1,3-dioxo-2H-isoindol-2-yl)methyl ester |
66525277 | Cyclopropanecarboxylic acid, 2,2-dimethyl-3-(2-methyl-1-propenyl)-, (1,3,4,5,6,7-hexahydro-1,3-dioxo-2H-isoindol-2-yl)methyl ester |
22467863 | Cyclopropanecarboxylic acid, 2,2-dimethyl-3-(2-methyl-1-propenyl)-, (1S)-2-methyl-4-oxo-3-(2-propenyl)-2-cyclopenten-1-yl ester, (1R,3R)- |
28057489 | Cyclopropanecarboxylic acid, 2,2-dimethyl-3-(2-methyl-1-propenyl)-, (1S)-2-methyl-4-oxo-3-(2-propenyl)-2-cyclopenten-1-yl ester, (1R,3R)- |
28434006 | Cyclopropanecarboxylic acid, 2,2-dimethyl-3-(2-methyl-1-propenyl)-, (1S)-2-methyl-4-oxo-3-(2-propenyl)-2-cyclopenten-1-yl ester, (1R,3R)- |
28991277 | Cyclopropanecarboxylic acid, 2,2-dimethyl-3-(2-methyl-1-propenyl)-, (1S)-2-methyl-4-oxo-3-(2-propenyl)-2-cyclopenten-1-yl ester, (1R,3R)- |
121211 | Cyclopropanecarboxylic acid, 2,2-dimethyl-3-(2-methyl-1-propenyl)-, (1S)-2-methyl-4-oxo-3-(2Z)-2,4-pentadienyl-2-cyclopenten-1-yl ester, (1R,3R)- |
3903693 | Cyclopropanecarboxylic acid, 2,2-dimethyl-3-(2-methyl-1-propenyl)-, (1S)-2-methyl-4-oxo-3-(2Z)-2,4-pentadienyl-2-cyclopenten-1-yl ester, (1R,3R)- |
39668014 | Cyclopropanecarboxylic acid, 2,2-dimethyl-3-(2-methyl-1-propenyl)-, (1S)-2-methyl-4-oxo-3-(2Z)-2,4-pentadienyl-2-cyclopenten-1-yl ester, (1R,3R)- |
70382 | Cyclopropanecarboxylic acid, 2,2-dimethyl-3-(2-methyl-1-propenyl)-, (2,4-dimethylphenyl)methyl ester |
26002802 | Cyclopropanecarboxylic acid, 2,2-dimethyl-3-(2-methyl-1-propenyl)-, (3-phenoxyphenyl)methyl ester |
53528328 | Cyclopropanecarboxylic acid, 2,2-dimethyl-3-(2-methyl-1-propenyl)-, (3-phenoxyphenyl)methyl ester |
73170793 | Cyclopropanecarboxylic acid, 2,2-dimethyl-3-(2-methyl-1-propenyl)-, (3-phenoxyphenyl)methyl ester |
10453868 | Cyclopropanecarboxylic acid, 2,2-dimethyl-3-(2-methyl-1-propenyl)-, [5-(phenylmethyl)-3-furanyl]methyl ester |
24004077 | Cyclopropanecarboxylic acid, 2,2-dimethyl-3-(2-methyl-1-propenyl)-, [5-(phenylmethyl)-3-furanyl]methyl ester |
52918635 | Cyclopropanecarboxylic acid, 3-(2,2-dibromoethenyl)-2,2-dimethyl-, (S)-cyano(3-phenoxyphenyl)methyl ester, (1R,3R)- |
55700964 | Cyclopropanecarboxylic acid, 3-(2,2-dibromoethenyl)-2,2-dimethyl-, (S)-cyano(3-phenoxyphenyl)methyl ester, (1R,3R)- |
62229770 | Cyclopropanecarboxylic acid, 3-(2,2-dibromoethenyl)-2,2-dimethyl-, (S)-cyano(3-phenoxyphenyl)methyl ester, (1R,3R)- |
52645531 | Cyclopropanecarboxylic acid, 3-(2,2-dichloroethenyl)-2,2-dimethyl-, (3-phenoxyphenyl)methyl ester |
57608045 | Cyclopropanecarboxylic acid, 3-(2,2-dichloroethenyl)-2,2-dimethyl-, (3-phenoxyphenyl)methyl ester |
60018942 | Cyclopropanecarboxylic acid, 3-(2,2-dichloroethenyl)-2,2-dimethyl-, (3-phenoxyphenyl)methyl ester |
63364001 | Cyclopropanecarboxylic acid, 3-(2,2-dichloroethenyl)-2,2-dimethyl-, (3-phenoxyphenyl)methyl ester |
75497642 | Cyclopropanecarboxylic acid, 3-(2,2-dichloroethenyl)-2,2-dimethyl-, (3-phenoxyphenyl)methyl ester |
93388660 | Cyclopropanecarboxylic acid, 3-(2,2-dichloroethenyl)-2,2-dimethyl-, (3-phenoxyphenyl)methyl ester |
52341329 | Cyclopropanecarboxylic acid, 3-(2,2-dichloroethenyl)-2,2-dimethyl-, (3-phenoxyphenyl)methyl ester, (1R,3S)-rel- |
61949777 | Cyclopropanecarboxylic acid, 3-(2,2-dichloroethenyl)-2,2-dimethyl-, (3-phenoxyphenyl)methyl ester, (1R,3S)-rel- |
68359375 | Cyclopropanecarboxylic acid, 3-(2,2-dichloroethenyl)-2,2-dimethyl-, cyano(4-fluoro-3-phenoxyphenyl)methyl ester |
83855463 | Cyclopropanecarboxylic acid, 3-(2,2-dichloroethenyl)-2,2-dimethyl-, cyano(4-fluoro-3-phenoxyphenyl)methyl ester |
85782827 | Cyclopropanecarboxylic acid, 3-(2,2-dichloroethenyl)-2,2-dimethyl-, cyano(4-fluoro-3-phenoxyphenyl)methyl ester |
68085858 | Cyclopropanecarboxylic acid, 3-(2-chloro-3,3,3-trifluoro-1-propenyl)-2,2-dimethyl-, cyano(3-phenoxyphenyl)methyl ester |
149436997 | Cyclopropanecarboxylic acid, 3-(2-chloro-3,3,3-trifluoro-1-propenyl)-2,2-dimethyl-, cyano(3-phenoxyphenyl)methyl ester |
255725861 | Cyclopropanecarboxylic acid, 3-(2-chloro-3,3,3-trifluoro-1-propenyl)-2,2-dimethyl-, cyano(3-phenoxyphenyl)methyl ester |
121299 | Cyclopropanecarboxylic acid, 3-[(1E)-3-methoxy-2-methyl-3-oxo-1-propen-1-yl]-2,2-dimethyl-, (1S)-2-methyl-4-oxo-3-(2Z)-2,4-pentadien-1-yl-2-cyclopenten-1-yl ester, (1R,3R)- |
39668025 | Cyclopropanecarboxylic acid, 3-[(1E)-3-methoxy-2-methyl-3-oxo-1-propen-1-yl]-2,2-dimethyl-, (1S)-2-methyl-4-oxo-3-(2Z)-2,4-pentadien-1-yl-2-cyclopenten-1-yl ester, (1R,3R)- |
79538322 | Cyclopropanecarboxylic acid, 3-[(1Z)-2-chloro-3,3,3-trifluoro-1-propenyl]-2,2-dimethyl-, (2,3,5,6-tetrafluoro-4-methylphenyl)methyl ester, (1R,3R)-rel- |
82657043 | Cyclopropanecarboxylic acid, 3-[(1Z)-2-chloro-3,3,3-trifluoro-1-propenyl]-2,2-dimethyl-, (2-methyl[1,1'-biphenyl]-3-yl)methyl ester, (1R,3R)-rel- |
88671890 | Cyclopropanecarboxylic acid, 3-[(1Z)-2-chloro-3,3,3-trifluoro-1-propenyl]-2,2-dimethyl-, (2-methyl[1,1'-biphenyl]-3-yl)methyl ester, (1R,3R)-rel- |
92880790 | Cyclopropanecarboxylic acid, 3-[(1Z)-2-chloro-3,3,3-trifluoro-1-propenyl]-2,2-dimethyl-, (2-methyl[1,1'-biphenyl]-3-yl)methyl ester, (1R,3R)-rel- |
107497609 | Cyclopropanecarboxylic acid, 3-[(1Z)-2-chloro-3,3,3-trifluoro-1-propenyl]-2,2-dimethyl-, (2-methyl[1,1'-biphenyl]-3-yl)methyl ester, (1R,3R)-rel- |
107538329 | Cyclopropanecarboxylic acid, 3-[(1Z)-2-chloro-3,3,3-trifluoro-1-propenyl]-2,2-dimethyl-, (2-methyl[1,1'-biphenyl]-3-yl)methyl ester, (1R,3R)-rel- |
59865133 | Cyclosporin A |
556672 | Cyclotetrasiloxane, 2,2,4,4,6,6,8,8-octamethyl- |
83874628 | Cyclotetrasiloxane, 2,2,4,4,6,6,8,8-octamethyl- |
104986370 | Cyclotetrasiloxane, 2,2,4,4,6,6,8,8-octamethyl- |
117563663 | Cyclotetrasiloxane, 2,2,4,4,6,6,8,8-octamethyl- |
1257661598 | Cyclotetrasiloxane, 2,2,4,4,6,6,8,8-octamethyl- |
10356760 | Cytidine, 2'-deoxy-5-fluoro- |
527071 | D-Gluconic acid, sodium salt (1:1) |
15537845 | D-Gluconic acid, sodium salt (1:1) |
22808657 | D-Gluconic acid, sodium salt (1:1) |
24551744 | D-Gluconic acid, sodium salt (1:1) |
252255371 | D-Gluconic acid, sodium salt (1:1) |
14906979 | D-Gluconic acid, sodium salt (1:?) |
16916782 | D-Gluconic acid, sodium salt (1:?) |
735332602 | D-Gluconic acid, sodium salt (1:?) |
18883664 | D-Glucose, 2-deoxy-2-[[(methylnitrosoamino)carbonyl]amino]- |
63423 | D-Glucose, 4-O-.beta.-D-galactopyranosyl- |
1336909 | D-Glucose, 4-O-.beta.-D-galactopyranosyl- |
35396146 | D-Glucose, 4-O-.beta.-D-galactopyranosyl- |
36570806 | D-Glucose, 4-O-.beta.-D-galactopyranosyl- |
73824632 | D-Glucose, 4-O-.beta.-D-galactopyranosyl- |
89466762 | D-Glucose, 4-O-.beta.-D-galactopyranosyl- |
200734903 | D-Glucose, 4-O-.beta.-D-galactopyranosyl- |
396716099 | D-Glucose, 4-O-.beta.-D-galactopyranosyl- |
1065027179 | D-Glucose, 4-O-.beta.-D-galactopyranosyl- |
488415 | D-Mannitol, 1,6-dibromo-1,6-dideoxy- |
673063 | D-Phenylalanine |
10549118 | D-Phenylalanine |
298395 | D-Streptamine, O-2-deoxy-2-(methylamino)-.alpha.-L-glucopyranosyl-(1.fwdarw.2)-O-5-deoxy-3-C-formyl-.alpha.-L-lyxofuranosyl-(1.fwdarw.4)-N1,N3-bis(aminoiminomethyl)-, sulfate (2:3) |
3810740 | D-Streptamine, O-2-deoxy-2-(methylamino)-.alpha.-L-glucopyranosyl-(1.fwdarw.2)-O-5-deoxy-3-C-formyl-.alpha.-L-lyxofuranosyl-(1.fwdarw.4)-N1,N3-bis(aminoiminomethyl)-, sulfate (2:3) |
8018051 | D-Streptamine, O-2-deoxy-2-(methylamino)-.alpha.-L-glucopyranosyl-(1.fwdarw.2)-O-5-deoxy-3-C-formyl-.alpha.-L-lyxofuranosyl-(1.fwdarw.4)-N1,N3-bis(aminoiminomethyl)-, sulfate (2:3) |
15105938 | D-Streptamine, O-2-deoxy-2-(methylamino)-.alpha.-L-glucopyranosyl-(1.fwdarw.2)-O-5-deoxy-3-C-formyl-.alpha.-L-lyxofuranosyl-(1.fwdarw.4)-N1,N3-bis(aminoiminomethyl)-, sulfate (2:3) |
67479327 | D-Streptamine, O-2-deoxy-2-(methylamino)-.alpha.-L-glucopyranosyl-(1.fwdarw.2)-O-5-deoxy-3-C-formyl-.alpha.-L-lyxofuranosyl-(1.fwdarw.4)-N1,N3-bis(aminoiminomethyl)-, sulfate (2:3) |
82115933 | D-Streptamine, O-2-deoxy-2-(methylamino)-.alpha.-L-glucopyranosyl-(1.fwdarw.2)-O-5-deoxy-3-C-formyl-.alpha.-L-lyxofuranosyl-(1.fwdarw.4)-N1,N3-bis(aminoiminomethyl)-, sulfate (2:3) |
85027845 | D-Streptamine, O-2-deoxy-2-(methylamino)-.alpha.-L-glucopyranosyl-(1.fwdarw.2)-O-5-deoxy-3-C-formyl-.alpha.-L-lyxofuranosyl-(1.fwdarw.4)-N1,N3-bis(aminoiminomethyl)-, sulfate (2:3) |
153946 | D-Tryptophan |
9000162 | Dammar |
1304025 | Decaborane(14) |
12707298 | Decaborane(14) |
17702419 | Decaborane(14) |
27340438 | Decaborane(14) |
52340097 | Decaborane(14) |
106996536 | Decaborane(14) |
112312 | Decanal |
124185 | Decane |
41556267 | Decanedioic acid, 1,10-bis(1,2,2,6,6-pentamethyl-4-piperidinyl) ester |
83931720 | Decanedioic acid, 1,10-bis(1,2,2,6,6-pentamethyl-4-piperidinyl) ester |
93793670 | Decanedioic acid, 1,10-bis(1,2,2,6,6-pentamethyl-4-piperidinyl) ester |
95078958 | Decanedioic acid, 1,10-bis(1,2,2,6,6-pentamethyl-4-piperidinyl) ester |
95918482 | Decanedioic acid, 1,10-bis(1,2,2,6,6-pentamethyl-4-piperidinyl) ester |
134868705 | Decanedioic acid, 1,10-bis(1,2,2,6,6-pentamethyl-4-piperidinyl) ester |
52829079 | Decanedioic acid, 1,10-bis(2,2,6,6-tetramethyl-4-piperidinyl) ester |
64104434 | Decanedioic acid, 1,10-bis(2,2,6,6-tetramethyl-4-piperidinyl) ester |
91450214 | Decanedioic acid, 1,10-bis(2,2,6,6-tetramethyl-4-piperidinyl) ester |
115621653 | Decanedioic acid, 1,10-bis(2,2,6,6-tetramethyl-4-piperidinyl) ester |
121449001 | Decanedioic acid, 1,10-bis(2,2,6,6-tetramethyl-4-piperidinyl) ester |
127510036 | Decanedioic acid, 1,10-bis(2,2,6,6-tetramethyl-4-piperidinyl) ester |
149264426 | Decanedioic acid, 1,10-bis(2,2,6,6-tetramethyl-4-piperidinyl) ester |
152787047 | Decanedioic acid, 1,10-bis(2,2,6,6-tetramethyl-4-piperidinyl) ester |
331982980 | Decanedioic acid, 1,10-bis(2,2,6,6-tetramethyl-4-piperidinyl) ester |
908343486 | Decanedioic acid, 1,10-bis(2,2,6,6-tetramethyl-4-piperidinyl) ester |
122623 | Decanedioic acid, 1,10-bis(2-ethylhexyl) ester |
28986405 | Decanedioic acid, 1,10-bis(2-ethylhexyl) ester |
131170177 | Decanedioic acid, 1,10-bis(2-ethylhexyl) ester |
334485 | Decanoic acid |
1562943 | Diazene, 1,2-bis(4-methoxyphenyl)-, 1-oxide |
74123210 | Diazene, 1,2-bis(4-methoxyphenyl)-, 1-oxide |
93485768 | Diazene, 1,2-bis(4-methoxyphenyl)-, 1-oxide |
1081826358 | Diazene, 1,2-bis(4-methoxyphenyl)-, 1-oxide |
103333 | Diazene, 1,2-diphenyl- |
495487 | Diazene, 1,2-diphenyl-, 1-oxide |
55599321 | Diazene, 1,2-diphenyl-, 1-oxide |
8074702 | Diazene, 1-(4-butylphenyl)-2-(4-methoxyphenyl)-, monooxide |
11106540 | Diazene, 1-(4-butylphenyl)-2-(4-methoxyphenyl)-, monooxide |
11115745 | Diazene, 1-(4-butylphenyl)-2-(4-methoxyphenyl)-, monooxide |
53469173 | Diazene, 1-(4-butylphenyl)-2-(4-methoxyphenyl)-, monooxide |
56214961 | Diazene, 1-(4-butylphenyl)-2-(4-methoxyphenyl)-, monooxide |
56728188 | Diazene, 1-(4-butylphenyl)-2-(4-methoxyphenyl)-, monooxide |
68992881 | Diazene, 1-(4-butylphenyl)-2-(4-methoxyphenyl)-, monooxide |
25843452 | Diazene, dimethyl-, 1-oxide |
140567 | Diazenesulfonic acid, [4-(dimethylamino)phenyl]-, sodium salt |
226368 | Dibenz[a,h]acridine |
53703 | Dibenz[a,h]anthracene |
224420 | Dibenz[a,j]acridine |
19408743 | Dibenzo-p-dioxin, 1,2,3,7,8,9-hexachloro- |
189640 | Dibenzo[b,def]chrysene |
189644 | Dibenzo[b,def]chrysene |
128665 | Dibenzo[b,def]chrysene-7,14-dione |
12772520 | Dibenzo[b,def]chrysene-7,14-dione |
39280745 | Dibenzo[b,def]chrysene-7,14-dione |
115685466 | Dibenzo[b,def]chrysene-7,14-dione |
662165697 | Dibenzo[b,def]chrysene-7,14-dione |
262124 | Dibenzo[b,e][1,4]dioxin |
35822469 | Dibenzo[b,e][1,4]dioxin, 1,2,3,4,6,7,8-heptachloro- |
5820070 | Dibenzo[b,e][1,4]dioxin, 1,2,3,4,6,7,9-heptachloro- |
58200707 | Dibenzo[b,e][1,4]dioxin, 1,2,3,4,6,7,9-heptachloro- |
39227286 | Dibenzo[b,e][1,4]dioxin, 1,2,3,4,7,8-hexachloro- |
57653857 | Dibenzo[b,e][1,4]dioxin, 1,2,3,4,7,8-hexachloro- |
30746588 | Dibenzo[b,e][1,4]dioxin, 1,2,3,4-tetrachloro- |
34465468 | Dibenzo[b,e][1,4]dioxin, 1,2,3,6,7,8-hexachloro- |
57653857 | Dibenzo[b,e][1,4]dioxin, 1,2,3,6,7,8-hexachloro- |
40321764 | Dibenzo[b,e][1,4]dioxin, 1,2,3,7,8-pentachloro- |
1745016 | Dibenzo[b,e][1,4]dioxin, 2,3,7,8-tetrachloro- |
1746016 | Dibenzo[b,e][1,4]dioxin, 2,3,7,8-tetrachloro- |
56795676 | Dibenzo[b,e][1,4]dioxin, 2,3,7,8-tetrachloro- |
33857282 | Dibenzo[b,e][1,4]dioxin, 2,3,7-trichloro- |
33857260 | Dibenzo[b,e][1,4]dioxin, 2,7-dichloro- |
37871004 | Dibenzo[b,e][1,4]dioxin, heptachloro- |
34464432 | Dibenzo[b,e][1,4]dioxin, hexachloro- |
34465468 | Dibenzo[b,e][1,4]dioxin, hexachloro- |
3268879 | Dibenzo[b,e][1,4]dioxin, octachloro- |
36088229 | Dibenzo[b,e][1,4]dioxin, pentachloro- |
41903575 | Dibenzo[b,e][1,4]dioxin, tetrachloro- |
191264 | Dibenzo[def,mno]chrysene |
132649 | Dibenzofuran |
214827482 | Dibenzofuran |
67562394 | Dibenzofuran, 1,2,3,4,6,7,8-heptachloro- |
67652394 | Dibenzofuran, 1,2,3,4,6,7,8-heptachloro- |
55673897 | Dibenzofuran, 1,2,3,4,7,8,9-heptachloro- |
70648269 | Dibenzofuran, 1,2,3,4,7,8-hexachloro- |
57117449 | Dibenzofuran, 1,2,3,6,7,8-hexachloro- |
72918219 | Dibenzofuran, 1,2,3,7,8,9-hexachloro- |
57117416 | Dibenzofuran, 1,2,3,7,8-pentachloro- |
60851345 | Dibenzofuran, 2,3,4,6,7,8-hexachloro- |
57117314 | Dibenzofuran, 2,3,4,7,8-pentachloro- |
51207310 | Dibenzofuran, 2,3,7,8-tetrachloro- |
51207319 | Dibenzofuran, 2,3,7,8-tetrachloro- |
42934532 | Dibenzofuran, chloro derivs. |
136677106 | Dibenzofuran, chloro derivs. |
38998753 | Dibenzofuran, heptachloro- |
55684941 | Dibenzofuran, hexachloro- |
39001020 | Dibenzofuran, octachloro- |
30402154 | Dibenzofuran, pentachloro- |
30402143 | Dibenzofuran, tetrachloro- |
42934532 | Dibenzofuran, tetrachloro- |
55722275 | Dibenzofuran, tetrachloro- |
43048006 | Dibenzofuran, trichloro- |
132649 | Dibenzofurans, derivs. |
54889440 | Dibenzothiophene, 1,2,3,4-Tetrahydro-8-methyl- |
1304003 | Diborane(6) |
16970813 | Diborane(6) |
19287457 | Diborane(6) |
19287888 | Diborane(6) |
133441460 | Diborane(6) |
849231169 | Diborane(6) |
17101369 | Diphosphite |
152169 | Diphosphoramide, N,N,N',N',N'',N'',N''',N'''-octamethyl- |
2466093 | Diphosphoric acid |
7722885 | Diphosphoric acid, sodium salt (1:4) |
93269171 | Diphosphoric acid, sodium salt (1:4) |
156460730 | Diphosphoric acid, sodium salt (1:4) |
1269628796 | Diphosphoric acid, sodium salt (1:4) |
107493 | Diphosphoric acid, tetraethyl ester |
2764729 | Dipyrido[1,2-a:2',1'-c]pyrazinediium, 6,7-dihydro- |
67994938 | Dipyrido[1,2-a:2',1'-c]pyrazinediium, 6,7-dihydro- |
85007 | Dipyrido[1,2-a:2',1'-c]pyrazinediium, 6,7-dihydro-, dibromide |
2764729 | Dipyrido[1,2-a:2',1'-c]pyrazinediium, 6,7-dihydro-, dibromide |
107460 | Disiloxane, 1,1,1,3,3,3-hexamethyl- |
864719971 | Disiloxane, 1,1,1,3,3,3-hexamethyl- |
1463472970 | Disiloxane, 1,1,1,3,3,3-hexamethyl- |
2627954 | Disiloxane, 1,3-diethenyl-1,1,3,3-tetramethyl- |
846574605 | Disiloxane, 1,3-diethenyl-1,1,3,3-tetramethyl- |
56359 | Distannoxane, 1,1,1,3,3,3-hexabutyl- |
1353053969 | Distannoxane, 1,1,1,3,3,3-hexabutyl- |
12684285 | Distannoxane, 1,1,1,3,3,3-hexakis(2-methyl-2-phenylpropyl)- |
13356086 | Distannoxane, 1,1,1,3,3,3-hexakis(2-methyl-2-phenylpropyl)- |
57547758 | Distannoxane, 1,1,1,3,3,3-hexakis(2-methyl-2-phenylpropyl)- |
68410004 | Distillates (petroleum), crude oil |
64742525 | Distillates (petroleum), hydrotreated heavy naphthenic |
74742887 | Distillates (petroleum), hydrotreated heavy naphthenic |
64742478 | Distillates (petroleum), hydrotreated light |
101795055 | Distillates (petroleum), hydrotreated light |
68425296 | Distillates (petroleum), naphtha-raffinate pyrolyzate-derived, gasoline-blending |
64741884 | Distillates (petroleum), solvent-refined heavy paraffinic |
2179591 | Disulfide, 2-propenyl propyl |
624920 | Disulfide, dimethyl |
7681574 | Disulfurous acid, sodium salt (1:2) |
15771296 | Disulfurous acid, sodium salt (1:2) |
1287784104 | Disulfurous acid, sodium salt (1:2) |
629970 | Docosane |
142789 | Dodecanamide, N-(2-hydroxyethyl)- |
8028851 | Dodecanamide, N-(2-hydroxyethyl)- |
15517654 | Dodecanamide, N-(2-hydroxyethyl)- |
65256271 | Dodecanamide, N-(2-hydroxyethyl)- |
123175086 | Dodecanamide, N-(2-hydroxyethyl)- |
112403 | Dodecane |
143077 | Dodecanoic acid |
7632486 | Dodecanoic acid |
8000622 | Dodecanoic acid |
8045270 | Dodecanoic acid |
203714072 | Dodecanoic acid |
77587 | Dodecanoic acid, 1,1'-(dibutylstannylene) ester |
358509 | Dodecanoic acid, 1,1'-(dibutylstannylene) ester |
7428797 | Dodecanoic acid, 1,1'-(dibutylstannylene) ester |
8028839 | Dodecanoic acid, 1,1'-(dibutylstannylene) ester |
70620289 | Dodecanoic acid, 1,1'-(dibutylstannylene) ester |
125199873 | Dodecanoic acid, 1,1'-(dibutylstannylene) ester |
185915280 | Dodecanoic acid, 1,1'-(dibutylstannylene) ester |
211990099 | Dodecanoic acid, 1,1'-(dibutylstannylene) ester |
120401 | Dodecanoic acid, compd. with 2,2'-iminobis[ethanol] (1:1) |
7487798 | Dodecanoic acid, compd. with 2,2'-iminobis[ethanol] (1:1) |
25378227 | Dodecene |
15840014 | Dysprosium, isotope of mass 166 |
112958 | Eicosane |
860208839 | Eicosane |
15840138 | Erbium, isotope of mass 169 |
379793 | Ergotaman-3',6',18-trione, 12'-hydroxy-2'-methyl-5'-(phenylmethyl)-, (5.alpha.)-, (2R,3R)-2,3-dihydroxybutanedioate (2:1) |
98260312 | Ergotaman-3',6',18-trione, 12'-hydroxy-2'-methyl-5'-(phenylmethyl)-, (5.alpha.)-, (2R,3R)-2,3-dihydroxybutanedioate (2:1) |
12510428 | Erionite ((K0-1Na0-1Ca0-0.5)10(Al10Si26O72).30H2O) |
66733219 | Erionite ((K0-1Na0-1Ca0-0.5)10(Al10Si26O72).30H2O) |
643221 | Erythromycin octadecanoate (salt) |
68583222 | Escherichia coli |
2529648 | Estra-1,3,5(10)-trien-17-ol, (17.beta.)- |
53167 | Estra-1,3,5(10)-trien-17-one, 3-hydroxy- |
37242414 | Estra-1,3,5(10)-trien-17-one, 3-hydroxy- |
50282 | Estra-1,3,5(10)-triene-3,17-diol (17.beta.)- |
22966796 | Estra-1,3,5(10)-triene-3,17-diol (17.beta.)-, bis[4-[bis(2-chloroethyl)amino]benzeneacetate] |
75047 | Ethanamine |
43031216 | Ethanamine |
85404166 | Ethanamine |
85404224 | Ethanamine |
147240 | Ethanamine, 2-(diphenylmethoxy)-N,N-dimethyl-, hydrochloride |
911455 | Ethanamine, 2-[4-(2-chloro-1,2-diphenylethenyl)phenoxy]-N,N-diethyl- |
555771 | Ethanamine, 2-chloro-N,N-bis(2-chloroethyl)- |
538078 | Ethanamine, 2-chloro-N-(2-chloroethyl)-N-ethyl- |
51752 | Ethanamine, 2-chloro-N-(2-chloroethyl)-N-methyl- |
55867 | Ethanamine, 2-chloro-N-(2-chloroethyl)-N-methyl-, hydrochloride |
121448 | Ethanamine, N,N-diethyl- |
144514147 | Ethanamine, N,N-diethyl- |
168277994 | Ethanamine, N,N-diethyl- |
172227746 | Ethanamine, N,N-diethyl- |
449752618 | Ethanamine, N,N-diethyl- |
750564568 | Ethanamine, N,N-diethyl- |
1200828449 | Ethanamine, N,N-diethyl- |
469216 | Ethanamine, N,N-dimethyl-2-[1-phenyl-1-(2-pyridinyl)ethoxy]- |
92126 | Ethanamine, N,N-dimethyl-2-[2-(phenylmethyl)phenoxy]- |
9008951 | Ethanamine, N,N-dimethyl-2-[2-(phenylmethyl)phenoxy]- |
109897 | Ethanamine, N-ethyl- |
3710847 | Ethanamine, N-ethyl-N-hydroxy- |
55185 | Ethanamine, N-ethyl-N-nitroso- |
71272 | Ethanaminium, 2,2'-[(1,4-dioxo-1,4-butanediyl)bis(oxy)]bis[N,N,N-trimethyl-, dichloride |
999815 | Ethanaminium, 2-chloro-N,N,N-trimethyl-, chloride (1:1) |
8073209 | Ethanaminium, 2-chloro-N,N,N-trimethyl-, chloride (1:1) |
39394213 | Ethanaminium, 2-chloro-N,N,N-trimethyl-, chloride (1:1) |
360577259 | Ethanaminium, 2-chloro-N,N,N-trimethyl-, chloride (1:1) |
67481 | Ethanaminium, 2-hydroxy-N,N,N-trimethyl-, chloride (1:1) |
129179 | Ethanaminium, N-[4-[[4-(diethylamino)phenyl](2,4-disulfophenyl)methylene]-2,5-cyclohexadien-1-ylidene]-N-ethyl-, inner salt, sodium salt (1:1) |
66554696 | Ethanaminium, N-[4-[[4-(diethylamino)phenyl](2,4-disulfophenyl)methylene]-2,5-cyclohexadien-1-ylidene]-N-ethyl-, inner salt, sodium salt (1:1) |
81604537 | Ethanaminium, N-[4-[[4-(diethylamino)phenyl](2,4-disulfophenyl)methylene]-2,5-cyclohexadien-1-ylidene]-N-ethyl-, inner salt, sodium salt (1:1) |
220750196 | Ethanaminium, N-[4-[[4-(diethylamino)phenyl](2,4-disulfophenyl)methylene]-2,5-cyclohexadien-1-ylidene]-N-ethyl-, inner salt, sodium salt (1:1) |
856315349 | Ethanaminium, N-[4-[[4-(diethylamino)phenyl](2,4-disulfophenyl)methylene]-2,5-cyclohexadien-1-ylidene]-N-ethyl-, inner salt, sodium salt (1:1) |
74840 | Ethane |
78840 | Ethane |
624895 | Ethane, (methylthio)- |
111911 | Ethane, 1,1'-[methylenebis(oxy)]bis[2-chloro- |
60297 | Ethane, 1,1'-oxybis- |
7578394 | Ethane, 1,1'-oxybis- |
74446438 | Ethane, 1,1'-oxybis- |
927820244 | Ethane, 1,1'-oxybis- |
111444 | Ethane, 1,1'-oxybis[2-chloro- |
52438912 | Ethane, 1,1'-oxybis[2-chloro- |
92091286 | Ethane, 1,1'-oxybis[2-chloro- |
111966 | Ethane, 1,1'-oxybis[2-methoxy- |
54631708 | Ethane, 1,1'-oxybis[2-methoxy- |
70992868 | Ethane, 1,1'-oxybis[2-methoxy- |
142939397 | Ethane, 1,1'-oxybis[2-methoxy- |
627543 | Ethane, 1,1'-tellurobis- |
352932 | Ethane, 1,1'-thiobis- |
505602 | Ethane, 1,1'-thiobis[2-chloro- |
39472407 | Ethane, 1,1'-thiobis[2-chloro- |
68157620 | Ethane, 1,1'-thiobis[2-chloro- |
69020377 | Ethane, 1,1'-thiobis[2-chloro- |
172672707 | Ethane, 1,1'-thiobis[2-chloro- |
67721 | Ethane, 1,1,1,2,2,2-hexachloro- |
76017 | Ethane, 1,1,1,2,2-pentachloro- |
354336 | Ethane, 1,1,1,2,2-pentafluoro- |
630206 | Ethane, 1,1,1,2-tetrachloro- |
76119 | Ethane, 1,1,1,2-tetrachloro-2,2-difluoro- |
354110 | Ethane, 1,1,1,2-tetrachloro-2-fluoro- |
811972 | Ethane, 1,1,1,2-tetrafluoro- |
71556 | Ethane, 1,1,1-trichloro- |
74552833 | Ethane, 1,1,1-trichloro- |
354585 | Ethane, 1,1,1-trichloro-2,2,2-trifluoro- |
420462 | Ethane, 1,1,1-trifluoro- |
1445450 | Ethane, 1,1,1-trimethoxy- |
79276 | Ethane, 1,1,2,2-tetrabromo- |
79345 | Ethane, 1,1,2,2-tetrachloro- |
79435 | Ethane, 1,1,2,2-tetrachloro- |
76120 | Ethane, 1,1,2,2-tetrachloro-1,2-difluoro- |
354143 | Ethane, 1,1,2,2-tetrachloro-1-fluoro- |
134237324 | Ethane, 1,1,2,2-tetrachloro-1-fluoro- |
76131 | Ethane, 1,1,2-trichloro- |
79005 | Ethane, 1,1,2-trichloro- |
43207 | Ethane, 1,1,2-trichloro-1,2,2-trifluoro- |
76131 | Ethane, 1,1,2-trichloro-1,2,2-trifluoro- |
761313 | Ethane, 1,1,2-trichloro-1,2,2-trifluoro- |
39349945 | Ethane, 1,1,2-trichloro-1,2,2-trifluoro- |
56996613 | Ethane, 1,1,2-trichloro-1,2,2-trifluoro- |
57762342 | Ethane, 1,1,2-trichloro-1,2,2-trifluoro- |
59948560 | Ethane, 1,1,2-trichloro-1,2,2-trifluoro- |
557915 | Ethane, 1,1-dibromo- |
75343 | Ethane, 1,1-dichloro- |
306832 | Ethane, 1,1-dichloro-1,2,2,2-tetrafluoro- |
374072 | Ethane, 1,1-dichloro-1,2,2,2-tetrafluoro- |
812044 | Ethane, 1,1-dichloro-1,2,2-trifluoro- |
171006 | Ethane, 1,1-dichloro-1-fluoro- |
1717006 | Ethane, 1,1-dichloro-1-fluoro- |
594729 | Ethane, 1,1-dichloro-1-nitro- |
619330 | Ethane, 1,1-dichloro-2,2-diethoxy- |
75376 | Ethane, 1,1-difluoro- |
71281715 | Ethane, 1,1-difluoro- |
354212 | Ethane, 1,2,2-trichloro-1,1-difluoro- |
62549182 | Ethane, 1,2,2-trichloro-1,1-difluoro- |
134237335 | Ethane, 1,2,2-trichloro-1,1-difluoro- |
712351741 | Ethane, 1,2,2-trichloro-1,1-difluoro- |
112265 | Ethane, 1,2-bis(2-chloroethoxy)- |
106934 | Ethane, 1,2-dibromo- |
8003074 | Ethane, 1,2-dibromo- |
56729216 | Ethane, 1,2-dibromo- |
625084379 | Ethane, 1,2-dibromo- |
124732 | Ethane, 1,2-dibromo-1,1,2,2-tetrafluoro- |
76199558 | Ethane, 1,2-dibromo-1,1,2,2-tetrafluoro- |
107062 | Ethane, 1,2-dichloro- |
52399936 | Ethane, 1,2-dichloro- |
76142 | Ethane, 1,2-dichloro-1,1,2,2-tetrafluoro- |
354234 | Ethane, 1,2-dichloro-1,1,2-trifluoro- |
1649087 | Ethane, 1,2-dichloro-1,1-difluoro- |
431061 | Ethane, 1,2-dichloro-1,2-difluoro- |
629141 | Ethane, 1,2-diethoxy- |
110714 | Ethane, 1,2-dimethoxy- |
7644393 | Ethane, 1,2-dimethoxy- |
173201804 | Ethane, 1,2-dimethoxy- |
107040 | Ethane, 1-bromo-2-chloro- |
76153 | Ethane, 1-chloro-1,1,2,2,2-pentafluoro- |
12770911 | Ethane, 1-chloro-1,1,2,2,2-pentafluoro- |
354256 | Ethane, 1-chloro-1,1,2,2-tetrafluoro- |
75683 | Ethane, 1-chloro-1,1-difluoro- |
65762256 | Ethane, 1-chloro-1,1-difluoro- |
306832 | Ethane, 2,2-dichloro-1,1,1-trifluoro- |
76380 | Ethane, 2,2-dichloro-1,1-difluoro-1-methoxy- |
8056959 | Ethane, 2,2-dichloro-1,1-difluoro-1-methoxy- |
683534 | Ethane, 2-bromo-1,1-dichloro- |
421012 | Ethane, 2-bromo-1-chloro-1,1-difluoro- |
151677 | Ethane, 2-bromo-2-chloro-1,1,1-trifluoro- |
2837890 | Ethane, 2-chloro-1,1,1,2-tetrafluoro- |
2873890 | Ethane, 2-chloro-1,1,1,2-tetrafluoro- |
75887 | Ethane, 2-chloro-1,1,1-trifluoro- |
13838169 | Ethane, 2-chloro-1-(difluoromethoxy)-1,1,2-trifluoro- |
132998915 | Ethane, 2-chloro-1-(difluoromethoxy)-1,1,2-trifluoro- |
74964 | Ethane, bromo- |
68411723 | Ethane, chloro derivs. |
68583573 | Ethane, chloro derivs. |
68909115 | Ethane, chloro derivs. |
75003 | Ethane, chloro- |
63938103 | Ethane, chlorotetrafluoro- |
1300216 | Ethane, dichloro- |
90454185 | Ethane, dichloro-1,1,2-trifluoro- |
25167888 | Ethane, dichlorofluoro- |
76142 | Ethane, dichlorotetrafluoro- |
1320372 | Ethane, dichlorotetrafluoro- |
34077877 | Ethane, dichlorotrifluoro- |
79243 | Ethane, nitro- |
79345 | Ethane, tetrachloro- |
1299907 | Ethane, tetrachloro- |
25322207 | Ethane, tetrachloro- |
71556 | Ethane, trichloro- |
1299894 | Ethane, trichloro- |
25323891 | Ethane, trichloro- |
1320394 | Ethane, trichlorotrifluoro- |
26523648 | Ethane, trichlorotrifluoro- |
29463705 | Ethane, trichlorotrifluoro- |
107222 | Ethanedial |
83513308 | Ethanedial |
460195 | Ethanedinitrile |
144627 | Ethanedioic acid |
63504289 | Ethanedioic acid |
97993787 | Ethanedioic acid |
216451386 | Ethanedioic acid |
79210 | Ethaneperoxoic acid |
89370718 | Ethaneperoxoic acid |
232259028 | Ethaneperoxoic acid |
107686 | Ethanesulfonic acid, 2-(methylamino)- |
142363539 | Ethanesulfonic acid, 2-[(2,6-diethylphenyl)(methoxymethyl)amino]-2-oxo- |
107357 | Ethanesulfonic acid, 2-amino- |
91105792 | Ethanesulfonic acid, 2-amino- |
1365481055 | Ethanesulfonic acid, 2-amino- |
62555 | Ethanethioamide |
1482800 | Ethanethioamide |
75081 | Ethanethiol |
23135220 | Ethanimidothioic acid, 2-(dimethylamino)-N-[[(methylamino)carbonyl]oxy]-2-oxo-, methyl ester |
30558431 | Ethanimidothioic acid, 2-(dimethylamino)-N-hydroxy-2-oxo-, methyl ester |
76274469 | Ethanimidothioic acid, 2-(dimethylamino)-N-hydroxy-2-oxo-, methyl ester |
59669260 | Ethanimidothioic acid, N,N'-[thiobis[(methylimino)carbonyloxy]]bis-, dimethyl ester |
65154623 | Ethanimidothioic acid, N,N'-[thiobis[(methylimino)carbonyloxy]]bis-, dimethyl ester |
16752775 | Ethanimidothioic acid, N-[[(methylamino)carbonyl]oxy]-, methyl ester |
22224937 | Ethanimidothioic acid, N-[[(methylamino)carbonyl]oxy]-, methyl ester |
136511074 | Ethanimidothioic acid, N-[[(methylamino)carbonyl]oxy]-, methyl ester |
136799445 | Ethanimidothioic acid, N-[[(methylamino)carbonyl]oxy]-, methyl ester |
64175 | Ethanol |
8000166 | Ethanol |
8024451 | Ethanol |
121182783 | Ethanol |
102716 | Ethanol, 2,2',2''-nitrilotris- |
36549538 | Ethanol, 2,2',2''-nitrilotris- |
36549549 | Ethanol, 2,2',2''-nitrilotris- |
36549550 | Ethanol, 2,2',2''-nitrilotris- |
36659797 | Ethanol, 2,2',2''-nitrilotris- |
105655274 | Ethanol, 2,2',2''-nitrilotris- |
126068675 | Ethanol, 2,2',2''-nitrilotris- |
464917268 | Ethanol, 2,2',2''-nitrilotris- |
105599 | Ethanol, 2,2'-(methylimino)bis- |
511262763 | Ethanol, 2,2'-(methylimino)bis- |
944314721 | Ethanol, 2,2'-(methylimino)bis- |
1116547 | Ethanol, 2,2'-(nitrosoimino)bis- |
112276 | Ethanol, 2,2'-[1,2-ethanediylbis(oxy)]bis- |
676186 | Ethanol, 2,2'-[1,2-ethanediylbis(oxy)]bis- |
118662309 | Ethanol, 2,2'-[1,2-ethanediylbis(oxy)]bis- |
121202297 | Ethanol, 2,2'-[1,2-ethanediylbis(oxy)]bis- |
939972017 | Ethanol, 2,2'-[1,2-ethanediylbis(oxy)]bis- |
111217 | Ethanol, 2,2'-[1,2-ethanediylbis(oxy)]bis-, 1,1'-diacetate |
2784943 | Ethanol, 2,2'-[[4-(methylamino)-3-nitrophenyl]imino]bis- |
33229344 | Ethanol, 2,2'-[[4-[(2-hydroxyethyl)amino]-3-nitrophenyl]imino]bis- |
111422 | Ethanol, 2,2'-iminobis- |
8033736 | Ethanol, 2,2'-iminobis- |
111466 | Ethanol, 2,2'-oxybis- |
4669265 | Ethanol, 2,2'-oxybis- |
5952261 | Ethanol, 2,2'-oxybis-, 1,1'-dicarbamate |
693210 | Ethanol, 2,2'-oxybis-, 1,1'-dinitrate |
66492771 | Ethanol, 2,2'-oxybis-, 1,1'-dinitrate |
109591 | Ethanol, 2-(1-methylethoxy)- |
136787 | Ethanol, 2-(2,4-dichlorophenoxy)-, hydrogen sulfate, sodium salt |
112345 | Ethanol, 2-(2-butoxyethoxy)- |
210818089 | Ethanol, 2-(2-butoxyethoxy)- |
875421797 | Ethanol, 2-(2-butoxyethoxy)- |
124174 | Ethanol, 2-(2-butoxyethoxy)-, 1-acetate |
124177 | Ethanol, 2-(2-butoxyethoxy)-, 1-acetate |
98100700 | Ethanol, 2-(2-butoxyethoxy)-, 1-acetate |
111900 | Ethanol, 2-(2-ethoxyethoxy)- |
111773 | Ethanol, 2-(2-methoxyethoxy)- |
102818 | Ethanol, 2-(dibutylamino)- |
100378 | Ethanol, 2-(diethylamino)- |
102802006 | Ethanol, 2-(diethylamino)- |
108010 | Ethanol, 2-(dimethylamino)- |
116134099 | Ethanol, 2-(dimethylamino)- |
156681253 | Ethanol, 2-(dimethylamino)- |
112254 | Ethanol, 2-(hexyloxy)- |
109831 | Ethanol, 2-(methylamino)- |
1428190924 | Ethanol, 2-(methylamino)- |
111411 | Ethanol, 2-[(2-aminoethyl)amino]- |
51251980 | Ethanol, 2-[(2-aminoethyl)amino]- |
2871014 | Ethanol, 2-[(4-amino-2-nitrophenyl)amino]- |
143226 | Ethanol, 2-[2-(2-butoxyethoxy)ethoxy]- |
68882 | Ethanol, 2-[2-[4-[(4-chlorophenyl)phenylmethyl]-1-piperazinyl]ethoxy]- |
147152214 | Ethanol, 2-[2-[4-[(4-chlorophenyl)phenylmethyl]-1-piperazinyl]ethoxy]- |
141435 | Ethanol, 2-amino- |
9007334 | Ethanol, 2-amino- |
540512 | Ethanol, 2-bromo- |
1867114 | Ethanol, 2-bromo- |
111762 | Ethanol, 2-butoxy- |
107461825 | Ethanol, 2-butoxy- |
161279909 | Ethanol, 2-butoxy- |
78513 | Ethanol, 2-butoxy-, 1,1',1''-phosphate |
19040507 | Ethanol, 2-butoxy-, 1,1',1''-phosphate |
31227664 | Ethanol, 2-butoxy-, 1,1',1''-phosphate |
119166982 | Ethanol, 2-butoxy-, 1,1',1''-phosphate |
112072 | Ethanol, 2-butoxy-, 1-acetate |
107073 | Ethanol, 2-chloro- |
1867090 | Ethanol, 2-chloro- |
1253945559 | Ethanol, 2-chloro- |
140089 | Ethanol, 2-chloro-, 1,1',1''-phosphite |
115968 | Ethanol, 2-chloro-, phosphate (3:1) |
21343840 | Ethanol, 2-chloro-, phosphate (3:1) |
110805 | Ethanol, 2-ethoxy- |
96231366 | Ethanol, 2-ethoxy- |
111159 | Ethanol, 2-ethoxy-, 1-acetate |
371620 | Ethanol, 2-fluoro- |
60242 | Ethanol, 2-mercapto- |
99748784 | Ethanol, 2-mercapto- |
109864 | Ethanol, 2-methoxy- |
110496 | Ethanol, 2-methoxy-, 1-acetate |
625489 | Ethanol, 2-nitro- |
122996 | Ethanol, 2-phenoxy- |
37220498 | Ethanol, 2-phenoxy- |
56257900 | Ethanol, 2-phenoxy- |
1020398735 | Ethanol, 2-phenoxy- |
2807309 | Ethanol, 2-propoxy- |
83855850 | Ethanol, 2-propoxy- |
555759 | Ethanol, aluminum salt (3:1) |
2835429 | Ethanol, aluminum salt (3:1) |
82948467 | Ethanol, aluminum salt (3:1) |
112388360 | Ethanol, aluminum salt (3:1) |
139984228 | Ethanol, aluminum salt (3:1) |
858823968 | Ethanol, aluminum salt (3:1) |
1091602924 | Ethanol, aluminum salt (3:1) |
7725931 | Ethanone, 1-(2,3-dihydro-4-methyl-2-thioxo-5-thiazolyl)- |
88283414 | Ethanone, 1-(2,4-dichlorophenyl)-2-(3-pyridinyl)-, O-methyloxime |
577593 | Ethanone, 1-(2-nitrophenyl)- |
121891 | Ethanone, 1-(3-nitrophenyl)- |
100196 | Ethanone, 1-(4-nitrophenyl)- |
1122549 | Ethanone, 1-(4-pyridinyl)- |
81141 | Ethanone, 1-[4-(1,1-dimethylethyl)-2,6-dimethyl-3,5-dinitrophenyl]- |
765435 | Ethanone, 1-cyclopropyl- |
98862 | Ethanone, 1-phenyl- |
41903508 | Ethanone, 1-phenyl-, monohydroxy deriv. |
532274 | Ethanone, 2-chloro-1-phenyl- |
119539 | Ethanone, 2-hydroxy-1,2-diphenyl- |
579442 | Ethanone, 2-hydroxy-1,2-diphenyl- |
4549400 | Ethenamine, N-methyl-N-nitroso- |
72559 | Ethene |
74851 | Ethene |
33060309 | Ethene |
87701642 | Ethene |
87701653 | Ethene |
110758 | Ethene, (2-chloroethoxy)- |
127184 | Ethene, 1,1,2,2-tetrachloro- |
116143 | Ethene, 1,1,2,2-tetrafluoro- |
9014839 | Ethene, 1,1,2,2-tetrafluoro- |
79016 | Ethene, 1,1,2-trichloro- |
52037464 | Ethene, 1,1,2-trichloro- |
593920 | Ethene, 1,1-dibromo- |
75054 | Ethene, 1,1-dichloro- |
75354 | Ethene, 1,1-dichloro- |
75387 | Ethene, 1,1-difluoro- |
1272398818 | Ethene, 1,1-difluoro- |
540498 | Ethene, 1,2-dibromo- |
540590 | Ethene, 1,2-dichloro- |
156605 | Ethene, 1,2-dichloro-, (1E)- |
156606 | Ethene, 1,2-dichloro-, (1E)- |
43695790 | Ethene, 1,2-dichloro-, (1E)- |
156592 | Ethene, 1,2-dichloro-, (1Z)- |
1438395686 | Ethene, 1,2-dichloro-, (1Z)- |
598732 | Ethene, 1-bromo-1,2,2-trifluoro- |
79389 | Ethene, 1-chloro-1,2,2-trifluoro- |
593602 | Ethene, bromo- |
75014 | Ethene, chloro- |
107062 | Ethene, chloro- |
1187028370 | Ethene, chloro- |
8063943 | Ethene, chloro-, homopolymer |
9002862 | Ethene, chloro-, homopolymer |
9006091 | Ethene, chloro-, homopolymer |
9036811 | Ethene, chloro-, homopolymer |
9041558 | Ethene, chloro-, homopolymer |
9043474 | Ethene, chloro-, homopolymer |
9043485 | Ethene, chloro-, homopolymer |
9072177 | Ethene, chloro-, homopolymer |
9072393 | Ethene, chloro-, homopolymer |
11097919 | Ethene, chloro-, homopolymer |
11111947 | Ethene, chloro-, homopolymer |
11119270 | Ethene, chloro-, homopolymer |
25038464 | Ethene, chloro-, homopolymer |
37349647 | Ethene, chloro-, homopolymer |
37357612 | Ethene, chloro-, homopolymer |
39287893 | Ethene, chloro-, homopolymer |
39296178 | Ethene, chloro-, homopolymer |
39387434 | Ethene, chloro-, homopolymer |
39389565 | Ethene, chloro-, homopolymer |
39393594 | Ethene, chloro-, homopolymer |
50642892 | Ethene, chloro-, homopolymer |
50935778 | Ethene, chloro-, homopolymer |
51281460 | Ethene, chloro-, homopolymer |
51540751 | Ethene, chloro-, homopolymer |
51569450 | Ethene, chloro-, homopolymer |
53029144 | Ethene, chloro-, homopolymer |
53112417 | Ethene, chloro-, homopolymer |
54328277 | Ethene, chloro-, homopolymer |
54328288 | Ethene, chloro-, homopolymer |
55465753 | Ethene, chloro-, homopolymer |
59678578 | Ethene, chloro-, homopolymer |
59740408 | Ethene, chloro-, homopolymer |
59740420 | Ethene, chloro-, homopolymer |
60281994 | Ethene, chloro-, homopolymer |
62132303 | Ethene, chloro-, homopolymer |
62931082 | Ethene, chloro-, homopolymer |
63440299 | Ethene, chloro-, homopolymer |
66988601 | Ethene, chloro-, homopolymer |
68441747 | Ethene, chloro-, homopolymer |
68858775 | Ethene, chloro-, homopolymer |
72751145 | Ethene, chloro-, homopolymer |
74192237 | Ethene, chloro-, homopolymer |
74504793 | Ethene, chloro-, homopolymer |
76012298 | Ethene, chloro-, homopolymer |
79103676 | Ethene, chloro-, homopolymer |
80044128 | Ethene, chloro-, homopolymer |
90452372 | Ethene, chloro-, homopolymer |
93050829 | Ethene, chloro-, homopolymer |
94928208 | Ethene, chloro-, homopolymer |
96353763 | Ethene, chloro-, homopolymer |
96726771 | Ethene, chloro-, homopolymer |
97123541 | Ethene, chloro-, homopolymer |
97343787 | Ethene, chloro-, homopolymer |
98865431 | Ethene, chloro-, homopolymer |
117079842 | Ethene, chloro-, homopolymer |
121870608 | Ethene, chloro-, homopolymer |
124149628 | Ethene, chloro-, homopolymer |
139074741 | Ethene, chloro-, homopolymer |
142804840 | Ethene, chloro-, homopolymer |
148880095 | Ethene, chloro-, homopolymer |
155422176 | Ethene, chloro-, homopolymer |
161051907 | Ethene, chloro-, homopolymer |
161279965 | Ethene, chloro-, homopolymer |
172929214 | Ethene, chloro-, homopolymer |
172929225 | Ethene, chloro-, homopolymer |
187247434 | Ethene, chloro-, homopolymer |
202218766 | Ethene, chloro-, homopolymer |
203460553 | Ethene, chloro-, homopolymer |
206072562 | Ethene, chloro-, homopolymer |
220323682 | Ethene, chloro-, homopolymer |
221007074 | Ethene, chloro-, homopolymer |
221007085 | Ethene, chloro-, homopolymer |
226986750 | Ethene, chloro-, homopolymer |
237753456 | Ethene, chloro-, homopolymer |
819078472 | Ethene, chloro-, homopolymer |
944150612 | Ethene, chloro-, homopolymer |
1151920498 | Ethene, chloro-, homopolymer |
1202645337 | Ethene, chloro-, homopolymer |
107062 | Ethene, dichloro- |
25323302 | Ethene, dichloro- |
109922 | Ethene, ethoxy- |
75025 | Ethene, fluoro- |
9002884 | Ethene, homopolymer |
9041321 | Ethene, homopolymer |
9082159 | Ethene, homopolymer |
11098285 | Ethene, homopolymer |
11119247 | Ethene, homopolymer |
11119258 | Ethene, homopolymer |
12728299 | Ethene, homopolymer |
37310977 | Ethene, homopolymer |
37331401 | Ethene, homopolymer |
37349692 | Ethene, homopolymer |
37353949 | Ethene, homopolymer |
39307012 | Ethene, homopolymer |
39421915 | Ethene, homopolymer |
51274114 | Ethene, homopolymer |
51329761 | Ethene, homopolymer |
51329830 | Ethene, homopolymer |
52434227 | Ethene, homopolymer |
53238849 | Ethene, homopolymer |
53568471 | Ethene, homopolymer |
53850978 | Ethene, homopolymer |
56833206 | Ethene, homopolymer |
57158095 | Ethene, homopolymer |
58391665 | Ethene, homopolymer |
61614286 | Ethene, homopolymer |
62449676 | Ethene, homopolymer |
63100663 | Ethene, homopolymer |
64296522 | Ethene, homopolymer |
66797044 | Ethene, homopolymer |
66829229 | Ethene, homopolymer |
67383000 | Ethene, homopolymer |
67462866 | Ethene, homopolymer |
70431242 | Ethene, homopolymer |
71212210 | Ethene, homopolymer |
73247151 | Ethene, homopolymer |
73730004 | Ethene, homopolymer |
73989658 | Ethene, homopolymer |
74238849 | Ethene, homopolymer |
74238850 | Ethene, homopolymer |
74238872 | Ethene, homopolymer |
74812172 | Ethene, homopolymer |
79806012 | Ethene, homopolymer |
79818932 | Ethene, homopolymer |
81544072 | Ethene, homopolymer |
81604673 | Ethene, homopolymer |
86089976 | Ethene, homopolymer |
86168389 | Ethene, homopolymer |
87521128 | Ethene, homopolymer |
91449159 | Ethene, homopolymer |
91728255 | Ethene, homopolymer |
95327267 | Ethene, homopolymer |
95918197 | Ethene, homopolymer |
95918266 | Ethene, homopolymer |
101484633 | Ethene, homopolymer |
101484757 | Ethene, homopolymer |
101484826 | Ethene, homopolymer |
103843114 | Ethene, homopolymer |
106705264 | Ethene, homopolymer |
110736464 | Ethene, homopolymer |
112041357 | Ethene, homopolymer |
112821111 | Ethene, homopolymer |
112821133 | Ethene, homopolymer |
113690269 | Ethene, homopolymer |
114013557 | Ethene, homopolymer |
114451171 | Ethene, homopolymer |
114471099 | Ethene, homopolymer |
121761953 | Ethene, homopolymer |
126040162 | Ethene, homopolymer |
126040173 | Ethene, homopolymer |
126879401 | Ethene, homopolymer |
131461842 | Ethene, homopolymer |
131461853 | Ethene, homopolymer |
136958800 | Ethene, homopolymer |
142985613 | Ethene, homopolymer |
150632749 | Ethene, homopolymer |
151595174 | Ethene, homopolymer |
153302160 | Ethene, homopolymer |
156799290 | Ethene, homopolymer |
159251500 | Ethene, homopolymer |
160612771 | Ethene, homopolymer |
161051678 | Ethene, homopolymer |
163751846 | Ethene, homopolymer |
172451637 | Ethene, homopolymer |
174594048 | Ethene, homopolymer |
176365961 | Ethene, homopolymer |
177529725 | Ethene, homopolymer |
177771903 | Ethene, homopolymer |
177893377 | Ethene, homopolymer |
183076462 | Ethene, homopolymer |
184182056 | Ethene, homopolymer |
187175957 | Ethene, homopolymer |
187619938 | Ethene, homopolymer |
189120954 | Ethene, homopolymer |
191490321 | Ethene, homopolymer |
199128499 | Ethene, homopolymer |
201948427 | Ethene, homopolymer |
202876242 | Ethene, homopolymer |
208196832 | Ethene, homopolymer |
211174402 | Ethene, homopolymer |
211866910 | Ethene, homopolymer |
211866976 | Ethene, homopolymer |
212134140 | Ethene, homopolymer |
213018576 | Ethene, homopolymer |
214692407 | Ethene, homopolymer |
220674431 | Ethene, homopolymer |
252039682 | Ethene, homopolymer |
253608558 | Ethene, homopolymer |
263163593 | Ethene, homopolymer |
265646933 | Ethene, homopolymer |
273402645 | Ethene, homopolymer |
286388872 | Ethene, homopolymer |
303981046 | Ethene, homopolymer |
339991934 | Ethene, homopolymer |
345581206 | Ethene, homopolymer |
362051283 | Ethene, homopolymer |
391249802 | Ethene, homopolymer |
438467211 | Ethene, homopolymer |
500354847 | Ethene, homopolymer |
558440236 | Ethene, homopolymer |
583878744 | Ethene, homopolymer |
592532815 | Ethene, homopolymer |
602330972 | Ethene, homopolymer |
602330994 | Ethene, homopolymer |
658081904 | Ethene, homopolymer |
662139051 | Ethene, homopolymer |
851974599 | Ethene, homopolymer |
851974602 | Ethene, homopolymer |
852465215 | Ethene, homopolymer |
853066792 | Ethene, homopolymer |
862280248 | Ethene, homopolymer |
863603978 | Ethene, homopolymer |
866927471 | Ethene, homopolymer |
881176347 | Ethene, homopolymer |
895130833 | Ethene, homopolymer |
910450270 | Ethene, homopolymer |
917487037 | Ethene, homopolymer |
922501368 | Ethene, homopolymer |
940910770 | Ethene, homopolymer |
945217094 | Ethene, homopolymer |
1010857018 | Ethene, homopolymer |
1021428034 | Ethene, homopolymer |
1137119095 | Ethene, homopolymer |
1187527292 | Ethene, homopolymer |
1208346831 | Ethene, homopolymer |
1227178235 | Ethene, homopolymer |
1228118986 | Ethene, homopolymer |
1256781573 | Ethene, homopolymer |
1281939841 | Ethene, homopolymer |
1365657573 | Ethene, homopolymer |
1365657584 | Ethene, homopolymer |
1383916560 | Ethene, homopolymer |
1393813701 | Ethene, homopolymer |
1429741581 | Ethene, homopolymer |
107255 | Ethene, methoxy- |
9002895 | Ethenol, homopolymer |
9014146 | Ethenol, homopolymer |
9050537 | Ethenol, homopolymer |
9066051 | Ethenol, homopolymer |
25038511 | Ethenol, homopolymer |
39320291 | Ethenol, homopolymer |
53241160 | Ethenol, homopolymer |
58740504 | Ethenol, homopolymer |
61584381 | Ethenol, homopolymer |
73298530 | Ethenol, homopolymer |
75923487 | Ethenol, homopolymer |
82428088 | Ethenol, homopolymer |
98002483 | Ethenol, homopolymer |
106442335 | Ethenol, homopolymer |
110736475 | Ethenol, homopolymer |
118168835 | Ethenol, homopolymer |
147827369 | Ethenol, homopolymer |
151439020 | Ethenol, homopolymer |
152987514 | Ethenol, homopolymer |
153569701 | Ethenol, homopolymer |
155421526 | Ethenol, homopolymer |
162261316 | Ethenol, homopolymer |
172452038 | Ethenol, homopolymer |
176742146 | Ethenol, homopolymer |
353276423 | Ethenol, homopolymer |
372077139 | Ethenol, homopolymer |
416899995 | Ethenol, homopolymer |
551960180 | Ethenol, homopolymer |
860310936 | Ethenol, homopolymer |
875587238 | Ethenol, homopolymer |
1159795773 | Ethenol, homopolymer |
1221137854 | Ethenol, homopolymer |
1251055034 | Ethenol, homopolymer |
1360538164 | Ethenol, homopolymer |
1360617282 | Ethenol, homopolymer |
1379820548 | Ethenol, homopolymer |
1391975953 | Ethenol, homopolymer |
1417904881 | Ethenol, homopolymer |
1422717369 | Ethenol, homopolymer |
463514 | Ethenone |
32834278 | Ethenone |
32834358 | Ethenone |
74862 | Ethyne |
57113743 | Ethyne |
7572294 | Ethyne, dichloro- |
14683239 | Europium, isotope of mass 152 |
15585101 | Europium, isotope of mass 154 |
14391163 | Europium, isotope of mass 155 |
14280354 | Europium, isotope of mass 156 |
64742047 | Extracts (petroleum), heavy paraffinic distillate solvent |
8039438 | Fatty acids |
12624101 | Fatty acids |
60572001 | Fatty acids |
67254799 | Fatty acids |
13408623 | Ferrate(3-), hexakis(cyano-.kappa.C)-, (OC-6-11)- |
13408634 | Ferrate(4-), hexakis(cyano-.kappa.C)-, (OC-6-11)- |
55318235 | Ferrate(4-), hexakis(cyano-.kappa.C)-, (OC-6-11)- |
55448403 | Ferrate(4-), hexakis(cyano-.kappa.C)-, (OC-6-11)- |
60927302 | Ferrate(4-), hexakis(cyano-.kappa.C)-, (OC-6-11)- |
25869005 | Ferrate(4-), hexakis(cyano-.kappa.C)-, ammonium iron(3+) (1:1:1), (OC-6-11)- |
31095144 | Ferrate(4-), hexakis(cyano-.kappa.C)-, ammonium iron(3+) (1:1:1), (OC-6-11)- |
102545 | Ferrocene |
51364126 | Ferrocene |
55404687 | Ferrocene |
774583141 | Ferrocene |
856324920 | Ferrocene |
856780217 | Ferrocene |
1080518860 | Ferrocene |
12252334 | Fiberglass |
36355018 | FireMaster BP 6 |
59536651 | FireMaster BP 6 |
59536651 | FireMaster FF 1 |
67774327 | FireMaster FF 1 |
206440 | Fluoranthene |
7782414 | Fluoride |
16984488 | Fluoride |
405267450 | Fluoride |
7782414 | Fluorine |
28077976 | Fluorine |
719993314 | Fluorine |
50000 | Formaldehyde |
8005387 | Formaldehyde |
8006073 | Formaldehyde |
8013136 | Formaldehyde |
112068710 | Formaldehyde |
1053659792 | Formaldehyde |
1156543564 | Formaldehyde |
1158237025 | Formaldehyde |
1227476289 | Formaldehyde |
1416946650 | Formaldehyde |
75127 | Formamide |
23296415 | Formamide |
1156543553 | Formamide |
1158234151 | Formamide |
26644462 | Formamide, N,N'-[1,4-piperazinediylbis(2,2,2-trichloroethylidene)]bis- |
68122 | Formamide, N,N-dimethyl- |
15175630 | Formamide, N,N-dimethyl- |
15175776 | Formamide, N,N-dimethyl- |
33513427 | Formamide, N,N-dimethyl- |
114057157 | Formamide, N,N-dimethyl- |
24554265 | Formamide, N-[4-(5-nitro-2-furanyl)-2-thiazolyl]- |
103708 | Formamide, N-phenyl- |
64186 | Formic acid |
8006937 | Formic acid |
67382927 | Formic acid |
82069145 | Formic acid |
1016316601 | Formic acid |
625558 | Formic acid, 1-methylethyl ester |
109944 | Formic acid, ethyl ester |
556638 | Formic acid, lithium salt (1:1) |
107313 | Formic acid, methyl ester |
1053659554 | Formic acid, methyl ester |
1173023738 | Formic acid, methyl ester |
141537 | Formic acid, sodium salt (1:1) |
84050157 | Formic acid, sodium salt (1:1) |
84050168 | Formic acid, sodium salt (1:1) |
84050179 | Formic acid, sodium salt (1:1) |
1015855658 | Formic acid, sodium salt (1:1) |
68476302 | Fuel oil, no. 2 |
68476802 | Fuel oil, no. 2 |
68476313 | Fuel oil, no. 4 |
8008206 | Fuel oil, no. 5 |
70892114 | Fuel oil, no. 5 |
68334305 | Fuels, diesel |
68512903 | Fuels, diesel |
110009 | Furan |
625865 | Furan, 2,5-dimethyl- |
109999 | Furan, tetrahydro- |
77392702 | Furan, tetrahydro- |
55957103 | Fyrquel 220 |
14276654 | Gadolinium, isotope of mass 153 |
10318260 | Galactitol, 1,6-dibromo-1,6-dideoxy- |
7440553 | Gallium |
1303000 | Gallium arsenide (GaAs) |
12254954 | Gallium arsenide (GaAs) |
106495925 | Gallium arsenide (GaAs) |
116443039 | Gallium arsenide (GaAs) |
385800124 | Gallium arsenide (GaAs) |
817163738 | Gallium arsenide (GaAs) |
888030715 | Gallium arsenide (GaAs) |
959925101 | Gallium arsenide (GaAs) |
1018852646 | Gallium arsenide (GaAs) |
1099648868 | Gallium arsenide (GaAs) |
1434046679 | Gallium arsenide (GaAs) |
12024214 | Gallium oxide (Ga2O3) |
1246736651 | Gallium oxide (Ga2O3) |
8006619 | Gasoline |
86290815 | Gasoline |
8006619 | Gasoline, aviation |
308082099 | Gasoline, aviation |
8006619 | Gasoline, natural |
7782652 | Germane |
7440564 | Germanium |
129827754 | Germanium |
14374813 | Germanium, isotope of mass 71 |
77065 | Gibb-3-ene-1,10-dicarboxylic acid, 2,4a,7-trihydroxy-1-methyl-8-methylene-, 1,4a-lactone, (1.alpha.,2.beta.,4a.alpha.,4b.beta.,10.beta.)- |
1405965 | Gibb-3-ene-1,10-dicarboxylic acid, 2,4a,7-trihydroxy-1-methyl-8-methylene-, 1,4a-lactone, (1.alpha.,2.beta.,4a.alpha.,4b.beta.,10.beta.)- |
7121553 | Gibb-3-ene-1,10-dicarboxylic acid, 2,4a,7-trihydroxy-1-methyl-8-methylene-, 1,4a-lactone, (1.alpha.,2.beta.,4a.alpha.,4b.beta.,10.beta.)- |
16202203 | Gibb-3-ene-1,10-dicarboxylic acid, 2,4a,7-trihydroxy-1-methyl-8-methylene-, 1,4a-lactone, (1.alpha.,2.beta.,4a.alpha.,4b.beta.,10.beta.)- |
58915449 | Gibb-3-ene-1,10-dicarboxylic acid, 2,4a,7-trihydroxy-1-methyl-8-methylene-, 1,4a-lactone, (1.alpha.,2.beta.,4a.alpha.,4b.beta.,10.beta.)- |
192662672 | Gibb-3-ene-1,10-dicarboxylic acid, 2,4a,7-trihydroxy-1-methyl-8-methylene-, 1,4a-lactone, (1.alpha.,2.beta.,4a.alpha.,4b.beta.,10.beta.)- |
295313574 | Gibb-3-ene-1,10-dicarboxylic acid, 2,4a,7-trihydroxy-1-methyl-8-methylene-, 1,4a-lactone, (1.alpha.,2.beta.,4a.alpha.,4b.beta.,10.beta.)- |
474760457 | Gibb-3-ene-1,10-dicarboxylic acid, 2,4a,7-trihydroxy-1-methyl-8-methylene-, 1,4a-lactone, (1.alpha.,2.beta.,4a.alpha.,4b.beta.,10.beta.)- |
859282716 | Gibb-3-ene-1,10-dicarboxylic acid, 2,4a,7-trihydroxy-1-methyl-8-methylene-, 1,4a-lactone, (1.alpha.,2.beta.,4a.alpha.,4b.beta.,10.beta.)- |
1423015911 | Gibb-3-ene-1,10-dicarboxylic acid, 2,4a,7-trihydroxy-1-methyl-8-methylene-, 1,4a-lactone, (1.alpha.,2.beta.,4a.alpha.,4b.beta.,10.beta.)- |
12002436 | Gilsonite |
56406 | Glycine |
52955632 | Glycine |
57678190 | Glycine |
87867945 | Glycine |
848646457 | Glycine |
1119449363 | Glycine |
1173020115 | Glycine |
1196157784 | Glycine |
60004 | Glycine, N,N'-1,2-ethanediylbis[N-(carboxymethyl)- |
64028 | Glycine, N,N'-1,2-ethanediylbis[N-(carboxymethyl)- |
13440783 | Glycine, N,N'-1,2-ethanediylbis[N-(carboxymethyl)- |
20539279 | Glycine, N,N'-1,2-ethanediylbis[N-(carboxymethyl)- |
26627463 | Glycine, N,N'-1,2-ethanediylbis[N-(carboxymethyl)- |
30485871 | Glycine, N,N'-1,2-ethanediylbis[N-(carboxymethyl)- |
30485882 | Glycine, N,N'-1,2-ethanediylbis[N-(carboxymethyl)- |
30485906 | Glycine, N,N'-1,2-ethanediylbis[N-(carboxymethyl)- |
32757101 | Glycine, N,N'-1,2-ethanediylbis[N-(carboxymethyl)- |
94108755 | Glycine, N,N'-1,2-ethanediylbis[N-(carboxymethyl)- |
161122334 | Glycine, N,N'-1,2-ethanediylbis[N-(carboxymethyl)- |
402925671 | Glycine, N,N'-1,2-ethanediylbis[N-(carboxymethyl)- |
675141169 | Glycine, N,N'-1,2-ethanediylbis[N-(carboxymethyl)- |
7379262 | Glycine, N,N'-1,2-ethanediylbis[N-(carboxymethyl)-, ammonium salt (1:?) |
150389 | Glycine, N,N'-1,2-ethanediylbis[N-(carboxymethyl)-, sodium salt (1:3) |
8014662 | Glycine, N,N'-1,2-ethanediylbis[N-(carboxymethyl)-, sodium salt (1:3) |
97928922 | Glycine, N,N'-1,2-ethanediylbis[N-(carboxymethyl)-, sodium salt (1:3) |
64028 | Glycine, N,N'-1,2-ethanediylbis[N-(carboxymethyl)-, sodium salt (1:4) |
8013512 | Glycine, N,N'-1,2-ethanediylbis[N-(carboxymethyl)-, sodium salt (1:4) |
8023210 | Glycine, N,N'-1,2-ethanediylbis[N-(carboxymethyl)-, sodium salt (1:4) |
50809353 | Glycine, N,N'-1,2-ethanediylbis[N-(carboxymethyl)-, sodium salt (1:4) |
70699535 | Glycine, N,N'-1,2-ethanediylbis[N-(carboxymethyl)-, sodium salt (1:4) |
97928933 | Glycine, N,N'-1,2-ethanediylbis[N-(carboxymethyl)-, sodium salt (1:4) |
139139 | Glycine, N,N-bis(carboxymethyl)- |
26627441 | Glycine, N,N-bis(carboxymethyl)- |
26627452 | Glycine, N,N-bis(carboxymethyl)- |
80751515 | Glycine, N,N-bis(carboxymethyl)- |
18105038 | Glycine, N,N-bis(carboxymethyl)-, mercury(2+) salt (2:3) |
5064313 | Glycine, N,N-bis(carboxymethyl)-, sodium salt (1:3) |
37291819 | Glycine, N,N-bis(carboxymethyl)-, sodium salt (1:3) |
18662538 | Glycine, N,N-bis(carboxymethyl)-, trisodium salt, monohydrate |
38727558 | Glycine, N-(chloroacetyl)-N-(2,6-diethylphenyl)-, ethyl ester |
51142202 | Glycine, N-(chloroacetyl)-N-(2,6-diethylphenyl)-, ethyl ester |
52002014 | Glycine, N-(chloroacetyl)-N-(2,6-diethylphenyl)-, ethyl ester |
62180863 | Glycine, N-(chloroacetyl)-N-(2,6-diethylphenyl)-, ethyl ester |
1071536 | Glycine, N-(phosphonomethyl)- |
1071836 | Glycine, N-(phosphonomethyl)- |
37337603 | Glycine, N-(phosphonomethyl)- |
42618097 | Glycine, N-(phosphonomethyl)- |
75241086 | Glycine, N-(phosphonomethyl)- |
107971 | Glycine, N-methyl- |
783292499 | Glycine, N-methyl- |
13256229 | Glycine, N-methyl-N-nitroso- |
7440575 | Gold |
33019351 | Gold |
1093282279 | Gold |
14914160 | Gold, isotope of mass 196 |
1337800 | Gold, isotope of mass 198 |
8031503 | Gold, isotope of mass 198 |
10043499 | Gold, isotope of mass 198 |
102067 | Guanidine, N,N'-diphenyl- |
20277923 | Guanidine, N,N'-diphenyl- |
25323697 | Guanidine, N,N'-diphenyl- |
33505703 | Guanidine, N,N'-diphenyl- |
39291219 | Guanidine, N,N'-diphenyl- |
55556100 | Guanidine, N,N'-diphenyl- |
368867996 | Guanidine, N,N'-diphenyl- |
67953542 | Guanidine, N-cyano-, polymer with N1-(2-aminoethyl)-1,2-ethanediamine and 2-(chloromethyl)oxirane |
2439103 | Guanidine, N-dodecyl-, acetate (1:1) |
15880996 | Guanidine, N-dodecyl-, acetate (1:1) |
51426085 | Guanidine, N-dodecyl-, acetate (1:1) |
96923045 | Guanidine, N-dodecyl-, acetate (1:1) |
1135443229 | Guanidine, N-dodecyl-, acetate (1:1) |
70257 | Guanidine, N-methyl-N'-nitro-N-nitroso- |
100234535 | Guanidine, N-methyl-N'-nitro-N-nitroso- |
556887 | Guanidine, N-nitro- |
506934 | Guanidine, nitrate (1:1) |
6609934 | Guanidine, nitrate (1:1) |
24011903 | Guanidine, nitrate (1:1) |
64039276 | Guanosine, 2'-deoxy-6-thio-, monohydrate |
9000300 | Guar gum |
9008177 | Guar gum |
9010508 | Guar gum |
9049336 | Guar gum |
9066073 | Guar gum |
53986279 | Guar gum |
57406685 | Guar gum |
57406710 | Guar gum |
63799542 | Guar gum |
85510163 | Guar gum |
1312293381 | Guar gum |
8047378 | Gum arabic |
8047389 | Gum arabic |
9000015 | Gum arabic |
37316555 | Gum arabic |
37316566 | Gum arabic |
39378444 | Gum arabic |
39378455 | Gum arabic |
10101414 | Gypsum (Ca(SO4).2H2O) |
13397245 | Gypsum (Ca(SO4).2H2O) |
70513701 | Gypsum (Ca(SO4).2H2O) |
77030592 | Gypsum (Ca(SO4).2H2O) |
7440586 | Hafnium |
412316008 | Hafnium |
14900211 | Hafnium, isotope of mass 181 |
58718664 | Halowax 1000 |
58718675 | Halowax 1001 |
39450050 | Halowax 1099 |
7440597 | Helium |
494798311 | Helium |
1312815283 | Helium |
1317608 | Hematite (Fe2O3) |
629947 | Heneicosane |
76448 | Heptachlor and its epoxide -- RCRA T |
629787 | Heptadecane |
111717 | Heptanal |
142825 | Heptane |
142845 | Heptane |
8031332 | Heptane |
44607138 | Heptane |
592278 | Heptane, 2-methyl- |
589811 | Heptane, 3-methyl- |
116502433 | Heptane, 3-methyl- |
25339564 | Heptene |
630013 | Hexacosane |
544763 | Hexadecane |
555351 | Hexadecanoic acid, aluminum salt (3:1) |
69646000 | Hexadecanoic acid, aluminum salt (3:1) |
66251 | Hexanal |
123057 | Hexanal, 2-ethyl- |
58712008 | Hexanal, 2-ethyl- |
628024 | Hexanamide |
100543 | Hexane |
110543 | Hexane |
8031343 | Hexane |
822060 | Hexane, 1,6-diisocyanato- |
53192271 | Hexane, 1,6-diisocyanato- |
57350773 | Hexane, 1,6-diisocyanato- |
63525906 | Hexane, 1,6-diisocyanato- |
66368965 | Hexane, 1,6-diisocyanato- |
88357624 | Hexane, 1,6-diisocyanato- |
133394599 | Hexane, 1,6-diisocyanato- |
243121019 | Hexane, 1,6-diisocyanato- |
280144196 | Hexane, 1,6-diisocyanato- |
824958443 | Hexane, 1,6-diisocyanato- |
1196968383 | Hexane, 1,6-diisocyanato- |
1199811169 | Hexane, 1,6-diisocyanato- |
1447694907 | Hexane, 1,6-diisocyanato- |
544105 | Hexane, 1-chloro- |
646140 | Hexane, 1-nitro- |
591764 | Hexane, 2-methyl- |
589344 | Hexane, 3-methyl- |
116502455 | Hexane, 3-methyl- |
25495903 | Hexane, chloro- |
628944 | Hexanediamide |
111693 | Hexanedinitrile |
55462970 | Hexanedinitrile |
103231 | Hexanedioic acid, 1,6-bis(2-ethylhexyl) ester |
39393674 | Hexanedioic acid, 1,6-bis(2-ethylhexyl) ester |
63637489 | Hexanedioic acid, 1,6-bis(2-ethylhexyl) ester |
70147216 | Hexanedioic acid, 1,6-bis(2-ethylhexyl) ester |
141048 | Hexanedioic acid, 1,6-bis(2-methylpropyl) ester |
53659851 | Hexanedioic acid, 1,6-bis(2-methylpropyl) ester |
141173 | Hexanedioic acid, 1,6-bis[2-(2-butoxyethoxy)ethyl] ester |
62863074 | Hexanedioic acid, 1,6-bis[2-(2-butoxyethoxy)ethyl] ester |
79806001 | Hexanedioic acid, 1,6-bis[2-(2-butoxyethoxy)ethyl] ester |
130455639 | Hexanedioic acid, 1,6-bis[2-(2-butoxyethoxy)ethyl] ester |
194548851 | Hexanedioic acid, 1,6-bis[2-(2-butoxyethoxy)ethyl] ester |
105997 | Hexanedioic acid, 1,6-dibutyl ester |
849990 | Hexanedioic acid, 1,6-dicyclohexyl ester |
105975 | Hexanedioic acid, 1,6-didecyl ester |
141286 | Hexanedioic acid, 1,6-diethyl ester |
27178161 | Hexanedioic acid, 1,6-diisodecyl ester |
29761328 | Hexanedioic acid, 1,6-diisodecyl ester |
105557173 | Hexanedioic acid, 1,6-diisodecyl ester |
1330865 | Hexanedioic acid, 1,6-diisooctyl ester |
108778229 | Hexanedioic acid, 1,6-diisooctyl ester |
627930 | Hexanedioic acid, 1,6-dimethyl ester |
111366611 | Hexanedioic acid, 1,6-dimethyl ester |
151326 | Hexanedioic acid, 1,6-dinonyl ester |
123795 | Hexanedioic acid, 1,6-dioctyl ester |
106194 | Hexanedioic acid, 1,6-dipropyl ester |
22707353 | Hexanedioic acid, 1-decyl 6-hexyl ester |
110292 | Hexanedioic acid, 1-decyl 6-octyl ester |
110327 | Hexanedioic acid, bis(2-(hexyloxy)ethyl) ester |
10022603 | Hexanedioic acid, bis(2-ethylbutyl) ester |
7790070 | Hexanedioic acid, bis[2-(2-ethylbutoxy)ethyl] ester |
4337659 | Hexanedioic acid, mono(2-ethylhexyl) ester |
25101035 | Hexanedioic acid, polymer with 1,2-propanediol |
63149702 | Hexanedioic acid, polymer with 1,2-propanediol |
1446491980 | Hexanedioic acid, polymer with 1,2-propanediol |
142621 | Hexanoic acid |
53896267 | Hexanoic acid |
149575 | Hexanoic acid, 2-ethyl- |
83829689 | Hexanoic acid, 2-ethyl- |
202054395 | Hexanoic acid, 2-ethyl- |
18540299 | Hexavalent chromium compounds |
26266682 | Hexenal, 2-ethyl- |
25264931 | Hexene |
26266024 | Hexene |
13967652 | Holmium, isotope of mass 166 |
13967652 | Holmium, isotope of mass 166m(1.2E+03 yr) |
378751792 | Holmium, isotope of mass 166m(1.2E+03 yr) |
67210 | Homocysteine, S-ethyl- |
302012 | Hydrazine |
31886267 | Hydrazine |
75013580 | Hydrazine |
78206914 | Hydrazine |
119775109 | Hydrazine |
51718 | Hydrazine, (2-phenylethyl)- |
57147 | Hydrazine, 1,1-dimethyl- |
108316 | Hydrazine, 1,1-dimethyl- |
88733282 | Hydrazine, 1,1-dimethyl- |
1615801 | Hydrazine, 1,2-diethyl- |
40738 | Hydrazine, 1,2-dimethyl- |
540738 | Hydrazine, 1,2-dimethyl- |
122667 | Hydrazine, 1,2-diphenyl- |
60343 | Hydrazine, methyl- |
60344 | Hydrazine, methyl- |
7803578 | Hydrazine, monohydrate |
10217524 | Hydrazine, monohydrate |
100630 | Hydrazine, phenyl- |
1057722403 | Hydrazine, phenyl- |
10034932 | Hydrazine, sulfate (1:1) |
95416152 | Hydrazine, sulfate (1:1) |
79196 | Hydrazinecarbothioamide |
57567 | Hydrazinecarboxamide |
563417 | Hydrazinecarboxamide |
59870 | Hydrazinecarboxamide, 2-[(5-nitro-2-furanyl)methylene]- |
8027712 | Hydrazinecarboxamide, 2-[(5-nitro-2-furanyl)methylene]- |
60051856 | Hydrazinecarboxamide, 2-[(5-nitro-2-furanyl)methylene]- |
563417 | Hydrazinecarboxamide, hydrochloride (1:1) |
13284076 | Hydrazinecarboximidamide, 2,2'-[carbonylbis(imino-4,1-phenyleneethylidyne)]bis- |
38848769 | Hydrazinium, 1-(2-hydroxypropyl)-1,1-dimethyl-2-(1-oxotetradecyl)-, inner salt |
17341401 | Hydrazinium, 1-(2-hydroxypropyl)-1,1-dimethyl-2-(2-methyl-1-oxo-2-propen-1-yl)-, inner salt |
56652494 | Hydrazinium, 1-(2-hydroxypropyl)-1,1-dimethyl-2-(2-methyl-1-oxo-2-propen-1-yl)-, inner salt |
68912174 | Hydrazinium, 1-(2-hydroxypropyl)-1,1-dimethyl-2-(2-methyl-1-oxo-2-propen-1-yl)-, inner salt |
73486507 | Hydrazinium, 1-(2-hydroxypropyl)-1,1-dimethyl-2-(2-methyl-1-oxo-2-propen-1-yl)-, inner salt |
92267599 | Hydrazinium, 1-(2-hydroxypropyl)-1,1-dimethyl-2-(2-methyl-1-oxo-2-propen-1-yl)-, inner salt |
122919646 | Hydrazinium, 1-(2-hydroxypropyl)-1,1-dimethyl-2-(2-methyl-1-oxo-2-propen-1-yl)-, inner salt |
159833417 | Hydrazinium, 1-(2-hydroxypropyl)-1,1-dimethyl-2-(2-methyl-1-oxo-2-propen-1-yl)-, inner salt |
10035106 | Hydrobromic acid |
62140561 | Hydrobromic acid |
64742898 | Hydrocarbons |
308067530 | Hydrocarbons |
68920069 | Hydrocarbons, C7-9 |
8012951 | Hydrocarbons, petroleum |
7647010 | Hydrochloric acid |
7647100 | Hydrochloric acid |
7647372 | Hydrochloric acid |
8007565 | Hydrochloric acid |
51005197 | Hydrochloric acid |
61674622 | Hydrochloric acid |
113962655 | Hydrochloric acid |
218625684 | Hydrochloric acid |
74908 | Hydrocyanic acid |
191234227 | Hydrocyanic acid |
341972314 | Hydrocyanic acid |
7664393 | Hydrofluoric acid |
32057093 | Hydrofluoric acid |
326604755 | Hydrofluoric acid |
1333740 | Hydrogen |
725200577 | Hydrogen |
12408025 | Hydrogen ion |
7722841 | Hydrogen peroxide (H2O2) |
8007305 | Hydrogen peroxide (H2O2) |
37355843 | Hydrogen peroxide (H2O2) |
66554505 | Hydrogen peroxide (H2O2) |
97929732 | Hydrogen peroxide (H2O2) |
218625720 | Hydrogen peroxide (H2O2) |
7783075 | Hydrogen selenide (H2Se) |
7783064 | Hydrogen sulfide (H2S) |
11144153 | Hydrogen sulfide (H2S) |
75912 | Hydroperoxide, 1,1-dimethylethyl |
80477 | Hydroperoxide, 1-methyl-1-(4-methylcyclohexyl)ethyl |
80159 | Hydroperoxide, 1-methyl-1-phenylethyl |
79568788 | Hydroperoxide, 1-methyl-1-phenylethyl |
14280309 | Hydroxide |
58390082 | Hydroxide |
58721689 | Hydroxide |
3352576 | Hydroxyl |
7803498 | Hydroxylamine |
593566 | Hydroxylamine, O-methyl-, hydrochloride (1:1) |
73151129 | Hydroxylamine, O-methyl-, hydrochloride (1:1) |
253880852 | Hydroxylamine, O-methyl-, hydrochloride (1:1) |
400605405 | Hydroxylamine, O-methyl-, hydrochloride (1:1) |
5470111 | Hydroxylamine, hydrochloride (1:1) |
379722733 | Hydroxylamine, hydrochloride (1:1) |
10046001 | Hydroxylamine, sulfate (1:1) |
72033433 | Hydroxylamine, sulfate (1:1) |
10039540 | Hydroxylamine, sulfate (2:1) |
120893789 | Hydroxylamine, sulfate (2:1) |
14380611 | Hypochlorite |
7681529 | Hypochlorous acid, sodium salt (1:1) |
8007598 | Hypochlorous acid, sodium salt (1:1) |
56172577 | Hypochlorous acid, sodium salt (1:1) |
102324787 | Hypochlorous acid, sodium salt (1:1) |
227453692 | Hypochlorous acid, sodium salt (1:1) |
834286 | Imidodicarbonimidic diamide, N-(2-phenylethyl)-, monohydrochloride |
193395 | Indeno[1,2,3-cd]pyrene |
348085461 | Indeno[1,2,3-cd]pyrene |
173584446 | Indeno[1,2-e][1,3,4]oxadiazine-4a(3H)-carboxylic acid, 7-chloro-2,5-dihydro-2-[[(methoxycarbonyl)[4-(trifluoromethoxy)phenyl]amino]carbonyl]-, methyl ester, (4aS)- |
174060414 | Indeno[1,2-e][1,3,4]oxadiazine-4a(3H)-carboxylic acid, 7-chloro-2,5-dihydro-2-[[(methoxycarbonyl)[4-(trifluoromethoxy)phenyl]amino]carbonyl]-, methyl ester, (4aS)- |
7440746 | Indium |
14191710 | Indium, isotope of mass 115 |
342698 | Inosine, 6-S-methyl-6-thio- |
20461545 | Iodide |
7553562 | Iodine |
8012815 | Iodine |
8012859 | Iodine |
8031478 | Iodine |
24503900 | Iodine |
506785 | Iodine cyanide (I(CN)) |
7783666 | Iodine fluoride (IF5) |
14158328 | Iodine, isotope of mass 126 |
15046841 | Iodine, isotope of mass 129, at. |
10043660 | Iodine, isotope of mass 131, at. |
24267569 | Iodine, isotope of mass 131, at. |
14683160 | Iodine, isotope of mass 132, at. |
7439885 | Iridium |
14981910 | Iridium, isotope of mass 190 |
14694690 | Iridium, isotope of mass 192 |
15128093 | Iridium, isotope of mass 192 |
25384116 | Iridium, isotope of mass 192 |
7439896 | Iron |
8011798 | Iron |
8053609 | Iron |
15438310 | Iron |
39344713 | Iron |
70884354 | Iron |
73135383 | Iron |
129048517 | Iron |
161135393 | Iron |
190454138 | Iron |
195161832 | Iron |
199281226 | Iron |
443783526 | Iron |
675141170 | Iron |
13463406 | Iron carbonyl (Fe(CO)5), (TB-5-11)- |
36823355 | Iron carbonyl (Fe(CO)5), (TB-5-11)- |
37220421 | Iron carbonyl (Fe(CO)5), (TB-5-11)- |
540770454 | Iron carbonyl (Fe(CO)5), (TB-5-11)- |
848779179 | Iron carbonyl (Fe(CO)5), (TB-5-11)- |
7758943 | Iron chloride (FeCl2) |
612850325 | Iron chloride (FeCl2) |
7705080 | Iron chloride (FeCl3) |
12178835 | Iron chloride (FeCl3) |
130622207 | Iron chloride (FeCl3) |
774583107 | Iron chloride (FeCl3) |
8012473 | Iron dextran |
8050939 | Iron dextran |
9004664 | Iron dextran |
9009885 | Iron dextran |
9044580 | Iron dextran |
9061476 | Iron dextran |
11129478 | Iron dextran |
37318948 | Iron dextran |
37349147 | Iron dextran |
50643000 | Iron dextran |
53858585 | Iron dextran |
1332372 | Iron oxide |
1333372 | Iron oxide |
8075669 | Iron oxide |
1198473265 | Iron oxide |
1309371 | Iron oxide (Fe2O3) |
1343095 | Iron oxide (Fe2O3) |
8011970 | Iron oxide (Fe2O3) |
8049501 | Iron oxide (Fe2O3) |
12000930 | Iron oxide (Fe2O3) |
12002174 | Iron oxide (Fe2O3) |
12227871 | Iron oxide (Fe2O3) |
60880866 | Iron oxide (Fe2O3) |
65455449 | Iron oxide (Fe2O3) |
65637710 | Iron oxide (Fe2O3) |
88528261 | Iron oxide (Fe2O3) |
90452214 | Iron oxide (Fe2O3) |
110736419 | Iron oxide (Fe2O3) |
118277319 | Iron oxide (Fe2O3) |
129131595 | Iron oxide (Fe2O3) |
131874414 | Iron oxide (Fe2O3) |
135507538 | Iron oxide (Fe2O3) |
147229901 | Iron oxide (Fe2O3) |
147229912 | Iron oxide (Fe2O3) |
160186107 | Iron oxide (Fe2O3) |
177715241 | Iron oxide (Fe2O3) |
185464442 | Iron oxide (Fe2O3) |
188357780 | Iron oxide (Fe2O3) |
220787064 | Iron oxide (Fe2O3) |
253310520 | Iron oxide (Fe2O3) |
448923715 | Iron oxide (Fe2O3) |
741267312 | Iron oxide (Fe2O3) |
1115688113 | Iron oxide (Fe2O3) |
1146982117 | Iron oxide (Fe2O3) |
1210992565 | Iron oxide (Fe2O3) |
1382787021 | Iron oxide (Fe2O3) |
1397708803 | Iron oxide (Fe2O3) |
1430053954 | Iron oxide (Fe2O3) |
1317619 | Iron oxide (Fe3O4) |
73905814 | Iron oxide (Fe3O4) |
107720809 | Iron oxide (Fe3O4) |
118440509 | Iron oxide (Fe3O4) |
122391586 | Iron oxide (Fe3O4) |
139660109 | Iron oxide (Fe3O4) |
144856042 | Iron oxide (Fe3O4) |
170277368 | Iron oxide (Fe3O4) |
207621214 | Iron oxide (Fe3O4) |
208666799 | Iron oxide (Fe3O4) |
219674870 | Iron oxide (Fe3O4) |
224310081 | Iron oxide (Fe3O4) |
253310519 | Iron oxide (Fe3O4) |
514204116 | Iron oxide (Fe3O4) |
940941195 | Iron oxide (Fe3O4) |
942194221 | Iron oxide (Fe3O4) |
954415691 | Iron oxide (Fe3O4) |
1433983766 | Iron oxide (Fe3O4) |
1481694603 | Iron oxide (Fe3O4) |
15438310 | Iron, ion (Fe2+) |
14681595 | Iron, isotope of mass 55 |
14596124 | Iron, isotope of mass 59 |
301053 | Iron, tris(N,N-dimethylcarbamodithioato-.kappa.S,.kappa.S')-, (OC-6-11)- |
13494274 | Iron, tris(N,N-dimethylcarbamodithioato-.kappa.S,.kappa.S')-, (OC-6-11)- |
14484641 | Iron, tris(N,N-dimethylcarbamodithioato-.kappa.S,.kappa.S')-, (OC-6-11)- |
64070924 | Iron, tris(N,N-dimethylcarbamodithioato-.kappa.S,.kappa.S')-, (OC-6-11)- |
1135443069 | Iron, tris(N,N-dimethylcarbamodithioato-.kappa.S,.kappa.S')-, (OC-6-11)- |
9016879 | Isocyanic acid, polymethylenepolyphenylene ester |
37291693 | Isocyanic acid, polymethylenepolyphenylene ester |
37370302 | Isocyanic acid, polymethylenepolyphenylene ester |
39278756 | Isocyanic acid, polymethylenepolyphenylene ester |
50814421 | Isocyanic acid, polymethylenepolyphenylene ester |
51059166 | Isocyanic acid, polymethylenepolyphenylene ester |
51810209 | Isocyanic acid, polymethylenepolyphenylene ester |
54018198 | Isocyanic acid, polymethylenepolyphenylene ester |
56273495 | Isocyanic acid, polymethylenepolyphenylene ester |
59392733 | Isocyanic acid, polymethylenepolyphenylene ester |
61642522 | Isocyanic acid, polymethylenepolyphenylene ester |
66174310 | Isocyanic acid, polymethylenepolyphenylene ester |
69345955 | Isocyanic acid, polymethylenepolyphenylene ester |
71061206 | Isocyanic acid, polymethylenepolyphenylene ester |
74315870 | Isocyanic acid, polymethylenepolyphenylene ester |
75026141 | Isocyanic acid, polymethylenepolyphenylene ester |
76600867 | Isocyanic acid, polymethylenepolyphenylene ester |
81031803 | Isocyanic acid, polymethylenepolyphenylene ester |
81406011 | Isocyanic acid, polymethylenepolyphenylene ester |
83271425 | Isocyanic acid, polymethylenepolyphenylene ester |
83271436 | Isocyanic acid, polymethylenepolyphenylene ester |
83512907 | Isocyanic acid, polymethylenepolyphenylene ester |
85497207 | Isocyanic acid, polymethylenepolyphenylene ester |
86473203 | Isocyanic acid, polymethylenepolyphenylene ester |
87139886 | Isocyanic acid, polymethylenepolyphenylene ester |
87347646 | Isocyanic acid, polymethylenepolyphenylene ester |
88385528 | Isocyanic acid, polymethylenepolyphenylene ester |
88651687 | Isocyanic acid, polymethylenepolyphenylene ester |
94469815 | Isocyanic acid, polymethylenepolyphenylene ester |
96595709 | Isocyanic acid, polymethylenepolyphenylene ester |
97397198 | Isocyanic acid, polymethylenepolyphenylene ester |
101840817 | Isocyanic acid, polymethylenepolyphenylene ester |
103106612 | Isocyanic acid, polymethylenepolyphenylene ester |
103812904 | Isocyanic acid, polymethylenepolyphenylene ester |
107231856 | Isocyanic acid, polymethylenepolyphenylene ester |
108021949 | Isocyanic acid, polymethylenepolyphenylene ester |
111310306 | Isocyanic acid, polymethylenepolyphenylene ester |
116439260 | Isocyanic acid, polymethylenepolyphenylene ester |
120528463 | Isocyanic acid, polymethylenepolyphenylene ester |
120797377 | Isocyanic acid, polymethylenepolyphenylene ester |
129406026 | Isocyanic acid, polymethylenepolyphenylene ester |
133686814 | Isocyanic acid, polymethylenepolyphenylene ester |
137397934 | Isocyanic acid, polymethylenepolyphenylene ester |
138069644 | Isocyanic acid, polymethylenepolyphenylene ester |
141255789 | Isocyanic acid, polymethylenepolyphenylene ester |
143476942 | Isocyanic acid, polymethylenepolyphenylene ester |
147445258 | Isocyanic acid, polymethylenepolyphenylene ester |
153190024 | Isocyanic acid, polymethylenepolyphenylene ester |
154102111 | Isocyanic acid, polymethylenepolyphenylene ester |
154609093 | Isocyanic acid, polymethylenepolyphenylene ester |
154766264 | Isocyanic acid, polymethylenepolyphenylene ester |
160477361 | Isocyanic acid, polymethylenepolyphenylene ester |
162355206 | Isocyanic acid, polymethylenepolyphenylene ester |
162628811 | Isocyanic acid, polymethylenepolyphenylene ester |
172826969 | Isocyanic acid, polymethylenepolyphenylene ester |
178464283 | Isocyanic acid, polymethylenepolyphenylene ester |
183563248 | Isocyanic acid, polymethylenepolyphenylene ester |
184539091 | Isocyanic acid, polymethylenepolyphenylene ester |
203743048 | Isocyanic acid, polymethylenepolyphenylene ester |
203944483 | Isocyanic acid, polymethylenepolyphenylene ester |
208196650 | Isocyanic acid, polymethylenepolyphenylene ester |
209252368 | Isocyanic acid, polymethylenepolyphenylene ester |
211991832 | Isocyanic acid, polymethylenepolyphenylene ester |
212569272 | Isocyanic acid, polymethylenepolyphenylene ester |
219753205 | Isocyanic acid, polymethylenepolyphenylene ester |
283603338 | Isocyanic acid, polymethylenepolyphenylene ester |
300852588 | Isocyanic acid, polymethylenepolyphenylene ester |
315680138 | Isocyanic acid, polymethylenepolyphenylene ester |
379692850 | Isocyanic acid, polymethylenepolyphenylene ester |
478809084 | Isocyanic acid, polymethylenepolyphenylene ester |
484655096 | Isocyanic acid, polymethylenepolyphenylene ester |
612824052 | Isocyanic acid, polymethylenepolyphenylene ester |
667447281 | Isocyanic acid, polymethylenepolyphenylene ester |
875453933 | Isocyanic acid, polymethylenepolyphenylene ester |
912469295 | Isocyanic acid, polymethylenepolyphenylene ester |
913174251 | Isocyanic acid, polymethylenepolyphenylene ester |
1228530764 | Isocyanic acid, polymethylenepolyphenylene ester |
1342796193 | Isocyanic acid, polymethylenepolyphenylene ester |
1352205754 | Isocyanic acid, polymethylenepolyphenylene ester |
1422250405 | Isocyanic acid, polymethylenepolyphenylene ester |
12758520 | Isodecanol |
25339177 | Isodecanol |
50973085 | Isodecanol |
1281998 | Isooctane |
11070056 | Isooctane |
26635643 | Isooctane |
1341419 | Isooctanol |
8031467 | Isooctanol |
26952216 | Isooctanol |
61256 | Isoquinoline, 1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxy-, hydrochloride (1:1) |
8001206 | Kerosine (petroleum) |
8008206 | Kerosine (petroleum) |
50815004 | Kerosine (petroleum) |
55465935 | Kerosine (petroleum) |
63241543 | Kerosine (petroleum) |
111941107 | Kerosine (petroleum) |
13983272 | Krypton, isotope of mass 85 |
70226027 | Kwik Seal |
50817 | L-Ascorbic acid |
14536175 | L-Ascorbic acid |
30208618 | L-Ascorbic acid |
50976755 | L-Ascorbic acid |
56172555 | L-Ascorbic acid |
56533052 | L-Ascorbic acid |
57304742 | L-Ascorbic acid |
57606403 | L-Ascorbic acid |
88845265 | L-Ascorbic acid |
89924696 | L-Ascorbic acid |
129940972 | L-Ascorbic acid |
154170908 | L-Ascorbic acid |
259133783 | L-Ascorbic acid |
623158952 | L-Ascorbic acid |
882690917 | L-Ascorbic acid |
884381695 | L-Ascorbic acid |
885512243 | L-Ascorbic acid |
1018124032 | L-Ascorbic acid |
2757906 | L-Glutamic acid, 5-[2-[4-(hydroxymethyl)phenyl]hydrazide] |
528745 | L-Glutamic acid, N-[3,5-dichloro-4-[[(2,4-diamino-6-pteridinyl)methyl]methylamino]benzoyl]- |
54626 | L-Glutamic acid, N-[4-[[(2,4-diamino-6-pteridinyl)methyl]amino]benzoyl]- |
64801554 | L-Glutamic acid, N-[4-[[(2,4-diamino-6-pteridinyl)methyl]amino]benzoyl]- |
120382787 | L-Glutamic acid, N-[4-[[(2,4-diamino-6-pteridinyl)methyl]amino]benzoyl]- |
59052 | L-Glutamic acid, N-[4-[[(2,4-diamino-6-pteridinyl)methyl]methylamino]benzoyl]- |
1082707843 | L-Glutamic acid, N-[4-[[(2,4-diamino-6-pteridinyl)methyl]methylamino]benzoyl]- |
3054362 | L-Glutamic acid, compd. with L-arginine (1:1) |
4320303 | L-Glutamic acid, compd. with L-arginine (1:1) |
91250270 | L-Glutamic acid, compd. with L-arginine (1:1) |
94601782 | L-Glutamic acid, compd. with L-arginine (1:1) |
142472 | L-Glutamic acid, sodium salt (1:1) |
51959412 | L-Glutamic acid, sodium salt (1:1) |
56974540 | L-Glutamic acid, sodium salt (1:1) |
116268418 | L-Glutamic acid, sodium salt (1:1) |
59518 | L-Methionine |
63683 | L-Methionine |
7005187 | L-Methionine |
24425783 | L-Methionine |
1437870988 | L-Methionine |
1463481017 | L-Methionine |
1463481062 | L-Methionine |
1463481153 | L-Methionine |
1463481197 | L-Methionine |
1463481233 | L-Methionine |
1463481277 | L-Methionine |
1463481313 | L-Methionine |
1463481379 | L-Methionine |
1463481415 | L-Methionine |
1463481460 | L-Methionine |
1463481517 | L-Methionine |
1463481584 | L-Methionine |
1463481733 | L-Methionine |
1463481802 | L-Methionine |
1463481891 | L-Methionine |
1463610754 | L-Methionine |
1463610765 | L-Methionine |
1466415575 | L-Methionine |
63912 | L-Phenylalanine |
3617445 | L-Phenylalanine |
5297029 | L-Phenylalanine |
10549094 | L-Phenylalanine |
67675336 | L-Phenylalanine |
801204115 | L-Phenylalanine |
148823 | L-Phenylalanine, 4-[bis(2-chloroethyl)amino]- |
8057258 | L-Phenylalanine, 4-[bis(2-chloroethyl)amino]- |
303479 | L-Phenylalanine, N-[[(3R)-5-chloro-3,4-dihydro-8-hydroxy-3-methyl-1-oxo-1H-2-benzopyran-7-yl]carbonyl]- |
115026 | L-Serine, diazoacetate (ester) |
438493222 | L-Serine, diazoacetate (ester) |
73223 | L-Tryptophan |
6912863 | L-Tryptophan |
80206300 | L-Tryptophan |
154635355 | L-Tryptophan |
56699 | L-Tryptophan, 5-hydroxy- |
4350098 | L-Tryptophan, 5-hydroxy- |
34953849 | L-Tryptophan, 5-hydroxy- |
1228817955 | L-Tryptophan, 5-hydroxy- |
555306 | L-Tyrosine, 3-hydroxy-.alpha.-methyl- |
779088 | L-Tyrosine, 3-hydroxy-.alpha.-methyl- |
1339759 | L-Tyrosine, 3-hydroxy-.alpha.-methyl- |
4290088 | L-Tyrosine, 3-hydroxy-.alpha.-methyl- |
88620568 | L-Tyrosine, 3-hydroxy-.alpha.-methyl- |
133161543 | L-Tyrosine, 3-hydroxy-.alpha.-methyl- |
7439910 | Lanthanum |
14762711 | Lanthanum |
110123483 | Lanthanum |
881842020 | Lanthanum |
13981287 | Lanthanum, isotope of mass 140 |
7439921 | Lead |
724427661 | Lead |
1308298 | Lead chromate oxide (Pb2(CrO4)O) |
18454121 | Lead chromate oxide (Pb2(CrO4)O) |
1323950282 | Lead chromate oxide (Pb2(CrO4)O) |
1335257 | Lead oxide |
469906250 | Lead oxide |
1309597 | Lead oxide (PbO) |
1317368 | Lead oxide (PbO) |
12359238 | Lead oxide (PbO) |
1309600 | Lead oxide (PbO2) |
60525544 | Lead oxide (PbO2) |
301075 | Lead, bis(N,N-dimethylcarbamodithioato-.kappa.S,.kappa.S')-, (T-4)- |
19010663 | Lead, bis(N,N-dimethylcarbamodithioato-.kappa.S,.kappa.S')-, (T-4)- |
1335326 | Lead, bis(acetato-.kappa.O)tetrahydroxytri- |
14687253 | Lead, isotope of mass 203 |
14255040 | Lead, isotope of mass 210 |
15092941 | Lead, isotope of mass 212 |
15067284 | Lead, isotope of mass 214 |
68131986 | Leather, scrap |
68424679 | Leather, scrap |
8062155 | Lignosulfonic acid |
58318459 | Lignosulfonic acid |
92680767 | Lignosulfonic acid |
1222186642 | Lignosulfonic acid |
8061516 | Lignosulfonic acid, sodium salt |
8077007 | Lignosulfonic acid, sodium salt |
9009750 | Lignosulfonic acid, sodium salt |
39392671 | Lignosulfonic acid, sodium salt |
53241331 | Lignosulfonic acid, sodium salt |
54511090 | Lignosulfonic acid, sodium salt |
57308175 | Lignosulfonic acid, sodium salt |
57308197 | Lignosulfonic acid, sodium salt |
58252372 | Lignosulfonic acid, sodium salt |
69913082 | Lignosulfonic acid, sodium salt |
70620303 | Lignosulfonic acid, sodium salt |
71124419 | Lignosulfonic acid, sodium salt |
89800419 | Lignosulfonic acid, sodium salt |
91728062 | Lignosulfonic acid, sodium salt |
94766037 | Lignosulfonic acid, sodium salt |
102188954 | Lignosulfonic acid, sodium salt |
112938995 | Lignosulfonic acid, sodium salt |
118367854 | Lignosulfonic acid, sodium salt |
122178103 | Lignosulfonic acid, sodium salt |
122784490 | Lignosulfonic acid, sodium salt |
172672592 | Lignosulfonic acid, sodium salt |
218433411 | Lignosulfonic acid, sodium salt |
290349154 | Lignosulfonic acid, sodium salt |
913371194 | Lignosulfonic acid, sodium salt |
8030306 | Ligroine |
8031069 | Ligroine |
8032324 | Ligroine |
7439932 | Lithium |
7782890 | Lithium amide (Li(NH2)) |
12135170 | Lithium amide (Li(NH2)) |
7550358 | Lithium bromide (LiBr) |
14644350 | Lithium bromide (LiBr) |
59217628 | Lithium bromide (LiBr) |
128084720 | Lithium bromide (LiBr) |
7447418 | Lithium chloride (LiCl) |
404596801 | Lithium chloride (LiCl) |
1220508633 | Lithium chloride (LiCl) |
1309791761 | Lithium chloride (LiCl) |
7789244 | Lithium fluoride (LiF) |
12285653 | Lithium fluoride (LiF) |
40619189 | Lithium fluoride (LiF) |
64975457 | Lithium fluoride (LiF) |
7580678 | Lithium hydride (LiH) |
64975424 | Lithium hydride (LiH) |
159577727 | Lithium hydride (LiH) |
1310652 | Lithium hydroxide (Li(OH)) |
55622305 | Lithium hydroxide (Li(OH)) |
10377512 | Lithium iodide (LiI) |
59216976 | Lithium iodide (LiI) |
12057248 | Lithium oxide (Li2O) |
37382391 | Lithium oxide (Li2O) |
216588679 | Lithium oxide (Li2O) |
1492921126 | Lithium oxide (Li2O) |
70514124 | Lubricating oils, used |
14265759 | Lutetium, isotope of mass 177 |
7439954 | Magnesium |
14147081 | Magnesium |
67208780 | Magnesium |
199281204 | Magnesium |
298688489 | Magnesium |
7786303 | Magnesium chloride (MgCl2) |
12285346 | Magnesium chloride (MgCl2) |
77069228 | Magnesium chloride (MgCl2) |
1122625868 | Magnesium chloride (MgCl2) |
7783406 | Magnesium fluoride (MgF2) |
1309484 | Magnesium oxide (MgO) |
1309488 | Magnesium oxide (MgO) |
13589167 | Magnesium oxide (MgO) |
52933730 | Magnesium oxide (MgO) |
82375777 | Magnesium oxide (MgO) |
185461910 | Magnesium oxide (MgO) |
187036802 | Magnesium oxide (MgO) |
227961491 | Magnesium oxide (MgO) |
1193320896 | Magnesium oxide (MgO) |
519620 | Magnesium, [(2E,7R,11R)-3,7,11,15-tetramethyl-2-hexadecenyl (3S,4S,21R)-9-ethenyl-14-ethyl-13-formyl-21-(methoxycarbonyl)-4,8,18-trimethyl-20-oxo-3-phorbinepropanoato(2-)-.kappa.N23,.kappa.N24,.kappa.N25,.kappa.N26]-, (SP-4-2)- |
16103803 | Magnesium, [(2E,7R,11R)-3,7,11,15-tetramethyl-2-hexadecenyl (3S,4S,21R)-9-ethenyl-14-ethyl-13-formyl-21-(methoxycarbonyl)-4,8,18-trimethyl-20-oxo-3-phorbinepropanoato(2-)-.kappa.N23,.kappa.N24,.kappa.N25,.kappa.N26]-, (SP-4-2)- |
22088171 | Magnesium, [(2E,7R,11R)-3,7,11,15-tetramethyl-2-hexadecenyl (3S,4S,21R)-9-ethenyl-14-ethyl-13-formyl-21-(methoxycarbonyl)-4,8,18-trimethyl-20-oxo-3-phorbinepropanoato(2-)-.kappa.N23,.kappa.N24,.kappa.N25,.kappa.N26]-, (SP-4-2)- |
479618 | Magnesium, [(2E,7R,11R)-3,7,11,15-tetramethyl-2-hexadecenyl (3S,4S,21R)-9-ethenyl-14-ethyl-21-(methoxycarbonyl)-4,8,13,18-tetramethyl-20-oxo-3-phorbinepropanoato(2-)-.kappa.N23,.kappa.N24,.kappa.N25,.kappa.N26]-, (SP-4-2)- |
1407416 | Magnesium, [(2E,7R,11R)-3,7,11,15-tetramethyl-2-hexadecenyl (3S,4S,21R)-9-ethenyl-14-ethyl-21-(methoxycarbonyl)-4,8,13,18-tetramethyl-20-oxo-3-phorbinepropanoato(2-)-.kappa.N23,.kappa.N24,.kappa.N25,.kappa.N26]-, (SP-4-2)- |
10579949 | Magnesium, [(2E,7R,11R)-3,7,11,15-tetramethyl-2-hexadecenyl (3S,4S,21R)-9-ethenyl-14-ethyl-21-(methoxycarbonyl)-4,8,13,18-tetramethyl-20-oxo-3-phorbinepropanoato(2-)-.kappa.N23,.kappa.N24,.kappa.N25,.kappa.N26]-, (SP-4-2)- |
11012218 | Magnesium, [(2E,7R,11R)-3,7,11,15-tetramethyl-2-hexadecenyl (3S,4S,21R)-9-ethenyl-14-ethyl-21-(methoxycarbonyl)-4,8,13,18-tetramethyl-20-oxo-3-phorbinepropanoato(2-)-.kappa.N23,.kappa.N24,.kappa.N25,.kappa.N26]-, (SP-4-2)- |
22088091 | Magnesium, [(2E,7R,11R)-3,7,11,15-tetramethyl-2-hexadecenyl (3S,4S,21R)-9-ethenyl-14-ethyl-21-(methoxycarbonyl)-4,8,13,18-tetramethyl-20-oxo-3-phorbinepropanoato(2-)-.kappa.N23,.kappa.N24,.kappa.N25,.kappa.N26]-, (SP-4-2)- |
23389175 | Magnesium, [(2E,7R,11R)-3,7,11,15-tetramethyl-2-hexadecenyl (3S,4S,21R)-9-ethenyl-14-ethyl-21-(methoxycarbonyl)-4,8,13,18-tetramethyl-20-oxo-3-phorbinepropanoato(2-)-.kappa.N23,.kappa.N24,.kappa.N25,.kappa.N26]-, (SP-4-2)- |
7439965 | Manganese |
8031401 | Manganese |
8075396 | Manganese |
17375029 | Manganese |
39303065 | Manganese |
195161785 | Manganese |
8064140 | Manganese alloy, base, Mn 74-82,Fe 8-19,C 6.9-7.5,Si 0-1.2,P 0-0.4 (ASTM A99) |
12604534 | Manganese alloy, base, Mn 74-82,Fe 8-19,C 6.9-7.5,Si 0-1.2,P 0-0.4 (ASTM A99) |
37188300 | Manganese alloy, base, Mn 74-82,Fe 8-19,C 6.9-7.5,Si 0-1.2,P 0-0.4 (ASTM A99) |
52966957 | Manganese alloy, base, Mn 74-82,Fe 8-19,C 6.9-7.5,Si 0-1.2,P 0-0.4 (ASTM A99) |
7439965 | Manganese compounds |
1317346 | Manganese oxide (Mn2O3) |
39432478 | Manganese oxide (Mn2O3) |
1317357 | Manganese oxide (Mn3O4) |
339311307 | Manganese oxide (Mn3O4) |
1313139 | Manganese oxide (MnO2) |
301678046 | Manganese oxide (MnO2) |
1363198042 | Manganese oxide (MnO2) |
301031 | Manganese, [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']- |
11004492 | Manganese, [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']- |
12125336 | Manganese, [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']- |
12427382 | Manganese, [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']- |
20316067 | Manganese, [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']- |
28355568 | Manganese, [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']- |
133317063 | Manganese, [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']- |
1338870 | Manganese, [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']-, mixt. with [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']zinc |
2234562 | Manganese, [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']-, mixt. with [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']zinc |
8018017 | Manganese, [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']-, mixt. with [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']zinc |
8064366 | Manganese, [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']-, mixt. with [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']zinc |
8065676 | Manganese, [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']-, mixt. with [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']zinc |
8065950 | Manganese, [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']-, mixt. with [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']zinc |
8069510 | Manganese, [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']-, mixt. with [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']zinc |
12001342 | Manganese, [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']-, mixt. with [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']zinc |
12656698 | Manganese, [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']-, mixt. with [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']zinc |
14376546 | Manganese, [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']-, mixt. with [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']zinc |
39432694 | Manganese, [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']-, mixt. with [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']zinc |
56532435 | Manganese, [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']-, mixt. with [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']zinc |
62712145 | Manganese, [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']-, mixt. with [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']zinc |
67071607 | Manganese, [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']-, mixt. with [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']zinc |
75789547 | Manganese, [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']-, mixt. with [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']zinc |
84070122 | Manganese, [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']-, mixt. with [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']zinc |
172672412 | Manganese, [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']-, mixt. with [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']zinc |
6379471 | Manganese, bis(dimethylcarbamodithioato-.kappa.S,.kappa.S')-, (T-4)- |
7786336 | Manganese, bis(dimethylcarbamodithioato-.kappa.S,.kappa.S')-, (T-4)- |
10198455 | Manganese, bis(dimethylcarbamodithioato-.kappa.S,.kappa.S')-, (T-4)- |
15339363 | Manganese, bis(dimethylcarbamodithioato-.kappa.S,.kappa.S')-, (T-4)- |
60226962 | Manganese, bis(dimethylcarbamodithioato-.kappa.S,.kappa.S')-, (T-4)- |
13966319 | Manganese, isotope of mass 54 |
12079651 | Manganese, tricarbonyl(.eta.5-2,4-cyclopentadien-1-yl)- |
12108133 | Manganese, tricarbonyl[(1,2,3,4,5-.eta.)-1-methyl-2,4-cyclopentadien-1-yl]- |
41536429 | Manganese, tricarbonyl[(1,2,3,4,5-.eta.)-1-methyl-2,4-cyclopentadien-1-yl]- |
69658 | Mannitol |
87785 | Mannitol |
133437 | Mannitol |
5149406 | Mannitol |
36413613 | Mannitol |
54648 | Mercurate(1-), ethyl[2-(mercapto-.kappa.S)benzoato(2-)-.kappa.O]-, sodium (1:1) |
2141277 | Mercurate(1-), ethyl[2-(mercapto-.kappa.S)benzoato(2-)-.kappa.O]-, sodium (1:1) |
8030328 | Mercurate(1-), ethyl[2-(mercapto-.kappa.S)benzoato(2-)-.kappa.O]-, sodium (1:1) |
8030339 | Mercurate(1-), ethyl[2-(mercapto-.kappa.S)benzoato(2-)-.kappa.O]-, sodium (1:1) |
11004812 | Mercurate(1-), ethyl[2-(mercapto-.kappa.S)benzoato(2-)-.kappa.O]-, sodium (1:1) |
23065352 | Mercurate(1-), ethyl[2-(mercapto-.kappa.S)benzoato(2-)-.kappa.O]-, sodium (1:1) |
25948509 | Mercurate(1-), ethyl[2-(mercapto-.kappa.S)benzoato(2-)-.kappa.O]-, sodium (1:1) |
77536619 | Mercurate(1-), ethyl[2-(mercapto-.kappa.S)benzoato(2-)-.kappa.O]-, sodium (1:1) |
113170857 | Mercurate(1-), ethyl[2-(mercapto-.kappa.S)benzoato(2-)-.kappa.O]-, sodium (1:1) |
130995492 | Mercurate(1-), ethyl[2-(mercapto-.kappa.S)benzoato(2-)-.kappa.O]-, sodium (1:1) |
362653085 | Mercurate(1-), ethyl[2-(mercapto-.kappa.S)benzoato(2-)-.kappa.O]-, sodium (1:1) |
878791130 | Mercurate(1-), ethyl[2-(mercapto-.kappa.S)benzoato(2-)-.kappa.O]-, sodium (1:1) |
7439976 | Mercury |
8030646 | Mercury |
8031274 | Mercury |
51887479 | Mercury |
92355345 | Mercury |
92786624 | Mercury |
123720036 | Mercury |
149038915 | Mercury |
7487947 | Mercury chloride (HgCl2) |
1344452 | Mercury oxide (HgO) |
8028340 | Mercury oxide (HgO) |
21908532 | Mercury oxide (HgO) |
22967926 | Mercury(1+), methyl- |
62384 | Mercury, (acetato-.kappa.O)phenyl- |
1337060 | Mercury, (acetato-.kappa.O)phenyl- |
7487947 | Mercury, (acetato-.kappa.O)phenyl- |
7775099 | Mercury, (acetato-.kappa.O)phenyl- |
8013476 | Mercury, (acetato-.kappa.O)phenyl- |
61840457 | Mercury, (acetato-.kappa.O)phenyl- |
64684453 | Mercury, (acetato-.kappa.O)phenyl- |
73588735 | Mercury, (acetato-.kappa.O)phenyl- |
112415595 | Mercury, (acetato-.kappa.O)phenyl- |
151382 | Mercury, (acetato?.kappa.O)(2?methoxyethyl)- |
12798322 | Mercury, (acetato?.kappa.O)(2?methoxyethyl)- |
502396 | Mercury, (cyanoguanidinato-.kappa.N')methyl- |
12542904 | Mercury, (cyanoguanidinato-.kappa.N')methyl- |
28519246 | Mercury, (cyanoguanidinato-.kappa.N')methyl- |
55685 | Mercury, (nitrato-.kappa.O)phenyl- |
628864 | Mercury, bis(fulminato-.kappa.C)- |
20820455 | Mercury, bis(fulminato-.kappa.C)- |
42240200 | Mercury, bis(fulminato-.kappa.C)- |
92114960 | Mercury, bis(fulminato-.kappa.C)- |
123886 | Mercury, chloro(2-methoxyethyl)- |
115093 | Mercury, chloromethyl- |
143362 | Mercury, chloromethyl- |
1184572 | Mercury, hydroxymethyl- |
8012144 | Metaphosphoric acid (H6P6O18), sodium salt (1:6) |
10124568 | Metaphosphoric acid (H6P6O18), sodium salt (1:6) |
16210450 | Metaphosphoric acid (H6P6O18), sodium salt (1:6) |
20517559 | Metaphosphoric acid (H6P6O18), sodium salt (1:6) |
193678443 | Metaphosphoric acid (H6P6O18), sodium salt (1:6) |
1357387917 | Metaphosphoric acid (H6P6O18), sodium salt (1:6) |
74895 | Methanamine |
42939708 | Methanamine |
85404177 | Methanamine |
119775096 | Methanamine |
1391413981 | Methanamine |
75503 | Methanamine, N,N-dimethyl- |
4558127 | Methanamine, N,N-dimethyl- |
124403 | Methanamine, N-methyl- |
62759 | Methanamine, N-methyl-N-nitroso- |
95476 | Methanamine, N-methyl-N-nitroso- |
75592 | Methanaminium, N,N,N-trimethyl-, hydroxide (1:1) |
78017875 | Methanaminium, N,N,N-trimethyl-, hydroxide (1:1) |
93615680 | Methanaminium, N,N,N-trimethyl-, hydroxide (1:1) |
104422119 | Methanaminium, N,N,N-trimethyl-, hydroxide (1:1) |
105468357 | Methanaminium, N,N,N-trimethyl-, hydroxide (1:1) |
117277880 | Methanaminium, N,N,N-trimethyl-, hydroxide (1:1) |
123626971 | Methanaminium, N,N,N-trimethyl-, hydroxide (1:1) |
129653914 | Methanaminium, N,N,N-trimethyl-, hydroxide (1:1) |
129654611 | Methanaminium, N,N,N-trimethyl-, hydroxide (1:1) |
143549795 | Methanaminium, N,N,N-trimethyl-, hydroxide (1:1) |
154636596 | Methanaminium, N,N,N-trimethyl-, hydroxide (1:1) |
195460174 | Methanaminium, N,N,N-trimethyl-, hydroxide (1:1) |
950683291 | Methanaminium, N,N,N-trimethyl-, hydroxide (1:1) |
1239135842 | Methanaminium, N,N,N-trimethyl-, hydroxide (1:1) |
510134 | Methanaminium, N-[4-[[4-(dimethylamino)phenyl]phenylmethylene]-2,5-cyclohexadien-1-ylidene]-N-methyl-, chloride (1:1) |
569642 | Methanaminium, N-[4-[[4-(dimethylamino)phenyl]phenylmethylene]-2,5-cyclohexadien-1-ylidene]-N-methyl-, chloride (1:1) |
596642 | Methanaminium, N-[4-[[4-(dimethylamino)phenyl]phenylmethylene]-2,5-cyclohexadien-1-ylidene]-N-methyl-, chloride (1:1) |
8004873 | Methanaminium, N-[4-[[4-(dimethylamino)phenyl]phenylmethylene]-2,5-cyclohexadien-1-ylidene]-N-methyl-, chloride (1:1) |
55172504 | Methanaminium, N-[4-[[4-(dimethylamino)phenyl]phenylmethylene]-2,5-cyclohexadien-1-ylidene]-N-methyl-, chloride (1:1) |
548629 | Methanaminium, N-[4-[bis[4-(dimethylamino)phenyl]methylene]-2,5-cyclohexadien-1-ylidene]-N-methyl-, chloride (1:1) |
7077318 | Methanaminium, N-[4-[bis[4-(dimethylamino)phenyl]methylene]-2,5-cyclohexadien-1-ylidene]-N-methyl-, chloride (1:1) |
8004873 | Methanaminium, N-[4-[bis[4-(dimethylamino)phenyl]methylene]-2,5-cyclohexadien-1-ylidene]-N-methyl-, chloride (1:1) |
23355477 | Methanaminium, N-[4-[bis[4-(dimethylamino)phenyl]methylene]-2,5-cyclohexadien-1-ylidene]-N-methyl-, chloride (1:1) |
74828 | Methane |
131452567 | Methane |
115106 | Methane, 1,1'-oxybis- |
157621619 | Methane, 1,1'-oxybis- |
451449675 | Methane, 1,1'-oxybis- |
542881 | Methane, 1,1'-oxybis[1-chloro- |
67685 | Methane, 1,1'-sulfinylbis- |
8070539 | Methane, 1,1'-sulfinylbis- |
164071414 | Methane, 1,1'-sulfinylbis- |
705301219 | Methane, 1,1'-sulfinylbis- |
3064708 | Methane, 1,1'-sulfonylbis[1,1,1-trichloro- |
75183 | Methane, 1,1'-thiobis- |
956465013 | Methane, 1,1'-thiobis- |
74839 | Methane, bromo- |
74795 | Methane, bromochloro- |
74975 | Methane, bromochloro- |
83847498 | Methane, bromochloro- |
353593 | Methane, bromochlorodifluoro- |
421012 | Methane, bromochlorodifluoro- |
11104737 | Methane, bromochlorodifluoro- |
75274 | Methane, bromodichloro- |
75638 | Methane, bromotrifluoro- |
62395259 | Methane, bromotrifluoro- |
1452383173 | Methane, bromotrifluoro- |
74873 | Methane, chloro- |
75456 | Methane, chlorodifluoro- |
25497294 | Methane, chlorodifluoro- |
73666770 | Methane, chlorodifluoro- |
134191961 | Methane, chlorodifluoro- |
191542015 | Methane, chlorodifluoro- |
593704 | Methane, chlorofluoro- |
107302 | Methane, chloromethoxy- |
75729 | Methane, chlorotrifluoro- |
185009432 | Methane, chlorotrifluoro- |
334883 | Methane, diazo- |
463605 | Methane, diazo- |
16835997 | Methane, diazo- |
62024162 | Methane, diazo- |
74953 | Methane, dibromo- |
106914 | Methane, dibromo- |
124481 | Methane, dibromochloro- |
594183 | Methane, dibromodichloro- |
75616 | Methane, dibromodifluoro- |
75092 | Methane, dichloro- |
75718 | Methane, dichlorodifluoro- |
62185711 | Methane, dichlorodifluoro- |
185009396 | Methane, dichlorodifluoro- |
1256919171 | Methane, dichlorodifluoro- |
75434 | Methane, dichlorofluoro- |
39289286 | Methane, dichlorofluoro- |
594047 | Methane, dichloroiodo- |
75105 | Methane, difluoro- |
75116 | Methane, diiodo- |
103883814 | Methane, diiodo- |
109375 | Methane, dimethoxy- |
109875 | Methane, dimethoxy- |
74884 | Methane, iodo- |
147937073 | Methane, iodo- |
624839 | Methane, isocyanato- |
593759 | Methane, isocyano- |
556616 | Methane, isothiocyanato- |
75525 | Methane, nitro- |
104306481 | Methane, nitro- |
558134 | Methane, tetrabromo- |
56235 | Methane, tetrachloro- |
75730 | Methane, tetrafluoro- |
509148 | Methane, tetranitro- |
75252 | Methane, tribromo- |
464108 | Methane, tribromonitro- |
57578 | Methane, trichloro- |
67663 | Methane, trichloro- |
8013545 | Methane, trichloro- |
75694 | Methane, trichlorofluoro- |
62185700 | Methane, trichlorofluoro- |
79620410 | Methane, trichlorofluoro- |
83589406 | Methane, trichlorofluoro- |
91315616 | Methane, trichlorofluoro- |
76062 | Methane, trichloronitro- |
75478 | Methane, triiodo- |
149735 | Methane, trimethoxy- |
251301356 | Methane, trimethoxy- |
32488509 | Methane-13C, tetrachloro- |
3149744 | Methane-d2, bromochloro- |
1665005 | Methane-d2, dichloro- |
75707 | Methanesulfenyl chloride, trichloro- |
594423 | Methanesulfenyl chloride, trichloro- |
20434917 | Methanesulfenyl chloride, trichloro- |
344328672 | Methanesulfenyl chloride, trichloro- |
75752 | Methanesulfonic acid |
44209645 | Methanesulfonic acid |
44209725 | Methanesulfonic acid |
62203241 | Methanesulfonic acid |
87128903 | Methanesulfonic acid |
98527298 | Methanesulfonic acid |
115449984 | Methanesulfonic acid |
125756914 | Methanesulfonic acid |
1129867340 | Methanesulfonic acid |
333277 | Methanesulfonic acid, 1,1,1-trifluoro-, methyl ester |
62500 | Methanesulfonic acid, ethyl ester |
101946081 | Methanesulfonic acid, ethyl ester |
126318 | Methanesulfonic acid, iodo-, sodium salt |
66273 | Methanesulfonic acid, methyl ester |
74921 | Methanethiol |
74931 | Methanethiol |
74941 | Methanethiol |
63933471 | Methanethiol |
505027725 | Methanethiol |
75707 | Methanethiol, trichloro- |
594423 | Methanethiol, trichloro- |
409314701 | Methanethiol, trichloro- |
33089611 | Methanimidamide, N'-(2,4-dimethylphenyl)-N-[[(2,4-dimethylphenyl)imino]methyl]-N-methyl- |
6164983 | Methanimidamide, N'-(4-chloro-2-methylphenyl)-N,N-dimethyl- |
17702577 | Methanimidamide, N,N-dimethyl-N'-[2-methyl-4-[[(methylamino)carbonyl]oxy]phenyl]- |
29811265 | Methanimidamide, N,N-dimethyl-N'-[2-methyl-4-[[(methylamino)carbonyl]oxy]phenyl]- |
18413177 | Methanimidamide, N,N-dimethyl-N'-[3-[[(methylamino)carbonyl]oxy]phenyl]-, hydrochloride (1:1) |
23422539 | Methanimidamide, N,N-dimethyl-N'-[3-[[(methylamino)carbonyl]oxy]phenyl]-, hydrochloride (1:1) |
26445738 | Methanimidamide, N,N-dimethyl-N'-[3-[[(methylamino)carbonyl]oxy]phenyl]-, hydrochloride (1:1) |
67561 | Methanol |
54841713 | Methanol |
1173023830 | Methanol |
592621 | Methanol, (methyl-ONN-azoxy)-, acetate (ester) |
131533 | Methanone, (2-hydroxy-4-methoxyphenyl)(2-hydroxyphenyl)- |
186100798 | Methanone, (2-hydroxy-4-methoxyphenyl)(2-hydroxyphenyl)- |
131577 | Methanone, (2-hydroxy-4-methoxyphenyl)phenyl- |
14375372 | Methanone, (2-hydroxy-4-methoxyphenyl)phenyl- |
58392157 | Methanone, (2-hydroxy-4-methoxyphenyl)phenyl- |
58392226 | Methanone, (2-hydroxy-4-methoxyphenyl)phenyl- |
138464230 | Methanone, (2-hydroxy-4-methoxyphenyl)phenyl- |
153859735 | Methanone, (2-hydroxy-4-methoxyphenyl)phenyl- |
897050189 | Methanone, (2-hydroxy-4-methoxyphenyl)phenyl- |
90948 | Methanone, bis[4-(dimethylamino)phenyl]- |
119619 | Methanone, diphenyl- |
852361036 | Methanone, diphenyl- |
9006422 | Metiram |
12001262 | Mica-group minerals |
12003382 | Mica-group minerals |
53112508 | Mica-group minerals |
56902411 | Mica-group minerals |
65589459 | Mica-group minerals |
66814582 | Mica-group minerals |
66814593 | Mica-group minerals |
68859132 | Mica-group minerals |
69237338 | Mica-group minerals |
71587161 | Mica-group minerals |
361539608 | Mica-group minerals |
7631950 | Molybdate (MoO42-), sodium (1:2), (T-4)- |
14666912 | Molybdate (MoO42-), sodium (1:2), (T-4)- |
106463336 | Molybdate (MoO42-), sodium (1:2), (T-4)- |
1224508557 | Molybdate (MoO42-), sodium (1:2), (T-4)- |
1351977280 | Molybdate (MoO42-), sodium (1:2), (T-4)- |
7439987 | Molybdenum |
1313275 | Molybdenum oxide (MoO3) |
12412214 | Molybdenum oxide (MoO3) |
12412225 | Molybdenum oxide (MoO3) |
37376479 | Molybdenum oxide (MoO3) |
77835702 | Molybdenum oxide (MoO3) |
114316517 | Molybdenum oxide (MoO3) |
114663842 | Molybdenum oxide (MoO3) |
199790619 | Molybdenum oxide (MoO3) |
252368255 | Molybdenum oxide (MoO3) |
278186893 | Molybdenum oxide (MoO3) |
390388973 | Molybdenum oxide (MoO3) |
14119132 | Molybdenum, isotope of mass 93 |
14119154 | Molybdenum, isotope of mass 99 |
76573 | Morphinan-6-ol, 7,8-didehydro-4,5-epoxy-3-methoxy-17-methyl-, (5.alpha.,6.alpha.)- |
52288 | Morphinan-6-ol, 7,8-didehydro-4,5-epoxy-3-methoxy-17-methyl-, (5.alpha.,6.alpha.)-, phosphate (1:1) (salt) |
110918 | Morpholine |
1440615 | Morpholine |
88542818 | Morpholine |
96122951 | Morpholine |
99108562 | Morpholine |
147366312 | Morpholine |
854893202 | Morpholine |
141913 | Morpholine, 2,6-dimethyl- |
100743 | Morpholine, 4-ethyl- |
59892 | Morpholine, 4-nitroso- |
8030306 | Naphtha |
8030317 | Naphtha |
8032324 | Naphtha |
50813735 | Naphtha |
54847971 | Naphtha |
64475850 | Naphtha |
116010527 | Naphtha |
121448837 | Naphtha |
345960909 | Naphtha |
1217187524 | Naphtha |
64741419 | Naphtha (petroleum), heavy straight-run |
64741668 | Naphtha (petroleum), light alkylate |
91203 | Naphthalene |
72931454 | Naphthalene |
2234131 | Naphthalene, 1,2,3,4,5,6,7,8-octachloro- |
119642 | Naphthalene, 1,2,3,4-tetrahydro- |
523477 | Naphthalene, 1,2,4a,5,8,8a-hexahydro-4,7-dimethyl-1-(1-methylethyl)-, (1S,4aR,8aS)- |
606371 | Naphthalene, 1,3-dinitro- |
605710 | Naphthalene, 1,5-dinitro- |
602380 | Naphthalene, 1,8-dinitro- |
90131 | Naphthalene, 1-chloro- |
321380 | Naphthalene, 1-fluoro- |
551064 | Naphthalene, 1-isothiocyanato- |
90120 | Naphthalene, 1-methyl- |
86577 | Naphthalene, 1-nitro- |
91587 | Naphthalene, 2-chloro- |
939275 | Naphthalene, 2-ethyl- |
90120 | Naphthalene, 2-methyl- |
91576 | Naphthalene, 2-methyl- |
881038 | Naphthalene, 2-methyl-1-nitro- |
91178 | Naphthalene, decahydro- |
29350730 | Naphthalene, decahydro-1,6-dimethyl-4-(1-methylethyl)-, (1S,4S,4aS,6S,8aS)-, didehydro deriv. |
108910538 | Naphthalene, decahydro-1,6-dimethyl-4-(1-methylethyl)-, (1S,4S,4aS,6S,8aS)-, didehydro deriv. |
25551284 | Naphthalene, diisocyanato- |
39394451 | Naphthalene, diisocyanato- |
1335939 | Naphthalene, dimethyl- |
27457314 | Naphthalene, dimethyl- |
28804888 | Naphthalene, dimethyl- |
65338047 | Naphthalene, dimethyl- |
65338081 | Naphthalene, dimethyl- |
1335871 | Naphthalene, hexachloro- |
30402165 | Naphthalene, hexachloro- |
1321944 | Naphthalene, methyl- |
1321648 | Naphthalene, pentachloro- |
1335882 | Naphthalene, tetrachloro- |
1321659 | Naphthalene, trichloro- |
1338245 | Naphthenic acids |
51806612 | Naphthenic acids, cobalt salts |
61789513 | Naphthenic acids, cobalt salts |
161279658 | Naphthenic acids, cobalt salts |
20020024 | Napthalene, 1,2,3,4-tetrachloro- |
26761455 | Neodecanoic acid, 2-oxiranylmethyl ester |
14269740 | Neodymium, isotope of mass 147 |
39409455 | Neptune Blue |
7440020 | Nickel |
7440022 | Nickel |
8049318 | Nickel |
17375041 | Nickel |
39303463 | Nickel |
53527814 | Nickel |
112084170 | Nickel |
134631462 | Nickel |
195161843 | Nickel |
623574572 | Nickel |
1250376705 | Nickel |
1250376738 | Nickel |
1262528313 | Nickel |
1437722774 | Nickel |
1437723062 | Nickel |
1437723368 | Nickel |
12612554 | Nickel carbonyl (Ni(CO)4), (T-4)- |
13005317 | Nickel carbonyl (Ni(CO)4), (T-4)- |
13463393 | Nickel carbonyl (Ni(CO)4), (T-4)- |
14875957 | Nickel carbonyl (Ni(CO)4), (T-4)- |
36252605 | Nickel carbonyl (Ni(CO)4), (T-4)- |
42126465 | Nickel carbonyl (Ni(CO)4), (T-4)- |
71327123 | Nickel carbonyl (Ni(CO)4), (T-4)- |
848779180 | Nickel carbonyl (Ni(CO)4), (T-4)- |
7718549 | Nickel chloride (NiCl2) |
7440020 | Nickel compounds |
557197 | Nickel cyanide (Ni(CN)2) |
99601920 | Nickel cyanide (Ni(CN)2) |
99601931 | Nickel cyanide (Ni(CN)2) |
1314063 | Nickel oxide (Ni2O3) |
34875542 | Nickel oxide (Ni2O3) |
164144916 | Nickel oxide (Ni2O3) |
203212673 | Nickel oxide (Ni2O3) |
1313991 | Nickel oxide (NiO) |
185461965 | Nickel oxide (NiO) |
203645174 | Nickel oxide (NiO) |
339311410 | Nickel oxide (NiO) |
12035368 | Nickel oxide (NiO2) |
12035722 | Nickel sulfide (Ni3S2) |
22965602 | Nickel, [N,N-bis[(carboxy-.kappa.O)methyl]glycinato(3-)-.kappa.N,.kappa.O]- |
1295358 | Nickel, bis[(1,2,5,6-.eta.)-1,5-cyclooctadiene]- |
14336700 | Nickel, isotope of mass 59 |
13981378 | Nickel, isotope of mass 63 |
34831033 | Nickelate(1-), [N,N-bis[(carboxy-.kappa.O)methyl]glycinato(3-)-.kappa.N,.kappa.O]-, hydrogen (1:1), (T-4)- |
1271289 | Nickelocene |
51269444 | Nickelocene |
1080518917 | Nickelocene |
7440031 | Niobium |
26842137 | Niobium |
13967765 | Niobium, isotope of mass 95 |
14797558 | Nitrate |
23746181 | Nitrate |
34236356 | Nitrate |
73394839 | Nitrate |
84145824 | Nitrate |
7697372 | Nitric acid |
78989432 | Nitric acid |
218625708 | Nitric acid |
802862595 | Nitric acid |
1053657183 | Nitric acid |
1173016700 | Nitric acid |
1431325802 | Nitric acid |
6484522 | Nitric acid ammonium salt (1:1) |
7783202 | Nitric acid ammonium salt (1:1) |
95255406 | Nitric acid ammonium salt (1:1) |
893438761 | Nitric acid ammonium salt (1:1) |
7761888 | Nitric acid silver(1+) salt (1:1) |
8012122 | Nitric acid silver(1+) salt (1:1) |
31890207 | Nitric acid silver(1+) salt (1:1) |
7631994 | Nitric acid sodium salt (1:1) |
862599222 | Nitric acid sodium salt (1:1) |
1401517041 | Nitric acid sodium salt (1:1) |
13473900 | Nitric acid, aluminum salt (3:1) |
25295243 | Nitric acid, aluminum salt (3:1) |
220685698 | Nitric acid, aluminum salt (3:1) |
1313195435 | Nitric acid, aluminum salt (3:1) |
1469908915 | Nitric acid, aluminum salt (3:1) |
13597994 | Nitric acid, beryllium salt (2:1) |
10124375 | Nitric acid, calcium salt (2:1) |
56532059 | Nitric acid, calcium salt (2:1) |
94079751 | Nitric acid, calcium salt (2:1) |
95680754 | Nitric acid, calcium salt (2:1) |
260792083 | Nitric acid, calcium salt (2:1) |
292135478 | Nitric acid, calcium salt (2:1) |
13548384 | Nitric acid, chromium(3+) salt (3:1) |
20249212 | Nitric acid, chromium(3+) salt (3:1) |
10026229 | Nitric acid, cobalt(2+) salt, hexahydrate |
13494901 | Nitric acid, gallium salt (3:1) |
27425770 | Nitric acid, gallium salt (3:1) |
33836974 | Nitric acid, gallium salt (3:1) |
39394166 | Nitric acid, gallium salt (3:1) |
10277437 | Nitric acid, lanthanum(3+) salt, hexahydrate |
7790694 | Nitric acid, lithium salt (1:1) |
1314087121 | Nitric acid, lithium salt (1:1) |
10377603 | Nitric acid, magnesium salt (2:1) |
50908844 | Nitric acid, magnesium salt (2:1) |
627134 | Nitric acid, propyl ester |
10102451 | Nitric acid, thallium(1+) salt (1:1) |
10102440 | Nitrite |
12183969 | Nitrite |
14797558 | Nitrite |
14797650 | Nitrite |
114466534 | Nitrite |
7664417 | Nitrogen |
7727379 | Nitrogen |
93037139 | Nitrogen |
156457453 | Nitrogen |
161728274 | Nitrogen |
263005658 | Nitrogen |
745765075 | Nitrogen |
778548564 | Nitrogen |
794449540 | Nitrogen |
882528565 | Nitrogen |
951778248 | Nitrogen |
1119449410 | Nitrogen |
1384252827 | Nitrogen |
7783542 | Nitrogen fluoride (NF3) |
7727379 | Nitrogen oxide |
11104931 | Nitrogen oxide |
11129694 | Nitrogen oxide |
10024972 | Nitrogen oxide (N2O) |
126386650 | Nitrogen oxide (N2O) |
129451496 | Nitrogen oxide (N2O) |
130835711 | Nitrogen oxide (N2O) |
147527079 | Nitrogen oxide (N2O) |
175876445 | Nitrogen oxide (N2O) |
794457855 | Nitrogen oxide (N2O) |
847968132 | Nitrogen oxide (N2O) |
850203008 | Nitrogen oxide (N2O) |
10102440 | Nitrogen oxide (N2O4) |
10544726 | Nitrogen oxide (N2O4) |
1220110473 | Nitrogen oxide (N2O4) |
10102439 | Nitrogen oxide (NO) |
51005200 | Nitrogen oxide (NO) |
51005211 | Nitrogen oxide (NO) |
53851197 | Nitrogen oxide (NO) |
90452292 | Nitrogen oxide (NO) |
10102440 | Nitrogen oxide (NO2) |
50443931 | Nitrogen oxide (NO2) |
56003839 | Nitrogen oxide (NO2) |
66252286 | Nitrogen oxide (NO2) |
78246056 | Nitrogen oxide (NO2) |
119990113 | Nitrogen oxide (NO2) |
127999626 | Nitrogen oxide (NO2) |
542563 | Nitrous acid, 2-methylpropyl ester |
110463 | Nitrous acid, 3-methylbutyl ester |
463047 | Nitrous acid, 3-methylbutyl ester |
109955 | Nitrous acid, ethyl ester |
8013589 | Nitrous acid, ethyl ester |
463047 | Nitrous acid, pentyl ester |
7632000 | Nitrous acid, sodium salt (1:1) |
32863153 | Nitrous acid, sodium salt (1:1) |
56227204 | Nitrous acid, sodium salt (1:1) |
82497436 | Nitrous acid, sodium salt (1:1) |
82998401 | Nitrous acid, sodium salt (1:1) |
629925 | Nonadecane |
124196 | Nonanal |
918959883 | Nonanal |
111842 | Nonane |
875820943 | Nonane |
630024 | Octacosane |
593453 | Octadecane |
57114 | Octadecanoic acid |
8013283 | Octadecanoic acid |
8023061 | Octadecanoic acid |
8037409 | Octadecanoic acid |
8037830 | Octadecanoic acid |
8039518 | Octadecanoic acid |
8039529 | Octadecanoic acid |
8039530 | Octadecanoic acid |
8039541 | Octadecanoic acid |
39390619 | Octadecanoic acid |
58392668 | Octadecanoic acid |
82497276 | Octadecanoic acid |
134503336 | Octadecanoic acid |
197923107 | Octadecanoic acid |
294203079 | Octadecanoic acid |
294203159 | Octadecanoic acid |
1245726946 | Octadecanoic acid |
5829481 | Octadecanoic acid, 9,10-dichloro- |
31135634 | Octadecanoic acid, 9,10-dichloro- |
637127 | Octadecanoic acid, aluminum salt (3:1) |
65324358 | Octadecanoic acid, aluminum salt (3:1) |
2223930 | Octadecanoic acid, cadmium salt (2:1) |
4568289 | Octadecanoic acid, compd. with 2,2',2''-nitrilotris[ethanol] (1:1) |
557051 | Octadecanoic acid, zinc salt (2:1) |
8028873 | Octadecanoic acid, zinc salt (2:1) |
72535558 | Octadecanoic acid, zinc salt (2:1) |
124130 | Octanal |
111659 | Octane |
31372915 | Octane |
629823 | Octane, 1,1'-oxybis- |
1166299586 | Octane, 1,1'-oxybis- |
124072 | Octanoic acid |
3825261 | Octanoic acid, 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro-, ammonium salt (1:1) |
77751769 | Octanoic acid, 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro-, ammonium salt (1:1) |
95328997 | Octanoic acid, 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro-, ammonium salt (1:1) |
1689992 | Octanoic acid, 2,6-dibromo-4-cyanophenyl ester |
33964248 | Octanoic acid, 2,6-dibromo-4-cyanophenyl ester |
86702809 | Octanoic acid, 2,6-dibromo-4-cyanophenyl ester |
68916392 | Oils, Hamamelis virginiana |
8001283 | Oils, croton |
8024371 | Oils, curcuma |
1317711 | Olivine-group minerals |
7440042 | Osmium |
7446131 | Osmium oxide (OsO4), (T-4)- |
12060194 | Osmium oxide (OsO4), (T-4)- |
20816120 | Osmium oxide (OsO4), (T-4)- |
15766504 | Osmium, isotope of mass 185 |
14119245 | Osmium, isotope of mass 191 |
16057775 | Osmium, isotope of mass 193 |
503300 | Oxetane |
75218 | Oxirane |
19034083 | Oxirane |
37341052 | Oxirane |
99932759 | Oxirane |
142175324 | Oxirane |
184288322 | Oxirane |
436859788 | Oxirane |
2186245 | Oxirane, ((4-methylphenoxy)methyl)- |
26447143 | Oxirane, ((4-methylphenoxy)methyl)- |
5926909 | Oxirane, ((hexyloxy)methyl)- |
503093 | Oxirane, (fluoromethyl)- |
3083236 | Oxirane, (trichloromethyl)- |
1675543 | Oxirane, 2,2'-[(1-methylethylidene)bis(4,1-phenyleneoxymethylene)]bis- |
47424124 | Oxirane, 2,2'-[(1-methylethylidene)bis(4,1-phenyleneoxymethylene)]bis- |
64339511 | Oxirane, 2,2'-[(1-methylethylidene)bis(4,1-phenyleneoxymethylene)]bis- |
85101004 | Oxirane, 2,2'-[(1-methylethylidene)bis(4,1-phenyleneoxymethylene)]bis- |
116161207 | Oxirane, 2,2'-[(1-methylethylidene)bis(4,1-phenyleneoxymethylene)]bis- |
170962546 | Oxirane, 2,2'-[(1-methylethylidene)bis(4,1-phenyleneoxymethylene)]bis- |
220756605 | Oxirane, 2,2'-[(1-methylethylidene)bis(4,1-phenyleneoxymethylene)]bis- |
1018476179 | Oxirane, 2,2'-[(1-methylethylidene)bis(4,1-phenyleneoxymethylene)]bis- |
1226906553 | Oxirane, 2,2'-[(1-methylethylidene)bis(4,1-phenyleneoxymethylene)]bis- |
1253646320 | Oxirane, 2,2'-[(1-methylethylidene)bis(4,1-phenyleneoxymethylene)]bis- |
1416960741 | Oxirane, 2,2'-[(1-methylethylidene)bis(4,1-phenyleneoxymethylene)]bis- |
17557232 | Oxirane, 2,2'-[(2,2-dimethyl-1,3-propanediyl)bis(oxymethylene)]bis- |
101906 | Oxirane, 2,2'-[1,3-phenylenebis(oxymethylene)]bis- |
168331520 | Oxirane, 2,2'-[1,3-phenylenebis(oxymethylene)]bis- |
2425798 | Oxirane, 2,2'-[1,4-butanediylbis(oxymethylene)]bis- |
54350593 | Oxirane, 2,2'-[1,4-butanediylbis(oxymethylene)]bis- |
162786245 | Oxirane, 2,2'-[1,4-butanediylbis(oxymethylene)]bis- |
39817099 | Oxirane, 2,2'-[methylenebis(phenyleneoxymethylene)]bis- |
87110767 | Oxirane, 2,2'-[methylenebis(phenyleneoxymethylene)]bis- |
2238075 | Oxirane, 2,2'-[oxybis(methylene)]bis- |
186354950 | Oxirane, 2,2'-[oxybis(methylene)]bis- |
5076200 | Oxirane, 2,2,3,3-tetramethyl- |
428591 | Oxirane, 2,2,3-trifluoro-3-(trifluoromethyl)- |
75579383 | Oxirane, 2,2,3-trifluoro-3-(trifluoromethyl)- |
3583479 | Oxirane, 2,3-bis(chloromethyl)- |
3266237 | Oxirane, 2,3-dimethyl- |
3083258 | Oxirane, 2-(2,2,2-trichloroethyl)- |
3132647 | Oxirane, 2-(bromomethyl)- |
31324637 | Oxirane, 2-(bromomethyl)- |
82584734 | Oxirane, 2-(bromomethyl)- |
2426086 | Oxirane, 2-(butoxymethyl)- |
85858602 | Oxirane, 2-(butoxymethyl)- |
144376830 | Oxirane, 2-(butoxymethyl)- |
921213378 | Oxirane, 2-(butoxymethyl)- |
106898 | Oxirane, 2-(chloromethyl)- |
9009125 | Oxirane, 2-(chloromethyl)- |
13403377 | Oxirane, 2-(chloromethyl)- |
36250814 | Oxirane, 2-(chloromethyl)- |
109351748 | Oxirane, 2-(chloromethyl)- |
930370 | Oxirane, 2-(methoxymethyl)- |
126872182 | Oxirane, 2-(methoxymethyl)- |
122601 | Oxirane, 2-(phenoxymethyl)- |
66527933 | Oxirane, 2-(phenoxymethyl)- |
7665727 | Oxirane, 2-[(1,1-dimethylethoxy)methyl]- |
126753057 | Oxirane, 2-[(1,1-dimethylethoxy)methyl]- |
4016142 | Oxirane, 2-[(1-methylethoxy)methyl]- |
126753035 | Oxirane, 2-[(1-methylethoxy)methyl]- |
2210799 | Oxirane, 2-[(2-methylphenoxy)methyl]- |
80076455 | Oxirane, 2-[(2-methylphenoxy)methyl]- |
106293 | Oxirane, 2-[(2-propen-1-yloxy)methyl]- |
106923 | Oxirane, 2-[(2-propen-1-yloxy)methyl]- |
90907930 | Oxirane, 2-[(2-propen-1-yloxy)methyl]- |
112186068 | Oxirane, 2-[(2-propen-1-yloxy)methyl]- |
2461189 | Oxirane, 2-[(dodecyloxy)methyl]- |
60616935 | Oxirane, 2-[(dodecyloxy)methyl]- |
136959085 | Oxirane, 2-[(dodecyloxy)methyl]- |
2461156 | Oxirane, 2-[[(2-ethylhexyl)oxy]methyl]- |
98913532 | Oxirane, 2-[[(2-ethylhexyl)oxy]methyl]- |
102640368 | Oxirane, 2-[[(2-ethylhexyl)oxy]methyl]- |
145928912 | Oxirane, 2-[[(2-ethylhexyl)oxy]methyl]- |
388080793 | Oxirane, 2-[[(2-ethylhexyl)oxy]methyl]- |
845755342 | Oxirane, 2-[[(2-ethylhexyl)oxy]methyl]- |
3101608 | Oxirane, 2-[[4-(1,1-dimethylethyl)phenoxy]methyl]- |
71281679 | Oxirane, 2-[[4-(1,1-dimethylethyl)phenoxy]methyl]- |
99938815 | Oxirane, 2-[[4-(1,1-dimethylethyl)phenoxy]methyl]- |
124632413 | Oxirane, 2-[[4-(1,1-dimethylethyl)phenoxy]methyl]- |
128994014 | Oxirane, 2-[[4-(1,1-dimethylethyl)phenoxy]methyl]- |
260047367 | Oxirane, 2-[[4-(1,1-dimethylethyl)phenoxy]methyl]- |
877129425 | Oxirane, 2-[[4-(1,1-dimethylethyl)phenoxy]methyl]- |
61578049 | Oxirane, 2-[[4-(1-methyl-1-phenylethyl)phenoxy]methyl]- |
2855198 | Oxirane, 2-decyl- |
128900210 | Oxirane, 2-decyl- |
3234284 | Oxirane, 2-dodecyl- |
130321674 | Oxirane, 2-dodecyl- |
930223 | Oxirane, 2-ethenyl- |
22910583 | Oxirane, 2-ethenyl- |
88416313 | Oxirane, 2-ethenyl- |
106887 | Oxirane, 2-ethyl- |
26249207 | Oxirane, 2-ethyl- |
55555969 | Oxirane, 2-ethyl- |
7390810 | Oxirane, 2-hexadecyl- |
165323660 | Oxirane, 2-hexadecyl- |
75569 | Oxirane, 2-methyl- |
16033719 | Oxirane, 2-methyl- |
2404446 | Oxirane, 2-octyl- |
67210451 | Oxirane, 2-octyl- |
71077708 | Oxirane, 2-octyl- |
96093 | Oxirane, 2-phenyl- |
62497636 | Oxirane, 2-phenyl- |
67253490 | Oxirane, 2-phenyl- |
7320378 | Oxirane, 2-tetradecyl- |
151284105 | Oxirane, 2-tetradecyl- |
765344 | Oxiranecarboxaldehyde |
103729459 | Oxiranecarboxaldehyde |
2443392 | Oxiraneoctanoic acid, 3-octyl- |
52275146 | Oxiraneoctanoic acid, 3-octyl- |
54075762 | Oxonium, trimethyl-, (OC-6-11)-hexachloroantimonate(1-) (1:1) |
1338938 | Oxygen |
7782447 | Oxygen |
14797707 | Oxygen |
80217987 | Oxygen |
80937333 | Oxygen |
1053656931 | Oxygen |
1173018524 | Oxygen |
7783417 | Oxygen fluoride (OF2) |
10028156 | Ozone |
74087868 | Ozone |
412908408 | Ozone |
728855478 | Ozone |
855426801 | Ozone |
11104293 | PCB 1242 |
53449219 | PCB 1242 |
53469219 | PCB 1242 |
12672296 | PCB 1248 |
262371357 | PCB 1248 |
11097691 | PCB 1254 |
11096825 | PCB 1260 |
11196825 | PCB 1260 |
7440053 | Palladium |
7647101 | Palladium chloride (PdCl2) |
14967681 | Palladium, isotope of mass 103 |
17637999 | Palladium, isotope of mass 107 |
1337764 | Palygorskite ([Mg(Al0.5-1Fe0-0.5)]Si4(OH)O10.4H2O) |
12174117 | Palygorskite ([Mg(Al0.5-1Fe0-0.5)]Si4(OH)O10.4H2O) |
12174286 | Palygorskite ([Mg(Al0.5-1Fe0-0.5)]Si4(OH)O10.4H2O) |
37189507 | Palygorskite ([Mg(Al0.5-1Fe0-0.5)]Si4(OH)O10.4H2O) |
61180550 | Palygorskite ([Mg(Al0.5-1Fe0-0.5)]Si4(OH)O10.4H2O) |
64418162 | Palygorskite ([Mg(Al0.5-1Fe0-0.5)]Si4(OH)O10.4H2O) |
71396548 | Palygorskite ([Mg(Al0.5-1Fe0-0.5)]Si4(OH)O10.4H2O) |
137546919 | Palygorskite ([Mg(Al0.5-1Fe0-0.5)]Si4(OH)O10.4H2O) |
8012951 | Paraffin oil |
8015596 | Paraffin oil |
8033894 | Paraffin oil |
8038048 | Paraffin oil |
8039143 | Paraffin oil |
8039756 | Paraffin oil |
8043785 | Paraffin oil |
37231699 | Paraffin oil |
37232056 | Paraffin oil |
37232067 | Paraffin oil |
37232078 | Paraffin oil |
39290238 | Paraffin oil |
39296258 | Paraffin oil |
39355083 | Paraffin oil |
39355094 | Paraffin oil |
39355356 | Paraffin oil |
39464772 | Paraffin oil |
39464783 | Paraffin oil |
50935858 | Paraffin oil |
50935950 | Paraffin oil |
51004581 | Paraffin oil |
51109967 | Paraffin oil |
52012278 | Paraffin oil |
52012289 | Paraffin oil |
53028743 | Paraffin oil |
58391381 | Paraffin oil |
58615808 | Paraffin oil |
60327802 | Paraffin oil |
74870909 | Paraffin oil |
79956368 | Paraffin oil |
83046053 | Paraffin oil |
97048209 | Paraffin oil |
99551141 | Paraffin oil |
102819987 | Paraffin oil |
106803310 | Paraffin oil |
115251268 | Paraffin oil |
116357369 | Paraffin oil |
122176992 | Paraffin oil |
124448528 | Paraffin oil |
146908772 | Paraffin oil |
172307107 | Paraffin oil |
187112192 | Paraffin oil |
188832179 | Paraffin oil |
219686290 | Paraffin oil |
261380103 | Paraffin oil |
331464541 | Paraffin oil |
8002742 | Paraffin waxes and Hydrocarbon waxes |
8035629 | Paraffin waxes and Hydrocarbon waxes |
8044028 | Paraffin waxes and Hydrocarbon waxes |
8044799 | Paraffin waxes and Hydrocarbon waxes |
9083414 | Paraffin waxes and Hydrocarbon waxes |
12704915 | Paraffin waxes and Hydrocarbon waxes |
12704926 | Paraffin waxes and Hydrocarbon waxes |
12795754 | Paraffin waxes and Hydrocarbon waxes |
37220238 | Paraffin waxes and Hydrocarbon waxes |
37339803 | Paraffin waxes and Hydrocarbon waxes |
39355221 | Paraffin waxes and Hydrocarbon waxes |
39373789 | Paraffin waxes and Hydrocarbon waxes |
51331352 | Paraffin waxes and Hydrocarbon waxes |
54692421 | Paraffin waxes and Hydrocarbon waxes |
57572437 | Paraffin waxes and Hydrocarbon waxes |
57608841 | Paraffin waxes and Hydrocarbon waxes |
58057117 | Paraffin waxes and Hydrocarbon waxes |
68607089 | Paraffin waxes and Hydrocarbon waxes |
68649503 | Paraffin waxes and Hydrocarbon waxes |
70431264 | Paraffin waxes and Hydrocarbon waxes |
72993885 | Paraffin waxes and Hydrocarbon waxes |
72993896 | Paraffin waxes and Hydrocarbon waxes |
72993909 | Paraffin waxes and Hydrocarbon waxes |
105054931 | Paraffin waxes and Hydrocarbon waxes |
105845087 | Paraffin waxes and Hydrocarbon waxes |
115251235 | Paraffin waxes and Hydrocarbon waxes |
115251246 | Paraffin waxes and Hydrocarbon waxes |
160936345 | Paraffin waxes and Hydrocarbon waxes |
401516345 | Paraffin waxes and Hydrocarbon waxes |
8029398 | Paraffin waxes and Hydrocarbon waxes, chloro |
11098332 | Paraffin waxes and Hydrocarbon waxes, chloro |
37187409 | Paraffin waxes and Hydrocarbon waxes, chloro |
39279657 | Paraffin waxes and Hydrocarbon waxes, chloro |
39406092 | Paraffin waxes and Hydrocarbon waxes, chloro |
39444365 | Paraffin waxes and Hydrocarbon waxes, chloro |
50646907 | Paraffin waxes and Hydrocarbon waxes, chloro |
51990126 | Paraffin waxes and Hydrocarbon waxes, chloro |
52276525 | Paraffin waxes and Hydrocarbon waxes, chloro |
52555472 | Paraffin waxes and Hydrocarbon waxes, chloro |
52622669 | Paraffin waxes and Hydrocarbon waxes, chloro |
52677733 | Paraffin waxes and Hydrocarbon waxes, chloro |
52677744 | Paraffin waxes and Hydrocarbon waxes, chloro |
52677755 | Paraffin waxes and Hydrocarbon waxes, chloro |
53028594 | Paraffin waxes and Hydrocarbon waxes, chloro |
53028607 | Paraffin waxes and Hydrocarbon waxes, chloro |
53200354 | Paraffin waxes and Hydrocarbon waxes, chloro |
54577718 | Paraffin waxes and Hydrocarbon waxes, chloro |
55353509 | Paraffin waxes and Hydrocarbon waxes, chloro |
56509649 | Paraffin waxes and Hydrocarbon waxes, chloro |
56730951 | Paraffin waxes and Hydrocarbon waxes, chloro |
58516522 | Paraffin waxes and Hydrocarbon waxes, chloro |
60202644 | Paraffin waxes and Hydrocarbon waxes, chloro |
63449398 | Paraffin waxes and Hydrocarbon waxes, chloro |
66746358 | Paraffin waxes and Hydrocarbon waxes, chloro |
108171262 | Paraffin waxes and Hydrocarbon waxes, chloro |
108171273 | Paraffin waxes and Hydrocarbon waxes, chloro |
108688637 | Paraffin waxes and Hydrocarbon waxes, chloro |
1303975 | Pentaborane(9) |
19624227 | Pentaborane(9) |
24378367 | Pentaborane(9) |
24378378 | Pentaborane(9) |
24378389 | Pentaborane(9) |
52712659 | Pentaborane(9) |
64442815 | Pentaborane(9) |
71129914 | Pentaborane(9) |
629992 | Pentacosane |
629629 | Pentadecane |
110623 | Pentanal |
109660 | Pentane |
8031354 | Pentane |
111240 | Pentane, 1,5-dibromo- |
540841 | Pentane, 2,2,4-trimethyl- |
31921365 | Pentane, 2,2,4-trimethyl- |
565753 | Pentane, 2,3,4-trimethyl- |
565593 | Pentane, 2,3-dimethyl- |
108087 | Pentane, 2,4-dimethyl- |
625296 | Pentane, 2-chloro- |
125591313 | Pentane, 2-chloro- |
107835 | Pentane, 2-methyl- |
96140 | Pentane, 3-methyl- |
760214 | Pentane, 3-methylene- |
111308 | Pentanedial |
37245617 | Pentanedial |
79215579 | Pentanedial |
107950890 | Pentanedial |
1428979547 | Pentanedial |
35691657 | Pentanedinitrile, 2-bromo-2-(bromomethyl)- |
4553622 | Pentanedinitrile, 2-methyl- |
110598 | Pentanenitrile |
109524 | Pentanoic acid |
12124877 | Pentanoic acid |
14797730 | Perchlorate |
60349260 | Perchlorate |
181259574 | Perchlorate |
7616946 | Perchloryl fluoride ((ClO3)F) |
13862607 | Perchloryl fluoride ((ClO3)F) |
7722647 | Permanganic acid (HMnO4), potassium salt (1:1) |
13987014 | Permanganic acid (HMnO4), potassium salt (1:1) |
146104974 | Permanganic acid (HMnO4), potassium salt (1:1) |
23414724 | Permanganic acid (HMnO4), zinc salt |
78637 | Peroxide, 1,1'-(1,1,4,4-tetramethyl-1,4-butanediyl)bis[2-(1,1-dimethylethyl) |
64366729 | Peroxide, 1,1'-(1,1,4,4-tetramethyl-1,4-butanediyl)bis[2-(1,1-dimethylethyl) |
80237872 | Peroxide, 1,1'-(1,1,4,4-tetramethyl-1,4-butanediyl)bis[2-(1,1-dimethylethyl) |
105521593 | Peroxide, 1,1'-(1,1,4,4-tetramethyl-1,4-butanediyl)bis[2-(1,1-dimethylethyl) |
109603454 | Peroxide, 1,1'-(1,1,4,4-tetramethyl-1,4-butanediyl)bis[2-(1,1-dimethylethyl) |
118093188 | Peroxide, 1,1'-(1,1,4,4-tetramethyl-1,4-butanediyl)bis[2-(1,1-dimethylethyl) |
138427608 | Peroxide, 1,1'-(1,1,4,4-tetramethyl-1,4-butanediyl)bis[2-(1,1-dimethylethyl) |
139352388 | Peroxide, 1,1'-(1,1,4,4-tetramethyl-1,4-butanediyl)bis[2-(1,1-dimethylethyl) |
143637290 | Peroxide, 1,1'-(1,1,4,4-tetramethyl-1,4-butanediyl)bis[2-(1,1-dimethylethyl) |
158049628 | Peroxide, 1,1'-(1,1,4,4-tetramethyl-1,4-butanediyl)bis[2-(1,1-dimethylethyl) |
180513580 | Peroxide, 1,1'-(1,1,4,4-tetramethyl-1,4-butanediyl)bis[2-(1,1-dimethylethyl) |
184247210 | Peroxide, 1,1'-(1,1,4,4-tetramethyl-1,4-butanediyl)bis[2-(1,1-dimethylethyl) |
186467254 | Peroxide, 1,1'-(1,1,4,4-tetramethyl-1,4-butanediyl)bis[2-(1,1-dimethylethyl) |
860310583 | Peroxide, 1,1'-(1,1,4,4-tetramethyl-1,4-butanediyl)bis[2-(1,1-dimethylethyl) |
25155253 | Peroxide, 1,1'-[1,3(or 1,4)-phenylenebis(1-methylethylidene)]bis[2-(1,1-dimethylethyl) |
33296616 | Peroxide, 1,1'-[1,3(or 1,4)-phenylenebis(1-methylethylidene)]bis[2-(1,1-dimethylethyl) |
38783196 | Peroxide, 1,1'-[1,3(or 1,4)-phenylenebis(1-methylethylidene)]bis[2-(1,1-dimethylethyl) |
53801368 | Peroxide, 1,1'-[1,3(or 1,4)-phenylenebis(1-methylethylidene)]bis[2-(1,1-dimethylethyl) |
95974939 | Peroxide, 1,1'-[1,3(or 1,4)-phenylenebis(1-methylethylidene)]bis[2-(1,1-dimethylethyl) |
121535486 | Peroxide, 1,1'-[1,3(or 1,4)-phenylenebis(1-methylethylidene)]bis[2-(1,1-dimethylethyl) |
123203758 | Peroxide, 1,1'-[1,3(or 1,4)-phenylenebis(1-methylethylidene)]bis[2-(1,1-dimethylethyl) |
153859508 | Peroxide, 1,1'-[1,3(or 1,4)-phenylenebis(1-methylethylidene)]bis[2-(1,1-dimethylethyl) |
166090886 | Peroxide, 1,1'-[1,3(or 1,4)-phenylenebis(1-methylethylidene)]bis[2-(1,1-dimethylethyl) |
868236231 | Peroxide, 1,1'-[1,3(or 1,4)-phenylenebis(1-methylethylidene)]bis[2-(1,1-dimethylethyl) |
2278220 | Peroxide, acetyl nitro |
325458411 | Peroxide, acetyl nitro |
32368697 | Peroxide, benzoyl nitro |
110054 | Peroxide, bis(1,1-dimethylethyl) |
62534718 | Peroxide, bis(1,1-dimethylethyl) |
80433 | Peroxide, bis(1-methyl-1-phenylethyl) |
82322574 | Peroxide, bis(1-methyl-1-phenylethyl) |
88161120 | Peroxide, bis(1-methyl-1-phenylethyl) |
188070599 | Peroxide, bis(1-methyl-1-phenylethyl) |
209969799 | Peroxide, bis(1-methyl-1-phenylethyl) |
246180994 | Peroxide, bis(1-methyl-1-phenylethyl) |
478016943 | Peroxide, bis(1-methyl-1-phenylethyl) |
945614062 | Peroxide, bis(1-methyl-1-phenylethyl) |
94360 | Peroxide, dibenzoyl |
106934 | Peroxide, dibenzoyl |
37370299 | Peroxide, dibenzoyl |
117989716 | Peroxide, dibenzoyl |
132323445 | Peroxide, dibenzoyl |
143928589 | Peroxide, dibenzoyl |
7727540 | Peroxydisulfuric acid ([(HO)S(O)2]2O2), ammonium salt (1:2) |
7727541 | Peroxydisulfuric acid ([(HO)S(O)2]2O2), ammonium salt (1:2) |
398469959 | Peroxydisulfuric acid ([(HO)S(O)2]2O2), ammonium salt (1:2) |
7727211 | Peroxydisulfuric acid ([(HO)S(O)2]2O2), potassium salt (1:2) |
106015105 | Peroxydisulfuric acid ([(HO)S(O)2]2O2), potassium salt (1:2) |
1001387467 | Peroxydisulfuric acid ([(HO)S(O)2]2O2), potassium salt (1:2) |
7775271 | Peroxydisulfuric acid ([(HO)S(O)2]2O2), sodium salt (1:2) |
872981992 | Peroxydisulfuric acid ([(HO)S(O)2]2O2), sodium salt (1:2) |
8002059 | Petroleum |
61789955 | Petroleum |
8002059 | Petroleum distillates |
8030306 | Petroleum spirits |
8032324 | Petroleum spirits |
63394003 | Petroleum spirits |
64475850 | Petroleum spirits |
7329502 | Phen-2,4,6-d3-ol |
4165622 | Phen-d5-ol |
85018 | Phenanthrene |
483658 | Phenanthrene, 1-methyl-7-(1-methylethyl)- |
2531842 | Phenanthrene, 2-methyl- |
1517222 | Phenanthrene-d10 |
229878 | Phenanthridine |
71523 | Phenol |
108952 | Phenol |
8002071 | Phenol |
14534237 | Phenol |
50356257 | Phenol |
28777700 | Phenol, (1,1-dimethylethyl)-, phosphate |
1336318 | Phenol, (1,1-dimethylethyl)-4-methoxy- |
8003245 | Phenol, (1,1-dimethylethyl)-4-methoxy- |
8041814 | Phenol, (1,1-dimethylethyl)-4-methoxy- |
9009681 | Phenol, (1,1-dimethylethyl)-4-methoxy- |
25013165 | Phenol, (1,1-dimethylethyl)-4-methoxy- |
37349772 | Phenol, (1,1-dimethylethyl)-4-methoxy- |
56587667 | Phenol, (1,1-dimethylethyl)-4-methoxy- |
57534288 | Phenol, (1,1-dimethylethyl)-4-methoxy- |
26967760 | Phenol, (1-methylethyl)-, phosphate (3:1) |
70304 | Phenol, 2,2'-methylenebis[3,4,6-trichloro- |
8054986 | Phenol, 2,2'-methylenebis[3,4,6-trichloro- |
139411964 | Phenol, 2,2'-methylenebis[3,4,6-trichloro- |
1195388852 | Phenol, 2,2'-methylenebis[3,4,6-trichloro- |
97234 | Phenol, 2,2'-methylenebis[4-chloro- |
8017865 | Phenol, 2,2'-methylenebis[4-chloro- |
1135443661 | Phenol, 2,2'-methylenebis[4-chloro- |
97187 | Phenol, 2,2'-thiobis[4,6-dichloro- |
3294039 | Phenol, 2,2'-thiobis[4-(1,1,3,3-tetramethylbutyl)- |
33397238 | Phenol, 2,2'-thiobis[4-(1,1,3,3-tetramethylbutyl)- |
93487184 | Phenol, 2,2'-thiobis[4-(1,1,3,3-tetramethylbutyl)- |
97245 | Phenol, 2,2'-thiobis[4-chloro- |
74082965 | Phenol, 2,2'-thiobis[4-chloro- |
90664 | Phenol, 2,2'-thiobis[6-(1,1-dimethylethyl)-4-methyl- |
42612577 | Phenol, 2,2'-thiobis[6-(1,1-dimethylethyl)-4-methyl- |
209534214 | Phenol, 2,2'-thiobis[6-(1,1-dimethylethyl)-4-methyl- |
905570425 | Phenol, 2,2'-thiobis[6-(1,1-dimethylethyl)-4-methyl- |
608719 | Phenol, 2,3,4,5,6-pentabromo- |
87865 | Phenol, 2,3,4,5,6-pentachloro- |
39390777 | Phenol, 2,3,4,5,6-pentachloro- |
101802544 | Phenol, 2,3,4,5,6-pentachloro- |
1135443672 | Phenol, 2,3,4,5,6-pentachloro- |
131522 | Phenol, 2,3,4,5,6-pentachloro-, sodium salt (1:1) |
4901513 | Phenol, 2,3,4,5-tetrachloro- |
2539175 | Phenol, 2,3,4,5-tetrachloro-6-methoxy- |
58902 | Phenol, 2,3,4,6-tetrachloro- |
12698643 | Phenol, 2,3,4,6-tetrachloro- |
15950660 | Phenol, 2,3,4-trichloro- |
2668248 | Phenol, 2,3,4-trichloro-6-methoxy- |
12407862 | Phenol, 2,3,5(or 3,4,5)-trimethyl-, methylcarbamate |
37301454 | Phenol, 2,3,5(or 3,4,5)-trimethyl-, methylcarbamate |
58784137 | Phenol, 2,3,5(or 3,4,5)-trimethyl-, methylcarbamate |
935955 | Phenol, 2,3,5,6-tetrachloro- |
933788 | Phenol, 2,3,5-trichloro- |
2655154 | Phenol, 2,3,5-trimethyl-, methylcarbamate |
2686999 | Phenol, 2,3,5-trimethyl-, methylcarbamate |
933755 | Phenol, 2,3,6-trichloro- |
576249 | Phenol, 2,3-dichloro- |
526750 | Phenol, 2,3-dimethyl- |
95954 | Phenol, 2,4,5-trichloro- |
25167822 | Phenol, 2,4,5-trichloro- |
77001457 | Phenol, 2,4,5-trichloro- |
118796 | Phenol, 2,4,6-tribromo- |
88062 | Phenol, 2,4,6-trichloro- |
88891 | Phenol, 2,4,6-trinitro- |
29663114 | Phenol, 2,4,6-trinitro- |
189195399 | Phenol, 2,4,6-trinitro- |
190402109 | Phenol, 2,4,6-trinitro- |
856615639 | Phenol, 2,4,6-trinitro- |
856993130 | Phenol, 2,4,6-trinitro- |
857370424 | Phenol, 2,4,6-trinitro- |
131748 | Phenol, 2,4,6-trinitro-, ammonium salt (1:1) |
4041412 | Phenol, 2,4,6-trinitro-, ammonium salt (1:1) |
74893780 | Phenol, 2,4,6-trinitro-, ammonium salt (1:1) |
101671903 | Phenol, 2,4,6-trinitro-, ammonium salt (1:1) |
340127824 | Phenol, 2,4,6-trinitro-, ammonium salt (1:1) |
405108603 | Phenol, 2,4,6-trinitro-, ammonium salt (1:1) |
120956 | Phenol, 2,4-bis(1,1-dimethylpropyl)- |
137097 | Phenol, 2,4-diamino-, hydrochloride (1:2) |
64768349 | Phenol, 2,4-diamino-, hydrochloride (1:2) |
120832 | Phenol, 2,4-dichloro- |
105679 | Phenol, 2,4-dimethyl- |
130071 | Phenol, 2,4-dimethyl- |
51285 | Phenol, 2,4-dinitro- |
117271 | Phenol, 2,4-dinitro- |
583788 | Phenol, 2,5-dichloro- |
95874 | Phenol, 2,5-dimethyl- |
50356122 | Phenol, 2,5-dimethyl- |
145929313 | Phenol, 2,5-dimethyl- |
128370 | Phenol, 2,6-bis(1,1-dimethylethyl)-4-methyl- |
36631284 | Phenol, 2,6-bis(1,1-dimethylethyl)-4-methyl- |
42615305 | Phenol, 2,6-bis(1,1-dimethylethyl)-4-methyl- |
50356199 | Phenol, 2,6-bis(1,1-dimethylethyl)-4-methyl- |
50641991 | Phenol, 2,6-bis(1,1-dimethylethyl)-4-methyl- |
52683462 | Phenol, 2,6-bis(1,1-dimethylethyl)-4-methyl- |
53571703 | Phenol, 2,6-bis(1,1-dimethylethyl)-4-methyl- |
58500826 | Phenol, 2,6-bis(1,1-dimethylethyl)-4-methyl- |
83047169 | Phenol, 2,6-bis(1,1-dimethylethyl)-4-methyl- |
97123416 | Phenol, 2,6-bis(1,1-dimethylethyl)-4-methyl- |
102962458 | Phenol, 2,6-bis(1,1-dimethylethyl)-4-methyl- |
259752539 | Phenol, 2,6-bis(1,1-dimethylethyl)-4-methyl- |
290348231 | Phenol, 2,6-bis(1,1-dimethylethyl)-4-methyl- |
87650 | Phenol, 2,6-dichloro- |
305851 | Phenol, 2,6-diiodo-4-nitro- |
8026935 | Phenol, 2,6-diiodo-4-nitro- |
576261 | Phenol, 2,6-dimethyl- |
28449969 | Phenol, 2,6-dimethyl- |
50356224 | Phenol, 2,6-dimethyl- |
1363408621 | Phenol, 2,6-dimethyl- |
1420071 | Phenol, 2-(1,1-dimethylethyl)-4,6-dinitro- |
114261 | Phenol, 2-(1-methylethoxy)-, methylcarbamate |
3687227 | Phenol, 2-(1-methylheptyl)-4,6-dinitro- |
89725 | Phenol, 2-(1-methylpropyl)- |
28449958 | Phenol, 2-(1-methylpropyl)- |
96346155 | Phenol, 2-(1-methylpropyl)- |
88857 | Phenol, 2-(1-methylpropyl)-4,6-dinitro- |
2813958 | Phenol, 2-(1-methylpropyl)-4,6-dinitro- |
39403800 | Phenol, 2-(1-methylpropyl)-4,6-dinitro- |
152212209 | Phenol, 2-(1-methylpropyl)-4,6-dinitro- |
444304 | Phenol, 2-(trifluoromethyl)- |
6358232 | Phenol, 2-[(2,4-dinitrophenyl)amino]- |
4790710 | Phenol, 2-[(2-methyl-2-propen-1-yl)oxy]- |
52551674 | Phenol, 2-[bis(2-hydroxyethyl)amino]-5-nitro- |
95556 | Phenol, 2-amino- |
51194 | Phenol, 2-amino-, hydrochloride |
67845798 | Phenol, 2-amino-, sulfate (2:1) |
6358152 | Phenol, 2-amino-3,4,6-trichloro- |
527628 | Phenol, 2-amino-4,6-dichloro- |
96913 | Phenol, 2-amino-4,6-dinitro- |
98306 | Phenol, 2-amino-4-(methylsulfonyl)- |
95852 | Phenol, 2-amino-4-chloro- |
6358072 | Phenol, 2-amino-4-chloro-5-nitro- |
6358083 | Phenol, 2-amino-4-chloro-6-nitro- |
95841 | Phenol, 2-amino-4-methyl- |
99570 | Phenol, 2-amino-4-nitro- |
121880 | Phenol, 2-amino-5-nitro- |
95578 | Phenol, 2-chloro- |
5323659 | Phenol, 2-chloro-4-(1,1-dimethylpropyl)- |
131895 | Phenol, 2-cyclohexyl-4,6-dinitro- |
367124 | Phenol, 2-fluoro- |
811801340 | Phenol, 2-fluoro- |
90051 | Phenol, 2-methoxy- |
97541 | Phenol, 2-methoxy-4-(1-propen-1-yl)- |
97530 | Phenol, 2-methoxy-4-(2-propen-1-yl)- |
95487 | Phenol, 2-methyl- |
534521 | Phenol, 2-methyl-4,6-dinitro- |
8068733 | Phenol, 2-methyl-4,6-dinitro- |
8071510 | Phenol, 2-methyl-4,6-dinitro- |
37359436 | Phenol, 2-methyl-4,6-dinitro- |
53240952 | Phenol, 2-methyl-4,6-dinitro- |
534521 | Phenol, 2-methyl-4,6-dinitro- and salts |
1335859 | Phenol, 2-methyl-4,6-dinitro- and salts |
88755 | Phenol, 2-nitro- |
136834 | Phenol, 2-nonyl- |
609198 | Phenol, 3,4,5-trichloro- |
2539266 | Phenol, 3,4,5-trichloro-2,6-dimethoxy- |
57057837 | Phenol, 3,4,5-trichloro-2-methoxy- |
60712449 | Phenol, 3,4,6-trichloro-2-methoxy- |
82622 | Phenol, 3,4,6-trichloro-2-nitro- |
95772 | Phenol, 3,4-dichloro- |
95658 | Phenol, 3,4-dimethyl- |
591355 | Phenol, 3,5-dichloro- |
7379513 | Phenol, 3,5-dimethyl-4-(methylthio)- |
203657 | Phenol, 3,5-dimethyl-4-(methylthio)-, methylcarbamate |
716165 | Phenol, 3,5-dimethyl-4-(methylthio)-, methylcarbamate |
2032657 | Phenol, 3,5-dimethyl-4-(methylthio)-, methylcarbamate |
64006 | Phenol, 3-(1-methylethyl)-, methylcarbamate |
91689 | Phenol, 3-(diethylamino)- |
99070 | Phenol, 3-(dimethylamino)- |
119313 | Phenol, 3-(dimethylamino)-4-methyl- |
621318 | Phenol, 3-(ethylamino)- |
120376 | Phenol, 3-(ethylamino)-4-methyl- |
101188 | Phenol, 3-(phenylamino)- |
591275 | Phenol, 3-amino- |
2836002 | Phenol, 3-amino-4-methyl- |
108430 | Phenol, 3-chloro- |
108394 | Phenol, 3-methyl- |
3120749 | Phenol, 3-methyl-4-(methylthio)- |
2581342 | Phenol, 3-methyl-4-nitro- |
2631370 | Phenol, 3-methyl-5-(1-methylethyl)-, methylcarbamate |
4111891 | Phenol, 3-methyl-5-(1-methylethyl)-, methylcarbamate |
31677562 | Phenol, 3-methyl-5-(1-methylethyl)-, methylcarbamate |
554847 | Phenol, 3-nitro- |
84173 | Phenol, 4,4'-(1,2-diethylidene-1,2-ethanediyl)bis- |
39011864 | Phenol, 4,4'-(1-ethyl-2-ethylidene-1,2-ethanediyl)bis- |
80057 | Phenol, 4,4'-(1-methylethylidene)bis- |
27360890 | Phenol, 4,4'-(1-methylethylidene)bis- |
28106823 | Phenol, 4,4'-(1-methylethylidene)bis- |
37808085 | Phenol, 4,4'-(1-methylethylidene)bis- |
137885531 | Phenol, 4,4'-(1-methylethylidene)bis- |
146479756 | Phenol, 4,4'-(1-methylethylidene)bis- |
1429425262 | Phenol, 4,4'-(1-methylethylidene)bis- |
79947 | Phenol, 4,4'-(1-methylethylidene)bis[2,6-dibromo- |
7300234 | Phenol, 4,4'-(1-methylethylidene)bis[2,6-dibromo- |
30496130 | Phenol, 4,4'-(1-methylethylidene)bis[2,6-dibromo- |
51253317 | Phenol, 4,4'-(1-methylethylidene)bis[2,6-dibromo- |
76341269 | Phenol, 4,4'-(1-methylethylidene)bis[2,6-dibromo- |
107719551 | Phenol, 4,4'-(1-methylethylidene)bis[2,6-dibromo- |
108608602 | Phenol, 4,4'-(1-methylethylidene)bis[2,6-dibromo- |
110670650 | Phenol, 4,4'-(1-methylethylidene)bis[2,6-dibromo- |
124779540 | Phenol, 4,4'-(1-methylethylidene)bis[2,6-dibromo- |
131891388 | Phenol, 4,4'-(1-methylethylidene)bis[2,6-dibromo- |
186673392 | Phenol, 4,4'-(1-methylethylidene)bis[2,6-dibromo- |
224951262 | Phenol, 4,4'-(1-methylethylidene)bis[2,6-dibromo- |
56531 | Phenol, 4,4'-[(1E)-1,2-diethyl-1,2-ethenediyl]bis- |
8026457 | Phenol, 4,4'-[(1E)-1,2-diethyl-1,2-ethenediyl]bis- |
8028099 | Phenol, 4,4'-[(1E)-1,2-diethyl-1,2-ethenediyl]bis- |
8030340 | Phenol, 4,4'-[(1E)-1,2-diethyl-1,2-ethenediyl]bis- |
8049421 | Phenol, 4,4'-[(1E)-1,2-diethyl-1,2-ethenediyl]bis- |
8053007 | Phenol, 4,4'-[(1E)-1,2-diethyl-1,2-ethenediyl]bis- |
130803 | Phenol, 4,4'-[(1E)-1,2-diethyl-1,2-ethenediyl]bis-, dipropanoate |
85609 | Phenol, 4,4'-butylidenebis[2-(1,1-dimethylethyl)-5-methyl- |
60318196 | Phenol, 4,4'-butylidenebis[2-(1,1-dimethylethyl)-5-methyl- |
80693103 | Phenol, 4,4'-butylidenebis[2-(1,1-dimethylethyl)-5-methyl- |
87524309 | Phenol, 4,4'-butylidenebis[2-(1,1-dimethylethyl)-5-methyl- |
90651437 | Phenol, 4,4'-butylidenebis[2-(1,1-dimethylethyl)-5-methyl- |
99346891 | Phenol, 4,4'-butylidenebis[2-(1,1-dimethylethyl)-5-methyl- |
111214552 | Phenol, 4,4'-butylidenebis[2-(1,1-dimethylethyl)-5-methyl- |
153569643 | Phenol, 4,4'-butylidenebis[2-(1,1-dimethylethyl)-5-methyl- |
193362537 | Phenol, 4,4'-butylidenebis[2-(1,1-dimethylethyl)-5-methyl- |
210757736 | Phenol, 4,4'-butylidenebis[2-(1,1-dimethylethyl)-5-methyl- |
96695 | Phenol, 4,4'-thiobis[2-(1,1-dimethylethyl)-5-methyl- |
12671704 | Phenol, 4,4'-thiobis[2-(1,1-dimethylethyl)-5-methyl- |
52012530 | Phenol, 4,4'-thiobis[2-(1,1-dimethylethyl)-5-methyl- |
60318323 | Phenol, 4,4'-thiobis[2-(1,1-dimethylethyl)-5-methyl- |
76996606 | Phenol, 4,4'-thiobis[2-(1,1-dimethylethyl)-5-methyl- |
126340601 | Phenol, 4,4'-thiobis[2-(1,1-dimethylethyl)-5-methyl- |
188253476 | Phenol, 4,4'-thiobis[2-(1,1-dimethylethyl)-5-methyl- |
381726029 | Phenol, 4,4'-thiobis[2-(1,1-dimethylethyl)-5-methyl- |
3818540 | Phenol, 4,4'-thiobis[3-(1,1-dimethylethyl)-5-methyl- |
858831682 | Phenol, 4,4'-thiobis[3-(1,1-dimethylethyl)-5-methyl- |
98544 | Phenol, 4-(1,1-dimethylethyl)- |
1334243569 | Phenol, 4-(1,1-dimethylethyl)- |
80466 | Phenol, 4-(1,1-dimethylpropyl)- |
53404185 | Phenol, 4-(1,1-dimethylpropyl)-, potassium salt (1:1) |
93458 | Phenol, 4-(2-naphthalenylamino)- |
31584 | Phenol, 4-(dimethylamino)-3,5-dimethyl-, methylcarbamate (ester) |
315184 | Phenol, 4-(dimethylamino)-3,5-dimethyl-, methylcarbamate (ester) |
39373869 | Phenol, 4-(dimethylamino)-3,5-dimethyl-, methylcarbamate (ester) |
2032599 | Phenol, 4-(dimethylamino)-3-methyl-, methylcarbamate (ester) |
55550 | Phenol, 4-(methylamino)-, sulfate (2:1) |
160976136 | Phenol, 4-(methylamino)-, sulfate (2:1) |
119153 | Phenol, 4-[(2,4-dinitrophenyl)amino]- |
6219892 | Phenol, 4-[(4-amino-3-methylphenyl)amino]- |
123308 | Phenol, 4-amino- |
52985098 | Phenol, 4-amino- |
51785 | Phenol, 4-amino-, hydrochloride (1:1) |
63084980 | Phenol, 4-amino-, sulfate (2:1) |
119346 | Phenol, 4-amino-2-nitro- |
106489 | Phenol, 4-chloro- |
88879 | Phenol, 4-chloro-2,6-dinitro- |
120321 | Phenol, 4-chloro-2-(phenylmethyl)- |
8013498 | Phenol, 4-chloro-2-(phenylmethyl)- |
144246479 | Phenol, 4-chloro-2-(phenylmethyl)- |
35471499 | Phenol, 4-chloro-2-(phenylmethyl)-, potassium salt (1:1) |
6358185 | Phenol, 4-chloro-2-[(2,4-dinitrophenyl)amino]- |
1570645 | Phenol, 4-chloro-2-methyl- |
88040 | Phenol, 4-chloro-3,5-dimethyl- |
59507 | Phenol, 4-chloro-3-methyl- |
35421080 | Phenol, 4-chloro-3-methyl- |
54548504 | Phenol, 4-chloro-3-methyl- |
150765 | Phenol, 4-methoxy- |
106445 | Phenol, 4-methyl- |
41873749 | Phenol, 4-methyl- |
6265130 | Phenol, 4-methyl-3-(methylamino)- |
100027 | Phenol, 4-nitro- |
856824674 | Phenol, 4-nitro- |
856824710 | Phenol, 4-nitro- |
88302 | Phenol, 4-nitro-3-(trifluoromethyl)- |
104916 | Phenol, 4-nitroso- |
104405 | Phenol, 4-nonyl- |
29832119 | Phenol, 4-nonyl- |
84852153 | Phenol, 4-nonyl- |
6265094 | Phenol, 5-(diethylamino)-4-methyl-2-nitroso- |
6265118 | Phenol, 5-(dimethylamino)-4-methyl-2-nitroso- |
2835952 | Phenol, 5-amino-2-methyl- |
1336352 | Phenol, chloro derivs. |
1320816 | Phenol, chloro- |
25167800 | Phenol, chloro- |
25167811 | Phenol, dichloro- |
1300716 | Phenol, dimethyl- |
144700027 | Phenol, dimethyl- |
25155231 | Phenol, dimethyl-, 1,1',1''-phosphate |
95660610 | Phenol, dimethyl-, 1,1',1''-phosphate |
174956833 | Phenol, dimethyl-, 1,1',1''-phosphate |
68937406 | Phenol, isobutylenated, phosphate (3:1) |
68937417 | Phenol, isopropylated, phosphate (3:1) |
299865 | Phenol, methyl- |
1319773 | Phenol, methyl- |
8003336 | Phenol, methyl- |
8006620 | Phenol, methyl- |
8026946 | Phenol, methyl- |
8027165 | Phenol, methyl- |
52037475 | Phenol, methyl- |
116804252 | Phenol, methyl- |
1300169 | Phenol, nonyl- |
25154523 | Phenol, nonyl- |
84852153 | Phenol, nonyl- |
256459004 | Phenol, nonyl- |
67554501 | Phenol, octyl- |
25167822 | Phenol, trichloro- |
57057837 | Phenol, trichloro-2-methoxy- |
61966367 | Phenol, trichloro-2-methoxy- |
25953064 | Phenol,5-(diethylamino)-2-nitroso-, monohydrochloride |
13127883 | Phenol-d6 |
262204 | Phenoxathiin |
342950 | Phenylalanine, 2-[bis(2-chloroethyl)amino]- |
531760 | Phenylalanine, 4-[bis(2-chloroethyl)amino]- |
51650 | Phenylalanine, 4-fluoro- |
60173 | Phenylalanine, 4-fluoro- |
300641 | Phenylalanine, 4-fluoro- |
14265442 | Phosphate |
264888199 | Phosphate |
7803512 | Phosphine |
167076440 | Phosphine |
638211 | Phosphine, phenyl- |
603350 | Phosphine, triphenyl- |
112771478 | Phosphine, triphenyl- |
630403257 | Phosphine, triphenyl- |
1198579871 | Phosphine, triphenyl- |
52686 | Phosphonic acid, (2,2,2-trichloro-1-hydroxyethyl)-, dimethyl ester |
37333098 | Phosphonic acid, (2,2,2-trichloro-1-hydroxyethyl)-, dimethyl ester |
50924442 | Phosphonic acid, (2,2,2-trichloro-1-hydroxyethyl)-, dimethyl ester |
56042252 | Phosphonic acid, (2,2,2-trichloro-1-hydroxyethyl)-, dimethyl ester |
66758314 | Phosphonic acid, (2,2,2-trichloro-1-hydroxyethyl)-, dimethyl ester |
597251 | Phosphonic acid, 4-morpholinyl-, dimethyl ester |
1429501 | Phosphonic acid, P,P',P'',P'''-[1,2-ethanediylbis[nitrilobis(methylene)]]tetrakis- |
54579316 | Phosphonic acid, P,P',P'',P'''-[1,2-ethanediylbis[nitrilobis(methylene)]]tetrakis- |
66300263 | Phosphonic acid, P,P',P'',P'''-[1,2-ethanediylbis[nitrilobis(methylene)]]tetrakis- |
85497536 | Phosphonic acid, P,P',P'',P'''-[1,2-ethanediylbis[nitrilobis(methylene)]]tetrakis- |
103333762 | Phosphonic acid, P,P',P'',P'''-[1,2-ethanediylbis[nitrilobis(methylene)]]tetrakis- |
244775211 | Phosphonic acid, P,P',P'',P'''-[1,2-ethanediylbis[nitrilobis(methylene)]]tetrakis- |
68188965 | Phosphonic acid, P,P',P'',P'''-[1,2-ethanediylbis[nitrilobis(methylene)]]tetrakis-, potassium salt (1:4) |
15142968 | Phosphonic acid, P,P',P'',P'''-[1,2-ethanediylbis[nitrilobis(methylene)]]tetrakis-, sodium salt (1:6) |
15147969 | Phosphonic acid, P,P',P'',P'''-[1,2-ethanediylbis[nitrilobis(methylene)]]tetrakis-, sodium salt (1:6) |
2809214 | Phosphonic acid, P,P'-(1-hydroxyethylidene)bis- |
51888665 | Phosphonic acid, P,P'-(1-hydroxyethylidene)bis- |
66216986 | Phosphonic acid, P,P'-(1-hydroxyethylidene)bis- |
83047250 | Phosphonic acid, P,P'-(1-hydroxyethylidene)bis- |
85985268 | Phosphonic acid, P,P'-(1-hydroxyethylidene)bis- |
86159184 | Phosphonic acid, P,P'-(1-hydroxyethylidene)bis- |
100511442 | Phosphonic acid, P,P'-(1-hydroxyethylidene)bis- |
103736669 | Phosphonic acid, P,P'-(1-hydroxyethylidene)bis- |
106908763 | Phosphonic acid, P,P'-(1-hydroxyethylidene)bis- |
129130423 | Phosphonic acid, P,P'-(1-hydroxyethylidene)bis- |
138360846 | Phosphonic acid, P,P'-(1-hydroxyethylidene)bis- |
192526559 | Phosphonic acid, P,P'-(1-hydroxyethylidene)bis- |
303177335 | Phosphonic acid, P,P'-(1-hydroxyethylidene)bis- |
853028383 | Phosphonic acid, P,P'-(1-hydroxyethylidene)bis- |
78386 | Phosphonic acid, P-ethyl-, diethyl ester |
150103836 | Phosphonic acid, P-ethyl-, diethyl ester |
756796 | Phosphonic acid, P-methyl-, dimethyl ester |
351011433 | Phosphonic acid, P-methyl-, dimethyl ester |
880251707 | Phosphonic acid, P-methyl-, dimethyl ester |
1066519 | Phosphonic acid, aminomethyl- |
868859 | Phosphonic acid, dimethyl ester |
124641 | Phosphonium, tetrakis(hydroxymethyl)-, chloride (1:1) |
2245605 | Phosphonium, tetrakis(hydroxymethyl)-, chloride (1:1) |
55566308 | Phosphonium, tetrakis(hydroxymethyl)-, sulfate (2:1) |
58591110 | Phosphonium, tetrakis(hydroxymethyl)-, sulfate (2:1) |
65257047 | Phosphonium, tetrakis(hydroxymethyl)-, sulfate (2:1) |
944229 | Phosphonodithioic acid, ethyl-, O-ethyl S-phenyl ester |
107448 | Phosphonofluoridic acid, P-methyl-, 1-methylethyl ester |
50642234 | Phosphonofluoridic acid, P-methyl-, 1-methylethyl ester |
102490540 | Phosphonofluoridic acid, P-methyl-, 1-methylethyl ester |
50782699 | Phosphonothioic acid, P-methyl-, S-[2-[bis(1-methylethyl)amino]ethyl] O-ethyl ester |
51848476 | Phosphonothioic acid, P-methyl-, S-[2-[bis(1-methylethyl)amino]ethyl] O-ethyl ester |
53800401 | Phosphonothioic acid, P-methyl-, S-[2-[bis(1-methylethyl)amino]ethyl] O-ethyl ester |
65143057 | Phosphonothioic acid, P-methyl-, S-[2-[bis(1-methylethyl)amino]ethyl] O-ethyl ester |
70938840 | Phosphonothioic acid, P-methyl-, S-[2-[bis(1-methylethyl)amino]ethyl] O-ethyl ester |
327980 | Phosphonothioic acid, ethyl-, O-ethyl O-(2,4,5-trichlorophenyl) ester |
21609905 | Phosphonothioic acid, phenyl-, O-(4-bromo-2,5-dichlorophenyl) O-methyl ester |
73270492 | Phosphonothioic acid, phenyl-, O-(4-bromo-2,5-dichlorophenyl) O-methyl ester |
2104645 | Phosphonothioic acid, phenyl-, O-ethyl O-(4-nitrophenyl) ester |
22224926 | Phosphoramidic acid, (1-methylethyl)-, ethyl 3-methyl-4-(methylthio)phenyl ester |
947331 | Phosphoramidic acid, N-(4-methyl-1,3-dithiolan-2-ylidene)-, diethyl ester |
950107 | Phosphoramidic acid, N-(4-methyl-1,3-dithiolan-2-ylidene)-, diethyl ester |
12643220 | Phosphoramidic acid, N-(4-methyl-1,3-dithiolan-2-ylidene)-, diethyl ester |
21548323 | Phosphoramidic acid, N-1,3-dithietan-2-ylidene-, diethyl ester |
68335148 | Phosphoramidic acid, N-1,3-dithietan-2-ylidene-, diethyl ester |
947024 | Phosphoramidic acid, N-1,3-dithiolan-2-ylidene-, diethyl ester |
99910175 | Phosphoramidic acid, N-1,3-dithiolan-2-ylidene-, diethyl ester |
99910186 | Phosphoramidic acid, N-1,3-dithiolan-2-ylidene-, diethyl ester |
229865 | Phosphoramidic acid, methyl-, 2-chloro-4-(1,1-dimethylethyl)phenyl methyl ester |
299865 | Phosphoramidic acid, methyl-, 2-chloro-4-(1,1-dimethylethyl)phenyl methyl ester |
12676141 | Phosphoramidic acid, methyl-, 2-chloro-4-(1,1-dimethylethyl)phenyl methyl ester |
150402576 | Phosphoramidic acid, methyl-, 2-chloro-4-(1,1-dimethylethyl)phenyl methyl ester |
77816 | Phosphoramidocyanidic acid, N,N-dimethyl-, ethyl ester |
102490551 | Phosphoramidocyanidic acid, N,N-dimethyl-, ethyl ester |
299854 | Phosphoramidothioic acid, (1-methylethyl)-, O-(2,4-dichlorophenyl) O-methyl ester |
21248259 | Phosphoramidothioic acid, (1-methylethyl)-, O-(2,4-dichlorophenyl) O-methyl ester |
10265926 | Phosphoramidothioic acid, O,S-dimethyl ester |
115182359 | Phosphoramidothioic acid, O,S-dimethyl ester |
30560191 | Phosphoramidothioic acid, acetyl-, O,S-dimethyl ester |
115096112 | Phosphoramidothioic acid, acetyl-, O,S-dimethyl ester |
10026138 | Phosphorane, pentachloro- |
7647190 | Phosphorane, pentafluoro- |
137038303 | Phosphorane, pentafluoro- |
1314563 | Phosphoric acid |
7664382 | Phosphoric acid |
28602757 | Phosphoric acid |
178560731 | Phosphoric acid |
959699833 | Phosphoric acid |
1021417413 | Phosphoric acid |
1053657230 | Phosphoric acid |
1196963548 | Phosphoric acid |
126738 | Phosphoric acid tributyl ester |
15158857 | Phosphoric acid tributyl ester |
19824614 | Phosphoric acid tributyl ester |
80094399 | Phosphoric acid tributyl ester |
329184614 | Phosphoric acid tributyl ester |
1238174190 | Phosphoric acid tributyl ester |
56803373 | Phosphoric acid, (1,1-dimethylethyl)phenyl diphenyl ester |
28108998 | Phosphoric acid, (1-methylethyl)phenyl diphenyl ester |
359793445 | Phosphoric acid, (1-methylethyl)phenyl diphenyl ester |
141662 | Phosphoric acid, (1E)-3-(dimethylamino)-1-methyl-3-oxo-1-propenyl dimethyl ester |
22248799 | Phosphoric acid, (1Z)-2-chloro-1-(2,4,5-trichlorophenyl)ethenyl dimethyl ester |
300765 | Phosphoric acid, 1,2-dibromo-2,2-dichloroethyl dimethyl ester |
53095311 | Phosphoric acid, 1,2-dibromo-2,2-dichloroethyl dimethyl ester |
52686 | Phosphoric acid, 2,2-dichloroethenyl dimethyl ester |
62737 | Phosphoric acid, 2,2-dichloroethenyl dimethyl ester |
8023221 | Phosphoric acid, 2,2-dichloroethenyl dimethyl ester |
8072217 | Phosphoric acid, 2,2-dichloroethenyl dimethyl ester |
8072397 | Phosphoric acid, 2,2-dichloroethenyl dimethyl ester |
8076162 | Phosphoric acid, 2,2-dichloroethenyl dimethyl ester |
11095173 | Phosphoric acid, 2,2-dichloroethenyl dimethyl ester |
11096212 | Phosphoric acid, 2,2-dichloroethenyl dimethyl ester |
11111312 | Phosphoric acid, 2,2-dichloroethenyl dimethyl ester |
11126720 | Phosphoric acid, 2,2-dichloroethenyl dimethyl ester |
11678891 | Phosphoric acid, 2,2-dichloroethenyl dimethyl ester |
12772406 | Phosphoric acid, 2,2-dichloroethenyl dimethyl ester |
55819324 | Phosphoric acid, 2,2-dichloroethenyl dimethyl ester |
62139951 | Phosphoric acid, 2,2-dichloroethenyl dimethyl ester |
62655598 | Phosphoric acid, 2,2-dichloroethenyl dimethyl ester |
95828550 | Phosphoric acid, 2,2-dichloroethenyl dimethyl ester |
116788911 | Phosphoric acid, 2,2-dichloroethenyl dimethyl ester |
961115 | Phosphoric acid, 2-chloro-1-(2,4,5-trichlorophenyl)ethenyl dimethyl ester |
22248799 | Phosphoric acid, 2-chloro-1-(2,4,5-trichlorophenyl)ethenyl dimethyl ester |
22350761 | Phosphoric acid, 2-chloro-1-(2,4,5-trichlorophenyl)ethenyl dimethyl ester |
270906 | Phosphoric acid, 2-chloro-1-(2,4-dichlorophenyl)ethenyl diethyl ester |
470906 | Phosphoric acid, 2-chloro-1-(2,4-dichlorophenyl)ethenyl diethyl ester |
8018062 | Phosphoric acid, 2-chloro-1-(2,4-dichlorophenyl)ethenyl diethyl ester |
8067672 | Phosphoric acid, 2-chloro-1-(2,4-dichlorophenyl)ethenyl diethyl ester |
13171216 | Phosphoric acid, 2-chloro-3-(diethylamino)-1-methyl-3-oxo-1-propenyl dimethyl ester |
1241947 | Phosphoric acid, 2-ethylhexyl diphenyl ester |
64532974 | Phosphoric acid, 4-nonylphenyl diphenyl ester |
7784307 | Phosphoric acid, aluminum salt (1:1) |
8022591 | Phosphoric acid, aluminum salt (1:1) |
13765930 | Phosphoric acid, aluminum salt (1:1) |
36201726 | Phosphoric acid, aluminum salt (1:1) |
37324428 | Phosphoric acid, aluminum salt (1:1) |
51668554 | Phosphoric acid, aluminum salt (1:1) |
52350115 | Phosphoric acid, aluminum salt (1:1) |
89686544 | Phosphoric acid, aluminum salt (1:1) |
93237811 | Phosphoric acid, aluminum salt (1:1) |
135151778 | Phosphoric acid, aluminum salt (1:1) |
189303353 | Phosphoric acid, aluminum salt (1:1) |
7783280 | Phosphoric acid, ammonium salt (1:?) |
10124319 | Phosphoric acid, ammonium salt (1:?) |
124673865 | Phosphoric acid, ammonium salt (1:?) |
107664 | Phosphoric acid, dibutyl ester |
72283568 | Phosphoric acid, dibutyl ester |
2528361 | Phosphoric acid, dibutyl phenyl ester |
311455 | Phosphoric acid, diethyl 4-nitrophenyl ester |
962583 | Phosphoric acid, diethyl 6-methyl-2-(1-methylethyl)-4-pyrimidinyl ester |
919448 | Phosphoric acid, dimethyl (1E)-1-methyl-3-(methylamino)-3-oxo-1-propenyl ester |
6923224 | Phosphoric acid, dimethyl (1E)-1-methyl-3-(methylamino)-3-oxo-1-propenyl ester |
83857414 | Phosphoric acid, dimethyl (1E)-1-methyl-3-(methylamino)-3-oxo-1-propenyl ester |
950356 | Phosphoric acid, dimethyl-4-nitrophenyl ester |
29761215 | Phosphoric acid, isodecyl diphenyl ester |
59800463 | Phosphoric acid, isodecyl diphenyl ester |
146480140 | Phosphoric acid, isodecyl diphenyl ester |
7446277 | Phosphoric acid, lead(2+) salt (2:3) |
1314087563 | Phosphoric acid, lead(2+) salt (2:3) |
1323177 | Phosphoric acid, methylphenyl diphenyl ester |
25444495 | Phosphoric acid, methylphenyl diphenyl ester |
26444495 | Phosphoric acid, methylphenyl diphenyl ester |
627081247 | Phosphoric acid, methylphenyl diphenyl ester |
7558794 | Phosphoric acid, sodium salt (1:2) |
148560763 | Phosphoric acid, sodium salt (1:2) |
1374442713 | Phosphoric acid, sodium salt (1:2) |
7601549 | Phosphoric acid, sodium salt (1:3) |
96337983 | Phosphoric acid, sodium salt (1:3) |
1269628785 | Phosphoric acid, sodium salt (1:3) |
78400 | Phosphoric acid, triethyl ester |
512561 | Phosphoric acid, trimethyl ester |
91316448 | Phosphoric acid, trimethyl ester |
1806548 | Phosphoric acid, trioctyl ester |
115866 | Phosphoric acid, triphenyl ester |
402955026 | Phosphoric acid, triphenyl ester |
78422 | Phosphoric acid, tris(2-ethylhexyl) ester |
73308 | Phosphoric acid, tris(2-methylphenyl) ester |
78308 | Phosphoric acid, tris(2-methylphenyl) ester |
1336409 | Phosphoric acid, tris(2-methylphenyl) ester |
126716 | Phosphoric acid, tris(2-methylpropyl) ester |
856824629 | Phosphoric acid, tris(2-methylpropyl) ester |
563042 | Phosphoric acid, tris(3-methylphenyl) ester |
78320 | Phosphoric acid, tris(4-methylphenyl) ester |
1330785 | Phosphoric acid, tris(methylphenyl) ester |
25013176 | Phosphoric acid, tris(methylphenyl) ester |
34902620 | Phosphoric acid, tris(methylphenyl) ester |
56499457 | Phosphoric acid, tris(methylphenyl) ester |
56573105 | Phosphoric acid, tris(methylphenyl) ester |
69234044 | Phosphoric acid, tris(methylphenyl) ester |
1259372536 | Phosphoric acid, tris(methylphenyl) ester |
13847228 | Phosphoric acid, zinc salt (1:?) |
680319 | Phosphoric triamide, N,N,N',N',N'',N''-hexamethyl- |
24992550 | Phosphoric triamide, N,N,N',N',N'',N''-hexamethyl- |
51557018 | Phosphoric triamide, N,N,N',N',N'',N''-hexamethyl- |
10025873 | Phosphoric trichloride |
39380773 | Phosphoric trichloride |
1258871725 | Phosphoric trichloride |
814493 | Phosphorochloridic acid, diethyl ester |
1642542 | Phosphorochloridic acid, diethyl ester |
2524041 | Phosphorochloridothioic acid, O,O-diethyl ester |
1081841500 | Phosphorochloridothioic acid, O,O-diethyl ester |
2524030 | Phosphorochloridothioic acid, O,O-dimethyl ester |
4465945 | Phosphorodiamidic acid, N,N-bis(2-chloroethyl)-N'-(3-hydroxypropyl)-, compd. with cyclohexanamine (1:1) |
115264 | Phosphorodiamidic fluoride, tetramethyl- |
741582 | Phosphorodithioic acid, O,O-bis(1-methylethyl) S-[2-[(phenylsulfonyl)amino]ethyl] ester |
39291719 | Phosphorodithioic acid, O,O-bis(1-methylethyl) S-[2-[(phenylsulfonyl)amino]ethyl] ester |
2642719 | Phosphorodithioic acid, O,O-diethyl S-[(4-oxo-1,2,3-benzotriazin-3(4H)-yl)methyl] ester |
289022 | Phosphorodithioic acid, O,O-diethyl S-[(ethylthio)methyl] ester |
298022 | Phosphorodithioic acid, O,O-diethyl S-[(ethylthio)methyl] ester |
2497076 | Phosphorodithioic acid, O,O-diethyl S-[2-(ethylsulfinyl)ethyl] ester |
298044 | Phosphorodithioic acid, O,O-diethyl S-[2-(ethylthio)ethyl] ester |
3288582 | Phosphorodithioic acid, O,O-diethyl S-methyl ester |
86500 | Phosphorodithioic acid, O,O-dimethyl S-[(4-oxo-1,2,3-benzotriazin-3(4H)-yl)methyl] ester |
54182739 | Phosphorodithioic acid, O,O-dimethyl S-[(4-oxo-1,2,3-benzotriazin-3(4H)-yl)methyl] ester |
60515 | Phosphorodithioic acid, O,O-dimethyl S-[2-(methylamino)-2-oxoethyl] ester |
11003535 | Phosphorodithioic acid, O,O-dimethyl S-[2-(methylamino)-2-oxoethyl] ester |
11096201 | Phosphorodithioic acid, O,O-dimethyl S-[2-(methylamino)-2-oxoethyl] ester |
56833739 | Phosphorodithioic acid, O,O-dimethyl S-[2-(methylamino)-2-oxoethyl] ester |
79956186 | Phosphorodithioic acid, O,O-dimethyl S-[2-(methylamino)-2-oxoethyl] ester |
34643464 | Phosphorodithioic acid, O-(2,4-dichlorophenyl) O-ethyl S-propyl ester |
64772549 | Phosphorodithioic acid, O-(2,4-dichlorophenyl) O-ethyl S-propyl ester |
35400432 | Phosphorodithioic acid, O-ethyl O-[4-(methylthio)phenyl] S-propyl ester |
59299579 | Phosphorodithioic acid, O-ethyl O-[4-(methylthio)phenyl] S-propyl ester |
92642314 | Phosphorodithioic acid, O-ethyl O-[4-(methylthio)phenyl] S-propyl ester |
13194484 | Phosphorodithioic acid, O-ethyl S,S-dipropyl ester |
78342 | Phosphorodithioic acid, S,S'-1,4-dioxane-2,3-diyl O,O,O',O'-tetraethyl ester |
563122 | Phosphorodithioic acid, S,S'-methylene O,O,O',O'-tetraethyl ester |
12676936 | Phosphorodithioic acid, S,S'-methylene O,O,O',O'-tetraethyl ester |
12738475 | Phosphorodithioic acid, S,S'-methylene O,O,O',O'-tetraethyl ester |
24934916 | Phosphorodithioic acid, S-(chloromethyl) O,O-diethyl ester |
37209293 | Phosphorodithioic acid, S-(chloromethyl) O,O-diethyl ester |
732116 | Phosphorodithioic acid, S-[(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)methyl] O,O-dimethyl ester |
950378 | Phosphorodithioic acid, S-[(5-methoxy-2-oxo-1,3,4-thiadiazol-3(2H)-yl)methyl] O,O-dimethyl ester |
11114311 | Phosphorodithioic acid, S-[(5-methoxy-2-oxo-1,3,4-thiadiazol-3(2H)-yl)methyl] O,O-dimethyl ester |
80210099 | Phosphorodithioic acid, S-[(5-methoxy-2-oxo-1,3,4-thiadiazol-3(2H)-yl)methyl] O,O-dimethyl ester |
2310170 | Phosphorodithioic acid, S-[(6-chloro-2-oxo-3(2H)-benzoxazolyl)methyl] O,O-diethyl ester |
11129092 | Phosphorodithioic acid, S-[(6-chloro-2-oxo-3(2H)-benzoxazolyl)methyl] O,O-diethyl ester |
12650350 | Phosphorodithioic acid, S-[(6-chloro-2-oxo-3(2H)-benzoxazolyl)methyl] O,O-diethyl ester |
29562467 | Phosphorodithioic acid, S-[(6-chloro-2-oxo-3(2H)-benzoxazolyl)methyl] O,O-diethyl ester |
54182717 | Phosphorodithioic acid, S-[(6-chloro-2-oxo-3(2H)-benzoxazolyl)methyl] O,O-diethyl ester |
2540821 | Phosphorodithioic acid, S-[2-(formylmethylamino)-2-oxoethyl] O,O-dimethyl ester |
12767543 | Phosphorodithioic acid, S-[2-(formylmethylamino)-2-oxoethyl] O,O-dimethyl ester |
10311849 | Phosphorodithioic acid, S-[2-chloro-1-(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)ethyl] O,O-diethyl ester |
13071799 | Phosphorodithioic acid, S-[[(1,1-dimethylethyl)thio]methyl] O,O-diethyl ester |
3735237 | Phosphorodithioic acid, S-[[(2,5-dichlorophenyl)thio]methyl] O,O-dimethyl ester |
786196 | Phosphorodithioic acid, S-[[(4-chlorophenyl)thio]methyl] O,O-diethyl ester |
55914 | Phosphorofluoridic acid, bis(1-methylethyl) ester |
37209351 | Phosphorofluoridic acid, bis(1-methylethyl) ester |
126681 | Phosphorothioic acid, O,O,O-triethyl ester |
54593838 | Phosphorothioic acid, O,O-diethyl O-(1,2,2,2-tetrachloroethyl) ester |
104559355 | Phosphorothioic acid, O,O-diethyl O-(1,2,2,2-tetrachloroethyl) ester |
119791490 | Phosphorothioic acid, O,O-diethyl O-(1,2,2,2-tetrachloroethyl) ester |
2921882 | Phosphorothioic acid, O,O-diethyl O-(3,5,6-trichloro-2-pyridinyl) ester |
12768488 | Phosphorothioic acid, O,O-diethyl O-(3,5,6-trichloro-2-pyridinyl) ester |
39475553 | Phosphorothioic acid, O,O-diethyl O-(3,5,6-trichloro-2-pyridinyl) ester |
56382 | Phosphorothioic acid, O,O-diethyl O-(4-nitrophenyl) ester |
8057703 | Phosphorothioic acid, O,O-diethyl O-(4-nitrophenyl) ester |
11111914 | Phosphorothioic acid, O,O-diethyl O-(4-nitrophenyl) ester |
110616892 | Phosphorothioic acid, O,O-diethyl O-(4-nitrophenyl) ester |
297972 | Phosphorothioic acid, O,O-diethyl O-2-pyrazinyl ester |
30917363 | Phosphorothioic acid, O,O-diethyl O-2-pyrazinyl ester |
298033 | Phosphorothioic acid, O,O-diethyl O-[2-(ethylthio)ethyl] ester |
8000973 | Phosphorothioic acid, O,O-diethyl O-[2-(ethylthio)ethyl] ester, mixt. with O,O-diethyl S-[2-(ethylthio)ethyl] phosphorothioate |
8058739 | Phosphorothioic acid, O,O-diethyl O-[2-(ethylthio)ethyl] ester, mixt. with O,O-diethyl S-[2-(ethylthio)ethyl] phosphorothioate |
8065483 | Phosphorothioic acid, O,O-diethyl O-[2-(ethylthio)ethyl] ester, mixt. with O,O-diethyl S-[2-(ethylthio)ethyl] phosphorothioate |
34624538 | Phosphorothioic acid, O,O-diethyl O-[2-(ethylthio)ethyl] ester, mixt. with O,O-diethyl S-[2-(ethylthio)ethyl] phosphorothioate |
115902 | Phosphorothioic acid, O,O-diethyl O-[4-(methylsulfinyl)phenyl] ester |
115913 | Phosphorothioic acid, O,O-diethyl O-[4-(methylsulfinyl)phenyl] ester |
72435 | Phosphorothioic acid, O,O-diethyl O-[6-methyl-2-(1-methylethyl)-4-pyrimidinyl] ester |
333415 | Phosphorothioic acid, O,O-diethyl O-[6-methyl-2-(1-methylethyl)-4-pyrimidinyl] ester |
485472 | Phosphorothioic acid, O,O-diethyl O-[6-methyl-2-(1-methylethyl)-4-pyrimidinyl] ester |
27936409 | Phosphorothioic acid, O,O-diethyl O-[6-methyl-2-(1-methylethyl)-4-pyrimidinyl] ester |
30583381 | Phosphorothioic acid, O,O-diethyl O-[6-methyl-2-(1-methylethyl)-4-pyrimidinyl] ester |
65863038 | Phosphorothioic acid, O,O-diethyl O-[6-methyl-2-(1-methylethyl)-4-pyrimidinyl] ester |
299843 | Phosphorothioic acid, O,O-dimethyl O-(2,4,5-trichlorophenyl) ester |
8028282 | Phosphorothioic acid, O,O-dimethyl O-(2,4,5-trichlorophenyl) ester |
8050655 | Phosphorothioic acid, O,O-dimethyl O-(2,4,5-trichlorophenyl) ester |
54328120 | Phosphorothioic acid, O,O-dimethyl O-(2,4,5-trichlorophenyl) ester |
56172599 | Phosphorothioic acid, O,O-dimethyl O-(2,4,5-trichlorophenyl) ester |
5598130 | Phosphorothioic acid, O,O-dimethyl O-(3,5,6-trichloro-2-pyridinyl) ester |
122145 | Phosphorothioic acid, O,O-dimethyl O-(3-methyl-4-nitrophenyl) ester |
12764873 | Phosphorothioic acid, O,O-dimethyl O-(3-methyl-4-nitrophenyl) ester |
54182706 | Phosphorothioic acid, O,O-dimethyl O-(3-methyl-4-nitrophenyl) ester |
94650983 | Phosphorothioic acid, O,O-dimethyl O-(3-methyl-4-nitrophenyl) ester |
298000 | Phosphorothioic acid, O,O-dimethyl O-(4-nitrophenyl) ester |
37359356 | Phosphorothioic acid, O,O-dimethyl O-(4-nitrophenyl) ester |
63653667 | Phosphorothioic acid, O,O-dimethyl O-(4-nitrophenyl) ester |
55389 | Phosphorothioic acid, O,O-dimethyl O-[3-methyl-4-(methylthio)phenyl] ester |
97176 | Phosphorothioic acid, O-(2,4-dichlorophenyl) O,O-diethyl ester |
11137498 | Phosphorothioic acid, O-(2,4-dichlorophenyl) O,O-diethyl ester |
56724 | Phosphorothioic acid, O-(3-chloro-4-methyl-2-oxo-2H-1-benzopyran-7-yl) O,O-diethyl ester |
35400432 | Phosphorothioic acid, O-(4-bromo-2-chlorophenyl) O-ethyl S-propyl ester |
41198087 | Phosphorothioic acid, O-(4-bromo-2-chlorophenyl) O-ethyl S-propyl ester |
61230420 | Phosphorothioic acid, O-(4-bromo-2-chlorophenyl) O-ethyl S-propyl ester |
61287512 | Phosphorothioic acid, O-(4-bromo-2-chlorophenyl) O-ethyl S-propyl ester |
92760413 | Phosphorothioic acid, O-(4-bromo-2-chlorophenyl) O-ethyl S-propyl ester |
2636262 | Phosphorothioic acid, O-(4-cyanophenyl) O,O-dimethyl ester |
12692909 | Phosphorothioic acid, O-(4-cyanophenyl) O,O-dimethyl ester |
54578391 | Phosphorothioic acid, O-(4-cyanophenyl) O,O-dimethyl ester |
21923239 | Phosphorothioic acid, O-[2,5-dichloro-4-(methylthio)phenyl] O,O-diethyl ester |
51052596 | Phosphorothioic acid, O-[2,5-dichloro-4-(methylthio)phenyl] O,O-diethyl ester |
96182535 | Phosphorothioic acid, O-[2-(1,1-dimethylethyl)-5-pyrimidinyl] O-ethyl O-(1-methylethyl) ester |
12648521 | Phosphorothioic acid, O-[2-(diethylamino)-6-methyl-4-pyrimidinyl] O,O-diethyl ester |
23505411 | Phosphorothioic acid, O-[2-(diethylamino)-6-methyl-4-pyrimidinyl] O,O-diethyl ester |
11104271 | Phosphorothioic acid, O-[2-(diethylamino)-6-methyl-4-pyrimidinyl] O,O-dimethyl ester |
29232937 | Phosphorothioic acid, O-[2-(diethylamino)-6-methyl-4-pyrimidinyl] O,O-dimethyl ester |
8022002 | Phosphorothioic acid, O-[2-(ethylthio)ethyl] O,O-dimethyl ester, mixt. with S-[2-(ethylthio)ethyl] O,O-dimethyl phosphorothioate |
52857 | Phosphorothioic acid, O-[4-[(dimethylamino)sulfonyl]phenyl] O,O-dimethyl ester |
3383968 | Phosphorothioic acid, Op,Op'-(thiodi-4,1-phenylene) Op,Op,Op',Op'-tetramethyl ester |
53320584 | Phosphorothioic acid, Op,Op'-(thiodi-4,1-phenylene) Op,Op,Op',Op'-tetramethyl ester |
3734972 | Phosphorothioic acid, S-(2-(diethylamino)ethyl) O,O-diethyl ester, ethanedioate (1:1) |
2778043 | Phosphorothioic acid, S-[(5-methoxy-4-oxo-4H-pyran-2-yl)methyl] O,O-dimethyl ester |
78535 | Phosphorothioic acid, S-[2-(diethylamino)ethyl] O,O-diethyl ester |
102388589 | Phosphorothioic acid, S-[2-(diethylamino)ethyl] O,O-diethyl ester |
301122 | Phosphorothioic acid, S-[2-(ethylsulfinyl)ethyl] O,O-dimethyl ester |
37320937 | Phosphorothioic acid, S-[2-(ethylsulfinyl)ethyl] O,O-dimethyl ester |
919868 | Phosphorothioic acid, S-[2-(ethylthio)ethyl] O,O-dimethyl ester |
1079803498 | Phosphorothioic acid, S-[2-(ethylthio)ethyl] O,O-dimethyl ester |
78488 | Phosphorotrithioic acid |
25758763 | Phosphorotrithioic acid |
78488 | Phosphorotrithioic acid, S,S,S-tributyl ester |
150505 | Phosphorotrithious acid, tributyl ester |
121459 | Phosphorous acid, trimethyl ester |
101020 | Phosphorous acid, triphenyl ester |
301133 | Phosphorous acid, tris(2-ethylhexyl) ester |
7719122 | Phosphorous trichloride |
11082954 | Phosphorous trichloride |
7723140 | Phosphorus |
29879376 | Phosphorus |
1314563 | Phosphorus oxide (P2O5) |
24377842 | Phosphorus oxide (P2O5) |
50811864 | Phosphorus oxide (P2O5) |
59778573 | Phosphorus oxide (P2O5) |
72906424 | Phosphorus oxide (P2O5) |
1314803 | Phosphorus sulfide (P2S5) |
12066625 | Phosphorus sulfide (P2S5) |
16857093 | Phosphorus sulfide (P2S5) |
129680279 | Phosphorus sulfide (P2S5) |
132620996 | Phosphorus sulfide (P2S5) |
337913538 | Phosphorus sulfide (P2S5) |
341007601 | Phosphorus sulfide (P2S5) |
342401472 | Phosphorus sulfide (P2S5) |
409325037 | Phosphorus sulfide (P2S5) |
952005457 | Phosphorus sulfide (P2S5) |
14596373 | Phosphorus, isotope of mass 32 |
24267558 | Phosphorus, isotope of mass 32 |
7723140 | Phosphorus, mol. (P4) |
12185103 | Phosphorus, mol. (P4) |
51273586 | Phosphorus, mol. (P4) |
110850 | Piperazine |
8017901 | Piperazine |
8027814 | Piperazine |
26644462 | Piperazine |
81546158 | Piperazine |
854880152 | Piperazine |
861800353 | Piperazine |
142643 | Piperazine, hydrochloride (1:2) |
8049001 | Piperazine, hydrochloride (1:2) |
110894 | Piperidine |
100754 | Piperidine, 1-nitroso- |
68374629 | Piperidine, 1-nitroso- |
7440064 | Platinum |
7440664 | Platinum |
21547637 | Platinum |
15663271 | Platinum, diamminedichloro-, (SP-4-2)- |
96081742 | Platinum, diamminedichloro-, (SP-4-2)- |
936542993 | Platinum, diamminedichloro-, (SP-4-2)- |
15706362 | Platinum, isotope of mass 191 |
15735703 | Platinum, isotope of mass 193 |
15735703 | Platinum, isotope of mass 193m(4.33 d) |
378783154 | Platinum, isotope of mass 193m(4.33 d) |
1067147 | Plumbane, chlorotriethyl- |
15710471 | Plumbane, chlorotriethyl- |
78002 | Plumbane, tetraethyl- |
75741 | Plumbane, tetramethyl- |
7440075 | Plutonium |
15117483 | Plutonium |
13981163 | Plutonium, isotope of mass 238 |
1517483 | Plutonium, isotope of mass 239 |
15117483 | Plutonium, isotope of mass 239 |
7440086 | Polonium |
13981527 | Polonium, isotope of mass 210 |
14809837 | Polonium, isotope of mass 210 |
9016459 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
9021038 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
9067509 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
11098161 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
11103609 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
11107930 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
12767689 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
12789127 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
12790679 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
25154523 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
26064028 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
28136109 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
29594363 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
30676836 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
32196524 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
37187238 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
37210949 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
37230992 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
37280801 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
37336520 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
39289571 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
39316455 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
39316739 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
39346855 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
39373712 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
39392831 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
39393367 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
39421493 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
39453059 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
39454983 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
39475462 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
42617038 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
50855293 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
50934844 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
51059973 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
51609199 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
51668510 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
51938591 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
51938604 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
52012438 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
52038467 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
52051497 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
52434078 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
52440036 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
52440785 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
52440945 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
52504184 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
52504195 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
52683075 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
53125170 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
53529490 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
53663551 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
53763352 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
53763363 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
54174366 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
54985545 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
55126802 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
55838692 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
56590966 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
57308028 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
57571694 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
59330697 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
60098671 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
60476279 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
61614071 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
61840559 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
62169442 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
62229214 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
62229247 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
62229292 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
63440039 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
63798889 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
64296146 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
64940972 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
65035407 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
65035418 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
65777142 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
66525846 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
67053581 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
72847440 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
72847451 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
74434416 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
74656636 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
74749716 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
75882096 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
76829055 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
77271604 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
80341599 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
80966321 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
81296824 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
83271481 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
90452816 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
93095762 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
95828594 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
96231617 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
96957641 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
96958177 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
96958280 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
99402832 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
99531825 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |